Drug Information| Drug ID:   | NPD2488 |
| Drug Name:   | Hydromorphone Hydrochloride |
| Molecular Formula:   | C17H19NO3.ClH |
| Canonical SMILES:   | O=C1CC[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O.Cl |
| Standard InCHI:   | "InChI=1S/C17H19NO3.ClH/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;/h2,4,10-11,16,19H,3,5-8H2,1H3;1H/t10-,11+,16-,17-;/m0./s1" |
| Standard InCHIKey:   | XHILEZUETWRSHC-NRGUFEMZSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD2488Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6912 | NPC97086 |
| Remote Similarity | 0.6765 | NPC115906 |
| Remote Similarity | 0.6765 | NPC608430 |
| Remote Similarity | 0.6133 | NPC43726 |
| Remote Similarity | 0.6133 | NPC147161 |
| Remote Similarity | 0.5946 | NPC485664 |
| Remote Similarity | 0.5811 | NPC328423 |
| Remote Similarity | 0.5811 | NPC74436 |
| Remote Similarity | 0.5811 | NPC232533 |
| Remote Similarity | 0.5811 | NPC298343 |
| Remote Similarity | 0.5811 | NPC566104 |
| Remote Similarity | 0.5811 | NPC607466 |
| Remote Similarity | 0.5811 | NPC608460 |
| Remote Similarity | 0.525 | NPC258640 |
| Remote Similarity | 0.5125 | NPC611959 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 285.14 |
| ALogP   | -1.0261 |
| MLogP   | 2.89 |
| XLogP   | 0.907 |
| HDA   | 2 |
| HBD   | 1 |
| Rotatable Bonds   | 2 |
| TPSA   | 49.77 |
| RO5 Violation   | 0 |