NPASS drugs

Drug Information

Drug ID:	NPD2971
Drug Name:	Hydrocodone
Molecular Formula:	C18H21NO3
Canonical SMILES:	COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4CCC1=O)C
Standard InCHI:	"InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3,6,11-12,17H,4-5,7-9H2,1-2H3/t11-,12+,17-,18-/m0/s1"
Standard InCHIKey:	LLPOLZWFYMWNKH-CMKMFDCUSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD2971

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	119997
0.1-0.2	89835
0.2-0.3	1757
0.3-0.4	104
0.4-0.5	22
0.5-0.6	15
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC115906
High Similarity	1.0	NPC608430
Remote Similarity	0.6866	NPC305440
Remote Similarity	0.6866	NPC67346
Remote Similarity	0.6866	NPC599847
Remote Similarity	0.6618	NPC214629
Remote Similarity	0.6143	NPC318674
Remote Similarity	0.6143	NPC174783
Remote Similarity	0.5972	NPC550752
Remote Similarity	0.5946	NPC238919
Remote Similarity	0.5946	NPC70075
Remote Similarity	0.5753	NPC43069
Remote Similarity	0.5753	NPC235802
Remote Similarity	0.5753	NPC262786
Remote Similarity	0.5753	NPC163601
Remote Similarity	0.5753	NPC2073
Remote Similarity	0.5753	NPC319632
Remote Similarity	0.5753	NPC612004
Remote Similarity	0.5616	NPC66909
Remote Similarity	0.5616	NPC612018
Remote Similarity	0.5479	NPC301340
Remote Similarity	0.5325	NPC311781
Remote Similarity	0.5195	NPC580459

Drug Structure

NPD2971 OpenBabel08211702562D 22 26 0 0 1 0 0 0 0 0999 V2000 -4.0465 -1.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3617 2.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1530 1.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1530 -1.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4282 -2.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4282 2.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1530 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6025 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8777 0.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1530 0.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1530 -0.8369 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8777 -0.4185 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7034 -1.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7034 1.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4282 0.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7034 0.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7034 -0.8369 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4282 -0.4185 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6025 -0.8369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0656 -2.1178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0213 2.0919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 21 1 0 0 0 0 3 6 2 0 0 0 0 3 10 1 0 0 0 0 4 5 1 0 0 0 0 4 11 1 0 0 0 0 5 13 1 0 0 0 0 6 14 1 0 0 0 0 7 8 1 0 0 0 0 8 19 1 0 0 0 0 9 10 1 0 0 0 0 10 15 2 0 0 0 0 11 12 1 0 0 0 0 11 18 1 1 0 0 0 12 9 1 6 0 0 0 12 19 1 0 0 0 0 13 17 1 0 0 0 0 13 20 2 0 0 0 0 14 16 2 0 0 0 0 14 21 1 0 0 0 0 15 16 1 0 0 0 0 15 18 1 0 0 0 0 16 22 1 0 0 0 0 17 18 1 1 0 0 0 17 22 1 0 0 0 0 18 7 1 6 0 0 0 M END $$$$

External Identifiers

TTD	DIB008737; DAP000253
DrugBank	DB00956
ChEMBL	CHEMBL1457
IUPHAR/BPS	7081
PharmaGKB	PA449900
KEGG Drug	D08045
PubChem CID	5284569
ChEBI	5779
CAS Number	125-29-1

Drug Properties

Molecular Weight	299.15
ALogP	-0.6176
MLogP	3
XLogP	1.426
HDA	2
HBD	0
Rotatable Bonds	3
TPSA	38.77
RO5 Violation	0