NPASS Compound

Natural Product: NPC483160

Natural Product ID	NPC483160
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	WLSLCZJALFPBET-PKZQQIFTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000334] Flavonoids [CHEMONTID:0001586] Biflavonoids and polyflavonoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 101109 0 0 0 0 0 0 0 0999 V2000 9.2320 3.4724 -0.5203 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6046 2.0823 -0.4337 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6766 1.1047 0.0454 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9668 0.0333 0.8523 C 0 0 2 0 0 0 0 0 0 0 0 0 7.6240 -0.2501 0.1899 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7653 0.9923 0.3577 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9990 1.2988 -0.7386 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6642 1.4811 -0.5217 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0336 0.1823 -0.0134 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0641 -0.8409 -1.1512 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7345 -2.1762 -0.4988 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7697 -1.9449 0.6585 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9363 -0.7346 0.4530 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6973 0.4298 0.2294 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9203 -0.8227 -0.5358 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3356 -0.2584 -0.3325 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4445 1.1114 -0.6474 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5271 1.7637 -1.0887 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6710 1.6906 -0.4445 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8390 3.0180 -0.7292 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0575 3.6161 -0.5309 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0963 2.8544 -0.0434 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9748 1.5165 0.2569 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7400 0.9312 0.0512 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6002 -0.3095 0.3226 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4086 -0.9296 0.1379 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3513 -2.3447 0.4710 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3188 -2.9152 1.2956 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3452 -4.2775 1.5646 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3962 -5.1095 1.0113 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4439 -4.5682 0.2033 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4403 -3.2031 -0.0502 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3879 -6.4845 1.2575 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1545 0.7667 0.7830 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8327 1.5196 1.8802 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2324 1.9321 2.8993 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2577 1.7835 1.7525 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8634 2.8742 2.3422 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2162 3.0838 2.1942 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9551 2.1912 1.4505 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3369 1.0991 0.8625 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9831 0.8746 1.0011 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3127 -0.1830 0.4476 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9780 -0.0454 0.0483 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6789 -0.6696 -1.2476 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1160 -1.9227 -1.2895 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8122 -2.5660 -2.4904 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0769 -1.9424 -3.6904 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6421 -0.6843 -3.6440 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9423 -0.0484 -2.4589 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7794 -2.5715 -4.9022 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0147 -0.5647 1.0703 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3192 2.3840 1.2890 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0400 3.7357 3.0837 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3584 3.4422 0.1697 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7334 3.7273 -1.2228 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5025 -1.8658 1.8752 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2538 -3.0740 -1.4174 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2260 -0.8416 -1.8680 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6306 2.1071 0.5361 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0381 -1.3508 0.8111 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6866 0.4622 2.1500 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3489 0.5632 -1.0302 O 0 0 0 0 0 0 0 0 0 0 0 0 10.2186 3.4192 -1.0032 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3314 3.9167 0.4949 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5710 4.1175 -1.1288 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2446 1.8288 -1.4396 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3213 1.6641 0.7406 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5882 -0.8828 0.9171 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7903 -0.5027 -0.8597 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2235 0.9196 1.3169 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5539 2.2309 0.2931 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1248 1.8768 -1.3848 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5916 -0.1233 0.8655 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2369 -0.5797 -1.8283 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6757 -2.5584 -0.0627 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1605 -2.8373 0.7769 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4043 -0.4963 1.4152 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1997 4.6561 -0.7512 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0577 -2.2663 1.7367 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0954 -4.7135 2.2023 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3066 -5.2127 -0.2366 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3473 -2.8890 -0.7250 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9777 -7.1097 0.5676 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6963 3.9332 2.6522 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9162 0.3973 0.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8792 -2.4762 -0.3732 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3691 -3.5534 -2.4681 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8541 -0.1861 -4.5813 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3877 0.9415 -2.4054 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5815 -3.0362 -5.3566 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8836 1.9105 0.6213 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9888 3.5514 4.0883 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0952 3.3442 -0.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3442 4.5300 -0.7644 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8214 -1.5670 2.5555 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8140 -3.8400 -0.9977 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6186 -1.7400 -2.0246 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4971 -2.1488 0.4926 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2027 1.2758 2.3637 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2671 -0.4198 -0.9844 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 30 33 1 0 34 23 1 6 34 35 1 0 35 36 2 0 35 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 1 0 44 45 1 6 45 46 2 0 46 47 1 0 47 48 2 0 48 49 1 0 49 50 2 0 48 51 1 0 44 52 1 0 40 53 1 0 38 54 1 0 22 55 1 0 20 56 1 0 12 57 1 0 11 58 1 0 10 59 1 0 6 60 1 0 5 61 1 0 4 62 1 0 3 63 1 0 60 2 1 0 14 9 1 0 26 16 2 0 32 27 1 0 44 34 1 0 50 45 1 0 24 19 1 0 52 34 1 0 42 37 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 6 3 68 1 1 4 69 1 1 5 70 1 6 6 71 1 1 8 72 1 0 8 73 1 0 9 74 1 1 10 75 1 6 11 76 1 1 12 77 1 1 13 78 1 1 21 79 1 0 28 80 1 0 29 81 1 0 31 82 1 0 32 83 1 0 33 84 1 0 39 85 1 0 41 86 1 0 46 87 1 0 47 88 1 0 49 89 1 0 50 90 1 0 51 91 1 0 53 92 1 0 54 93 1 0 55 94 1 0 56 95 1 0 57 96 1 0 58 97 1 0 59 98 1 0 61 99 1 0 62100 1 0 63101 1 0 M END

