NPASS Compound

Natural Product: NPC483080

Natural Product ID	NPC483080
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NPIGXIDNKYVGRB-PBZDJEQUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	134147125
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 86 0 0 0 0 0 0 0 0999 V2000 -2.2197 -4.1053 -1.7747 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3284 -3.0990 -1.7535 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5509 -3.7536 -1.1445 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0088 -1.8711 -0.9174 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7961 -1.1577 -1.4401 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4028 0.0450 -0.7226 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9597 0.0180 0.7097 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9002 -0.5154 1.7118 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8377 1.5334 1.0594 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2306 2.1589 1.1638 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0324 3.6172 1.5168 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4822 4.5650 0.7038 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1801 4.2024 -0.5524 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2861 5.9840 1.0534 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1734 1.7814 2.3459 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9591 0.9150 2.7518 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1923 0.9270 4.2266 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1674 1.4361 2.0020 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0680 2.0357 2.5869 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1690 1.1697 0.5546 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4354 0.1954 0.0476 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4219 -0.5784 0.8166 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4839 -2.0167 0.5078 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4581 -2.7370 0.7268 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6703 -2.6886 -0.0858 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4009 -4.1620 -0.2900 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8217 -2.5883 0.8762 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7886 -0.4743 2.2632 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9345 -1.4193 2.9813 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7977 0.0589 -1.2852 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6423 1.0916 -1.7227 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9194 1.8735 -0.4997 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8808 0.5537 -2.3989 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6592 -0.3910 -1.5647 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4463 -0.1455 -3.6680 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6337 1.6624 -2.7883 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0272 -4.4601 -0.7252 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6417 -5.0108 -2.3029 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3110 -3.7700 -2.2776 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5207 -2.8081 -2.8188 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3026 -3.9560 -0.0782 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7884 -4.7243 -1.6132 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4284 -3.0589 -1.1513 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8677 -1.1512 -1.0756 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0172 -2.1488 0.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9625 -1.8423 -1.7301 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1416 -0.7987 -2.4845 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4845 0.4681 -1.2732 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1638 0.8448 -0.9484 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9784 -0.2430 1.4951 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7374 0.0682 2.6843 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8055 -1.5493 2.0302 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3519 2.0653 0.2097 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8267 1.7342 1.9674 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7914 2.1142 0.2294 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5182 3.8329 2.4445 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5242 5.1015 -1.0753 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5566 3.6010 -1.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1128 3.6078 -0.3269 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9066 6.5235 0.1594 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3074 6.4184 1.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6358 6.1141 1.9386 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2506 2.8382 2.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9213 1.8236 3.1758 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7669 -0.0265 4.6478 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7006 1.7545 4.7453 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2829 0.8665 4.4216 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9207 -2.2875 -1.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5497 -4.5168 0.3364 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3311 -4.7664 -0.0889 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1161 -4.3989 -1.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6084 -3.1837 1.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9461 -1.5373 1.1746 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7875 -2.8898 0.4005 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0819 1.7019 -2.4938 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9954 1.9899 -0.2591 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5535 2.9148 -0.6595 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2275 -0.4669 -0.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6071 -1.4035 -2.0066 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7308 -0.1384 -1.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7781 0.3784 -4.5849 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8729 -1.1897 -3.7111 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3453 -0.2354 -3.7474 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5332 1.6796 -2.3846 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 7 6 1 6 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 3 12 13 1 0 12 14 1 0 9 15 1 0 15 16 1 0 16 17 1 1 16 18 1 0 18 19 2 0 18 20 1 0 20 21 2 0 21 22 1 0 22 23 1 6 23 24 2 0 23 25 1 0 25 26 1 0 25 27 1 0 22 28 1 0 28 29 2 0 21 30 1 0 30 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 33 35 1 0 33 36 1 0 22 7 1 0 28 16 1 0 32 20 1 0 1 37 1 0 1 38 1 0 1 39 1 0 2 40 1 0 3 41 1 0 3 42 1 0 3 43 1 0 4 44 1 0 4 45 1 0 5 46 1 0 5 47 1 0 6 48 1 0 6 49 1 0 8 50 1 0 8 51 1 0 8 52 1 0 9 53 1 6 10 54 1 0 10 55 1 0 11 56 1 0 13 57 1 0 13 58 1 0 13 59 1 0 14 60 1 0 14 61 1 0 14 62 1 0 15 63 1 0 15 64 1 0 17 65 1 0 17 66 1 0 17 67 1 0 25 68 1 0 26 69 1 0 26 70 1 0 26 71 1 0 27 72 1 0 27 73 1 0 27 74 1 0 31 75 1 6 32 76 1 0 32 77 1 0 34 78 1 0 34 79 1 0 34 80 1 0 35 81 1 0 35 82 1 0 35 83 1 0 36 84 1 0 M END

