NPASS Compound

Natural Product: NPC483079

Natural Product ID	NPC483079
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YQXWWWPBXFBCNS-NLOUOIJMSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	134131990
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 88 0 0 0 0 0 0 0 0999 V2000 -4.0095 -2.4869 -4.0744 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7941 -1.6030 -2.8884 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8943 -0.1642 -3.3340 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4741 -1.8713 -2.1961 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4080 -0.8831 -1.0028 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1031 -1.1019 -0.2644 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9338 -0.2261 0.9621 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1266 -0.5698 1.8789 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1419 1.2149 0.5860 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4815 2.1499 1.7006 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6656 3.5454 1.1459 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0040 4.6038 1.5595 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3145 5.9249 0.8901 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0161 4.5992 2.6465 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0384 1.7395 -0.2958 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3139 1.4286 0.2405 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0704 2.7524 0.3249 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0913 0.4554 -0.6088 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0257 -0.8585 -0.3284 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8176 -1.5776 -1.3805 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7365 -0.4875 -1.8505 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2123 -0.6694 -3.2634 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1835 -1.8143 -3.2979 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9735 0.5945 -3.6442 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1711 -0.8136 -4.1592 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9206 0.6605 -1.7005 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2898 -1.3898 0.8179 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4122 -2.5767 1.1096 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3867 -0.4934 1.6448 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2982 -0.8798 3.0397 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7525 0.0090 3.8912 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1938 -2.0693 3.6946 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7576 -3.1566 3.0861 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1871 -4.2709 3.7733 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0689 -4.3479 5.1348 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5118 -3.2864 5.7963 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0931 -2.1926 5.0936 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2058 0.7994 1.5708 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7106 1.2289 2.5601 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1015 -2.4324 -4.3343 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4003 -2.2065 -4.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8211 -3.5412 -3.7709 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6491 -1.7812 -2.1800 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6247 -0.0435 -4.1603 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9257 0.2229 -3.7290 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2748 0.5007 -2.5064 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3620 -2.9030 -1.8732 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6689 -1.6228 -2.9104 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2991 -1.0958 -0.3916 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5222 0.0867 -1.4796 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2522 -1.0464 -0.9748 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1306 -2.1518 0.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5607 -1.5557 1.6309 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9859 0.1368 1.6859 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8858 -0.4992 2.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0627 1.2251 -0.0782 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4464 1.9399 2.2133 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7413 2.2508 2.4995 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3962 3.6588 0.3559 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4372 5.9204 0.7692 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0019 6.7481 1.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8246 5.9818 -0.1000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6641 3.7169 2.6547 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5574 4.6969 3.6150 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6365 5.5278 2.5717 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2322 2.8433 -0.4127 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1212 1.3328 -1.3307 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7744 2.7606 -0.5327 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6849 2.8164 1.2449 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4032 3.6218 0.1865 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4088 -2.4012 -0.9742 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1617 -1.8710 -2.2245 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6172 -0.3479 -1.1955 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6843 -1.8752 -2.3022 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0058 -1.5683 -4.0291 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7330 -2.7640 -3.6103 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3184 1.1254 -2.7276 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9001 0.3484 -4.2173 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3695 1.2628 -4.2870 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5587 -0.6682 -5.0796 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9034 -3.1851 2.0371 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6325 -5.1192 3.2431 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4130 -5.2383 5.6704 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4100 -3.3333 6.8943 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3373 -1.3897 5.6738 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 7 6 1 6 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 3 12 13 1 0 12 14 1 0 9 15 1 0 15 16 1 0 16 17 1 1 16 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 21 26 1 0 19 27 1 0 27 28 2 0 27 29 1 0 29 30 1 1 30 31 2 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 29 38 1 0 38 39 2 0 29 7 1 0 37 32 1 0 38 16 1 0 26 18 1 0 1 40 1 0 1 41 1 0 1 42 1 0 2 43 1 0 3 44 1 0 3 45 1 0 3 46 1 0 4 47 1 0 4 48 1 0 5 49 1 0 5 50 1 0 6 51 1 0 6 52 1 0 8 53 1 0 8 54 1 0 8 55 1 0 9 56 1 6 10 57 1 0 10 58 1 0 11 59 1 0 13 60 1 0 13 61 1 0 13 62 1 0 14 63 1 0 14 64 1 0 14 65 1 0 15 66 1 0 15 67 1 0 17 68 1 0 17 69 1 0 17 70 1 0 20 71 1 0 20 72 1 0 21 73 1 1 23 74 1 0 23 75 1 0 23 76 1 0 24 77 1 0 24 78 1 0 24 79 1 0 25 80 1 0 33 81 1 0 34 82 1 0 35 83 1 0 36 84 1 0 37 85 1 0 M END