Standard InCHIKey	WLSLCZJALFPBET-PKZQQIFTSA-N
Standard InCHI	InChI=1S/C42H38O21/c1-14-28(49)31(52)33(54)39(58-14)57-13-24-29(50)32(53)34(55)40(59-24)61-37-30(51)26-21(47)12-22(48)27(36(26)60-35(37)15-2-6-17(43)7-3-15)41-38(56)25-20(46)10-19(45)11-23(25)62-42(41,63-41)16-4-8-18(44)9-5-16/h2-12,14,24,28-29,31-34,39-40,43-50,52-55H,13H2,1H3/t14-,24+,28-,29+,31+,32-,33+,34+,39+,40-,41+,42+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc2c(=O)c3c(cc(c(c3oc2c2ccc(cc2)O)[C@@]23C(=O)c4c(cc(cc4O[C@]2(c2ccc(cc2)O)O3)O)O)O)O)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	878.19	Volume:	803.028 ? Van der Waals volume.
Dense:	1.094	LogP:	1.03 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.16 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.168 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	50.0
TPSA:	348.72 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	12.0	Rings:	9.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.092	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.817	Fsp³:	0.333
MCE-18:	205.714 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.799	Fluc inhibitor:	0.24 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.861 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.76 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.279	Promiscuous compounds:	0.26

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.7	MDCK Permeability:	-4.839
Pgp-inhibitor:	0.0	Pgp-substrate:	0.975
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.104	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.033
Plasma Protein Binding (PPB):	85.955%	Volume Distribution (VD):	-0.011
Fu:	11.061% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.873
BSEP inhibitor:	0.027

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.042
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.085 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.933

Half-life (T1/2):

5.825

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.151
Human Hepatotoxicity (H-HT):	0.755	Drug-induced Liver Injury (DILI):	0.765
AMES Toxicity:	0.753	Rat Oral Acute Toxicity:	0.099
Maximum Recommended Daily Dose:	0.227	Skin Sensitization:	0.995
Carcinogencity:	0.043	Eye Corrosion:	0.0
Eye Irritation:	0.225	Respiratory Toxicity:	0.013
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.916
Hematotoxicity:	0.01	Drug-induced Nephrotoxicity:	0.474
Genotoxicity:	0.965	RPMI-8226 Immunitoxicity:	0.29
A549 Cytotoxicity:	0.834	Hek293 Cytotoxicity:	0.97
BCF:	0.814 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.678 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.989 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.43 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	aerial part	n.a.	PMID[12033510]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28165740]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	Pericarp	n.a.	n.a.	PMID[9748380]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO11196	Impatiens balsamina	Species	Balsaminaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	3
IC50	5

Activity Type	# Activity
Cell line	8

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT76	Cell line	C6	Rattus norvegicus	Activity	=	109.14	%	PMID[28165740]
NPT81	Cell line	A549	Homo sapiens	IC50	>	10000.0	nM	PMID[28165740]
NPT146	Cell line	SK-OV-3	Homo sapiens	IC50	>	10000.0	nM	PMID[28165740]
NPT147	Cell line	SK-MEL-2	Homo sapiens	IC50	>	10000.0	nM	PMID[28165740]
NPT34	Cell line	BV-2	Mus musculus	Activity	=	100.29	%	PMID[28165740]
NPT34	Cell line	BV-2	Mus musculus	IC50	=	31020.0	nM	PMID[28165740]
NPT76	Cell line	C6	Rattus norvegicus	Activity	=	74.27	%	PMID[28165740]
NPT457	Cell line	BT-549	Homo sapiens	IC50	>	10000.0	nM	PMID[28165740]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC483160 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19208
0.1-0.2	27511
0.2-0.3	2511
0.3-0.4	434
0.4-0.5	157
0.5-0.6	26
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC483159
0.789	Intermediate Similarity	NPC483158
0.789	Intermediate Similarity	NPC483157
0.6036	Remote Similarity	NPC173582
0.6036	Remote Similarity	NPC265885
0.6036	Remote Similarity	NPC181465
0.6036	Remote Similarity	NPC215710
0.6036	Remote Similarity	NPC473438
0.6036	Remote Similarity	NPC253788
0.5789	Remote Similarity	NPC186816
0.5652	Remote Similarity	NPC473571
0.5652	Remote Similarity	NPC110941
0.5565	Remote Similarity	NPC203259
0.5565	Remote Similarity	NPC65563
0.5565	Remote Similarity	NPC33054
0.5565	Remote Similarity	NPC470949
0.5565	Remote Similarity	NPC176740
0.5565	Remote Similarity	NPC471725
0.5565	Remote Similarity	NPC134532
0.5565	Remote Similarity	NPC602582
0.5289	Remote Similarity	NPC476472
0.5289	Remote Similarity	NPC294815
0.5289	Remote Similarity	NPC16194
0.5259	Remote Similarity	NPC471079
0.525	Remote Similarity	NPC473327
0.5214	Remote Similarity	NPC39834
0.513	Remote Similarity	NPC66087
0.5126	Remote Similarity	NPC129264
0.5085	Remote Similarity	NPC44931
0.5083	Remote Similarity	NPC126784
0.5083	Remote Similarity	NPC241423
0.5079	Remote Similarity	NPC189564
0.5041	Remote Similarity	NPC12013
0.5041	Remote Similarity	NPC11432
0.5041	Remote Similarity	NPC477613

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483160 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5086
0.1-0.2	4007
0.2-0.3	50
0.3-0.4	2
0.4-0.5	3
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5565	Remote Similarity	NPD6797	Phase 2
0.5041	Remote Similarity	NPD7251	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data