Natural Product: NPC70940| Natural Product ID | NPC70940 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Dexibuprofen |
| IUPAC Name | (2S)-2-[4-(2-methylpropyl)phenyl]propanoic acid |
| Synonyms | Dexibuprofen; IBU-TAB; Neoprofen; Rufen; Seractil |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL175 |
| PubChem CID |
39912 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | HEFNNWSXXWATRW-JTQLQIEISA-N |
| Standard InCHI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| SMILES | CC(Cc1ccc(cc1)[C@@H](C(=O)O)C)C |
  Calculated Properties
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.jep.2005.01.054] |
| NPO25094 | Artemisia princeps | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17996677] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31181920] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31418264] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38754641] |
| NPO25094 | Artemisia princeps | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10492 | Artemisia montana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25094 | Artemisia princeps | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO25094 | Artemisia princeps | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO10492 | Artemisia montana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO25094 | Artemisia princeps | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO28276 | Artemisia argyi | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10492 | Artemisia montana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25094 | Artemisia princeps | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 2260.0 | nM | PMID[15013005] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 265500.0 | nM | PMID[15013005] |
| NPT2749 | Individual protein | Acetylcholinesterase | Rattus norvegicus | Inhibition | = | 20.0 | % | PMID[17126019] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 90.0 | % | PMID[17110105] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 29.0 | % | PMID[17110105] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 2600.0 | nM | PMID[18457385] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 1500.0 | nM | PMID[20804197] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 3200.0 | nM | PMID[20804197] |
| NPT210 | Individual protein | Thyroid stimulating hormone receptor | Homo sapiens | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | AC50 | = | 39810.72 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | AC50 | = | 15848.93 | nM | PubChem BioAssay data set |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 79432.8 | nM | PubChem BioAssay data set |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 105.0 | nM | DrugMatrix in vitro pharmacology data |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 98.65 | nM | PMID[21602044] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 730.0 | nM | PMID[21602044] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1480.0 | nM | PMID[21602044] |
| NPT3507 | Individual protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 42400.0 | nM | PMID[22877157] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 32700.0 | nM | PMID[22877157] |
| NPT3506 | Individual protein | Aldo-keto reductase family 1 member C4 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[22877157] |
| NPT3505 | Individual protein | Aldo-keto reductase family 1 member C1 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[22877157] |
| NPT160 | Individual protein | TAR DNA-binding protein 43 | Homo sapiens | Potency | n.a. | 25118.9 | nM | PubChem BioAssay data set |
| NPT104 | Individual protein | Cerebroside-sulfatase | Homo sapiens | Potency | n.a. | 151.0 | nM | PubChem BioAssay data set |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 4500.0 | nM | PMID[32738413] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2460.0 | nM | PMID[32738413] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 4960.0 | nM | PMID[32738413] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 16150.0 | nM | PMID[32738413] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | > | 20000.0 | nM | PMID[32738413] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3781 | Protein family | Interleukin-8 receptors, CXCR1/CXCR2 | Homo sapiens | Inhibition | = | 34.0 | % | PMID[15974585] |
| NPT3781 | Protein family | Interleukin-8 receptors, CXCR1/CXCR2 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[15974585] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT796 | Individual protein | Peripheral myelin protein 22 | Homo sapiens | Potency | = | 84921.4 | nM | PubChem BioAssay data set |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 2.8 | nM | PubChem BioAssay data set |
| NPT533 | Protein-protein interaction | Runt-related transcription factor 1/Core-binding factor subunit beta | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | AC50 | = | 188000.9 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Selectivity | = | 117.5 | n.a. | PMID[15013005] |
| NPT54 | Individual protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT698 | Individual protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 946.6 | nM | PubChem BioAssay data set |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 9.369 | % | DOI[10.6019/CHEMBL4495564] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 1.48 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 22.87 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT794 | Individual protein | Endonuclease 4 | Escherichia coli K-12 | Potency | = | 251.2 | nM | PubChem BioAssay data set |
| NPT23191 | Single protein | Acid-sensing ion channel 2 | Rattus norvegicus | Imax | = | 55.0 | % | PMID[28949138] |
| NPT23190 | Single protein | Acid-sensing ion channel 1 | Rattus norvegicus | Imax | = | 95.0 | % | PMID[28949138] |
| NPT23190 | Single protein | Acid-sensing ion channel 1 | Rattus norvegicus | IC50 | = | 346736.85 | nM | PMID[28949138] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | 0.2986 | % | PMID[38318365] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3782 | Protein family | Prostaglandin G/H synthase (cyclooxygenase) | Mus musculus | Inhibition | > | 99.0 | % | PMID[15974585] |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 0.7 | nM | PubChem BioAssay data set |
| NPT62 | Individual protein | 6-phospho-1-fructokinase | Trypanosoma brucei | Potency | n.a. | 1901.2 | nM | PubChem BioAssay data set |
| NPT694 | Individual protein | UDP-glucuronosyltransferase 1-3 | Homo sapiens | Activity | = | 83.0 | pm/min/mg | PMID[10836148] |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 0.4 | nM | PubChem BioAssay data set |
| NPT23188 | Single protein | Amiloride-sensitive cation channel 3 | Rattus norvegicus | IC50 | = | 309029.54 | nM | PMID[28949138] |
| NPT23188 | Single protein | Amiloride-sensitive cation channel 3 | Rattus norvegicus | Imax | = | 85.0 | % | PMID[28949138] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[17110105] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 795000.0 | nM | PMID[17110105] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition index | = | 0.505 | n.a. | DOI[10.1101/2020.04.03.023846] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 7.67 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Hit score | = | 0.05761 | n.a. | DOI[10.1101/2020.04.21.054387] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.04 | % | DOI[10.6019/CHEMBL4495565] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Potency | = | 14581.0 | nM | PubChem BioAssay data set |
| NPT29392 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/alpha-2/beta-2/gamma-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2984.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 21313.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.1 | n.a. | PMID[20804197] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 44.4 | nM | PMID[21802289] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3662.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 68.7 | % | PMID[21602044] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 53.0 | % | DOI[10.1007/s00044-011-9726-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 7.08 | mg.kg-1 | PMID[15013005] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 55.64 | % | PMID[17481895] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 23.9 | % | PMID[20804197] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 30.3 | % | PMID[20804197] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 29.5 | % | PMID[21602044] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 41.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 37700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 411.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 62.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 151.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 104.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 711.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 123.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 5.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1826.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 112.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 7.03 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 148.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 5.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 68500.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.52 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.98 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6960000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 44.65 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 136200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 9830.