NPASS Compound

Natural Product: NPC480777

Natural Product ID	NPC480777
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SPFPWBZAPXGZPE-KRRRKNKYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	73354400
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001283] Terpene lactones [CHEMONTID:0002119] Quassinoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 81 85 0 0 0 0 0 0 0 0999 V2000 4.9859 4.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6741 2.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7888 1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4769 0.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5916 -0.8705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0503 -0.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9356 0.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6237 -0.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2475 2.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1328 3.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7062 2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2760 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3943 -1.2135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0323 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1470 1.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8351 3.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9499 4.2246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4086 3.6844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9419 0.4816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4410 0.5340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1452 1.8584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2358 -0.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7349 -0.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4391 0.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5298 -1.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2577 -2.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8019 -1.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3247 -3.2299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8238 -3.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5280 -1.8531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6187 -4.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3273 -0.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1683 -0.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5090 0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5447 -2.7444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2742 -2.7784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2458 -1.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4547 -3.1171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6161 -1.0216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8297 -1.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8683 -1.2538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4531 3.7595 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6378 4.7290 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2978 5.5385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2154 2.0639 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9107 -1.5590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8817 -1.6109 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4259 -1.6968 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4930 -2.2882 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5593 3.6078 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5952 4.5447 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0562 4.3263 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8369 4.1750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1147 1.2436 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9569 -1.3366 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2143 -0.1736 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5378 2.3156 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8730 -2.1936 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8395 0.1012 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1147 1.3429 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1433 1.9631 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0526 -4.0248 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6238 -1.3932 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9857 -3.5476 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8810 -2.2049 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5158 0.3095 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0740 -0.3681 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8907 -3.6547 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3466 -5.2445 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4135 -5.7217 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4658 -3.1740 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5053 -2.1161 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7438 -1.2717 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5350 -3.8537 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7678 -2.6397 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8527 -0.8062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9480 -3.1168 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7938 -3.0524 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2566 -2.7027 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 4 6 1 0 6 7 1 0 7 8 1 1 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 17 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 2 0 25 26 1 0 25 27 1 0 27 28 1 0 27 29 1 0 27 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 15 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 34 38 1 0 15 39 1 1 39 40 2 0 39 41 1 0 41 42 1 0 6 43 1 0 9 2 1 0 20 11 1 0 36 7 1 0 36 12 1 0 16 12 1 0 1 44 1 0 1 45 1 0 1 46 1 0 3 47 1 0 6 48 1 6 8 49 1 0 8 50 1 0 8 51 1 0 9 52 1 6 10 53 1 0 10 54 1 0 11 55 1 1 13 56 1 0 13 57 1 0 16 58 1 1 17 59 1 6 24 60 1 0 26 61 1 0 26 62 1 0 26 63 1 0 28 64 1 0 28 65 1 0 28 66 1 0 29 67 1 0 29 68 1 0 29 69 1 0 33 70 1 0 33 71 1 0 33 72 1 0 34 73 1 1 35 74 1 1 36 75 1 6 37 76 1 0 38 77 1 0 42 78 1 0 42 79 1 0 42 80 1 0 43 81 1 0 M END

Standard InCHIKey	SPFPWBZAPXGZPE-KRRRKNKYSA-N
Standard InCHI	InChI=1S/C30H38O13/c1-12-8-16(32)23(35)28(6)15(12)10-17-29-11-40-30(26(38)39-7,24(36)19(34)21(28)29)22(29)20(25(37)41-17)42-18(33)9-13(2)27(4,5)43-14(3)31/h8-9,15,17,19-24,34-36H,10-11H2,1-7H3/b13-9+/t15-,17+,19+,20+,21+,22+,23+,24-,28-,29+,30+/m0/s1
SMILES	CC1=CC(=O)[C@H]([C@@]2(C)[C@H]1C[C@@H]1[C@]34CO[C@]([C@@H]4[C@H](C(=O)O1)OC(=O)/C=C(C)/C(C)(C)OC(=O)C)([C@H]([C@@H]([C@H]23)O)O)C(=O)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	606.23	Volume:	580.471 ? Van der Waals volume.
Dense:	1.044	LogP:	1.163 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.627 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.724 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	29.0
TPSA:	192.19 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.214	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.735	Fsp³:	0.7
MCE-18:	147.412 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.409	Fluc inhibitor:	0.005 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.033 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.075	Promiscuous compounds:	0.39

