NPASS Compound

Natural Product: NPC479942

Natural Product ID	NPC479942
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UCTQGEZEUWGOLP-QTVNPKFLSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 79 81 0 0 0 0 0 0 0 0999 V2000 -2.8872 -4.1078 -2.7597 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9637 -3.5513 -2.3010 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0286 -2.9867 -0.9693 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1921 -2.4555 -0.5884 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8940 -3.0334 -0.0297 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7496 -2.1441 -0.1501 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9434 -0.6602 0.0284 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9036 -0.2247 -1.0597 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4561 -0.4090 1.4188 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1649 -1.3943 2.4698 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1591 0.9638 1.9819 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7451 1.4297 1.7410 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5704 1.4797 0.2172 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8269 1.9395 -0.1552 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8949 1.2121 -0.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7894 -0.1330 0.5268 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4607 -0.7281 0.2979 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6545 0.1064 -0.2525 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8465 -0.9830 0.0220 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8405 -1.4582 0.8198 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8267 -1.1344 2.0541 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9480 -2.3410 0.3217 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7620 -1.6928 -0.7467 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8038 -2.7664 1.4963 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9379 -3.6567 1.0697 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6813 3.3138 -0.7123 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7088 3.6547 -1.6055 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3324 4.8797 -1.4374 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9904 5.6532 -0.5213 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4297 5.3147 -2.3419 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5410 3.0998 -1.3998 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2710 2.6363 -0.2501 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5869 2.8302 -0.4460 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3568 3.8384 0.0582 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7899 4.7015 0.7973 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8092 3.9684 -0.2160 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6374 2.7234 2.2120 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9824 -4.1927 -2.2005 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8648 -4.5213 -3.7610 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8409 -3.5058 -2.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0074 -2.4694 -1.2673 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3075 -2.0222 0.3816 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3486 -3.0739 1.0039 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5484 -4.1275 -0.1423 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9122 -2.5679 0.4286 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3666 -2.2276 -1.2267 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8786 0.0922 -0.7029 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4183 0.5728 -1.7259 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0881 -0.9820 -1.8499 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5884 -0.3878 1.2802 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6320 -0.9034 3.3522 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1207 -1.7467 2.9744 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6004 -2.2810 2.2816 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1989 0.8695 3.1211 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9428 1.6889 1.7898 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0954 0.7148 2.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8993 1.6038 -0.3072 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0547 -0.0332 1.6296 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6280 -1.5821 -0.4314 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1847 -1.1632 1.3099 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5300 0.0997 -1.3766 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4423 -3.2498 -0.0782 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5258 -1.0072 -0.3323 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2415 -2.5012 -1.3511 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0713 -1.1732 -1.4489 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2720 -1.8403 1.9405 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1967 -3.2164 2.3026 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4011 -3.2432 0.1617 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6194 -4.7103 0.9190 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7162 -3.6309 1.8667 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4913 4.0892 0.0380 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2234 6.3203 -2.7912 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6637 4.5531 -3.1134 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3864 5.4610 -1.7664 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9806 3.4805 0.4815 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0799 5.0262 -0.1147 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9361 3.7253 -1.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4271 3.2803 0.3680 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0971 2.8979 3.0485 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 14 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 28 30 1 0 26 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 12 37 1 0 18 7 1 0 18 13 1 0 32 13 1 0 1 38 1 0 1 39 1 0 2 40 1 0 4 41 1 0 4 42 1 0 5 43 1 0 5 44 1 0 6 45 1 0 6 46 1 0 8 47 1 0 8 48 1 0 8 49 1 0 9 50 1 0 10 51 1 0 10 52 1 0 10 53 1 0 11 54 1 0 11 55 1 0 12 56 1 0 15 57 1 0 16 58 1 1 17 59 1 0 17 60 1 0 18 61 1 0 22 62 1 6 23 63 1 0 23 64 1 0 23 65 1 0 24 66 1 0 24 67 1 0 25 68 1 0 25 69 1 0 25 70 1 0 26 71 1 1 30 72 1 0 30 73 1 0 30 74 1 0 32 75 1 1 36 76 1 0 36 77 1 0 36 78 1 0 37 79 1 0 M END

