NPASS drugs

Drug Information

Drug ID:	NPD2488
Drug Name:	Hydromorphone Hydrochloride
Molecular Formula:	C17H19NO3.ClH
Canonical SMILES:	O=C1CC[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O.Cl
Standard InCHI:	"InChI=1S/C17H19NO3.ClH/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;/h2,4,10-11,16,19H,3,5-8H2,1H3;1H/t10-,11+,16-,17-;/m0./s1"
Standard InCHIKey:	XHILEZUETWRSHC-NRGUFEMZSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2488

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	89552
0.1-0.2	119105
0.2-0.3	2952
0.3-0.4	73
0.4-0.5	43
0.5-0.6	10
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6912	NPC97086
Remote Similarity	0.6765	NPC115906
Remote Similarity	0.6765	NPC608430
Remote Similarity	0.6133	NPC43726
Remote Similarity	0.6133	NPC147161
Remote Similarity	0.5946	NPC485664
Remote Similarity	0.5811	NPC328423
Remote Similarity	0.5811	NPC74436
Remote Similarity	0.5811	NPC232533
Remote Similarity	0.5811	NPC298343
Remote Similarity	0.5811	NPC566104
Remote Similarity	0.5811	NPC607466
Remote Similarity	0.5811	NPC608460
Remote Similarity	0.525	NPC258640
Remote Similarity	0.5125	NPC611959

Drug Structure

NPD2488 OpenBabel08211702172D 23 26 0 0 1 0 0 0 0 0999 V2000 0.4420 -4.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3359 -1.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3359 -4.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0608 -1.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0608 -5.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3359 -3.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8861 -3.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6110 -2.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3359 -2.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3359 -4.1360 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6110 -3.7175 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7857 -1.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7857 -4.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0608 -2.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7857 -2.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7857 -4.1360 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0608 -3.7175 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8861 -4.1360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5106 -1.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5513 -5.4151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4892 -3.2989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5892 -0.7800 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 4.8511 -0.4420 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 4 2 0 0 0 0 2 9 1 0 0 0 0 3 5 1 0 0 0 0 3 10 1 0 0 0 0 4 12 1 0 0 0 0 5 13 1 0 0 0 0 6 7 1 0 0 0 0 7 18 1 0 0 0 0 8 9 1 0 0 0 0 9 14 2 0 0 0 0 10 11 1 0 0 0 0 10 17 1 1 0 0 0 11 8 1 6 0 0 0 11 18 1 0 0 0 0 12 15 2 0 0 0 0 12 19 1 0 0 0 0 13 16 1 0 0 0 0 13 20 2 0 0 0 0 14 15 1 0 0 0 0 14 17 1 0 0 0 0 15 21 1 0 0 0 0 16 17 1 1 0 0 0 16 21 1 0 0 0 0 17 6 1 6 0 0 0 19 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	285.14
ALogP	-1.0261
MLogP	2.89
XLogP	0.907
HDA	2
HBD	1
Rotatable Bonds	2
TPSA	49.77
RO5 Violation	0