NPASS Compound

Natural Product: NPC477288

Natural Product ID	NPC477288
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(1S,2R,4aS,6aR,6aS,6bR,8aR,10E,12aR,14bS)-10-hydroxyimino-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
IUPAC Name	(1S,2R,4aS,6aR,6aS,6bR,8aR,10E,12aR,14bS)-10-hydroxyimino-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11328874
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 4.0553 3.0556 0.1858 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4456 1.5947 -0.1152 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0572 1.3196 -1.5302 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1021 -0.1053 -1.9315 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6933 -1.1018 -0.8833 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7036 -2.0776 -1.4820 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3667 -1.5118 -1.7428 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7946 -0.5848 -0.7490 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6787 -0.3907 0.4024 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2258 -0.0343 1.6244 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2103 0.2009 1.9249 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0431 0.0076 0.7006 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5428 -1.0951 -0.1801 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4648 -1.5465 -1.2493 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8433 -1.0388 -1.2915 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1811 0.0676 -0.3486 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5327 -0.0355 0.9932 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8458 1.2101 1.7789 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2861 1.6102 1.7938 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8372 1.5934 0.4484 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4725 2.6360 -0.0409 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.6154 3.7678 0.7481 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6502 0.3434 -0.3556 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9948 0.7442 -1.8005 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5542 -0.7388 0.0703 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9653 -1.2058 1.8082 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2001 -2.2866 0.6909 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1774 -0.5465 0.3870 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8836 0.6563 0.8904 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0251 0.2397 1.8102 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4870 0.7209 -1.4818 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8953 -1.9120 -0.5579 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0047 -1.7409 -1.0946 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7663 -2.9034 0.3906 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8659 3.7563 -0.0196 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1037 3.3160 -0.3329 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8219 3.1013 1.2721 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5780 1.6142 -0.0800 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8224 1.8686 -2.1678 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1050 1.8537 -1.7961 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1331 -0.3300 -2.3343 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4581 -0.1994 -2.8577 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5997 -3.0081 -0.8959 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1876 -2.4317 -2.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4596 -1.0437 -2.7779 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6857 -2.3931 -1.9659 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8994 0.0867 2.4676 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5579 -0.3729 2.8064 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2324 1.2765 2.2872 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9170 0.9740 0.1210 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5013 -2.6783 -1.3060 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9852 -1.2910 -2.2462 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1377 -0.7023 -2.3344 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5888 -1.8695 -1.1035 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7158 1.0015 -0.8040 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5413 1.0995 2.8634 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2737 2.0931 1.4304 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4682 2.5512 2.3504 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8312 0.8330 2.4069 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6732 4.6947 0.3437 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1980 1.3507 -2.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9095 1.3692 -1.7438 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2602 -0.1457 -2.4084 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1662 -1.7482 0.1568 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0673 -0.3983 1.0199 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4265 -0.8212 -0.6494 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8344 -2.1826 1.3630 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0289 -1.0014 2.1196 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4238 -1.1727 2.7763 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8656 -2.5838 0.6263 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7766 -3.2068 0.4079 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4839 -2.1138 1.7697 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3451 -1.3547 1.1681 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2146 1.2703 1.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7663 -0.5969 2.4649 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9280 0.0386 1.1795 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2937 1.1034 2.4496 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0835 0.7890 -2.4344 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5699 0.7601 -1.8464 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7750 1.5979 -0.8781 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4540 -3.6652 0.4676 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 2 0 21 22 1 0 20 23 1 0 23 24 1 0 23 25 1 0 17 26 1 1 13 27 1 1 9 28 1 0 28 29 1 0 29 30 1 0 8 31 1 6 5 32 1 1 32 33 2 0 32 34 1 0 29 2 1 0 28 5 1 0 13 8 1 0 17 12 1 0 23 16 1 0 1 35 1 0 1 36 1 0 1 37 1 0 2 38 1 6 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 6 43 1 0 6 44 1 0 7 45 1 0 7 46 1 0 10 47 1 0 11 48 1 0 11 49 1 0 12 50 1 6 14 51 1 0 14 52 1 0 15 53 1 0 15 54 1 0 16 55 1 6 18 56 1 0 18 57 1 0 19 58 1 0 19 59 1 0 22 60 1 0 24 61 1 0 24 62 1 0 24 63 1 0 25 64 1 0 25 65 1 0 25 66 1 0 26 67 1 0 26 68 1 0 26 69 1 0 27 70 1 0 27 71 1 0 27 72 1 0 28 73 1 1 29 74 1 1 30 75 1 0 30 76 1 0 30 77 1 0 31 78 1 0 31 79 1 0 31 80 1 0 34 81 1 0 M END

Standard InCHIKey	FMHWMOZSBSUIPO-KTSBXWNTSA-N
Standard InCHI	InChI=1S/C30H47NO3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31-34)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-22,24,34H,9-17H2,1-7H3,(H,32,33)/b31-23+/t18-,19+,21+,22-,24+,27+,28-,29-,30+/m1/s1
SMILES	C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC/C(=N\O)/C5(C)C)C)C)[C@@H]2[C@H]1C)C)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	469.36	Volume:	514.112 ? Van der Waals volume.
Dense:	0.913	LogP:	4.127 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.467 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.219 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	28.0
TPSA:	69.89 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.236	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.921	Fsp³:	0.867
MCE-18:	101.786 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.66	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.027 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.042	Promiscuous compounds:	0.179