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.77	MDCK Permeability:	-5.158
Pgp-inhibitor:	0.251	Pgp-substrate:	0.892
PAMPA:	0.585 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.006
20% Bioavailability (F20%):	0.063	30% Bioavailability (F30%):	0.86
50% Bioavailability (F50%):	0.978

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.999
Plasma Protein Binding (PPB):	62.31%	Volume Distribution (VD):	-0.265
Fu:	37.286% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.996
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.008
BSEP inhibitor:	0.652

ADMET: Metabolism

CYP1A2-inhibitor:	0.01	CYP1A2-substrate:	0.02
CYP2C19-inhibitor:	0.048	CYP2C19-substrate:	0.351
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.003
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.524
CYP3A4-inhibitor:	0.933	CYP3A4-substrate:	0.225
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.977
HLM stability:	0.425 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.062

Half-life (T1/2):

2.811

ADMET: Toxicity

hERG Blockers:	0.009	hERG Blockers (10um):	0.053
Human Hepatotoxicity (H-HT):	0.84	Drug-induced Liver Injury (DILI):	0.986
AMES Toxicity:	0.879	Rat Oral Acute Toxicity:	0.679
Maximum Recommended Daily Dose:	0.821	Skin Sensitization:	1.0
Carcinogencity:	0.702	Eye Corrosion:	0.005
Eye Irritation:	0.572	Respiratory Toxicity:	0.38
Drug-induced Neurotoxicity:	0.827	Ototoxicity:	0.599
Hematotoxicity:	0.521	Drug-induced Nephrotoxicity:	0.971
Genotoxicity:	0.999	RPMI-8226 Immunitoxicity:	0.197
A549 Cytotoxicity:	0.169	Hek293 Cytotoxicity:	0.404
BCF:	0.505 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.317 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.157 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.533 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[2089121]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[3379416]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[3443857]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[3760882]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[3841557]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[7288443]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8133299]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	xylem	n.a.	PMID[8133299]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8691212]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO21014	Brucea antidysenterica	Species	Simaroubaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
ED50	4

Activity Type	# Activity
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	ED50	<	0.04	ug ml-1	PMID[3379416]
NPT81	Cell line	A549	Homo sapiens	ED50	=	0.48	ug ml-1	PMID[3379416]
NPT180	Cell line	HCT-8	Homo sapiens	ED50	<	0.4	ug ml-1	PMID[3379416]
NPT168	Cell line	P388	Mus musculus	ED50	=	0.56	ug ml-1	PMID[3379416]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC480777 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17370
0.1-0.2	30932
0.2-0.3	1440
0.3-0.4	46
0.4-0.5	32
0.5-0.6	20
0.6-0.7	13
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8514	High Similarity	NPC480783
0.8451	Intermediate Similarity	NPC17772
0.7867	Intermediate Similarity	NPC485623
0.7439	Intermediate Similarity	NPC480786
0.7143	Intermediate Similarity	NPC105926
0.6824	Remote Similarity	NPC470779
0.6582	Remote Similarity	NPC470776
0.6548	Remote Similarity	NPC67251
0.6463	Remote Similarity	NPC251236
0.6353	Remote Similarity	NPC480784
0.625	Remote Similarity	NPC40632
0.6173	Remote Similarity	NPC213084
0.6145	Remote Similarity	NPC479018
0.6118	Remote Similarity	NPC18945
0.6118	Remote Similarity	NPC152301
0.6098	Remote Similarity	NPC96312
0.6098	Remote Similarity	NPC328374
0.6092	Remote Similarity	NPC265557
0.5977	Remote Similarity	NPC480785
0.5977	Remote Similarity	NPC480787
0.5843	Remote Similarity	NPC476729
0.5814	Remote Similarity	NPC146432
0.5814	Remote Similarity	NPC470778
0.58	Remote Similarity	NPC471089
0.5765	Remote Similarity	NPC89929
0.5743	Remote Similarity	NPC480778
0.5714	Remote Similarity	NPC143268
0.5682	Remote Similarity	NPC190185
0.5632	Remote Similarity	NPC24651
0.5455	Remote Similarity	NPC476008
0.5402	Remote Similarity	NPC323821
0.5385	Remote Similarity	NPC94509
0.5385	Remote Similarity	NPC479017
0.5366	Remote Similarity	NPC49451
0.5349	Remote Similarity	NPC470777
0.5341	Remote Similarity	NPC16081
0.53	Remote Similarity	NPC262813
0.5096	Remote Similarity	NPC251998

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC480777 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6722
0.1-0.2	2401
0.2-0.3	27
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data