NPASS drugs

Drug Information

Drug ID:	NPD2053
Drug Name:	Penicillin V
Molecular Formula:	C16H18N2O5S
Canonical SMILES:	OC(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)COc1ccccc1
Standard InCHI:	"InChI=1S/C16H18N2O5S/c1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12+,14-/m1/s1"
Standard InCHIKey:	BPLBGHOLXOTWMN-MBNYWOFBSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2053

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	98256
0.1-0.2	112125
0.2-0.3	1327
0.3-0.4	19
0.4-0.5	4
0.5-0.6	7
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6032	NPC330588
Remote Similarity	0.5938	NPC90478
Remote Similarity	0.5758	NPC468984
Remote Similarity	0.5606	NPC478433
Remote Similarity	0.5362	NPC206980
Remote Similarity	0.5143	NPC487966
Remote Similarity	0.5075	NPC485035
Remote Similarity	0.5075	NPC469134

Drug Structure

NPD2053 OpenBabel08211701392D 26 28 0 0 1 0 0 0 0 0999 V2000 3.4049 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4049 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0012 3.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0353 2.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7083 2.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7765 1.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4495 1.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4836 1.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9511 0.3090 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2601 1.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2382 1.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5909 2.0032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2247 0.2247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9511 -1.3090 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6128 1.7953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 16 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 9 2 0 0 0 0 7 9 1 0 0 0 0 8 10 1 0 0 0 0 8 23 1 0 0 0 0 9 23 1 0 0 0 0 10 17 2 3 0 0 0 10 19 1 0 0 0 0 11 13 1 0 0 0 0 11 14 1 0 0 0 0 11 17 1 6 0 0 0 12 15 1 1 0 0 0 12 16 1 0 0 0 0 12 18 1 0 0 0 0 13 18 1 0 0 0 0 13 20 2 0 0 0 0 14 18 1 0 0 0 0 14 24 1 6 0 0 0 15 21 2 0 0 0 0 15 22 1 0 0 0 0 16 24 1 0 0 0 0 19 25 1 0 0 0 0 22 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001165
DrugBank	DB00417
ChEMBL	CHEMBL615
IUPHAR/BPS
PharmaGKB	PA164745442
KEGG Drug	D05411
PubChem CID	6869
ChEBI	27446
CAS Number	1987/8/1

Drug Properties

Molecular Weight	350.09
ALogP	-0.3094
MLogP	2.34
XLogP	1.739
HDA	6
HBD	2
Rotatable Bonds	9
TPSA	124.73
RO5 Violation	0