NPASS Compound

Natural Product: NPC472738

Natural Product ID	NPC472738
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SWUCFBDPUPIURE-ZNJAMJCFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3581940
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 -4.9326 2.7082 1.9696 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4232 1.4736 2.4387 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3755 0.4485 2.1218 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8286 -0.2293 3.0864 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0294 0.3017 0.6885 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2760 -0.2093 -0.0563 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8331 -1.5353 -0.6801 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4004 -1.1110 -1.0547 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9701 -0.6430 0.3437 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5936 -0.0538 0.1991 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0613 0.5668 1.4395 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2769 1.2285 1.1567 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1977 0.3101 0.4270 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5909 -0.1701 -0.8517 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6195 -1.0218 -0.4137 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2190 -2.0669 0.5866 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1364 -1.7572 -1.6044 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5500 -2.2458 -1.4819 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1373 0.9448 -1.7495 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5046 -1.0443 -1.6673 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9354 -0.5818 -1.6806 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4509 -0.1983 -0.3253 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5928 0.8441 0.3353 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7018 2.2026 -0.2690 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0376 0.9859 1.8002 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4940 0.8519 2.0026 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3170 0.9233 0.7940 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3142 1.6214 0.7302 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8975 0.1058 -0.3789 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6766 -1.2143 -0.2592 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3820 0.7515 -1.6385 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1247 0.3833 -2.6491 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5599 -0.0129 -2.0387 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3330 2.9235 1.0770 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3644 1.2810 1.8875 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5831 1.5902 3.5088 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1226 -0.0579 4.1107 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0877 -0.9763 2.8896 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7942 1.2932 0.2477 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6063 0.5048 -0.8115 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0954 -0.4334 0.6263 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4256 -1.7178 -1.5858 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8378 -2.3444 0.0551 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9886 -1.5553 0.9712 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7269 0.8153 -0.5162 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7599 1.4183 1.7030 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0288 -0.0551 2.3378 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7324 1.3976 2.1777 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1133 2.2117 0.7345 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2945 -0.6093 1.0843 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8928 -2.9696 0.4681 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2916 -1.7938 1.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8032 -2.4798 0.4411 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4994 -2.6847 -1.7253 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0460 -1.2386 -2.5664 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8676 -2.5905 -2.4888 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6730 -3.0963 -0.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9136 1.1219 -2.5557 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0218 1.9197 -1.2654 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7834 0.7551 -2.3148 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1666 -0.9932 -2.7472 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4831 -2.1049 -1.4256 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5600 -1.4659 -2.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3304 -1.1254 0.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7099 2.6216 0.0164 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9650 2.8672 0.1874 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6411 2.2613 -1.3485 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5161 0.2549 2.4523 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6792 1.9993 2.1486 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8408 1.6551 2.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7590 -0.1067 2.5380 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6214 -1.6670 -1.2884 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7557 -1.0210 -0.0834 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2241 -1.8760 0.4923 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9056 1.6940 -1.8970 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4266 0.0205 -2.4991 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4719 0.9993 -1.4612 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8543 0.0248 -3.5090 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3481 0.9978 -1.7179 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5795 0.0164 -2.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8771 -0.2381 -2.9097 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 1 15 17 1 0 17 18 1 0 14 19 1 6 14 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 6 23 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 1 0 29 31 1 0 21 32 1 0 8 33 1 6 9 5 1 0 15 10 1 0 29 22 1 0 18 8 1 0 23 13 1 0 1 34 1 0 2 35 1 0 2 36 1 0 4 37 1 0 4 38 1 0 5 39 1 6 6 40 1 0 6 41 1 0 7 42 1 0 7 43 1 0 9 44 1 1 10 45 1 6 11 46 1 0 11 47 1 0 12 48 1 0 12 49 1 0 13 50 1 1 16 51 1 0 16 52 1 0 16 53 1 0 17 54 1 0 17 55 1 0 18 56 1 0 18 57 1 0 19 58 1 0 19 59 1 0 19 60 1 0 20 61 1 0 20 62 1 0 21 63 1 6 22 64 1 1 24 65 1 0 24 66 1 0 24 67 1 0 25 68 1 0 25 69 1 0 26 70 1 0 26 71 1 0 30 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 31 76 1 0 31 77 1 0 32 78 1 0 33 79 1 0 33 80 1 0 33 81 1 0 M END