Standard InCHIKey	UCTQGEZEUWGOLP-QTVNPKFLSA-N
Standard InCHI	InChI=1S/C29H42O8/c1-9-16(3)11-12-28(8)18(5)13-24(32)29-22(26(34-19(6)30)37-27(29)35-20(7)31)14-21(15-23(28)29)36-25(33)17(4)10-2/h9,14,17-18,21,23-24,26-27,32H,1,3,10-13,15H2,2,4-8H3/t17-,18?,21-,23?,24?,26-,27+,28?,29?/m0/s1
SMILES	C=CC(=C)CCC1(C)C(C)CC(C23C(=C[C@@H](CC12)OC(=O)[C@@H](C)CC)[C@@H](OC(=O)C)O[C@H]3OC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	518.29	Volume:	538.974 ? Van der Waals volume.
Dense:	0.962	LogP:	3.509 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.469 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.538 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	20.0
TPSA:	108.36 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	1.0	Rings:	3.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.204	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.819	Fsp³:	0.69
MCE-18:	92.02 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.41	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.102 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.202	Promiscuous compounds:	0.208

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.169	MDCK Permeability:	-4.85
Pgp-inhibitor:	0.909	Pgp-substrate:	0.833
PAMPA:	0.442 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.976	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.019	MRP1:	0.998
Plasma Protein Binding (PPB):	58.489%	Volume Distribution (VD):	-0.087
Fu:	42.743% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.945
OATP1B3 inhibitor:	0.735	BCRP inhibitor:	0.618
BSEP inhibitor:	0.995

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.521
CYP2C19-inhibitor:	0.217	CYP2C19-substrate:	0.2
CYP2C9-inhibitor:	0.025	CYP2C9-substrate:	0.001
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.033
CYP3A4-inhibitor:	0.024	CYP3A4-substrate:	0.049
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.994
HLM stability:	0.997 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

8.442

Half-life (T1/2):

1.144

ADMET: Toxicity

hERG Blockers:	0.056	hERG Blockers (10um):	0.348
Human Hepatotoxicity (H-HT):	0.634	Drug-induced Liver Injury (DILI):	0.801
AMES Toxicity:	0.96	Rat Oral Acute Toxicity:	0.875
Maximum Recommended Daily Dose:	0.984	Skin Sensitization:	0.984
Carcinogencity:	0.455	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.199
Drug-induced Neurotoxicity:	0.804	Ototoxicity:	0.654
Hematotoxicity:	0.237	Drug-induced Nephrotoxicity:	0.888
Genotoxicity:	0.998	RPMI-8226 Immunitoxicity:	0.402
A549 Cytotoxicity:	0.591	Hek293 Cytotoxicity:	0.598
BCF:	0.96 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.914 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.949 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.138 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40015	Anacolosa clarkii	Species	Aptandraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[30830773]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
TGI	4