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.532	MDCK Permeability:	-5.072
Pgp-inhibitor:	0.173	Pgp-substrate:	0.0
PAMPA:	0.97 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.262	30% Bioavailability (F30%):	0.145
50% Bioavailability (F50%):	0.987

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.01	MRP1:	0.518
Plasma Protein Binding (PPB):	98.38%	Volume Distribution (VD):	-0.343
Fu:	1.626% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.999	BCRP inhibitor:	0.01
BSEP inhibitor:	0.988

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.07	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.081	CYP2C9-substrate:	0.004
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.535
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.734

Half-life (T1/2):

0.759

ADMET: Toxicity

hERG Blockers:	0.019	hERG Blockers (10um):	0.042
Human Hepatotoxicity (H-HT):	0.749	Drug-induced Liver Injury (DILI):	0.942
AMES Toxicity:	0.312	Rat Oral Acute Toxicity:	0.413
Maximum Recommended Daily Dose:	0.309	Skin Sensitization:	0.877
Carcinogencity:	0.918	Eye Corrosion:	0.041
Eye Irritation:	0.78	Respiratory Toxicity:	0.96
Drug-induced Neurotoxicity:	0.034	Ototoxicity:	0.731
Hematotoxicity:	0.851	Drug-induced Nephrotoxicity:	0.949
Genotoxicity:	0.795	RPMI-8226 Immunitoxicity:	0.02
A549 Cytotoxicity:	0.042	Hek293 Cytotoxicity:	0.161
BCF:	1.569 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.935 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.303 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.782 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO26571	Ilex paraguariensis	Species	Aquifoliaceae	Eukaryota	leaves	Mato Leitao, RS, Brazil	n.a.	PMID[18192087]
NPO26571	Ilex paraguariensis	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25955847]
NPO26571	Ilex paraguariensis	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26571	Ilex paraguariensis	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO26571	Ilex paraguariensis	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO26571	Ilex paraguariensis	Species	Aquifoliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT441	Individual protein	Cytochrome P450 19A1	Homo sapiens	IC50	>	500000	nM	PMID[18192087]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477288 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28767
0.1-0.2	18310
0.2-0.3	2182
0.3-0.4	374
0.4-0.5	151
0.5-0.6	42
0.6-0.7	15
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8065	Intermediate Similarity	NPC274050
0.8065	Intermediate Similarity	NPC162632
0.7313	Intermediate Similarity	NPC173089
0.6765	Remote Similarity	NPC51700
0.6765	Remote Similarity	NPC88716
0.6765	Remote Similarity	NPC68160
0.6667	Remote Similarity	NPC61543
0.6667	Remote Similarity	NPC293048
0.6667	Remote Similarity	NPC225585
0.6667	Remote Similarity	NPC71074
0.6667	Remote Similarity	NPC605937
0.6571	Remote Similarity	NPC32407
0.6571	Remote Similarity	NPC263548
0.6571	Remote Similarity	NPC606320
0.6479	Remote Similarity	NPC474964
0.6377	Remote Similarity	NPC477289
0.6338	Remote Similarity	NPC87095
0.625	Remote Similarity	NPC485589
0.5972	Remote Similarity	NPC38754
0.5921	Remote Similarity	NPC485586
0.5921	Remote Similarity	NPC485588
0.589	Remote Similarity	NPC305464
0.589	Remote Similarity	NPC19376
0.589	Remote Similarity	NPC25848
0.5844	Remote Similarity	NPC230151
0.5733	Remote Similarity	NPC477290
0.5694	Remote Similarity	NPC274330
0.5556	Remote Similarity	NPC485585
0.5542	Remote Similarity	NPC57362
0.5541	Remote Similarity	NPC158141
0.5541	Remote Similarity	NPC37221
0.5526	Remote Similarity	NPC148964
0.5476	Remote Similarity	NPC177246
0.5357	Remote Similarity	NPC485882
0.5352	Remote Similarity	NPC161496
0.5325	Remote Similarity	NPC62516
0.52	Remote Similarity	NPC263272
0.5172	Remote Similarity	NPC485587
0.5139	Remote Similarity	NPC604575
0.5135	Remote Similarity	NPC267691
0.5128	Remote Similarity	NPC127689
0.5128	Remote Similarity	NPC25299
0.5128	Remote Similarity	NPC481322
0.5114	Remote Similarity	NPC173569
0.5067	Remote Similarity	NPC480946
0.5067	Remote Similarity	NPC130577
0.5067	Remote Similarity	NPC142415
0.5067	Remote Similarity	NPC102683
0.5065	Remote Similarity	NPC259733
0.5065	Remote Similarity	NPC158371
0.5065	Remote Similarity	NPC207922
0.5065	Remote Similarity	NPC202728
0.5065	Remote Similarity	NPC158059
0.5065	Remote Similarity	NPC40092
0.5065	Remote Similarity	NPC293564
0.5065	Remote Similarity	NPC136697
0.5065	Remote Similarity	NPC479077
0.5063	Remote Similarity	NPC20235
0.5063	Remote Similarity	NPC299996
0.5063	Remote Similarity	NPC117663

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477288 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6967
0.1-0.2	2155
0.2-0.3	23
0.3-0.4	4
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data