NPASS Compound

Natural Product: NPC535815

Natural Product ID	NPC535815
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	5-hydroxy-2-(4-hydroxy-3-methoxy-phenyl)-7-[(2~{S},3~{R},4~{S},5~{S},6~{S})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-3-[(2~{S},3~{R},4~{S},5~{S},6~{S})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxy-chromen-4-one
IUPAC Name	5-hydroxy-2-(4-hydroxy-3-methoxy-phenyl)-7-[(2~{S},3~{R},4~{S},5~{S},6~{S})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-3-[(2~{S},3~{R},4~{S},5~{S},6~{S})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-[[(2~{R},3~{R},4~{S},5~{S},6~{R})-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxy-chromen-4-one
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 119125 0 0 0 0 0 0 0 0999 V2000 -7.5662 -4.4213 -0.8402 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4422 -5.1197 -1.3987 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2740 -4.3939 -1.5610 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1903 -3.0741 -1.1914 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0193 -2.3238 -1.3506 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0262 -0.9036 -0.9847 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8934 -0.1557 -0.9436 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6026 -0.6129 -1.1969 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6715 -0.8897 -0.1908 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6201 -0.6783 -0.6291 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4925 -1.6690 -0.2713 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8481 -1.4027 -0.8506 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4228 -0.2051 -0.4542 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6884 -0.0342 -0.9448 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5935 0.0055 0.1263 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8754 0.3022 -0.3657 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8476 -0.1242 0.7185 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1588 0.0640 0.3859 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0627 -0.2918 1.3851 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8003 0.7769 1.7781 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8528 1.1641 1.0126 C 0 0 2 0 0 0 0 0 0 0 0 0 11.3904 1.7119 -0.3044 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5246 2.1181 -1.0498 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8655 0.0423 0.8219 C 0 0 1 0 0 0 0 0 0 0 0 0 14.1370 0.3715 1.2649 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3307 -1.2267 1.4654 C 0 0 2 0 0 0 0 0 0 0 0 0 13.1679 -2.2958 1.1616 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9051 -1.4782 1.0793 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4180 -2.6504 1.6773 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9171 1.7841 -0.5984 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0546 2.1712 -1.3156 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6649 2.2423 -1.2716 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8772 3.0069 -0.3655 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7969 1.1630 -1.8068 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3346 0.7651 -3.0548 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5148 -1.7126 1.2492 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5771 -0.4249 1.7865 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2005 -2.3224 1.6602 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3143 -3.6522 2.0581 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8445 -2.1777 0.5606 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1214 -2.2237 1.1500 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0005 1.1915 -0.6003 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9810 1.9324 -0.5525 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2302 1.7089 -0.3123 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3818 3.0569 0.0444 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2411 3.8319 0.0837 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6373 3.5480 0.3367 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7651 2.7451 0.2894 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9823 3.2719 0.5888 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2238 2.6473 0.6029 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1114 3.3611 -0.1904 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4310 3.2033 0.2263 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.3565 3.4776 -0.9512 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.6937 3.3310 -0.5772 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6927 1.7761 0.6953 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.3464 0.9437 -0.3911 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8850 1.4664 1.9176 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.6328 1.4075 3.0943 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8136 2.5498 2.0035 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8729 2.1196 2.9371 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5722 1.4446 -0.0621 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3312 0.8908 -0.3680 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2135 -0.3568 -0.6930 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9713 -2.9925 -1.8972 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0403 -4.3434 -2.2811 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1983 -5.0612 -2.1154 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3143 -6.3961 -2.4798 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4671 -5.0678 -0.8190 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3848 -4.0418 0.1639 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7133 -3.5520 -1.5538 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0477 -2.5527 -0.7497 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8790 -0.0978 0.6086 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1255 -2.6931 -0.5696 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6929 -1.3241 -1.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5396 -2.2638 -0.7320 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9278 -0.9500 -1.5418 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0639 -0.2744 -1.2741 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6121 0.5219 1.6142 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5859 -1.1496 0.9960 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3811 -0.6296 2.2408 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3853 1.9794 1.5421 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7112 2.5736 -0.2053 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8430 0.9387 -0.8955 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3376 2.0180 -2.0047 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9262 -0.1509 -0.2640 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1670 0.6356 2.2206 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3956 -1.0466 2.5790 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6781 -3.1650 1.2473 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8950 -1.6298 -0.0436 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6082 -2.3655 2.1876 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9943 2.3181 0.3855 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2141 3.1353 -1.2495 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9369 3.0042 -2.0612 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2195 3.5644 -0.8738 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8104 1.6324 -2.0536 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0765 1.4543 -3.7492 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3659 -2.2629 1.6560 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5363 -0.5420 2.7803 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2207 -1.7616 2.5454 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2313 -3.8497 2.8767 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7624 -3.0496 -0.1024 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3687 -1.3057 1.4222 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0626 4.4662 0.8783 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7165 4.6078 0.6132 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1887 1.6022 0.2078 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7254 3.9112 1.0339 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0789 2.8038 -1.8083 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2587 4.5123 -1.3238 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8462 3.3603 0.3818 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7832 1.6533 0.8379 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1397 0.5345 -0.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3382 0.5071 1.7497 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1176 0.8765 3.7486 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2093 3.5198 2.3619 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3826 1.3042 2.6027 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3970 0.7696 -0.1173 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0419 -2.5232 -2.0807 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1745 -4.8285 -2.7116 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1760 -7.1070 -1.7736 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 26 28 1 0 28 29 1 0 16 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 11 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 38 40 1 0 40 41 1 0 7 42 1 0 42 43 2 0 42 44 1 0 44 45 2 0 45 46 1 0 45 47 1 0 47 48 2 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 57 59 1 0 59 60 1 0 48 61 1 0 61 62 2 0 62 63 1 0 5 64 2 0 64 65 1 0 65 66 2 0 66 67 1 0 66 3 1 0 63 6 1 0 40 9 1 0 62 44 1 0 34 14 1 0 59 50 1 0 28 19 1 0 1 68 1 0 1 69 1 0 1 70 1 0 4 71 1 0 9 72 1 1 11 73 1 6 12 74 1 0 12 75 1 0 14 76 1 6 16 77 1 6 17 78 1 0 17 79 1 0 19 80 1 1 21 81 1 1 22 82 1 0 22 83 1 0 23 84 1 0 24 85 1 6 25 86 1 0 26 87 1 1 27 88 1 0 28 89 1 6 29 90 1 0 30 91 1 1 31 92 1 0 32 93 1 6 33 94 1 0 34 95 1 6 35 96 1 0 36 97 1 6 37 98 1 0 38 99 1 1 39100 1 0 40101 1 6 41102 1 0 46103 1 0 47104 1 0 50105 1 6 52106 1 1 53107 1 0 53108 1 0 54109 1 0 55110 1 1 56111 1 0 57112 1 6 58113 1 0 59114 1 1 60115 1 0 61116 1 0 64117 1 0 65118 1 0 67119 1 0 M END

