NPASS drugs

Drug Information

Drug ID:	NPD1335
Drug Name:	Pipemidic Acid
Molecular Formula:	C14H17N5O3
Canonical SMILES:	CCn1cc(C(=O)O)c(=O)c2c1nc(nc2)N1CCNCC1
Standard InCHI:	InChI=1S/C14H17N5O3/c1-2-18-8-10(13(21)22)11(20)9-7-16-14(17-12(9)18)19-5-3-15-4-6-19/h7-8,15H,2-6H2,1H3,(H,21,22)
Standard InCHIKey:	JOHZPMXAZQZXHR-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD1335

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	171
0.1-0.2	4991
0.2-0.3	20999
0.3-0.4	2721
0.4-0.5	1737
0.5-0.6	265
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6471	NPC285923
Remote Similarity	0.6287	NPC210947
Remote Similarity	0.6154	NPC286696
Remote Similarity	0.6145	NPC126634
Remote Similarity	0.6061	NPC235501
Remote Similarity	0.6059	NPC185903
Remote Similarity	0.5977	NPC327477
Remote Similarity	0.5976	NPC237812
Remote Similarity	0.5976	NPC18223
Remote Similarity	0.5964	NPC470138
Remote Similarity	0.5882	NPC314646
Remote Similarity	0.5868	NPC25465
Remote Similarity	0.585	NPC202812
Remote Similarity	0.5849	NPC177996
Remote Similarity	0.5849	NPC147983
Remote Similarity	0.5848	NPC62151
Remote Similarity	0.5818	NPC144223
Remote Similarity	0.5767	NPC222174
Remote Similarity	0.5739	NPC174020
Remote Similarity	0.5731	NPC470140
Remote Similarity	0.5729	NPC476419
Remote Similarity	0.5723	NPC470139
Remote Similarity	0.5714	NPC246193
Remote Similarity	0.5714	NPC163105
Remote Similarity	0.569	NPC76544
Remote Similarity	0.569	NPC226184
Remote Similarity	0.569	NPC167285
Remote Similarity	0.5661	NPC168702
Remote Similarity	0.5661	NPC125659
Remote Similarity	0.5628	NPC60537
Remote Similarity	0.5611	NPC167400
Remote Similarity	0.5608	NPC33382

Drug Structure

NPD1335 OpenBabel08211700192D 24 26 0 0 0 0 0 0 0 0999 V2000 -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 18 1 0 0 0 0 3 5 1 0 0 0 0 3 15 1 0 0 0 0 4 6 1 0 0 0 0 4 15 1 0 0 0 0 5 19 1 0 0 0 0 6 19 1 0 0 0 0 7 9 2 0 0 0 0 7 16 1 0 0 0 0 8 10 2 0 0 0 0 8 18 1 0 0 0 0 9 11 1 0 0 0 0 9 12 1 0 0 0 0 10 11 1 0 0 0 0 10 13 1 0 0 0 0 11 20 2 0 0 0 0 12 17 2 0 0 0 0 12 18 1 0 0 0 0 13 21 2 0 0 0 0 13 22 1 0 0 0 0 14 16 2 0 0 0 0 14 17 1 0 0 0 0 14 19 1 0 0 0 0 15 23 1 0 0 0 0 22 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	303.13
ALogP	-0.7473
MLogP	2.12
XLogP	0.577
HDA	8
HBD	2
Rotatable Bonds	5
TPSA	98.66
RO5 Violation	0