NPASS drugs

Drug Information

Drug ID:	NPD1684
Drug Name:
Molecular Formula:	C15H18N2O
Canonical SMILES:	C/C=C/1C2C=C(CC1(N)c1c(C2)nc(cc1)O)C
Standard InCHI:	"InChI=1S/C15H18N2O/c1-3-11-10-6-9(2)8-15(11,16)12-4-5-14(18)17-13(12)7-10/h3-6,10H,7-8,16H2,1-2H3,(H,17,18)/b11-3+"
Standard InCHIKey:	ZRJBHWIHUMBLCN-QDEBKDIKSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD1684

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	115172
0.1-0.2	96050
0.2-0.3	486
0.3-0.4	11
0.4-0.5	8
0.5-0.6	7
0.6-0.7	1
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC47298
High Similarity	1.0	NPC482954
High Similarity	1.0	NPC255406
Intermediate Similarity	0.7843	NPC484634
Intermediate Similarity	0.7143	NPC484625
Remote Similarity	0.6296	NPC32028
Remote Similarity	0.5893	NPC78717
Remote Similarity	0.5862	NPC259545
Remote Similarity	0.569	NPC484624
Remote Similarity	0.5333	NPC484637
Remote Similarity	0.5312	NPC232340
Remote Similarity	0.5312	NPC180118
Remote Similarity	0.5254	NPC126481

Drug Structure

NPD1684 OpenBabel08211701082D 21 23 0 0 1 0 0 0 0 0999 V2000 5.6870 -2.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4874 -2.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8818 -2.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0003 -1.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6972 -1.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7899 -0.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3952 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0924 -2.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7899 -1.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0926 -0.4025 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.0925 -1.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6977 -1.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6975 -0.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6974 -0.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3952 -1.6105 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.6979 -2.0132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.3949 -0.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1840 -1.3934 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4181 -2.7681 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3950 0.8051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 9 1 0 0 0 0 3 11 2 0 0 0 0 4 5 2 0 0 0 0 4 12 1 0 0 0 0 5 14 1 0 0 0 0 6 9 2 0 0 0 0 6 10 1 0 0 0 0 7 10 1 0 0 0 0 7 13 1 0 0 0 0 8 9 1 0 0 0 0 8 15 1 0 0 0 0 10 11 1 0 0 0 0 11 15 1 0 0 0 0 12 13 2 0 0 0 0 12 15 1 0 0 0 0 13 17 1 0 0 0 0 14 17 2 0 0 0 0 14 18 1 0 0 0 0 15 16 1 0 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 18 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC000749
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	5912039
ChEBI
CAS Number

Drug Properties

Molecular Weight	242.14
ALogP	0.4801
MLogP	2.78
XLogP	1.283
HDA	2
HBD	2
Rotatable Bonds	4
TPSA	59.14
RO5 Violation	0