NPASS drugs

Drug Information

Drug ID:	NPD3089
Drug Name:	Methscopolamine
Molecular Formula:	C18H24NO4
Canonical SMILES:	OC[C@H](c1ccccc1)C(=O)O[C@@H]1C[C@H]2[C@@H]3[C@H]([C@H](C1)[N+]2(C)C)O3
Standard InCHI:	InChI=1S/C18H24NO4/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11/h3-7,12-17,20H,8-10H2,1-2H3/q+1/t12-,13-,14+,15+,16-,17+/m1/s1
Standard InCHIKey:	LZCOQTDXKCNBEE-BPXZUEPWSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3089

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	89
0.1-0.2	472
0.2-0.3	1202
0.3-0.4	3728
0.4-0.5	12847
0.5-0.6	11300
0.6-0.7	1177
0.7-0.8	65
0.8-0.85	1
0.85-0.9	0
0.9-0.95	6
0.95-1	3

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC245836
High Similarity	1.0	NPC233910
High Similarity	0.9758	NPC69496
High Similarity	0.9194	NPC169485
High Similarity	0.9194	NPC84281
High Similarity	0.9194	NPC291027
High Similarity	0.9194	NPC317474
High Similarity	0.9194	NPC213126
High Similarity	0.9127	NPC474847
Intermediate Similarity	0.806	NPC65310

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD3089 OpenBabel08211702562D 24 27 0 0 1 0 0 0 0 0999 V2000 -3.5926 0.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5926 1.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8301 -1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8301 -1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8301 -0.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8301 -0.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4367 1.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4367 0.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8301 1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1243 0.6856 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 0.9585 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1388 1.4946 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1388 -0.1234 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1877 1.1856 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1877 0.1856 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8301 1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7266 0.6856 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 -1.6602 0.9585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6602 0.9585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8301 2.3963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3217 0.6856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4903 1.4378 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 19 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 11 2 0 0 0 0 7 11 1 0 0 0 0 8 12 1 0 0 0 0 9 12 1 0 0 0 0 10 20 1 0 0 0 0 11 13 1 0 0 0 0 12 22 1 1 0 0 0 13 10 1 1 0 0 0 13 18 1 0 0 0 0 14 8 1 1 0 0 0 14 16 1 0 0 0 0 14 19 1 0 0 0 0 15 9 1 6 0 0 0 15 17 1 0 0 0 0 15 19 1 0 0 0 0 16 17 1 0 0 0 0 16 23 1 1 0 0 0 17 23 1 1 0 0 0 18 21 2 0 0 0 0 18 22 1 0 0 0 0 20 24 1 0 0 0 0 M CHG 1 19 1 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	318.17
ALogP	-2.9059
MLogP	2.89
XLogP	2.305
HDA	4
HBD	1
Rotatable Bonds	8
TPSA	59.06
RO5 Violation	0