Standard InCHIKey	LTMDRRVXDLERDM-AYPUAZDISA-N
Standard InCHI	InChI=1S/C40H52O27/c1-58-15-4-11(2-3-13(15)43)35-36(26(49)21-14(44)5-12(6-16(21)62-35)61-39-33(56)28(51)23(46)18(8-42)64-39)67-40-34(57)30(53)25(48)20(66-40)10-60-38-32(55)29(52)24(47)19(65-38)9-59-37-31(54)27(50)22(45)17(7-41)63-37/h2-6,17-20,22-25,27-34,37-48,50-57H,7-10H2,1H3/t17-,18+,19-,20+,22-,23-,24-,25-,27+,28+,29+,30+,31-,32-,33-,34-,37-,38-,39-,40+/m1/s1
SMILES	COC1=CC(C2=C(O[C@@H]3O[C@@H](CO[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C3=C(O)C=C(O[C@@H]4O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3O2)=CC=C1O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	964.27	Volume:	856.745 ? Van der Waals volume.
Dense:	1.126	LogP:	-1.807 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-0.352 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.234 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	42.0
TPSA:	436.96 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	16.0	Rings:	7.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.071	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.965	Fsp³:	0.625
MCE-18:	184.385 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.637	Fluc inhibitor:	0.313 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.673 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.635 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.241	Promiscuous compounds:	0.548

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.237	MDCK Permeability:	-4.714
Pgp-inhibitor:	0.0	Pgp-substrate:	0.882
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.998
20% Bioavailability (F20%):	0.041	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.002
Plasma Protein Binding (PPB):	67.534%	Volume Distribution (VD):	-0.243
Fu:	26.861% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.232
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.295

Half-life (T1/2):

