NPASS Compound

Natural Product: NPC487500

Natural Product ID	NPC487500
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HCCLIXKAUVSKHJ-GDNUTRCRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000334] Flavonoids [CHEMONTID:0001111] Flavonoid glycosides [CHEMONTID:0001583] Flavonoid O-glycosides [CHEMONTID:0003531] Flavonoid-3-O-glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 115121 0 0 0 0 0 0 0 0999 V2000 -7.6607 -4.4730 1.4248 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7088 -4.5356 0.2751 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2555 -5.5308 -0.7498 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3092 -5.6259 -1.9244 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1940 -4.6384 -1.7157 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7833 -3.2438 -1.4588 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7397 -2.4416 -1.1765 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5914 -1.2936 -1.9054 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2870 -0.6319 -1.4044 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4315 -0.6137 0.1111 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0676 -0.3434 0.6857 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3643 0.5971 -0.2965 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3476 1.4211 -1.0788 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0325 0.5312 -2.0096 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2680 1.9366 -0.2093 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9839 2.9213 0.2556 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3497 2.9159 -0.2169 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7571 2.0685 -1.0248 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2186 3.8808 0.2468 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5132 4.0326 -0.0320 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5020 4.8747 0.3340 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8683 5.9036 1.3514 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6289 5.7273 1.5960 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6924 4.7994 1.1500 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4924 4.7696 1.5219 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5451 3.8946 1.1525 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2611 4.1107 1.7474 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1476 4.7175 2.9914 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9951 5.1255 3.5615 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2602 4.9446 2.8586 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1139 4.3641 1.6781 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0328 3.9341 1.0758 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3568 4.1554 0.9475 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3646 5.4030 3.5164 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8567 6.7562 1.7196 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0157 3.0067 -0.9855 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5391 -0.2652 -1.0447 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7989 0.0333 -0.8921 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4167 -0.7919 0.2959 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8062 -0.9699 -0.2267 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4880 -2.2266 0.4050 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7818 -2.1569 0.1546 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8890 -2.0974 -0.5023 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7644 -2.1703 -1.7829 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2408 -1.9250 0.0825 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2193 -1.6517 -0.7135 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6189 -1.3882 -0.6096 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6537 -1.8391 0.0763 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8650 -1.2037 0.2909 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0242 0.1530 -0.3315 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9789 0.6435 -1.0405 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8884 -0.0628 -1.1715 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1354 1.9920 -1.6379 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1527 2.5050 -2.3828 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2609 0.6776 -0.0802 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8692 -1.6254 0.9339 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9243 -2.0916 1.6212 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6284 -1.0460 -1.6843 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5570 -0.1843 -1.9608 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5111 0.1599 0.2605 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4162 0.1161 1.3946 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0538 0.0721 1.9832 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7905 -1.8981 0.5341 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6216 -3.2790 -0.3056 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4874 -4.5018 -2.9322 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9850 -5.3458 -3.0929 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3179 -6.7590 -0.1088 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3089 -3.5926 1.4618 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3430 -5.3924 1.3922 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1334 -4.5641 2.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7274 -4.8976 0.6622 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2595 -5.1994 -1.0740 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8227 -6.6300 -2.0070 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5107 -4.9533 -0.9229 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4382 -2.9930 -2.2801 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3964 -0.5705 -1.5822 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5912 -1.3677 -2.9881 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4874 -1.4003 -1.6204 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2165 0.0414 0.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5118 -1.3237 0.6838 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7025 1.2522 0.2549 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8542 2.1455 -1.6827 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4461 4.9877 0.1340 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1415 6.4450 2.3276 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0757 4.8594 3.5598 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9025 5.5758 4.5229 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0971 3.5104 0.1058 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2939 4.0332 -0.0739 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2404 6.1812 4.2054 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7429 7.7169 1.8983 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9948 2.0980 -0.4625 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8259 1.0880 -0.5156 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9357 -1.7264 0.4684 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2477 -2.0833 1.5203 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9474 -3.0884 0.0593 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3998 -2.0412 1.1327 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8726 -1.6484 -1.8179 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5390 -2.8511 0.5223 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0578 0.3312 -1.7533 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6926 3.3489 -1.6369 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2565 1.8693 -2.4312 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3002 3.0129 -3.3315 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0234 0.1667 -0.6089 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7384 -2.4957 0.9622 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6775 -2.8282 2.4040 H 0 0 0 0 0 0 0 0 0 0 0 0 14.3268 -1.1720 2.2198 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3295 -2.1038 -1.9546 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4946 -0.7061 -2.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4828 -0.0436 0.1958 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8244 0.9755 1.0454 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2489 -0.2719 2.4707 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3775 -2.2047 1.3553 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9999 -3.6297 -2.9837 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5080 -4.6412 -3.6205 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9558 -7.5120 -0.6459 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 31 33 1 0 30 34 1 0 22 35 1 0 20 36 1 0 12 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 45 46 2 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 50 51 1 0 51 52 2 0 51 53 1 0 53 54 1 0 50 55 1 0 49 56 1 0 56 57 1 0 40 58 1 0 58 59 1 0 40 60 1 6 39 61 1 0 11 62 1 0 10 63 1 0 6 64 1 0 5 65 1 0 4 66 1 0 3 67 1 0 64 2 1 0 14 9 1 0 26 16 2 0 32 27 1 0 59 38 1 0 24 19 1 0 52 47 1 0 1 68 1 0 1 69 1 0 1 70 1 0 2 71 1 1 3 72 1 6 4 73 1 6 5 74 1 1 6 75 1 6 8 76 1 0 8 77 1 0 9 78 1 1 10 79 1 6 11 80 1 1 12 81 1 1 13 82 1 6 21 83 1 0 23 84 1 0 28 85 1 0 29 86 1 0 32 87 1 0 33 88 1 0 34 89 1 0 35 90 1 0 36 91 1 0 38 92 1 1 39 93 1 1 41 94 1 0 41 95 1 0 45 96 1 0 46 97 1 0 48 98 1 0 52 99 1 0 54100 1 0 54101 1 0 54102 1 0 55103 1 0 57104 1 0 57105 1 0 57106 1 0 58107 1 0 58108 1 0 60109 1 0 61110 1 0 62111 1 0 63112 1 0 65113 1 0 66114 1 0 67115 1 0 M END

