Drug Information| Drug ID:   | NPD1398 |
| Drug Name:   | Apc-100 |
| Molecular Formula:   | C14H20O2 |
| Canonical SMILES:   | Cc1c2OC(C)(C)CCc2c(c(c1C)O)C |
| Standard InCHI:   | "InChI=1S/C14H20O2/c1-8-9(2)13-11(10(3)12(8)15)6-7-14(4,5)16-13/h15H,6-7H2,1-5H3" |
| Standard InCHIKey:   | SEBPXHSZHLFWRL-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD1398Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5957 | NPC320847 |
| Remote Similarity | 0.5833 | NPC126759 |
| Remote Similarity | 0.5833 | NPC242580 |
| Remote Similarity | 0.5833 | NPC236070 |
| Remote Similarity | 0.5833 | NPC17425 |
| Remote Similarity | 0.5833 | NPC602820 |
| Remote Similarity | 0.5833 | NPC608398 |
| Remote Similarity | 0.549 | NPC139047 |
| Remote Similarity | 0.549 | NPC547258 |
| Remote Similarity | 0.5385 | NPC51124 |
| Remote Similarity | 0.5385 | NPC489686 |
| Remote Similarity | 0.5385 | NPC324314 |
| Remote Similarity | 0.5217 | NPC478668 |
| Remote Similarity | 0.5217 | NPC609474 |
| Remote Similarity | 0.5185 | NPC491279 |
| Remote Similarity | 0.5091 | NPC495131 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 220.15 |
| ALogP   | 2.2237 |
| MLogP   | 2.78 |
| XLogP   | 2.797 |
| HDA   | 0 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 29.46 |
| RO5 Violation   | 0 |