Standard InCHIKey	NPIGXIDNKYVGRB-PBZDJEQUSA-N
Standard InCHI	InChI=1S/C31H48O5/c1-18(2)12-11-15-30(10)21(14-13-19(3)4)17-29(9)25(33)22-16-23(28(7,8)35)36-26(22)31(30,27(29)34)24(32)20(5)6/h13,18,20-21,23,35H,11-12,14-17H2,1-10H3/t21-,23-,29+,30+,31-/m0/s1
SMILES	CC(C)CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(C)C(=O)C3=C([C@@]1(C(=O)C(C)C)C2=O)O[C@@H](C3)C(C)(C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	500.35	Volume:	549.831 ? Van der Waals volume.
Dense:	0.91	LogP:	5.355 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.332 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.641 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	18.0
TPSA:	80.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	1.0	Rings:	3.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.293	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.828	Fsp³:	0.774
MCE-18:	69.891 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.592	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.027 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.011 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.341	Promiscuous compounds:	0.059

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.839	MDCK Permeability:	-4.858
Pgp-inhibitor:	0.117	Pgp-substrate:	0.0
PAMPA:	0.169 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.0
50% Bioavailability (F50%):	0.056

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.365	MRP1:	0.998
Plasma Protein Binding (PPB):	87.767%	Volume Distribution (VD):	0.152
Fu:	14.015% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.953
OATP1B3 inhibitor:	0.738	BCRP inhibitor:	0.001
BSEP inhibitor:	0.982

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.997
CYP2C19-inhibitor:	0.997	CYP2C19-substrate:	0.003
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.988
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.136 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

6.056

Half-life (T1/2):

0.72

ADMET: Toxicity

hERG Blockers:	0.053	hERG Blockers (10um):	0.203
Human Hepatotoxicity (H-HT):	0.849	Drug-induced Liver Injury (DILI):	0.288
AMES Toxicity:	0.472	Rat Oral Acute Toxicity:	0.298
Maximum Recommended Daily Dose:	0.524	Skin Sensitization:	0.995
Carcinogencity:	0.893	Eye Corrosion:	0.087
Eye Irritation:	0.32	Respiratory Toxicity:	0.539
Drug-induced Neurotoxicity:	0.286	Ototoxicity:	0.414
Hematotoxicity:	0.489	Drug-induced Nephrotoxicity:	0.981
Genotoxicity:	0.922	RPMI-8226 Immunitoxicity:	0.093
A549 Cytotoxicity:	0.07	Hek293 Cytotoxicity:	0.158
BCF:	2.095 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.815 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.457 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	6.015 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	Uzbekistan	n.a.	PMID[15568778]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15568778]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27280968]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	75.4	%	PMID[27280968]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC483080 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15379
0.1-0.2	32271
0.2-0.3	2104
0.3-0.4	39
0.4-0.5	31
0.5-0.6	13
0.6-0.7	7
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8305	Intermediate Similarity	NPC472729
0.8305	Intermediate Similarity	NPC472730
0.7541	Intermediate Similarity	NPC483067
0.746	Intermediate Similarity	NPC472728
0.746	Intermediate Similarity	NPC472727
0.7077	Intermediate Similarity	NPC483076
0.7077	Intermediate Similarity	NPC483078
0.6769	Remote Similarity	NPC483068
0.6216	Remote Similarity	NPC483079
0.6197	Remote Similarity	NPC483052
0.6197	Remote Similarity	NPC483051
0.6111	Remote Similarity	NPC483055
0.6111	Remote Similarity	NPC483056
0.6053	Remote Similarity	NPC483077
0.5942	Remote Similarity	NPC21681
0.5882	Remote Similarity	NPC472733
0.5882	Remote Similarity	NPC472734
0.5526	Remote Similarity	NPC482995
0.5493	Remote Similarity	NPC472732
0.5493	Remote Similarity	NPC472731
0.5479	Remote Similarity	NPC483060
0.5362	Remote Similarity	NPC177680
0.5362	Remote Similarity	NPC153776
0.5342	Remote Similarity	NPC472675
0.5263	Remote Similarity	NPC483061
0.5263	Remote Similarity	NPC483062
0.5128	Remote Similarity	NPC482993

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483080 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6120
0.1-0.2	2977
0.2-0.3	53
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data