NPASS Compound

Natural Product: NPC473805

Natural Product ID	NPC473805
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	[(3S,8S,9R,10R,12R,13S,14R,17R)-17-Acetyl-3-[(2R,4R,5S,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-Dihydroxy-4-Methoxy-6-Methyloxan-2-Yl]Oxy-4-Methoxy-6-Methyloxan-2-Yl]Oxy-4-Methoxy-6-Methyloxan-2-Yl]Oxy-4-Hydroxy-6-Methyloxan-2-Yl]Oxy-8,14,17-Trihydroxy-10,13-Dimethyl-1,2,3,4,7,9,11,12,15,16-Decahydrocyclopenta[A]Phenanthren-12-Yl] Acetate
IUPAC Name	[(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-3-[(2R,4R,5S,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] acetate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL452282
PubChem CID	44575240
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 150157 0 0 0 0 0 0 0 0999 V2000 12.7528 1.6972 1.8279 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1667 0.3052 1.3210 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0297 0.3178 -0.1625 C 0 0 0 0 0 0 0 0 0 0 0 0 13.1384 -1.0114 -0.8331 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6693 -2.0822 0.1289 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6871 -1.4479 1.0942 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3226 -0.5869 1.9755 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6591 -0.8185 0.4365 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4424 -1.4545 0.6947 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7094 -1.7596 -0.5747 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5086 -0.6263 -1.3606 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6591 0.2525 -0.7378 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3177 0.7051 0.5609 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5898 -0.4544 1.4837 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3305 0.0406 2.5611 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6679 -0.2237 3.7728 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4513 -0.3387 -0.3648 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3586 0.3994 -0.7930 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5338 -0.2993 -1.8428 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2993 0.4192 -1.8845 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4773 -0.1367 -0.8546 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2487 -0.1593 0.4340 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4508 0.7997 0.3331 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0755 0.8713 1.5632 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9181 2.1264 2.1409 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2554 0.5036 -0.7884 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2151 -0.2004 -1.3206 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4986 0.6211 -2.3803 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6203 1.2569 -1.8118 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6426 0.2986 -1.6223 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0523 -1.0237 -1.2206 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8388 -0.6591 -0.3254 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2592 0.3863 0.4790 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4209 0.7401 -0.5589 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6961 1.0279 -1.0544 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6075 -0.1073 -0.5506 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9776 0.2296 0.8730 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0230 1.2851 0.8758 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3632 0.7864 0.4274 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7611 -0.4157 1.1786 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1388 -0.9615 0.6834 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1377 0.1187 0.6097 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3130 -0.2393 -0.2563 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1213 0.4785 -1.5795 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7746 1.2031 -1.4473 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6925 1.4249 0.0311 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3763 1.9085 0.5166 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9411 3.1406 -0.1575 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5288 3.1657 -0.5734 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5950 2.3399 -0.1362 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 2.3521 -0.5588 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5584 2.2030 1.8968 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6916 2.3643 0.3475 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5759 -1.6641 -0.4530 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8852 -2.3912 -1.1483 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.7460 -2.3510 0.2019 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.4391 0.3176 0.4244 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6250 0.4284 2.0459 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5213 -1.8776 1.6977 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4190 -3.2414 1.6242 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9328 -3.7478 0.5822 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8746 -4.1289 2.7611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0533 1.9897 2.2055 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4506 1.7145 -2.8168 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1034 -0.2502 -3.2223 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3055 -2.9147 -1.3256 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6995 -2.6633 0.8482 O 0 0 0 0 0 0 0 0 0 0 0 0 14.3973 -1.3172 -1.2896 O 0 0 0 0 0 0 0 0 0 0 0 0 14.3555 -1.5454 -2.6634 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0939 1.1038 -0.6667 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5237 2.4519 1.6722 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8546 1.9688 1.2376 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4242 1.6168 2.8940 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2230 0.1906 1.6171 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0973 0.8641 -0.4650 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4268 -1.0184 -1.7032 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1414 -2.8535 -0.4371 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2678 -2.2897 1.6820 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6015 -2.3345 1.3473 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6728 -2.0773 -0.2692 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5348 1.1726 -1.3276 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7066 1.4655 1.1069 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2890 1.2107 0.3730 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6550 -0.9452 1.7894 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6796 0.2686 3.7368 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2223 0.2705 4.5960 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6366 -1.3078 3.9066 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7440 1.3071 -1.2825 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2455 -1.3209 -1.5469 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3145 -1.1642 -1.2195 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5889 -1.1658 0.6482 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5952 0.2603 1.2283 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9833 1.8088 0.1478 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8749 2.3987 2.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4409 2.8721 1.4819 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4636 2.1392 3.0994 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5973 -1.1168 -1.7809 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7779 0.0224 -3.2636 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2284 0.1896 -2.5363 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6952 -1.6082 -2.0767 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7424 -1.6062 -0.6141 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5619 -1.5775 0.1989 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5760 0.1097 1.3536 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7693 0.9557 -2.1527 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0533 -1.0726 -0.6095 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4929 -0.1002 -1.1836 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2276 -0.7048 1.3957 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0285 0.6564 1.3285 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2843 0.5370 -0.6650 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8417 -0.3209 2.2587 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0629 -1.2442 0.9518 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8798 -1.4066 -0.2750 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1246 -0.2401 -2.4003 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9434 1.2101 -1.6886 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8597 2.1564 -1.9869 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0255 0.5119 -1.8484 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0751 4.0307 0.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5300 3.3784 -1.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1701 3.9181 -1.3087 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9891 3.1665 -1.2954 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5246 2.6332 0.3223 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9586 3.0855 2.0161 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3027 3.2692 0.4687 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4072 -1.6177 0.6827 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4393 -3.1713 0.8724 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3685 -2.8099 -0.6227 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7921 1.0734 -0.0861 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7696 0.3689 2.7326 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4403 -0.2576 2.2935 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0033 1.4626 2.0461 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6352 -3.6384 3.3661 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2341 -5.0911 2.3278 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9560 -4.3174 3.3712 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9802 2.0585 2.5456 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6215 1.4549 2.9725 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3935 3.0328 2.1318 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8683 2.2488 -1.9251 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2360 1.3415 -3.4932 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1764 2.4739 -3.3393 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3619 -0.4932 -4.0096 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5122 0.7422 -3.4922 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8685 -1.0576 -3.2994 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2371 -2.6338 -1.8768 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5979 -3.7434 -0.6501 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5806 -3.3743 -2.0411 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4492 -2.7356 1.8065 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9957 -0.6425 -3.1922 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3580 -1.7984 -3.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6465 -2.3972 -2.8699 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9829 0.6763 -0.4540 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 12 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 21 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 30 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 2 0 50 51 1 0 47 52 1 0 46 53 1 0 43 54 1 0 54 55 2 0 54 56 1 0 43 57 1 0 42 58 1 0 41 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 38 63 1 0 28 64 1 0 19 65 1 0 10 66 1 0 5 67 1 0 4 68 1 0 68 69 1 0 3 70 1 0 7 2 1 0 14 9 1 0 23 18 1 0 32 27 1 0 51 35 1 0 50 38 1 0 47 39 1 0 46 42 1 0 1 71 1 0 1 72 1 0 1 73 1 0 2 74 1 0 3 75 1 0 4 76 1 0 5 77 1 0 6 78 1 0 9 79 1 0 10 80 1 0 12 81 1 0 13 82 1 0 13 83 1 0 14 84 1 0 16 85 1 0 16 86 1 0 16 87 1 0 18 88 1 0 19 89 1 0 21 90 1 0 22 91 1 0 22 92 1 0 23 93 1 0 25 94 1 0 25 95 1 0 25 96 1 0 27 97 1 0 28 98 1 0 30 99 1 0 31100 1 0 31101 1 0 32102 1 0 33103 1 0 35104 1 0 36105 1 0 36106 1 0 37107 1 0 37108 1 0 39109 1 0 40110 1 0 40111 1 0 41112 1 0 44113 1 0 44114 1 0 45115 1 0 45116 1 0 48117 1 0 48118 1 0 49119 1 0 51120 1 0 51121 1 0 52122 1 0 53123 1 0 56124 1 0 56125 1 0 56126 1 0 57127 1 0 58128 1 0 58129 1 0 58130 1 0 62131 1 0 62132 1 0 62133 1 0 63134 1 0 63135 1 0 63136 1 0 64137 1 0 64138 1 0 64139 1 0 65140 1 0 65141 1 0 65142 1 0 66143 1 0 66144 1 0 66145 1 0 67146 1 0 69147 1 0 69148 1 0 69149 1 0 70150 1 0 M END

