NPASS Compound

Natural Product: NPC481657

Natural Product ID	NPC481657
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LEQNEABVKZQJMW-DPFAYIJNSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 152159 0 0 0 0 0 0 0 0999 V2000 -12.9223 -2.0278 1.9719 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5194 -0.7364 1.2651 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.7227 -0.2266 0.4723 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1921 0.6788 -0.6237 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9222 1.3059 -0.0758 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8881 0.1955 -0.0543 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4632 -0.9931 0.4259 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8291 0.6152 0.7296 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6253 0.5878 -0.0119 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1072 1.9736 -0.1332 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7124 2.6241 -1.3846 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7657 2.1675 -0.0632 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9697 1.2012 0.4619 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7303 0.3957 1.4890 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7379 -0.4053 0.6489 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4554 -1.2957 1.4013 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1745 -2.5851 0.9418 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4744 0.3055 -0.4853 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0978 0.3331 -0.5727 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4158 -0.9833 -0.4190 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3633 -2.1155 -0.0497 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6854 -1.3857 -1.5339 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6876 -0.4414 -1.7539 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3329 0.7946 -2.2907 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7923 0.8381 -1.9894 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4410 -0.0543 -2.8717 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4483 0.6111 -3.5773 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0002 -0.2731 -0.5655 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3243 -0.6642 -0.6295 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7495 -1.6661 0.3857 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0208 -2.3534 -0.0744 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8625 -1.2311 1.6741 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5238 -0.0567 1.8894 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8819 1.0081 1.0140 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1589 0.5872 -0.4120 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7471 1.5783 -1.2668 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7560 2.0307 -2.0844 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8737 -0.2004 1.6020 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7251 0.1130 2.6255 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5171 1.3536 2.2391 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4658 1.0816 1.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2418 -0.1954 1.2819 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7121 -1.2084 0.3043 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0521 -0.7313 2.6486 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0135 -0.9846 3.5212 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4197 -0.7421 3.1889 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6143 -0.8336 1.6926 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6977 0.1349 1.0331 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9570 0.3897 -0.4030 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2604 -0.0539 -0.9606 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3851 -0.2584 -0.0180 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0914 -1.5611 -0.4853 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4639 0.8021 -0.0523 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7671 1.0846 1.4011 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5513 0.7018 2.1947 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0399 -0.5086 1.4115 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7812 -1.5883 1.9627 O 0 0 0 0 0 0 0 0 0 0 0 0 11.1604 2.0022 -0.8222 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7900 2.2590 -1.8361 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1144 2.9975 -0.4810 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6565 0.2468 -0.5944 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1056 -1.2081 -1.7967 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3472 -1.0812 -3.1443 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7015 0.0021 -3.6938 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1915 -2.2667 -4.0291 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3877 -2.1542 1.3283 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6450 -1.0023 3.0650 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.0739 1.6591 -1.0140 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.2639 1.5421 -2.4024 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4748 0.5654 1.3440 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0611 -2.7337 1.9492 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7643 -2.4541 1.4164 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2579 -1.8118 3.0047 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2057 -0.0299 2.0439 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3020 -1.0776 0.0799 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8589 0.0466 -1.4939 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0910 1.6793 0.9425 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5437 2.1118 -0.7047 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5442 -0.0584 -1.0917 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8450 0.2239 -1.0563 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5470 2.5572 0.7323 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8905 2.9030 -2.0806 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1715 3.5750 -1.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4680 2.0086 -1.8635 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1117 1.7153 0.9548 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0899 -0.2521 2.0945 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3102 1.1138 2.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1095 -0.9155 -0.1384 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7283 -3.3668 1.5117 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3573 -2.6718 -0.1662 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0829 -2.8391 1.0680 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7487 1.0984 0.1679 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7340 -0.8891 0.4780 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0485 -2.3694 -0.8781 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8542 -1.9401 0.9086 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7008 -3.0205 0.0875 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0219 -0.8854 -2.5537 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8890 1.7479 -1.9553 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2326 0.8005 -3.4164 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2230 1.8560 -2.0506 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9218 -0.1193 -4.2473 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1713 1.1086 -2.9109 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9569 1.3670 -4.2444 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6083 -1.0464 -1.6345 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0326 -2.4828 0.3901 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3965 -2.9397 0.7895 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7923 -3.0935 -0.8820 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7965 -1.6629 -0.4021 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3293 0.2746 2.9293 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1919 2.0202 1.2528 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2132 0.9286 1.1732 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2340 0.3979 -0.6000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3152 2.8280 -2.7338 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5701 2.5487 -1.5151 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1557 1.2654 -2.7825 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1295 0.4116 3.5104 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7792 2.1024 1.8869 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0074 1.7836 3.1350 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1399 1.9624 1.0372 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9235 1.0582 0.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2363 -0.7339 -0.5958 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9157 -1.8634 0.7160 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4891 -1.8928 -0.0899 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7644 -1.3875 4.5244 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0772 -1.4862 3.7158 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6988 0.2531 3.5882 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8581 1.1221 1.5652 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7060 1.4569 -0.6832 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1591 -0.1870 -0.9711 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5799 0.7685 -1.6762 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4478 -2.4009 -0.1490 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2146 -1.5328 -1.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0554 -1.6195 0.0644 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6001 0.4409 1.7499 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0847 2.1316 1.5729 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8960 0.4079 3.2205 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8093 1.4809 2.3374 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9594 -1.4414 2.9284 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4563 2.7283 0.3389 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4714 3.1150 -1.4020 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6029 3.9949 -0.3076 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5766 0.1609 -1.5794 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1952 -2.7235 -4.1414 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8512 -1.9708 -5.0496 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4928 -2.9997 -3.5974 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6714 -2.7832 2.0541 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3702 -1.9883 2.6619 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6414 -1.1199 4.1683 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2991 1.6681 -2.9489 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6159 0.5142 -2.5972 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9350 2.3306 -2.7728 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7775 0.0282 2.1354 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 13 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 23 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 33 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 6 42 44 1 0 44 45 2 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 6 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 1 53 58 1 0 58 59 2 0 58 60 1 0 53 61 1 6 50 62 1 0 62 63 1 0 63 64 2 0 63 65 1 0 47 66 1 6 44 67 1 0 4 68 1 0 68 69 1 0 3 70 1 0 7 2 1 0 15 9 1 0 25 19 1 0 35 29 1 0 67 39 1 0 48 42 1 0 56 51 1 0 56 47 1 0 1 71 1 0 1 72 1 0 1 73 1 0 2 74 1 1 3 75 1 6 4 76 1 6 5 77 1 0 5 78 1 0 6 79 1 6 9 80 1 6 10 81 1 1 11 82 1 0 11 83 1 0 11 84 1 0 13 85 1 1 14 86 1 0 14 87 1 0 15 88 1 6 17 89 1 0 17 90 1 0 17 91 1 0 19 92 1 1 20 93 1 1 21 94 1 0 21 95 1 0 21 96 1 0 23 97 1 6 24 98 1 0 24 99 1 0 25100 1 1 27101 1 0 27102 1 0 27103 1 0 29104 1 6 30105 1 1 31106 1 0 31107 1 0 31108 1 0 33109 1 1 34110 1 0 34111 1 0 35112 1 1 37113 1 0 37114 1 0 37115 1 0 39116 1 1 40117 1 0 40118 1 0 41119 1 0 41120 1 0 43121 1 0 43122 1 0 43123 1 0 45124 1 0 46125 1 0 46126 1 0 48127 1 1 49128 1 0 49129 1 0 50130 1 6 52131 1 0 52132 1 0 52133 1 0 54134 1 0 54135 1 0 55136 1 0 55137 1 0 57138 1 0 60139 1 0 60140 1 0 60141 1 0 61142 1 0 65143 1 0 65144 1 0 65145 1 0 66146 1 0 67147 1 0 67148 1 0 69149 1 0 69150 1 0 69151 1 0 70152 1 0 M END