Standard InCHIKey	SWUCFBDPUPIURE-ZNJAMJCFSA-N
Standard InCHI	InChI=1S/C30H48O3/c1-18(17-31)19-10-12-27(4)14-15-29(6)20(24(19)27)8-9-22-28(5)13-11-23(33)26(2,3)25(28)21(32)16-30(22,29)7/h19-22,24-25,31-32H,1,8-17H2,2-7H3/t19-,20+,21+,22+,24+,25-,27+,28+,29+,30+/m0/s1
SMILES	OCC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)C[C@H]([C@@H]1[C@]3(C)CCC(=O)C1(C)C)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	456.36	Volume:	505.751 ? Van der Waals volume.
Dense:	0.902	LogP:	3.616 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.584 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.167 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	27.0
TPSA:	57.53 ? Topological Polar Surface Area.	H-Bond Acceptor:	3.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	3.0

MedChem Properties

QED Drug-Likeness Score:	0.488	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.014	Fsp³:	0.9
MCE-18:	102.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.87	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.387	Promiscuous compounds:	0.387

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.349	MDCK Permeability:	-4.992
Pgp-inhibitor:	0.1	Pgp-substrate:	0.05
PAMPA:	0.611 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.017	30% Bioavailability (F30%):	0.266
50% Bioavailability (F50%):	0.88

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.519	MRP1:	0.932
Plasma Protein Binding (PPB):	95.003%	Volume Distribution (VD):	0.246
Fu:	5.797% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.132
BSEP inhibitor:	0.86

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.098	CYP2C19-substrate:	0.075
CYP2C9-inhibitor:	0.002	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.004
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.911
HLM stability:	0.209 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

10.184

Half-life (T1/2):

0.507

ADMET: Toxicity

hERG Blockers:	0.052	hERG Blockers (10um):	0.169
Human Hepatotoxicity (H-HT):	0.637	Drug-induced Liver Injury (DILI):	0.267
AMES Toxicity:	0.305	Rat Oral Acute Toxicity:	0.275
Maximum Recommended Daily Dose:	0.439	Skin Sensitization:	0.966
Carcinogencity:	0.888	Eye Corrosion:	0.038
Eye Irritation:	0.438	Respiratory Toxicity:	0.702
Drug-induced Neurotoxicity:	0.15	Ototoxicity:	0.662
Hematotoxicity:	0.808	Drug-induced Nephrotoxicity:	0.76
Genotoxicity:	0.712	RPMI-8226 Immunitoxicity:	0.054
A549 Cytotoxicity:	0.195	Hek293 Cytotoxicity:	0.452
BCF:	1.472 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.731 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.262 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.612 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32825	cassine xylocarpa	Species	Celastraceae	Eukaryota	dried stems	Ahuachapan, El Salvado	n.a.	PMID[25927586]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1
IC50	1
Ratio CC50/IC50	1
CC50	1

Activity Type	# Activity
Cell line	1
Organism	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT460	Cell line	MT2	Homo sapiens	CC50	=	20000.0	nM	PMID[23249297]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	Inhibition	>	50.0	%	PMID[12027740]
NPT24	Organism	Human immunodeficiency virus 1	Human immunodeficiency virus 1	IC50	=	9500.0	nM	PMID[10727804]
NPT2	Others	Unspecified	n.a.	Ratio CC50/IC50	=	2.1	n.a.	PMID[19743809]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472738 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21581
0.1-0.2	25008
0.2-0.3	3001
0.3-0.4	203
0.4-0.5	46
0.5-0.6	11
0.6-0.7	4
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8246	Intermediate Similarity	NPC472739
0.7414	Intermediate Similarity	NPC103754
0.7241	Intermediate Similarity	NPC23884
0.7167	Intermediate Similarity	NPC474482
0.6667	Remote Similarity	NPC4643
0.6452	Remote Similarity	NPC475745
0.6154	Remote Similarity	NPC292553
0.6	Remote Similarity	NPC43300
0.5938	Remote Similarity	NPC474484
0.5902	Remote Similarity	NPC14112
0.5781	Remote Similarity	NPC475726
0.5714	Remote Similarity	NPC159497
0.5652	Remote Similarity	NPC474719
0.5588	Remote Similarity	NPC193907
0.5556	Remote Similarity	NPC248830
0.5556	Remote Similarity	NPC212241
0.5224	Remote Similarity	NPC73064
0.5152	Remote Similarity	NPC201459
0.5152	Remote Similarity	NPC74363

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472738 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6403
0.1-0.2	2641
0.2-0.3	106
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data