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 76.48 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 19.57 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 304700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.22 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.13 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 18.6 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1217170.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 42.17 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 419.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 66.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 166.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 103.17 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 663.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 148.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 5.8 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1968.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 118.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.47 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 148.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 5.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 67700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.35 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.43 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 44.35 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 139800.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 9450.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 80.83 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 20.1 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 315200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.72 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.37 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 14.05 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1298000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 40.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 35700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 328.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 61.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 133.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 104.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 710.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 116.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 6.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1703.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 116.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.3 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 150.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 3.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 63300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.63 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 7190000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 45.6 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 143700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 11000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 73.1 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 19.97 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 314700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.43 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.23 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 22.3 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1212330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 34.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 35000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 320.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 59.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 156.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 104.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 703.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 96.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 5.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1863.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 120.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.2 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 149.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 3.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 62700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.23 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.3 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6820000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 42.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 133700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 13000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 76.73 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 19.6 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 316700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 61.83 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.2 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 18.83 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1398330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 27.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 30700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 187.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 62.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 130.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 643.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 131.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 6.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1633.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 130.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.87 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 54300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 2.57 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 6560000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 40.9 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 127700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 9600.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 49.2 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 19.4 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 311300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.27 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 3.93 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 43.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1527000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 14.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 25300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 212.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 38.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 96.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 105.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 693.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 73.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 4.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1650.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 97.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.77 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 145.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 44700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 1.1 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.83 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 4370000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 27.87 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 85000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 20230.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 58.13 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 305000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.67 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 4.8 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 33.37 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1672670.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Mus musculus | Brain | Drug uptake | = | 43.06 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 126.87 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 339.85 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 720.99 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 1131.67 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 999.25 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 1344.34 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 41.47 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 122.64 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 250.88 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 612.98 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 597.82 | ng/g | PMID[21602044] |
| Mus musculus | Brain | Drug uptake | = | 1256.97 | ng/g | PMID[21602044] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC70940 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC70940 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD1089 | Phase 4 |
| 1.0 | High Similarity | NPD1090 | Phase 4 |
| 0.6585 | Remote Similarity | NPD1086 | Approved |
| 0.641 | Remote Similarity | NPD1693 | Phase 4 |
| 0.6061 | Remote Similarity | NPD1087 | Approved |
| 0.5938 | Remote Similarity | NPD1088 | Approved |
| 0.5882 | Remote Similarity | NPD800 | Phase 4 |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