6.201

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.008
Human Hepatotoxicity (H-HT):	0.617	Drug-induced Liver Injury (DILI):	0.988
AMES Toxicity:	0.987	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.087	Drug-induced Nephrotoxicity:	0.947
Genotoxicity:	0.441	RPMI-8226 Immunitoxicity:	0.247
A549 Cytotoxicity:	0.452	Hek293 Cytotoxicity:	0.152
BCF:	0.269 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.641 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.428 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.387 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	Fruits	n.a.	n.a.	PMID[11141122]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7395	Tribulus terrestris	Species	Zygophyllaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC535815 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24606
0.1-0.2	21205
0.2-0.3	2853
0.3-0.4	663
0.4-0.5	322
0.5-0.6	154
0.6-0.7	40
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7128	Intermediate Similarity	NPC186816
0.7113	Intermediate Similarity	NPC476472
0.7113	Intermediate Similarity	NPC294815
0.7113	Intermediate Similarity	NPC16194
0.6932	Remote Similarity	NPC297987
0.6932	Remote Similarity	NPC136042
0.6875	Remote Similarity	NPC488073
0.6854	Remote Similarity	NPC84362
0.6848	Remote Similarity	NPC203050
0.6848	Remote Similarity	NPC488072
0.6848	Remote Similarity	NPC225434
0.6796	Remote Similarity	NPC480441
0.6796	Remote Similarity	NPC25523
0.6739	Remote Similarity	NPC311830
0.6667	Remote Similarity	NPC156869
0.663	Remote Similarity	NPC101026
0.663	Remote Similarity	NPC488077
0.6629	Remote Similarity	NPC289667
0.6571	Remote Similarity	NPC277532
0.6559	Remote Similarity	NPC116458
0.6559	Remote Similarity	NPC246943
0.6559	Remote Similarity	NPC605784
0.6531	Remote Similarity	NPC153755
0.6489	Remote Similarity	NPC601586
0.6392	Remote Similarity	NPC275454
0.6364	Remote Similarity	NPC488079
0.6354	Remote Similarity	NPC251417
0.6346	Remote Similarity	NPC121703
0.63	Remote Similarity	NPC470443
0.6277	Remote Similarity	NPC601144
0.6211	Remote Similarity	NPC206123
0.6129	Remote Similarity	NPC46420
0.6129	Remote Similarity	NPC271692
0.6106	Remote Similarity	NPC192539
0.6095	Remote Similarity	NPC14187
0.6078	Remote Similarity	NPC209296
0.6061	Remote Similarity	NPC67105
0.604	Remote Similarity	NPC126784
0.604	Remote Similarity	NPC241423
0.604	Remote Similarity	NPC64425
0.6019	Remote Similarity	NPC142142
0.6019	Remote Similarity	NPC486577
0.6	Remote Similarity	NPC210073
0.6	Remote Similarity	NPC611303
0.5941	Remote Similarity	NPC479404
0.5941	Remote Similarity	NPC473571
0.5941	Remote Similarity	NPC110941
0.5929	Remote Similarity	NPC470720
0.5926	Remote Similarity	NPC219043
0.5922	Remote Similarity	NPC35119
0.5922	Remote Similarity	NPC473327
0.5914	Remote Similarity	NPC249281
0.59	Remote Similarity	NPC173582
0.59	Remote Similarity	NPC44931
0.59	Remote Similarity	NPC265885
0.59	Remote Similarity	NPC181465
0.59	Remote Similarity	NPC215710
0.59	Remote Similarity	NPC473438
0.59	Remote Similarity	NPC253788
0.5888	Remote Similarity	NPC89052
0.5882	Remote Similarity	NPC488074
0.5876	Remote Similarity	NPC223747
0.5872	Remote Similarity	NPC217520
0.5851	Remote Similarity	NPC277205
0.5851	Remote Similarity	NPC37919
0.5842	Remote Similarity	NPC22062
0.5842	Remote Similarity	NPC203259
0.5842	Remote Similarity	NPC479405
0.5842	Remote Similarity	NPC473634
0.5842	Remote Similarity	NPC33054
0.5842	Remote Similarity	NPC176740
0.5842	Remote Similarity	NPC471725
0.5842	Remote Similarity	NPC134532
0.5842	Remote Similarity	NPC138811
0.5842	Remote Similarity	NPC602582
0.5841	Remote Similarity	NPC470717
0.5833	Remote Similarity	NPC189564
0.5833	Remote Similarity	NPC488071
0.5816	Remote Similarity	NPC276377
0.5804	Remote Similarity	NPC295625
0.58	Remote Similarity	NPC471079
0.5789	Remote Similarity	NPC24043
0.5789	Remote Similarity	NPC488078
0.578	Remote Similarity	NPC292019
0.578	Remote Similarity	NPC202908
0.578	Remote Similarity	NPC173837
0.5773	Remote Similarity	NPC22832
0.5773	Remote Similarity	NPC486578
0.5769	Remote Similarity	NPC32641
0.5769	Remote Similarity	NPC256188
0.5766	Remote Similarity	NPC139571
