NPASS Compound

Natural Product: NPC528552

Natural Product ID	NPC528552
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	6-[6-[6-[6-(5,7-dihydroxy-4-oxo-chromen-2-yl)-2,3-dihydroxy-phenyl]-5,7-dihydroxy-4-oxo-chromen-2-yl]-2,3-dihydroxy-phenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one
IUPAC Name	6-[6-[6-[6-(5,7-dihydroxy-4-oxo-chromen-2-yl)-2,3-dihydroxy-phenyl]-5,7-dihydroxy-4-oxo-chromen-2-yl]-2,3-dihydroxy-phenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chromen-4-one
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 89 97 0 0 0 0 0 0 0 0999 V2000 -5.7115 1.3415 2.1507 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7796 1.0756 0.9395 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9669 1.5855 -0.0229 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1064 1.2385 -1.3555 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2497 1.7740 -2.3839 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8257 2.5520 -3.3658 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0530 3.0941 -4.3680 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7040 2.8393 -4.3608 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9477 3.4104 -5.4007 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1200 2.0723 -3.3973 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7637 1.8614 -3.4567 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8790 1.5247 -2.3911 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3033 0.6980 -1.3502 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6138 -0.6443 -1.2992 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4733 -1.2304 -2.2382 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0451 -1.3904 -0.2866 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1935 -0.8068 0.6430 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6778 -1.5417 1.5823 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1476 -1.0783 2.5208 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6379 -2.0270 3.5006 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1726 -2.7242 4.3889 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3494 -3.6108 5.2999 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6978 -3.8524 5.3783 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2495 -4.7472 6.2944 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5217 -3.1664 4.5003 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8861 -3.3895 4.5560 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9852 -2.2643 3.5738 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8805 -1.5678 2.6617 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7380 -0.5940 3.1588 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6794 -0.3382 4.5278 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6036 0.0834 2.3278 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6709 -0.1621 0.9649 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5017 0.4925 0.1875 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6161 0.3094 -1.1070 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5787 1.0976 -1.8841 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3539 2.0385 -1.2406 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2759 2.8100 -1.9218 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4417 2.6517 -3.2803 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3537 3.3998 -4.0181 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6784 1.7165 -3.9486 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8497 1.5605 -5.3196 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7539 0.9496 -3.2384 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7933 -0.6448 -1.6654 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8891 -1.3712 -0.8803 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1402 -2.2404 -1.3877 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8191 -1.1291 0.4744 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9504 -1.8093 1.3054 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1030 -2.7796 0.7842 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4829 0.2480 2.5103 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0439 1.0548 1.5304 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2511 2.2698 1.5045 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8843 0.5260 0.5939 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4588 1.2828 -0.4306 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1242 2.6379 -0.4546 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0560 0.3928 -1.6733 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8666 -0.1302 -0.7988 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8482 -1.0167 -1.2016 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7185 -1.5828 -0.2923 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7047 -2.4802 -0.7377 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6220 -1.2681 1.0573 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6391 -0.3844 1.4403 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4882 -0.0251 2.7851 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7647 0.1860 0.5379 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1952 2.2728 0.2385 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9030 2.7344 -3.3394 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5192 3.7055 -5.1373 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0193 3.7425 -5.1332 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2169 1.9434 -4.3101 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1596 -1.8871 -1.9181 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2864 -2.4613 -0.2363 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2410 -2.5250 4.3206 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3093 -4.1282 5.9664 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5097 -4.4374 7.2212 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2662 -4.2015 4.0865 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3463 0.5972 4.8076 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2766 0.8517 2.7331 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2538 2.1977 -0.1612 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8917 3.5561 -1.4181 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3469 3.3413 -3.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5189 0.9149 -5.7189 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1734 0.2307 -3.7839 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8392 -0.8395 -2.7118 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3951 -2.5650 0.1147 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1420 0.6572 3.2519 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8812 3.3231 -0.3789 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8952 -1.2420 -2.2688 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6713 -2.1257 -0.7078 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2858 -1.6933 1.7917 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4507 -0.7394 3.5073 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 8 10 1 0 10 11 1 0 10 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 14 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 2 0 23 24 1 0 23 25 1 0 25 26 1 0 25 27 2 0 27 28 1 0 28 29 2 0 29 30 1 0 29 31 1 0 31 32 2 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 2 0 36 37 1 0 37 38 2 0 38 39 1 0 38 40 1 0 40 41 1 0 40 42 2 0 34 43 2 0 43 44 1 0 44 45 2 0 44 46 1 0 46 47 2 0 47 48 1 0 19 49 2 0 49 50 1 0 50 51 2 0 50 52 1 0 52 53 2 0 53 54 1 0 4 55 1 0 55 56 1 0 56 57 2 0 57 58 1 0 58 59 1 0 58 60 2 0 60 61 1 0 61 62 1 0 61 63 2 0 63 2 1 0 12 5 1 0 53 13 1 0 63 56 1 0 52 17 1 0 27 20 1 0 47 28 1 0 46 32 1 0 42 35 1 0 3 64 1 0 6 65 1 0 7 66 1 0 9 67 1 0 11 68 1 0 15 69 1 0 16 70 1 0 21 71 1 0 22 72 1 0 24 73 1 0 26 74 1 0 30 75 1 0 31 76 1 0 36 77 1 0 37 78 1 0 39 79 1 0 41 80 1 0 42 81 1 0 43 82 1 0 48 83 1 0 49 84 1 0 54 85 1 0 57 86 1 0 59 87 1 0 60 88 1 0 62 89 1 0 M END

