NPASS drugs

Drug Information

Drug ID:	NPD1355
Drug Name:
Molecular Formula:	C14H18N6O
Canonical SMILES:	OCC1C=CC(C1)n1cnc2c1nc(=N)[nH]c2NC1CC1
Standard InCHI:	InChI=1S/C14H18N6O/c15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21/h1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19)
Standard InCHIKey:	MCGSCOLBFJQGHM-UHFFFAOYSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD1355

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	159
0.1-0.2	11021
0.2-0.3	15487
0.3-0.4	3431
0.4-0.5	589
0.5-0.6	175
0.6-0.7	27
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7086	NPC469975
Remote Similarity	0.6803	NPC8590
Remote Similarity	0.6438	NPC262926
Remote Similarity	0.6395	NPC61198
Remote Similarity	0.6395	NPC320818
Remote Similarity	0.6301	NPC57279
Remote Similarity	0.6294	NPC180462
Remote Similarity	0.625	NPC239737
Remote Similarity	0.6226	NPC472834
Remote Similarity	0.619	NPC324009
Remote Similarity	0.6184	NPC186619
Remote Similarity	0.6169	NPC317746
Remote Similarity	0.6149	NPC319221
Remote Similarity	0.6143	NPC327579
Remote Similarity	0.6131	NPC313547
Remote Similarity	0.6129	NPC64705
Remote Similarity	0.6129	NPC232408
Remote Similarity	0.6104	NPC318590
Remote Similarity	0.6104	NPC211820
Remote Similarity	0.6104	NPC251233
Remote Similarity	0.6076	NPC150853
Remote Similarity	0.6065	NPC274384
Remote Similarity	0.6065	NPC89147
Remote Similarity	0.6065	NPC177169
Remote Similarity	0.6053	NPC129756
Remote Similarity	0.6039	NPC74306
Remote Similarity	0.6039	NPC315642
Remote Similarity	0.6014	NPC327613
Remote Similarity	0.5987	NPC33996
Remote Similarity	0.596	NPC150950
Remote Similarity	0.596	NPC189436
Remote Similarity	0.596	NPC125076
Remote Similarity	0.5948	NPC296437
Remote Similarity	0.594	NPC59314
Remote Similarity	0.5909	NPC167285
Remote Similarity	0.5909	NPC209525
Remote Similarity	0.5909	NPC161659
Remote Similarity	0.5909	NPC470266
Remote Similarity	0.5909	NPC317821
Remote Similarity	0.5909	NPC226184
Remote Similarity	0.5909	NPC76544
Remote Similarity	0.586	NPC476521
Remote Similarity	0.5854	NPC93365
Remote Similarity	0.5844	NPC210947
Remote Similarity	0.5833	NPC476528
Remote Similarity	0.5833	NPC314152
Remote Similarity	0.5833	NPC229974
Remote Similarity	0.5833	NPC476433
Remote Similarity	0.5818	NPC195140
Remote Similarity	0.581	NPC313514
Remote Similarity	0.5806	NPC286696
Remote Similarity	0.5802	NPC328479
Remote Similarity	0.5796	NPC476522
Remote Similarity	0.5796	NPC474986
Remote Similarity	0.5796	NPC476013
Remote Similarity	0.5796	NPC476520
Remote Similarity	0.5786	NPC476408
Remote Similarity	0.5779	NPC30326
Remote Similarity	0.5759	NPC107374
Remote Similarity	0.5759	NPC156461
Remote Similarity	0.5759	NPC21448
Remote Similarity	0.5746	NPC273327
Remote Similarity	0.5723	NPC327477
Remote Similarity	0.5723	NPC164665
Remote Similarity	0.5723	NPC189068
Remote Similarity	0.5714	NPC41958
Remote Similarity	0.5714	NPC293163
Remote Similarity	0.5714	NPC477119
Remote Similarity	0.5706	NPC282531
Remote Similarity	0.5705	NPC185903
Remote Similarity	0.5697	NPC472833
Remote Similarity	0.5695	NPC235501
Remote Similarity	0.5689	NPC124276
Remote Similarity	0.5687	NPC309832
Remote Similarity	0.5687	NPC219313
Remote Similarity	0.5687	NPC269827
Remote Similarity	0.5686	NPC126634
Remote Similarity	0.566	NPC174020
Remote Similarity	0.5652	NPC121222
Remote Similarity	0.565	NPC473585
Remote Similarity	0.5644	NPC161224
Remote Similarity	0.5636	NPC60537
Remote Similarity	0.5634	NPC63433
Remote Similarity	0.5629	NPC243319
Remote Similarity	0.5621	NPC14590
Remote Similarity	0.562	NPC119133
Remote Similarity	0.5617	NPC136349
Remote Similarity	0.5613	NPC237812
Remote Similarity	0.5613	NPC18223
Remote Similarity	0.5611	NPC265111
Remote Similarity	0.561	NPC473646
Remote Similarity	0.561	NPC321052
Remote Similarity	0.5608	NPC15566
Remote Similarity	0.56	NPC313897

Drug Structure

NPD1355 OpenBabel08211700192D 25 28 0 0 1 0 0 0 0 0999 V2000 -3.3305 1.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0981 3.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 3.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4644 2.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1280 0.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7917 -0.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3364 2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1226 0.6522 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7213 1.4612 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.6581 2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7431 1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.7698 0.1170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0788 1.0680 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 2 0 0 0 0 1 8 1 0 0 0 0 2 3 1 0 0 0 0 2 9 1 0 0 0 0 3 9 1 0 0 0 0 4 10 1 0 0 0 0 5 8 1 0 0 0 0 5 10 1 0 0 0 0 6 8 1 0 0 0 0 6 21 1 0 0 0 0 7 16 2 0 0 0 0 7 20 1 0 0 0 0 9 17 1 0 0 0 0 10 20 1 0 0 0 0 11 12 2 0 0 0 0 11 13 1 0 0 0 0 11 16 1 0 0 0 0 12 17 1 0 0 0 0 12 18 1 0 0 0 0 13 19 2 0 0 0 0 13 20 1 0 0 0 0 14 15 2 0 0 0 0 14 18 1 0 0 0 0 14 19 1 0 0 0 0 15 22 1 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 21 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNCL002978
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	19767005
ChEBI
CAS Number

Drug Properties

Molecular Weight	286.15
ALogP	-2.1793
MLogP	2.23
XLogP	1.61
HDA	7
HBD	4
Rotatable Bonds	5
TPSA	98.32
RO5 Violation	0