NPASS drugs

Drug Information

Drug ID:	NPD2517
Drug Name:	Methicillin
Molecular Formula:	C17H20N2O6S
Canonical SMILES:	COc1cccc(c1C(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)O)OC
Standard InCHI:	"InChI=1S/C17H20N2O6S/c1-17(2)12(16(22)23)19-14(21)11(15(19)26-17)18-13(20)10-8(24-3)6-5-7-9(10)25-4/h5-7,11-12,15H,1-4H3,(H,18,20)(H,22,23)/t11-,12+,15-/m1/s1"
Standard InCHIKey:	RJQXTJLFIWVMTO-TYNCELHUSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2517

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	84389
0.1-0.2	125506
0.2-0.3	1821
0.3-0.4	11
0.4-0.5	5
0.5-0.6	7
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC478433
Remote Similarity	0.5538	NPC599814
Remote Similarity	0.5405	NPC478578
Remote Similarity	0.5385	NPC330588
Remote Similarity	0.5303	NPC90478
Remote Similarity	0.5152	NPC485035
Remote Similarity	0.5152	NPC469134
Remote Similarity	0.5147	NPC468984

Drug Structure

NPD2517 OpenBabel08211702172D 28 30 0 0 1 0 0 0 0 0999 V2000 3.4049 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4049 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8966 -4.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5708 -0.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7944 -3.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8284 -3.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1213 -3.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9511 0.3090 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2382 1.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5909 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1554 -3.3801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6049 -0.9306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9511 -1.3090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -2.8978 -0.2235 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6128 1.7953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 17 1 0 0 0 0 2 17 1 0 0 0 0 3 24 1 0 0 0 0 4 25 1 0 0 0 0 5 6 2 0 0 0 0 5 7 1 0 0 0 0 6 8 1 0 0 0 0 7 9 2 0 0 0 0 8 10 2 0 0 0 0 8 24 1 0 0 0 0 9 10 1 0 0 0 0 9 25 1 0 0 0 0 10 13 1 0 0 0 0 11 14 1 0 0 0 0 11 15 1 0 0 0 0 11 18 1 6 0 0 0 12 16 1 1 0 0 0 12 17 1 0 0 0 0 12 19 1 0 0 0 0 13 18 2 3 0 0 0 13 20 1 0 0 0 0 14 19 1 0 0 0 0 14 21 2 0 0 0 0 15 19 1 0 0 0 0 15 26 1 6 0 0 0 16 22 2 0 0 0 0 16 23 1 0 0 0 0 17 26 1 0 0 0 0 20 27 1 0 0 0 0 23 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001170
DrugBank	DB01603
ChEMBL	CHEMBL575
IUPHAR/BPS
PharmaGKB	PA164777034
KEGG Drug
PubChem CID	0
ChEBI	6827
CAS Number	61-32-5

Drug Properties

Molecular Weight	380.1
ALogP	-0.0571
MLogP	2.34
XLogP	0.939
HDA	6
HBD	2
Rotatable Bonds	11
TPSA	133.96
RO5 Violation	0