Standard InCHIKey	HCCLIXKAUVSKHJ-GDNUTRCRSA-N
Standard InCHI	InChI=1S/C43H48O24/c1-16-29(49)33(53)35(55)40(63-16)60-13-26-31(51)34(54)38(67-42-39(56)43(57,15-62-42)14-61-27(48)7-4-17-8-24(58-2)30(50)25(9-17)59-3)41(65-26)66-37-32(52)28-22(47)11-19(44)12-23(28)64-36(37)18-5-6-20(45)21(46)10-18/h4-12,16,26,29,31,33-35,38-42,44-47,49-51,53-57H,13-15H2,1-3H3/b7-4+/t16-,26+,29-,31+,33+,34-,35+,38+,39-,40+,41-,42-,43+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc2c(=O)c3c(cc(cc3oc2c2ccc(c(c2)O)O)O)O)O[C@H]2[C@@H]([C@@](COC(=O)/C=C/c3cc(c(c(c3)OC)O)OC)(CO2)O)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	948.25	Volume:	869.08 ? Van der Waals volume.
Dense:	1.091	LogP:	0.794 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.054 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.084 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	43.0
TPSA:	373.11 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	12.0	Rings:	7.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.04	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.829	Fsp³:	0.442
MCE-18:	176.032 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.686	Fluc inhibitor:	0.519 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.758 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.666 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.096	Promiscuous compounds:	0.511

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.255	MDCK Permeability:	-5.469
Pgp-inhibitor:	0.0	Pgp-substrate:	0.844
PAMPA:	0.997 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.334
20% Bioavailability (F20%):	0.748	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.265
Plasma Protein Binding (PPB):	85.639%	Volume Distribution (VD):	-0.14
Fu:	11.998% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.971
BSEP inhibitor:	0.043

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.025
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.551
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.829 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.956

Half-life (T1/2):