Standard InCHIKey	LEQNEABVKZQJMW-DPFAYIJNSA-N
Standard InCHI	InChI=1S/C51H82O19/c1-25-43(54)33(58-9)20-40(62-25)68-45-27(3)64-42(22-35(45)60-11)70-46-28(4)65-41(23-36(46)61-12)69-44-26(2)63-39(21-34(44)59-10)67-32-14-15-47(7)31(19-32)13-16-50(56)37(47)24-38(66-30(6)53)48(8)49(55,29(5)52)17-18-51(48,50)57/h13,25-28,32-46,54-57H,14-24H2,1-12H3/t25-,26-,27+,28-,32-,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,43-,44-,45+,46+,47-,48+,49+,50-,51+/m1/s1
SMILES	C[C@@H]1[C@H]([C@H](C[C@H](O1)O[C@H]1[C@H](C)O[C@@H](C[C@H]1OC)O[C@H]1[C@@H](C)O[C@@H](C[C@H]1OC)O[C@@H]1[C@@H](C)O[C@H](C[C@@H]1OC)O[C@@H]1CC[C@]2(C)C(=CC[C@]3([C@H]2C[C@@H]([C@@]2(C)[C@](CC[C@@]32O)(C(=O)C)O)OC(=O)C)O)C1)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	998.55	Volume:	981.305 ? Van der Waals volume.
Dense:	1.018	LogP:	2.569 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.012 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.736 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	46.0
TPSA:	235.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	4.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.144	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.747	Fsp³:	0.922
MCE-18:	165.571 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.734	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.005 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.503	Promiscuous compounds:	0.72