0.5765	Remote Similarity	NPC78326
0.5743	Remote Similarity	NPC67326
0.5729	Remote Similarity	NPC42773
0.5729	Remote Similarity	NPC45522
0.5729	Remote Similarity	NPC325555
0.5729	Remote Similarity	NPC226304
0.5728	Remote Similarity	NPC240306
0.5702	Remote Similarity	NPC470719
0.5701	Remote Similarity	NPC135358
0.5686	Remote Similarity	NPC150164
0.5684	Remote Similarity	NPC158674
0.5684	Remote Similarity	NPC323593
0.5684	Remote Similarity	NPC203500
0.5684	Remote Similarity	NPC189142
0.5684	Remote Similarity	NPC77660
0.5673	Remote Similarity	NPC65711
0.5673	Remote Similarity	NPC479403
0.567	Remote Similarity	NPC285197
0.566	Remote Similarity	NPC473073
0.5625	Remote Similarity	NPC488080
0.5625	Remote Similarity	NPC169977
0.5612	Remote Similarity	NPC120099
0.5588	Remote Similarity	NPC227508
0.5586	Remote Similarity	NPC164704
0.5579	Remote Similarity	NPC39360
0.5579	Remote Similarity	NPC77672
0.5579	Remote Similarity	NPC133671
0.5579	Remote Similarity	NPC135391
0.5579	Remote Similarity	NPC29763
0.5579	Remote Similarity	NPC78263
0.5579	Remote Similarity	NPC210003
0.5579	Remote Similarity	NPC250069
0.5567	Remote Similarity	NPC472459
0.5556	Remote Similarity	NPC470446
0.5556	Remote Similarity	NPC602805
0.5534	Remote Similarity	NPC65563
0.5534	Remote Similarity	NPC470949
0.5521	Remote Similarity	NPC145038
0.5521	Remote Similarity	NPC56077
0.5521	Remote Similarity	NPC281131
0.5521	Remote Similarity	NPC95090
0.5521	Remote Similarity	NPC253662
0.5521	Remote Similarity	NPC179950
0.5521	Remote Similarity	NPC27408
0.5521	Remote Similarity	NPC88789
0.5521	Remote Similarity	NPC491374
0.5514	Remote Similarity	NPC195257
0.5514	Remote Similarity	NPC220173
0.549	Remote Similarity	NPC609888
0.5487	Remote Similarity	NPC470716
0.5472	Remote Similarity	NPC473623
0.5472	Remote Similarity	NPC606657
0.5464	Remote Similarity	NPC603655
0.5463	Remote Similarity	NPC470449
0.5455	Remote Similarity	NPC243930
0.5455	Remote Similarity	NPC203145
0.5455	Remote Similarity	NPC21666
0.5446	Remote Similarity	NPC470715
0.5444	Remote Similarity	NPC287780
0.5444	Remote Similarity	NPC60982
0.5437	Remote Similarity	NPC39834
0.5421	Remote Similarity	NPC488089
0.5408	Remote Similarity	NPC599850
0.54	Remote Similarity	NPC607707
0.5385	Remote Similarity	NPC102028
0.5361	Remote Similarity	NPC64305
0.5354	Remote Similarity	NPC60735
0.5354	Remote Similarity	NPC26230
0.5347	Remote Similarity	NPC469931
0.5345	Remote Similarity	NPC198199
0.534	Remote Similarity	NPC480466
0.5339	Remote Similarity	NPC209550
0.5333	Remote Similarity	NPC37074
0.5327	Remote Similarity	NPC229409
0.5327	Remote Similarity	NPC72016
0.5321	Remote Similarity	NPC292929
0.53	Remote Similarity	NPC609478
0.5294	Remote Similarity	NPC116864
0.5294	Remote Similarity	NPC244776
0.5283	Remote Similarity	NPC46202
0.5283	Remote Similarity	NPC64051
0.5273	Remote Similarity	NPC602448
0.5268	Remote Similarity	NPC473072
0.5258	Remote Similarity	NPC261866
0.5221	Remote Similarity	NPC48984
0.5221	Remote Similarity	NPC480796
0.5221	Remote Similarity	NPC472993
0.521	Remote Similarity	NPC120952
0.521	Remote Similarity	NPC138990
0.5204	Remote Similarity	NPC8573
0.52	Remote Similarity	NPC307938
0.5182	Remote Similarity	NPC101636
0.5182	Remote Similarity	NPC470445
0.5167	Remote Similarity	NPC175429
0.5149	Remote Similarity	NPC197285
0.513	Remote Similarity	NPC311850
0.512	Remote Similarity	NPC223860
0.5102	Remote Similarity	NPC19388
0.5102	Remote Similarity	NPC240431
0.5102	Remote Similarity	NPC55786
0.5094	Remote Similarity	NPC303913
0.5091	Remote Similarity	NPC470447
0.5091	Remote Similarity	NPC76831
0.5088	Remote Similarity	NPC477895
0.5086	Remote Similarity	NPC488083
0.5048	Remote Similarity	NPC29958
0.5048	Remote Similarity	NPC139320

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC535815 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6005
0.1-0.2	3086
0.2-0.3	48
0.3-0.4	5
0.4-0.5	2
0.5-0.6	1
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6768	Remote Similarity	NPD7251	Phase 2
0.6505	Remote Similarity	NPD7808	Phase 3
0.6078	Remote Similarity	NPD7054	Phase 4
0.5842	Remote Similarity	NPD6797	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data