Drug Information| Drug ID:   | NPD2973 |
| Drug Name:   | Oxycodone Terephthalate |
| Molecular Formula:   | C18H21NO4.C8H6O4 |
| Canonical SMILES:   | OC(=O)c1ccc(cc1)C(=O)O.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@]4(O)CCC1=O)C |
| Standard InCHI:   | "InChI=1S/C18H21NO4.C8H6O4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10;9-7(10)5-1-2-6(4-3-5)8(11)12/h3-4,13,16,21H,5-9H2,1-2H3;1-4H,(H,9,10)(H,11,12)/t13-,16+,17+,18-;/m1./s1" |
| Standard InCHIKey:   | NRJLPDFIXKADPQ-RKXJKUSZSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2973Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8529 | NPC66909 |
| High Similarity | 0.8529 | NPC612018 |
| Remote Similarity | 0.5366 | NPC581397 |
| Remote Similarity | 0.5059 | NPC254045 |
| Remote Similarity | 0.5059 | NPC201055 |
| Remote Similarity | 0.5059 | NPC265000 |
| Remote Similarity | 0.5059 | NPC64576 |
| Remote Similarity | 0.5059 | NPC151470 |
| Remote Similarity | 0.5059 | NPC603205 |
| Remote Similarity | 0.5059 | NPC603486 |
| Remote Similarity | 0.5059 | NPC611632 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 315.15 |
| ALogP   | -1.0567 |
| MLogP   | 2.89 |
| XLogP   | 0.516 |
| HDA   | 3 |
| HBD   | 1 |
| Rotatable Bonds   | 4 |
| TPSA   | 59 |
| RO5 Violation   | 0 |