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.558	MDCK Permeability:	-5.223
Pgp-inhibitor:	0.042	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.637	30% Bioavailability (F30%):	0.317
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.998
Plasma Protein Binding (PPB):	72.264%	Volume Distribution (VD):	-0.086
Fu:	22.905% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.688
OATP1B3 inhibitor:	0.262	BCRP inhibitor:	0.027
BSEP inhibitor:	0.914

ADMET: Metabolism

CYP1A2-inhibitor:	0.798	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.568	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.01
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.986 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.237

Half-life (T1/2):

5.249

ADMET: Toxicity

hERG Blockers:	0.144	hERG Blockers (10um):	0.454
Human Hepatotoxicity (H-HT):	0.765	Drug-induced Liver Injury (DILI):	0.982
AMES Toxicity:	0.984	Rat Oral Acute Toxicity:	0.914
Maximum Recommended Daily Dose:	0.95	Skin Sensitization:	1.0
Carcinogencity:	0.779	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.167
Drug-induced Neurotoxicity:	0.063	Ototoxicity:	0.996
Hematotoxicity:	0.375	Drug-induced Nephrotoxicity:	0.835
Genotoxicity:	0.943	RPMI-8226 Immunitoxicity:	0.479
A549 Cytotoxicity:	0.918	Hek293 Cytotoxicity:	0.912
BCF:	0.421 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.484 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.47 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.549 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8809	Cynanchum wilfordii	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10217732]
NPO8809	Cynanchum wilfordii	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26716755]
NPO8809	Cynanchum wilfordii	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO8809	Cynanchum wilfordii	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	1

Activity Type	# Activity
Organism	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT32	Organism	Mus musculus	Mus musculus	ED50	>	200.0	mg.kg-1	PMID[26716755]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC481657 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18354
0.1-0.2	28244
0.2-0.3	3116
0.3-0.4	67
0.4-0.5	33
0.5-0.6	18
0.6-0.7	12
0.7-0.8	0
0.8-0.85	1
0.85-0.9	4
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.881	High Similarity	NPC481658
0.881	High Similarity	NPC79250
0.881	High Similarity	NPC290746
0.878	High Similarity	NPC473519
0.8182	Intermediate Similarity	NPC473805
0.7957	Intermediate Similarity	NPC165234
0.7957	Intermediate Similarity	NPC481659
0.7957	Intermediate Similarity	NPC271687
0.75	Intermediate Similarity	NPC102015
0.7412	Intermediate Similarity	NPC481656
0.7172	Intermediate Similarity	NPC475536
0.7128	Intermediate Similarity	NPC481661
0.7128	Intermediate Similarity	NPC481655
0.6635	Remote Similarity	NPC481654
0.6598	Remote Similarity	NPC475358
0.6598	Remote Similarity	NPC473566
0.6346	Remote Similarity	NPC474564
0.6321	Remote Similarity	NPC475613
0.6154	Remote Similarity	NPC473468
0.6147	Remote Similarity	NPC473641
0.6147	Remote Similarity	NPC475300
0.6053	Remote Similarity	NPC481660
0.6036	Remote Similarity	NPC475437
0.6036	Remote Similarity	NPC475464
0.6	Remote Similarity	NPC473557
0.5982	Remote Similarity	NPC475567
0.5789	Remote Similarity	NPC608980
0.5789	Remote Similarity	NPC609919
0.578	Remote Similarity	NPC481649
0.5776	Remote Similarity	NPC473797
0.5521	Remote Similarity	NPC481211
0.5521	Remote Similarity	NPC481209
0.5455	Remote Similarity	NPC607555
0.5439	Remote Similarity	NPC70236
0.5408	Remote Similarity	NPC481204
0.5345	Remote Similarity	NPC476092
0.5339	Remote Similarity	NPC481648
0.5164	Remote Similarity	NPC475175
0.5135	Remote Similarity	NPC481662
0.5124	Remote Similarity	NPC475447
0.5052	Remote Similarity	NPC479282
0.5041	Remote Similarity	NPC475531
0.5041	Remote Similarity	NPC475198

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC481657 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6867
0.1-0.2	2232
0.2-0.3	43
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data