NPASS Compound

Natural Product: NPC479661

Natural Product ID	NPC479661
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MKPNQZDUYFWCKB-UAFBEPASSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 80 83 0 0 0 0 0 0 0 0999 V2000 3.5848 0.5455 -0.8031 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2779 0.0636 0.5605 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5974 -1.3761 0.7481 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0335 -1.7780 0.5606 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6281 -1.5445 -0.7324 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6366 -0.7203 -0.9197 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2239 0.0220 0.1998 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1919 -0.5362 -2.2844 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1472 0.2486 -2.4413 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6223 -1.2454 -3.3201 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7742 -1.3021 1.6437 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9765 0.4889 1.1322 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9224 1.9909 1.1940 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5207 2.3608 0.6776 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2269 1.1288 1.1016 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2855 1.1443 2.6008 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5318 0.9550 0.4533 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0627 -0.2676 0.5549 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3049 -1.3057 1.2910 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1724 -1.2548 1.1669 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7085 0.0312 0.5723 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5913 -0.0803 -0.8993 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3884 -0.6504 -0.0172 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2067 -1.6996 -1.0788 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2673 -1.2885 1.0597 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7223 -1.0289 0.8765 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0996 -0.7368 -0.5302 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9710 -1.3669 -1.0605 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3760 0.3334 -1.2292 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2024 0.1258 -2.6830 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2232 1.6023 -1.0435 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0832 0.5764 -0.4843 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1361 1.4485 -1.2900 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2181 2.0858 -0.2712 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5140 1.1900 -0.8719 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8020 1.2125 -1.2365 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7283 -0.2552 -1.5504 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0375 0.5903 1.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0127 -1.9759 0.0126 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3509 -1.7134 1.8026 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0550 -2.9129 0.7132 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2452 -2.0672 -1.5975 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9775 0.7642 -0.2121 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5021 0.6946 0.7325 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8427 -0.5913 0.8925 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0108 -1.1180 -4.2529 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3320 -1.6509 2.4611 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0012 0.1525 2.2162 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7051 2.4863 0.6075 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9803 2.4023 2.2219 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5091 2.5745 -0.3826 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1188 3.2347 1.2225 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3674 1.1704 2.9235 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1460 2.0695 3.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1825 0.3070 3.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5615 -1.1539 2.3821 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7209 -2.2921 1.0080 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4716 -2.0595 0.4621 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7046 -1.5023 2.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4143 -0.7360 -1.2781 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4538 0.8423 -1.4560 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3331 -0.6931 -1.1266 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4599 -1.4792 -1.8383 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9191 -2.6404 -0.5684 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2110 -1.9576 -1.5356 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1060 -2.3981 1.0564 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8904 -0.9383 2.0561 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3489 -1.8515 1.2912 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9868 -0.1268 1.4917 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1193 0.0886 -2.9160 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6374 -0.8088 -3.0815 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6294 0.9496 -3.2605 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9838 2.0716 -0.0702 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9770 2.2779 -1.8805 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3042 1.3222 -1.0886 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3553 1.1671 0.4154 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6553 2.1785 -1.9107 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4882 0.7471 -1.8846 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8414 2.6759 0.4517 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5054 2.7827 -0.7084 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 6 8 1 0 8 9 2 0 8 10 1 0 4 11 1 0 2 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 2 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 18 23 1 0 23 24 1 6 23 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 29 31 1 0 29 32 1 0 32 33 1 0 33 34 1 0 21 12 1 0 32 23 1 0 21 15 1 0 34 17 1 0 1 35 1 0 1 36 1 0 1 37 1 0 2 38 1 1 3 39 1 0 3 40 1 0 4 41 1 1 5 42 1 0 7 43 1 0 7 44 1 0 7 45 1 0 10 46 1 0 11 47 1 0 12 48 1 1 13 49 1 0 13 50 1 0 14 51 1 0 14 52 1 0 16 53 1 0 16 54 1 0 16 55 1 0 19 56 1 0 19 57 1 0 20 58 1 0 20 59 1 0 22 60 1 0 22 61 1 0 22 62 1 0 24 63 1 0 24 64 1 0 24 65 1 0 25 66 1 0 25 67 1 0 26 68 1 0 26 69 1 0 30 70 1 0 30 71 1 0 30 72 1 0 31 73 1 0 31 74 1 0 31 75 1 0 32 76 1 1 33 77 1 0 33 78 1 0 34 79 1 0 34 80 1 0 M END