Standard InCHIKey	JRMIUJCJYJKCOE-ALRXJPKMSA-N
Standard InCHI	InChI=1S/C50H80O20/c1-23-39(54)44(61-11)40(55)45(65-23)70-43-26(4)64-38(21-33(43)60-10)69-42-25(3)63-37(20-32(42)59-9)68-41-24(2)62-36(19-31(41)53)67-30-13-14-46(7)29(18-30)12-15-49(57)34(46)22-35(66-28(6)52)47(8)48(56,27(5)51)16-17-50(47,49)58/h12,23-26,30-45,53-58H,13-22H2,1-11H3/t23-,24-,25-,26-,30+,31-,32+,33-,34-,35-,36+,37+,38+,39-,40-,41-,42-,43-,44+,45+,46+,47-,48+,49+,50-/m1/s1
SMILES	CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4O)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C)C)C)C)C)O)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1000.52	Volume:	972.799 ? Van der Waals volume.
Dense:	1.028	LogP:	2.158 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.641 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.713 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	46.0
TPSA:	266.28 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	6.0	Rings:	8.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.114	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.763	Fsp³:	0.92
MCE-18:	169.208 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.0	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.174 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.444	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.59	MDCK Permeability:	-5.119
Pgp-inhibitor:	0.0	Pgp-substrate:	1.0
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.857
20% Bioavailability (F20%):	0.105	30% Bioavailability (F30%):	0.562
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	1.0
Plasma Protein Binding (PPB):	33.239%	Volume Distribution (VD):	-0.459
Fu:	58.592% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.102	BCRP inhibitor:	0.003
BSEP inhibitor:	0.191