5.557

ADMET: Toxicity

hERG Blockers:	0.016	hERG Blockers (10um):	0.226
Human Hepatotoxicity (H-HT):	0.354	Drug-induced Liver Injury (DILI):	0.911
AMES Toxicity:	0.826	Rat Oral Acute Toxicity:	0.005
Maximum Recommended Daily Dose:	0.095	Skin Sensitization:	1.0
Carcinogencity:	0.02	Eye Corrosion:	0.0
Eye Irritation:	0.043	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.983
Hematotoxicity:	0.023	Drug-induced Nephrotoxicity:	0.414
Genotoxicity:	0.841	RPMI-8226 Immunitoxicity:	0.194
A549 Cytotoxicity:	0.861	Hek293 Cytotoxicity:	0.696
BCF:	0.57 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.363 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.015 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.273 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO41013	Polygala flavescens ssp. flavescens	Strain	Polygalaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28692289]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT644	Individual protein	L-lactate dehydrogenase A chain	Homo sapiens	IC50	>	500000.0	nM	PMID[28692289]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC487500 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17738
0.1-0.2	28525
0.2-0.3	2877
0.3-0.4	397
0.4-0.5	199
0.5-0.6	84
0.6-0.7	26
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9217	High Similarity	NPC487501
0.8783	High Similarity	NPC487502
0.8051	Intermediate Similarity	NPC473554
0.7521	Intermediate Similarity	NPC487499
0.7304	Intermediate Similarity	NPC303694
0.7227	Intermediate Similarity	NPC162394
0.7117	Intermediate Similarity	NPC122467
0.6842	Remote Similarity	NPC89127
0.6752	Remote Similarity	NPC89052
0.6746	Remote Similarity	NPC21359
0.6746	Remote Similarity	NPC460984
0.6579	Remote Similarity	NPC12013
0.6579	Remote Similarity	NPC11432
0.6579	Remote Similarity	NPC477613
0.65	Remote Similarity	NPC173837
0.6496	Remote Similarity	NPC221342
0.6496	Remote Similarity	NPC476470
0.6303	Remote Similarity	NPC602448
0.6279	Remote Similarity	NPC25946
0.626	Remote Similarity	NPC275977
0.622	Remote Similarity	NPC480444
0.6194	Remote Similarity	NPC249560
0.6172	Remote Similarity	NPC241781
0.6165	Remote Similarity	NPC72554
0.6106	Remote Similarity	NPC95866
0.6045	Remote Similarity	NPC30011
0.6034	Remote Similarity	NPC203259
0.6034	Remote Similarity	NPC33054
0.6034	Remote Similarity	NPC176740
0.6034	Remote Similarity	NPC471725
0.6034	Remote Similarity	NPC134532
0.6034	Remote Similarity	NPC602582
0.6	Remote Similarity	NPC192539
0.5985	Remote Similarity	NPC97817
0.5966	Remote Similarity	NPC473327
0.5897	Remote Similarity	NPC155877
0.5891	Remote Similarity	NPC156785
0.582	Remote Similarity	NPC292929
0.5814	Remote Similarity	NPC480445
0.5785	Remote Similarity	NPC142142
0.5772	Remote Similarity	NPC223426
0.5772	Remote Similarity	NPC218161
0.5769	Remote Similarity	NPC488740
0.5769	Remote Similarity	NPC488736
0.5769	Remote Similarity	NPC488733
0.5738	Remote Similarity	NPC476472
0.5738	Remote Similarity	NPC294815
0.5738	Remote Similarity	NPC16194
0.5726	Remote Similarity	NPC81042
0.5682	Remote Similarity	NPC488737
0.5662	Remote Similarity	NPC231787
0.5635	Remote Similarity	NPC488075
0.561	Remote Similarity	NPC220173
0.5603	Remote Similarity	NPC476215
0.5583	Remote Similarity	NPC255157
0.5583	Remote Similarity	NPC259896
0.5547	Remote Similarity	NPC480441
0.5546	Remote Similarity	NPC173582
0.5546	Remote Similarity	NPC265885
0.5546	Remote Similarity	NPC181465
0.5546	Remote Similarity	NPC215710
0.5546	Remote Similarity	NPC473438
0.5546	Remote Similarity	NPC253788
0.5528	Remote Similarity	NPC97119
0.5517	Remote Similarity	NPC33083
0.5481	Remote Similarity	NPC480442
0.5481	Remote Similarity	NPC480472
0.5462	Remote Similarity	NPC139571
0.5426	Remote Similarity	NPC217520
0.5424	Remote Similarity	NPC254855
0.5424	Remote Similarity	NPC94610
0.5417	Remote Similarity	NPC67326
0.5417	Remote Similarity	NPC39834
0.5417	Remote Similarity	NPC163242
0.5417	Remote Similarity	NPC272068
0.5414	Remote Similarity	NPC474522
0.541	Remote Similarity	NPC126784
0.541	Remote Similarity	NPC241423
0.5379	Remote Similarity	NPC488734
0.5379	Remote Similarity	NPC488735
0.5379	Remote Similarity	NPC488739
0.5379	Remote Similarity	NPC488732
0.5379	Remote Similarity	NPC488738
0.5372	Remote Similarity	NPC156869
0.536	Remote Similarity	NPC85751
0.536	Remote Similarity	NPC19240
0.5354	Remote Similarity	NPC214621
0.5354	Remote Similarity	NPC34267
0.5349	Remote Similarity	NPC477895
0.5328	Remote Similarity	NPC35167
0.5294	Remote Similarity	NPC116864
0.5294	Remote Similarity	NPC244776
0.5242	Remote Similarity	NPC245452
0.5224	Remote Similarity	NPC470713
0.5221	Remote Similarity	NPC209550
0.5191	Remote Similarity	NPC25523
0.5159	Remote Similarity	NPC603079
0.513	Remote Similarity	NPC127546
0.513	Remote Similarity	NPC57625
0.513	Remote Similarity	NPC173637
0.513	Remote Similarity	NPC317489
0.513	Remote Similarity	NPC223424
0.513	Remote Similarity	NPC600591
0.5122	Remote Similarity	NPC304741
0.512	Remote Similarity	NPC470443
0.5118	Remote Similarity	NPC471669
0.5116	Remote Similarity	NPC483765
0.5115	Remote Similarity	NPC292019
0.5115	Remote Similarity	NPC202908
0.5113	Remote Similarity	NPC470718
0.5108	Remote Similarity	NPC199172
0.5085	Remote Similarity	NPC219904
0.5079	Remote Similarity	NPC37668
0.5072	Remote Similarity	NPC480443
0.504	Remote Similarity	NPC153755
0.5037	Remote Similarity	NPC474093
0.5037	Remote Similarity	NPC104910

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC487500 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5362
0.1-0.2	3744
0.2-0.3	36
0.3-0.4	4
0.4-0.5	3
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6034	Remote Similarity	NPD6797	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data