Standard InCHIKey	CLGAJNQRFDJQID-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C45H26O18/c46-16-8-23(51)37-24(52)11-30(62-32(37)9-16)17-2-5-20(48)42(57)35(17)41-28(56)14-34-39(45(41)60)26(54)12-31(63-34)18-3-6-21(49)43(58)36(18)40-27(55)13-33-38(44(40)59)25(53)10-29(61-33)15-1-4-19(47)22(50)7-15/h1-14,46-51,55-60H
SMILES	O=C1C=C(C2=CC=C(O)C(O)=C2C2=C(O)C=C3OC(C4=CC=C(O)C(O)=C4C4=C(O)C=C5OC(C6=CC=C(O)C(O)=C6)=CC(=O)C5=C4O)=CC(=O)C3=C2O)OC2=CC(O)=CC(O)=C12

Calculated Properties

Physi-Chem Properties

Molecular Weight:	854.11	Volume:	804.817 ? Van der Waals volume.
Dense:	1.061	LogP:	3.457 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.708 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.678 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	54.0
TPSA:	333.39 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.079	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	3.814	Fsp³:	0.0
MCE-18:	58.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.995	Fluc inhibitor:	0.662 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.439 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.946 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.772	Promiscuous compounds:	0.917

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.489	MDCK Permeability:	-4.929
Pgp-inhibitor:	0.0	Pgp-substrate:	0.058
PAMPA:	0.955 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.473	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.999
Plasma Protein Binding (PPB):	96.672%	Volume Distribution (VD):	-0.63
Fu:	2.096% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.984
OATP1B3 inhibitor:	0.997	BCRP inhibitor:	0.772
BSEP inhibitor:	0.09

ADMET: Metabolism

CYP1A2-inhibitor:	0.048	CYP1A2-substrate:	0.001
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.01	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	1.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.411
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.955 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.299

Half-life (T1/2):

3.649

ADMET: Toxicity

hERG Blockers:	0.015	hERG Blockers (10um):	0.562
Human Hepatotoxicity (H-HT):	0.273	Drug-induced Liver Injury (DILI):	0.983
AMES Toxicity:	0.798	Rat Oral Acute Toxicity:	0.809
Maximum Recommended Daily Dose:	0.999	Skin Sensitization:	0.991
Carcinogencity:	0.512	Eye Corrosion:	0.0
Eye Irritation:	0.997	Respiratory Toxicity:	0.953
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.068
Hematotoxicity:	0.002	Drug-induced Nephrotoxicity:	0.001
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.106
A549 Cytotoxicity:	0.998	Hek293 Cytotoxicity:	0.997
BCF:	0.863 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.494 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.867 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.716 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO61111	Rhizogonium distichum	Species	Rhizogoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC528552 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	39841
0.1-0.2	8322
0.2-0.3	1094
0.3-0.4	514
0.4-0.5	67
0.5-0.6	16
0.6-0.7	2
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7353	Intermediate Similarity	NPC603692
0.7	Intermediate Similarity	NPC279121
0.6286	Remote Similarity	NPC111112
0.6164	Remote Similarity	NPC610480
0.5873	Remote Similarity	NPC50898
0.5857	Remote Similarity	NPC67322
0.5811	Remote Similarity	NPC254351
0.5781	Remote Similarity	NPC175013
0.5641	Remote Similarity	NPC72425
0.5522	Remote Similarity	NPC610974
0.5385	Remote Similarity	NPC78540
0.5224	Remote Similarity	NPC274121
0.52	Remote Similarity	NPC138299
0.5147	Remote Similarity	NPC213216
0.5143	Remote Similarity	NPC231772
0.5139	Remote Similarity	NPC52005
0.5075	Remote Similarity	NPC275772
0.5075	Remote Similarity	NPC20791
0.5068	Remote Similarity	NPC183950
0.5063	Remote Similarity	NPC259757

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC528552 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8008
0.1-0.2	1111
0.2-0.3	26
0.3-0.4	3
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7	Intermediate Similarity	NPD1511	Phase 2
0.5075	Remote Similarity	NPD1512	Phase 3

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data