Standard InCHIKey	YQXWWWPBXFBCNS-NLOUOIJMSA-N
Standard InCHI	InChI=1S/C34H46O5/c1-21(2)13-12-18-33(8)24(17-16-22(3)4)20-32(7)29-25(19-26(39-29)31(5,6)38)28(36)34(33,30(32)37)27(35)23-14-10-9-11-15-23/h9-11,14-16,21,24,26,38H,12-13,17-20H2,1-8H3/t24-,26-,32+,33+,34-/m0/s1
SMILES	CC(C)CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(C)C3=C(C[C@@H](C(C)(C)O)O3)C(=O)[C@@]1(C(=O)c1ccccc1)C2=O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	534.33	Volume:	585.254 ? Van der Waals volume.
Dense:	0.913	LogP:	6.423 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.83 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.597 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	24.0
TPSA:	80.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	1.0	Rings:	4.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.209	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.606	Fsp³:	0.618
MCE-18:	110.655 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.878	Fluc inhibitor:	0.048 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.032 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.173 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.104	Promiscuous compounds:	0.06

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.742	MDCK Permeability:	-4.654
Pgp-inhibitor:	0.109	Pgp-substrate:	0.019
PAMPA:	0.691 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.0
50% Bioavailability (F50%):	0.023

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	1.0	MRP1:	0.986
Plasma Protein Binding (PPB):	92.445%	Volume Distribution (VD):	-0.27
Fu:	6.313% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.89
OATP1B3 inhibitor:	0.209	BCRP inhibitor:	0.002
BSEP inhibitor:	0.97

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.99
CYP2C19-inhibitor:	0.98	CYP2C19-substrate:	0.998
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.088 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.692

Half-life (T1/2):

0.625

ADMET: Toxicity

hERG Blockers:	0.036	hERG Blockers (10um):	0.139
Human Hepatotoxicity (H-HT):	0.875	Drug-induced Liver Injury (DILI):	0.25
AMES Toxicity:	0.438	Rat Oral Acute Toxicity:	0.356
Maximum Recommended Daily Dose:	0.17	Skin Sensitization:	0.998
Carcinogencity:	0.966	Eye Corrosion:	0.029
Eye Irritation:	0.843	Respiratory Toxicity:	0.823
Drug-induced Neurotoxicity:	0.306	Ototoxicity:	0.383
Hematotoxicity:	0.279	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.961	RPMI-8226 Immunitoxicity:	0.026
A549 Cytotoxicity:	0.041	Hek293 Cytotoxicity:	0.204
BCF:	2.203 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.955 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.672 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	6.309 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	Uzbekistan	n.a.	PMID[15568778]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15568778]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[27280968]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11713	Hypericum scabrum	Species	Hypericaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	83.0	%	PMID[27280968]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC483079 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8039
0.1-0.2	39906
0.2-0.3	1759
0.3-0.4	88
0.4-0.5	32
0.5-0.6	16
0.6-0.7	10
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8551	High Similarity	NPC482993
0.8333	Intermediate Similarity	NPC483077
0.7105	Intermediate Similarity	NPC47466
0.7105	Intermediate Similarity	NPC116274
0.6806	Remote Similarity	NPC483076
0.6806	Remote Similarity	NPC483078
0.6667	Remote Similarity	NPC328997
0.6667	Remote Similarity	NPC294050
0.6667	Remote Similarity	NPC610705
0.641	Remote Similarity	NPC482995
0.6375	Remote Similarity	NPC146239
0.6375	Remote Similarity	NPC483095
0.6329	Remote Similarity	NPC482994
0.6216	Remote Similarity	NPC483080
0.5875	Remote Similarity	NPC482999
0.5875	Remote Similarity	NPC316553
0.5843	Remote Similarity	NPC144257
0.5733	Remote Similarity	NPC472733
0.5733	Remote Similarity	NPC472734
0.5595	Remote Similarity	NPC483098
0.5488	Remote Similarity	NPC61651
0.5465	Remote Similarity	NPC483099
0.5422	Remote Similarity	NPC483000
0.5385	Remote Similarity	NPC472732
0.5385	Remote Similarity	NPC472731
0.5128	Remote Similarity	NPC472729
0.5128	Remote Similarity	NPC472730
0.5059	Remote Similarity	NPC482998
0.5059	Remote Similarity	NPC482997
0.5059	Remote Similarity	NPC482996

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC483079 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3039
0.1-0.2	6028
0.2-0.3	83
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data