NPASS drugs

Drug Information

Drug ID:	NPD2575
Drug Name:
Molecular Formula:	C17H21NO5
Canonical SMILES:	OCC(c1ccccc1)(C(=O)OC1CC2N(C(C1)C1C2O1)C)O
Standard InCHI:	"InChI=1S/C17H21NO5/c1-18-12-7-11(8-13(18)15-14(12)23-15)22-16(20)17(21,9-19)10-5-3-2-4-6-10/h2-6,11-15,19,21H,7-9H2,1H3"
Standard InCHIKey:	JEJREKXHLFEVHN-UHFFFAOYSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2575

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	81723
0.1-0.2	126672
0.2-0.3	3125
0.3-0.4	136
0.4-0.5	57
0.5-0.6	8
0.6-0.7	16
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC59086
High Similarity	1.0	NPC29017
Intermediate Similarity	0.7551	NPC191074
Remote Similarity	0.6731	NPC245836
Remote Similarity	0.6731	NPC234378
Remote Similarity	0.6731	NPC200302
Remote Similarity	0.6731	NPC267466
Remote Similarity	0.6731	NPC233910
Remote Similarity	0.6731	NPC33541
Remote Similarity	0.6731	NPC116631
Remote Similarity	0.6731	NPC190558
Remote Similarity	0.6731	NPC248142
Remote Similarity	0.6731	NPC172518
Remote Similarity	0.6731	NPC97820
Remote Similarity	0.6731	NPC39830
Remote Similarity	0.6731	NPC117351
Remote Similarity	0.6731	NPC602722
Remote Similarity	0.6731	NPC611671
Remote Similarity	0.6604	NPC287708
Remote Similarity	0.5849	NPC567759
Remote Similarity	0.5849	NPC578255
Remote Similarity	0.5741	NPC51091
Remote Similarity	0.5741	NPC5754
Remote Similarity	0.5741	NPC31563
Remote Similarity	0.5741	NPC191830
Remote Similarity	0.5741	NPC548686
Remote Similarity	0.5741	NPC580311

Drug Structure

NPD2575 OpenBabel08211702172D 25 28 0 0 1 0 0 0 0 0999 V2000 -4.0710 0.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8314 -1.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8314 -1.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8314 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8314 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7812 1.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7812 -0.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9600 0.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4688 0.4196 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -2.4832 1.2286 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -2.4832 -0.3894 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -1.5322 0.9196 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -1.5322 -0.0804 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.0000 1.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.9600 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -3.0710 0.4196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4400 0.1286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8314 2.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9600 0.9600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8314 2.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6662 0.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4000 0.1286 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4400 0.1286 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 2 0 0 0 0 5 10 2 0 0 0 0 6 10 1 0 0 0 0 7 11 1 0 0 0 0 7 12 1 0 0 0 0 8 11 1 0 0 0 0 8 13 1 0 0 0 0 9 17 1 0 0 0 0 9 19 1 0 0 0 0 10 17 1 0 0 0 0 11 22 1 0 0 0 0 12 14 1 0 0 0 0 12 18 1 0 0 0 0 13 15 1 0 0 0 0 13 18 1 0 0 0 0 14 15 1 0 0 0 0 14 23 1 0 0 0 0 15 23 1 0 0 0 0 16 17 1 0 0 0 0 16 20 2 0 0 0 0 16 22 1 0 0 0 0 17 21 1 0 0 0 0 19 24 1 0 0 0 0 21 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001612
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	4105431
ChEBI
CAS Number

Drug Properties

Molecular Weight	319.14
ALogP	-2.1516
MLogP	2.67
XLogP	1.127
HDA	6
HBD	2
Rotatable Bonds	8
TPSA	82.53
RO5 Violation	0