NPASS drugs

Drug Information

Drug ID:	NPD2437
Drug Name:	Carbenicillin
Molecular Formula:	C17H18N2O6S
Canonical SMILES:	OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)C(c1ccccc1)C(=O)O
Standard InCHI:	"InChI=1S/C17H18N2O6S/c1-17(2)11(16(24)25)19-13(21)10(14(19)26-17)18-12(20)9(15(22)23)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,20)(H,22,23)(H,24,25)/t9?,10-,11+,14-/m1/s1"
Standard InCHIKey:	FPPNZSSZRUTDAP-UWFZAAFLSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2437

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	89263
0.1-0.2	118994
0.2-0.3	3433
0.3-0.4	33
0.4-0.5	6
0.5-0.6	4
0.6-0.7	4
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC330588
Intermediate Similarity	0.7414	NPC468984
Intermediate Similarity	0.7069	NPC90478
Remote Similarity	0.6885	NPC487966
Remote Similarity	0.6349	NPC206980
Remote Similarity	0.6333	NPC485035
Remote Similarity	0.6333	NPC469134
Remote Similarity	0.5694	NPC487965
Remote Similarity	0.5625	NPC609610
Remote Similarity	0.5469	NPC117829
Remote Similarity	0.5385	NPC478433

Drug Structure

NPD2437 OpenBabel08211702172D 29 31 0 0 1 0 0 0 0 0999 V2000 -3.4049 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4049 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2779 -1.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5708 -0.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0191 -2.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6049 -0.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3461 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3801 -2.1554 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9511 0.3090 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1213 -3.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9319 -0.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1554 -3.3801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8284 -3.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2382 1.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5909 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9511 -1.3090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 2.8978 -0.2235 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5696 -4.7944 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6128 1.7953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 17 1 0 0 0 0 2 17 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 8 2 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 12 1 0 0 0 0 9 15 1 0 0 0 0 10 13 1 0 0 0 0 10 14 1 0 0 0 0 10 18 1 1 0 0 0 11 16 1 6 0 0 0 11 17 1 0 0 0 0 11 19 1 0 0 0 0 12 18 2 3 0 0 0 12 20 1 0 0 0 0 13 19 1 0 0 0 0 13 21 2 0 0 0 0 14 19 1 0 0 0 0 14 26 1 1 0 0 0 15 22 2 0 0 0 0 15 23 1 0 0 0 0 16 24 2 0 0 0 0 16 25 1 0 0 0 0 17 26 1 0 0 0 0 20 27 1 0 0 0 0 23 28 1 0 0 0 0 25 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000438
DrugBank	DB00578
ChEMBL	CHEMBL1214
IUPHAR/BPS
PharmaGKB	PA448788
KEGG Drug
PubChem CID	20824
ChEBI	3393
CAS Number	4697-36-3

Drug Properties

Molecular Weight	378.09
ALogP	-0.338
MLogP	2.34
XLogP	2.036
HDA	8
HBD	3
Rotatable Bonds	10
TPSA	152.8
RO5 Violation	0