NPASS drugs

Drug Information

Drug ID:	NPD1331
Drug Name:	Azaribine
Molecular Formula:	C14H17N3O9
Canonical SMILES:	CC(=O)O[C@@H]1[C@H](OC(=O)C)[C@H](O[C@H]1n1ncc(nc1=O)O)COC(=O)C
Standard InCHI:	InChI=1S/C14H17N3O9/c1-6(18)23-5-9-11(24-7(2)19)12(25-8(3)20)13(26-9)17-14(22)16-10(21)4-15-17/h4,9,11-13H,5H2,1-3H3,(H,16,21,22)/t9-,11-,12-,13-/m1/s1
Standard InCHIKey:	QQOBRRFOVWGIMD-OJAKKHQRSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD1331

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	158
0.1-0.2	10569
0.2-0.3	16598
0.3-0.4	2952
0.4-0.5	507
0.5-0.6	83
0.6-0.7	19
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC109188
Intermediate Similarity	0.7841	NPC319753
Intermediate Similarity	0.7273	NPC329077
Intermediate Similarity	0.7	NPC325902
Remote Similarity	0.6735	NPC171116
Remote Similarity	0.6667	NPC325723
Remote Similarity	0.6598	NPC89051
Remote Similarity	0.6598	NPC43246
Remote Similarity	0.6531	NPC163352
Remote Similarity	0.6531	NPC210456
Remote Similarity	0.64	NPC315063
Remote Similarity	0.6311	NPC36985
Remote Similarity	0.6311	NPC17892
Remote Similarity	0.6289	NPC106780
Remote Similarity	0.625	NPC283698
Remote Similarity	0.625	NPC73765
Remote Similarity	0.6224	NPC71339
Remote Similarity	0.6224	NPC112842
Remote Similarity	0.6196	NPC315806
Remote Similarity	0.6095	NPC317639
Remote Similarity	0.6019	NPC324390
Remote Similarity	0.6	NPC324516
Remote Similarity	0.6	NPC318166
Remote Similarity	0.5962	NPC322594
Remote Similarity	0.5962	NPC327344
Remote Similarity	0.5962	NPC320249
Remote Similarity	0.5877	NPC155087
Remote Similarity	0.5877	NPC149843
Remote Similarity	0.5841	NPC329277
Remote Similarity	0.5726	NPC325750
Remote Similarity	0.5684	NPC126186
Remote Similarity	0.5678	NPC478024

Drug Structure

NPD1331 OpenBabel08211700192D 27 28 0 0 1 0 0 0 0 0999 V2000 0.3664 -2.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6243 -2.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1465 2.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3554 -2.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7731 -3.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0310 -1.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9385 1.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9487 -1.7024 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4487 -0.8364 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7796 -0.0933 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1853 -4.1295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0255 -1.4364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6817 0.5248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7677 -3.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4432 -0.7319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9875 0.8849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9706 -1.4945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 6 1 0 0 0 0 2 7 1 0 0 0 0 3 8 1 0 0 0 0 4 10 1 0 0 0 0 4 15 2 0 0 0 0 5 23 1 0 0 0 0 6 18 2 0 0 0 0 6 23 1 0 0 0 0 7 19 2 0 0 0 0 7 24 1 0 0 0 0 8 20 2 0 0 0 0 8 25 1 0 0 0 0 9 5 1 1 0 0 0 9 11 1 0 0 0 0 9 26 1 0 0 0 0 10 16 2 0 0 0 0 10 21 1 0 0 0 0 11 12 1 0 0 0 0 11 24 1 6 0 0 0 12 13 1 0 0 0 0 12 25 1 6 0 0 0 13 17 1 1 0 0 0 13 26 1 0 0 0 0 14 16 1 0 0 0 0 14 17 1 0 0 0 0 14 22 2 0 0 0 0 15 17 1 0 0 0 0 21 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB002736
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	371.10
ALogP	-0.723
MLogP	1.68
XLogP	-0.251
HDA	12
HBD	1
Rotatable Bonds	12
TPSA	153.39
RO5 Violation	1