Standard InCHIKey	MKPNQZDUYFWCKB-UAFBEPASSA-N
Standard InCHI	InChI=1S/C30H46O4/c1-18(16-20(31)17-19(2)26(33)34)21-10-14-30(7)23-8-9-24-27(3,4)25(32)12-13-28(24,5)22(23)11-15-29(21,30)6/h17-18,20-21,24,31H,8-16H2,1-7H3,(H,33,34)/b19-17+/t18-,20+,21-,24+,28-,29-,30+/m1/s1
SMILES	C[C@H](C[C@@H](/C=C(C)/C(=O)O)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3

Calculated Properties

Physi-Chem Properties

Molecular Weight:	470.34	Volume:	517.825 ? Van der Waals volume.
Dense:	0.908	LogP:	3.614 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.975 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.059 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	5.0	Rigid Bonds:	23.0
TPSA:	74.6 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.345	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.833	Fsp³:	0.8
MCE-18:	83.111 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.954	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.029 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.413	Promiscuous compounds:	0.3

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.076	MDCK Permeability:	-4.809
Pgp-inhibitor:	0.207	Pgp-substrate:	0.0
PAMPA:	0.995 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.056	30% Bioavailability (F30%):	0.301
50% Bioavailability (F50%):	0.972

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.849
Plasma Protein Binding (PPB):	93.577%	Volume Distribution (VD):	-0.121
Fu:	7.935% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.044
BSEP inhibitor:	0.994

ADMET: Metabolism

CYP1A2-inhibitor:	0.332	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.927	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.215
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.66
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.969
HLM stability:	0.187 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.891

Half-life (T1/2):

1.295

ADMET: Toxicity

hERG Blockers:	0.007	hERG Blockers (10um):	0.021
Human Hepatotoxicity (H-HT):	0.863	Drug-induced Liver Injury (DILI):	0.854
AMES Toxicity:	0.09	Rat Oral Acute Toxicity:	0.081
Maximum Recommended Daily Dose:	0.811	Skin Sensitization:	0.962
Carcinogencity:	0.734	Eye Corrosion:	0.057
Eye Irritation:	0.723	Respiratory Toxicity:	0.816
Drug-induced Neurotoxicity:	0.054	Ototoxicity:	0.783
Hematotoxicity:	0.591	Drug-induced Nephrotoxicity:	0.983
Genotoxicity:	0.839	RPMI-8226 Immunitoxicity:	0.054
A549 Cytotoxicity:	0.06	Hek293 Cytotoxicity:	0.111
BCF:	0.666 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.674 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.322 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.415 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6329	Abies chensiensis	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19435338]
NPO6329	Abies chensiensis	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[31557016]
NPO6329	Abies chensiensis	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6329	Abies chensiensis	Species	Pinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	4

Activity Type	# Activity
Organism	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT79	Organism	Bacillus subtilis	Bacillus subtilis	MIC	=	10.0	ug.mL-1	PMID[31557016]
NPT173	Organism	Klebsiella pneumoniae	Klebsiella pneumoniae	MIC	>	40.0	ug.mL-1	PMID[31557016]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	=	40.0	ug.mL-1	PMID[31557016]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	>	40.0	ug.mL-1	PMID[31557016]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC479661 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17399
0.1-0.2	28528
0.2-0.3	3384
0.3-0.4	420
0.4-0.5	97
0.5-0.6	20
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7581	Intermediate Similarity	NPC474083
0.7424	Intermediate Similarity	NPC489792
0.7231	Intermediate Similarity	NPC142253
0.7231	Intermediate Similarity	NPC3511
0.6769	Remote Similarity	NPC606148
0.6528	Remote Similarity	NPC73506
0.6389	Remote Similarity	NPC69982
0.6164	Remote Similarity	NPC489798
0.5915	Remote Similarity	NPC476174
0.5833	Remote Similarity	NPC479662
0.5753	Remote Similarity	NPC607625
0.5616	Remote Similarity	NPC289213
0.5616	Remote Similarity	NPC8571
0.5616	Remote Similarity	NPC54689
0.5556	Remote Similarity	NPC219495
0.5541	Remote Similarity	NPC243866
0.5526	Remote Similarity	NPC287833
0.55	Remote Similarity	NPC478309
0.5417	Remote Similarity	NPC201912
0.5417	Remote Similarity	NPC482576
0.5417	Remote Similarity	NPC38350
0.5417	Remote Similarity	NPC601139
0.5278	Remote Similarity	NPC109512
0.5256	Remote Similarity	NPC489789
0.519	Remote Similarity	NPC604630
0.5068	Remote Similarity	NPC605549
0.5067	Remote Similarity	NPC604148
0.5065	Remote Similarity	NPC214697

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC479661 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5518
0.1-0.2	3455
0.2-0.3	177
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data