NPASS drugs

Drug Information

Drug ID:	NPD2490
Drug Name:	Hydromorphone
Molecular Formula:	C17H19NO3
Canonical SMILES:	O=C1CC[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O
Standard InCHI:	"InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,16,19H,3,5-8H2,1H3/t10-,11+,16-,17-/m0/s1"
Standard InCHIKey:	WVLOADHCBXTIJK-YNHQPCIGSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD2490

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	89006
0.1-0.2	119526
0.2-0.3	3073
0.3-0.4	75
0.4-0.5	34
0.5-0.6	10
0.6-0.7	4
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7015	NPC97086
Remote Similarity	0.6866	NPC115906
Remote Similarity	0.6866	NPC608430
Remote Similarity	0.6216	NPC43726
Remote Similarity	0.6216	NPC147161
Remote Similarity	0.589	NPC328423
Remote Similarity	0.589	NPC74436
Remote Similarity	0.589	NPC232533
Remote Similarity	0.589	NPC298343
Remote Similarity	0.589	NPC566104
Remote Similarity	0.589	NPC607466
Remote Similarity	0.589	NPC608460
Remote Similarity	0.5811	NPC485664
Remote Similarity	0.5316	NPC258640
Remote Similarity	0.519	NPC611959

Drug Structure

NPD2490 OpenBabel08211702172D 22 26 0 0 1 0 0 0 0 0999 V2000 -4.0472 -1.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1533 1.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1533 -1.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4284 2.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4284 -2.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1533 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6031 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8782 0.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1533 0.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1533 -0.8371 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8782 -0.4185 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7036 1.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7036 -1.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4284 0.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7036 0.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7036 -0.8371 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4284 -0.4185 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6031 -0.8371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0214 2.0922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0621 -2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3618 2.8569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 4 2 0 0 0 0 2 9 1 0 0 0 0 3 5 1 0 0 0 0 3 10 1 0 0 0 0 4 12 1 0 0 0 0 5 13 1 0 0 0 0 6 7 1 0 0 0 0 7 18 1 0 0 0 0 8 9 1 0 0 0 0 9 14 2 0 0 0 0 10 11 1 0 0 0 0 10 17 1 1 0 0 0 11 8 1 6 0 0 0 11 18 1 0 0 0 0 12 15 2 0 0 0 0 12 19 1 0 0 0 0 13 16 1 0 0 0 0 13 20 2 0 0 0 0 14 15 1 0 0 0 0 14 17 1 0 0 0 0 15 21 1 0 0 0 0 16 17 1 1 0 0 0 16 21 1 0 0 0 0 17 6 1 6 0 0 0 19 22 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000472; DIB010579
DrugBank	DB00327
ChEMBL	CHEMBL398707
IUPHAR/BPS	7082
PharmaGKB	PA449918
KEGG Drug
PubChem CID	5284570
ChEBI	5790
CAS Number	466-99-9

Drug Properties

Molecular Weight	285.14
ALogP	-1.0261
MLogP	2.89
XLogP	0.907
HDA	2
HBD	1
Rotatable Bonds	2
TPSA	49.77
RO5 Violation	0