Drug Information| Drug ID:   | NPD2515 |
| Drug Name:   | Pheneticillin |
| Molecular Formula:   | C17H20N2O5S |
| Canonical SMILES:   | CC(C(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)O)Oc1ccccc1 |
| Standard InCHI:   | "InChI=1S/C17H20N2O5S/c1-9(24-10-7-5-4-6-8-10)13(20)18-11-14(21)19-12(16(22)23)17(2,3)25-15(11)19/h4-9,11-12,15H,1-3H3,(H,18,20)(H,22,23)/t9?,11-,12+,15-/m1/s1" |
| Standard InCHIKey:   | NONJJLVGHLVQQM-JHXYUMNGSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2515Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.623 | NPC330588 |
| Remote Similarity | 0.6129 | NPC90478 |
| Remote Similarity | 0.5938 | NPC468984 |
| Remote Similarity | 0.5538 | NPC478433 |
| Remote Similarity | 0.5294 | NPC206980 |
| Remote Similarity | 0.5294 | NPC487966 |
| Remote Similarity | 0.5231 | NPC485035 |
| Remote Similarity | 0.5231 | NPC469134 |
| Remote Similarity | 0.5152 | NPC117829 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 364.11 |
| ALogP   | -0.2134 |
| MLogP   | 2.45 |
| XLogP   | 2.265 |
| HDA   | 6 |
| HBD   | 2 |
| Rotatable Bonds   | 10 |
| TPSA   | 124.73 |
| RO5 Violation   | 0 |