Activity Type	# Activity
Cell line	2
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2276	Cell line	A673	Homo sapiens	TGI	=	1700.0	nM	PMID[30830773]
NPT15166	Cell line	Hep293TT	Homo sapiens	TGI	=	600.0	nM	PMID[30830773]
NPT2	Others	Unspecified	n.a.	TGI	=	800.0	nM	PMID[30830773]
NPT2	Others	Unspecified	n.a.	TGI	=	1100.0	nM	PMID[30830773]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC479942 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17985
0.1-0.2	27112
0.2-0.3	4594
0.3-0.4	45
0.4-0.5	35
0.5-0.6	32
0.6-0.7	33
0.7-0.8	0
0.8-0.85	1
0.85-0.9	3
0.9-0.95	3
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC475889
1.0	High Similarity	NPC7613
0.9333	High Similarity	NPC238397
0.9048	High Similarity	NPC127933
0.9032	High Similarity	NPC471363
0.8833	High Similarity	NPC479943
0.8548	High Similarity	NPC479940
0.8548	High Similarity	NPC7644
0.8281	Intermediate Similarity	NPC479941
0.7846	Intermediate Similarity	NPC330003
0.7846	Intermediate Similarity	NPC470321
0.7846	Intermediate Similarity	NPC264867
0.7846	Intermediate Similarity	NPC473207
0.7397	Intermediate Similarity	NPC486751
0.7313	Intermediate Similarity	NPC488658
0.7313	Intermediate Similarity	NPC488655
0.7164	Intermediate Similarity	NPC329623
0.7123	Intermediate Similarity	NPC87630
0.7	Intermediate Similarity	NPC125423
0.697	Remote Similarity	NPC602188
0.6901	Remote Similarity	NPC40728
0.6812	Remote Similarity	NPC88013
0.6667	Remote Similarity	NPC201880
0.6667	Remote Similarity	NPC488660
0.6667	Remote Similarity	NPC479497
0.6667	Remote Similarity	NPC488657
0.6667	Remote Similarity	NPC81567
0.6667	Remote Similarity	NPC179128
0.6667	Remote Similarity	NPC488652
0.6667	Remote Similarity	NPC609711
0.6618	Remote Similarity	NPC488236
0.6618	Remote Similarity	NPC479937
0.6571	Remote Similarity	NPC217921
0.6571	Remote Similarity	NPC135015
0.6522	Remote Similarity	NPC471366
0.6522	Remote Similarity	NPC476800
0.6522	Remote Similarity	NPC488237
0.6471	Remote Similarity	NPC488659
0.6471	Remote Similarity	NPC604149
0.6429	Remote Similarity	NPC128795
0.6389	Remote Similarity	NPC488964
0.6389	Remote Similarity	NPC184512
0.6364	Remote Similarity	NPC89171
0.6338	Remote Similarity	NPC473545
0.6338	Remote Similarity	NPC609715
0.6197	Remote Similarity	NPC134270
0.6197	Remote Similarity	NPC488654
0.6197	Remote Similarity	NPC479491
0.6197	Remote Similarity	NPC609880
0.6143	Remote Similarity	NPC472188
0.6143	Remote Similarity	NPC488656
0.6	Remote Similarity	NPC479939
0.5946	Remote Similarity	NPC472187
0.5946	Remote Similarity	NPC252296
0.5857	Remote Similarity	NPC479934
0.5714	Remote Similarity	NPC171598
0.5694	Remote Similarity	NPC488653
0.5679	Remote Similarity	NPC109376
0.5663	Remote Similarity	NPC224660
0.5625	Remote Similarity	NPC116292
0.56	Remote Similarity	NPC488963
0.56	Remote Similarity	NPC48548
0.5556	Remote Similarity	NPC479935
0.5556	Remote Similarity	NPC479936
0.5556	Remote Similarity	NPC318917
0.5556	Remote Similarity	NPC481019
0.5493	Remote Similarity	NPC481018
0.5405	Remote Similarity	NPC479938
0.5352	Remote Similarity	NPC472189
0.5333	Remote Similarity	NPC311223
0.5333	Remote Similarity	NPC481017
0.5286	Remote Similarity	NPC476802
0.527	Remote Similarity	NPC472186
0.5205	Remote Similarity	NPC481020
0.52	Remote Similarity	NPC488649
0.5172	Remote Similarity	NPC488962
0.5135	Remote Similarity	NPC471362
0.5135	Remote Similarity	NPC488235
0.5135	Remote Similarity	NPC471372
0.5132	Remote Similarity	NPC316974
0.5063	Remote Similarity	NPC488221
0.5063	Remote Similarity	NPC488220
0.5063	Remote Similarity	NPC488216
0.5056	Remote Similarity	NPC481025

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC479942 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7062
0.1-0.2	2028
0.2-0.3	60
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data