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.162	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.96	CYP3A4-substrate:	0.0
CYP2B6-substrate:	1.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.015 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.847

Half-life (T1/2):

6.916

ADMET: Toxicity

hERG Blockers:	0.132	hERG Blockers (10um):	0.269
Human Hepatotoxicity (H-HT):	0.597	Drug-induced Liver Injury (DILI):	0.677
AMES Toxicity:	0.858	Rat Oral Acute Toxicity:	0.895
Maximum Recommended Daily Dose:	0.893	Skin Sensitization:	0.039
Carcinogencity:	0.084	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.018
Drug-induced Neurotoxicity:	0.235	Ototoxicity:	0.997
Hematotoxicity:	0.038	Drug-induced Nephrotoxicity:	0.022
Genotoxicity:	0.963	RPMI-8226 Immunitoxicity:	0.45
A549 Cytotoxicity:	0.14	Hek293 Cytotoxicity:	0.903
BCF:	0.416 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.55 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.61 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.246 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32487	leptadenia pyrotechnica	Species	Apocynaceae	Eukaryota	whole plant	Dogon region, Mali	2002-Apr	PMID[16643040]
NPO32487	leptadenia pyrotechnica	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT3470	Cell line	WEHI-164	Mus musculus	IC50	=	640.0	nM	PMID[9371235]
NPT1182	Cell line	J774.A1	Mus musculus	IC50	=	780.0	nM	DOI[10.1584/jpestics.28.183]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473805 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19774
0.1-0.2	27488
0.2-0.3	2447
0.3-0.4	81
0.4-0.5	33
0.5-0.6	12
0.6-0.7	15
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9286	High Similarity	NPC473519
0.8182	Intermediate Similarity	NPC481657
0.7624	Intermediate Similarity	NPC475536
0.7423	Intermediate Similarity	NPC102015
0.7292	Intermediate Similarity	NPC481658
0.7292	Intermediate Similarity	NPC79250
0.7292	Intermediate Similarity	NPC290746
0.6792	Remote Similarity	NPC474564
0.6762	Remote Similarity	NPC473468
0.6733	Remote Similarity	NPC481661
0.6733	Remote Similarity	NPC481655
0.6667	Remote Similarity	NPC165234
0.6667	Remote Similarity	NPC481659
0.6667	Remote Similarity	NPC271687
0.6577	Remote Similarity	NPC473557
0.6569	Remote Similarity	NPC475358
0.6569	Remote Similarity	NPC473566
0.6549	Remote Similarity	NPC475567
0.614	Remote Similarity	NPC473641
0.614	Remote Similarity	NPC475300
0.6082	Remote Similarity	NPC481656
0.6018	Remote Similarity	NPC475613
0.5897	Remote Similarity	NPC475437
0.5897	Remote Similarity	NPC475464
0.5785	Remote Similarity	NPC473797
0.5603	Remote Similarity	NPC481654
0.5462	Remote Similarity	NPC70236
0.5317	Remote Similarity	NPC475175
0.528	Remote Similarity	NPC481660
0.5246	Remote Similarity	NPC476092
0.5159	Remote Similarity	NPC475447
0.5126	Remote Similarity	NPC481649
0.5078	Remote Similarity	NPC475531
0.5078	Remote Similarity	NPC475198

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473805 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7171
0.1-0.2	1928
0.2-0.3	43
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data