NPASS drugs

Drug Information

Drug ID:	NPD1069
Drug Name:	Melphalan Hydrochloride
Molecular Formula:	C13H18Cl2N2O2.ClH
Canonical SMILES:	ClCCN(c1ccc(cc1)C[C@@H](C(=O)O)N)CCCl.Cl
Standard InCHI:	"InChI=1S/C13H18Cl2N2O2.ClH/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19;/h1-4,12H,5-9,16H2,(H,18,19);1H/t12-;/m0./s1"
Standard InCHIKey:	OUUYBRCCFUEMLH-YDALLXLXSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD1069

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	131170
0.1-0.2	77842
0.2-0.3	2608
0.3-0.4	75
0.4-0.5	34
0.5-0.6	8
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC220547
High Similarity	1.0	NPC612031
Remote Similarity	0.5682	NPC326079
Remote Similarity	0.5435	NPC323302
Remote Similarity	0.5238	NPC10781
Remote Similarity	0.5238	NPC293628
Remote Similarity	0.5238	NPC122493
Remote Similarity	0.5238	NPC602629
Remote Similarity	0.5238	NPC605924
Remote Similarity	0.5238	NPC611640

Drug Structure

NPD1069 OpenBabel08201723592D 23 22 0 0 1 0 0 0 0 0999 V2000 4.8301 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -5.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6962 -5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -1.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -2.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -5.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -6.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5052 -1.3655 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -6.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -5.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -7.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 1 10 2 0 0 0 0 2 4 2 0 0 0 0 2 10 1 0 0 0 0 3 11 2 0 0 0 0 4 11 1 0 0 0 0 5 7 1 0 0 0 0 5 14 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 7 17 1 0 0 0 0 8 17 1 0 0 0 0 9 10 1 0 0 0 0 11 17 1 0 0 0 0 12 9 1 6 0 0 0 12 13 1 0 0 0 0 12 16 1 0 0 0 0 13 18 2 0 0 0 0 13 19 1 0 0 0 0 16 21 1 0 0 0 0 16 22 1 0 0 0 0 19 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	304.07
ALogP	0.4638
MLogP	2.23
XLogP	0.515
HDA	4
HBD	2
Rotatable Bonds	12
TPSA	66.56
RO5 Violation	0