NPASS Compound

Natural Product: NPC472612

Natural Product ID	NPC472612
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UKOWEFSYOURPSF-SSZVGQTDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3581231
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000476] Cinnamic acids and derivatives [CHEMONTID:0001391] Hydroxycinnamic acids and derivatives [CHEMONTID:0000059] Coumaric acids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 120124 0 0 0 0 0 0 0 0999 V2000 3.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7500 -3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -5.1962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2500 -3.8971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0000 -5.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4635 -6.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6203 -8.1145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9635 -6.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4271 -5.1962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2135 -4.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2172 -3.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2209 -2.0850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2098 -3.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6734 -1.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1880 -1.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6260 -0.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3540 -0.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0819 -1.7634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1342 -3.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9468 -3.9942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8622 -4.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4622 -3.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7343 -4.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0587 -3.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3308 -4.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6552 -3.5345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9273 -4.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2785 -5.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9540 -6.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6820 -5.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9017 -7.9411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1738 -8.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5505 -6.5327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5495 1.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0349 0.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5968 -0.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.8689 0.2037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9826 2.2987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2251 1.7126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4307 -6.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8980 -7.2465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3615 -8.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.3578 -9.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8287 -8.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2922 -10.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.7595 -10.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.7632 -9.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.2304 -9.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -18.2341 -8.8058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -19.7013 -9.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.6939 -11.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.6902 -12.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.2230 -12.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -17.1537 -13.8884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.1500 -15.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -19.1611 -11.6590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 2.5981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 3.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0490 -0.5490 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3692 -1.8851 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 -2.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -2.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8847 -3.2352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2197 -1.8318 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6297 -5.8063 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9963 -6.9346 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9060 -8.8871 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9897 -8.1225 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3319 -4.2035 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3785 -1.9562 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1164 -0.5887 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1288 -2.1360 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6223 0.9411 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7201 0.3910 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1488 -2.2406 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9145 -5.5564 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8758 -1.9113 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9280 -1.9495 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7222 -3.0573 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1324 -5.6014 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1994 -5.1243 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3575 -6.3513 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3789 -10.0080 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1178 -7.5703 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4458 -9.5308 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6813 -8.0270 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0131 2.4350 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4532 1.2880 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8404 -1.4299 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9997 1.6980 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2547 3.0936 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1728 3.2117 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1189 -8.4018 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7426 -5.4674 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8324 -7.8702 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2885 -11.5262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2996 -8.1821 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -20.0132 -7.6505 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -19.3894 -10.5849 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -21.1685 -9.4295 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.2193 -13.2647 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.2648 -16.0068 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0353 -13.9994 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1463 -16.1178 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -19.6247 -13.0856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9888 0.1828 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 2.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0490 4.6471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5490 3.1471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 5.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 2 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 16 19 1 1 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 2 0 34 35 1 0 35 36 2 0 35 37 1 0 37 38 1 0 34 39 1 0 22 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 14 46 1 0 46 47 1 0 47 48 1 0 48 49 2 0 48 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 2 0 57 58 1 0 58 59 2 0 58 60 1 0 60 61 1 0 57 62 1 0 5 63 2 0 63 64 1 0 64 65 2 0 65 66 1 0 64 67 1 0 67 68 1 0 65 3 1 0 16 11 1 0 42 20 1 0 59 52 1 0 36 29 1 0 1 69 1 0 1 70 1 0 1 71 1 0 4 72 1 0 6 73 1 0 7 74 1 0 11 75 1 6 12 76 1 1 13 77 1 0 14 78 1 6 17 79 1 0 17 80 1 0 18 81 1 0 20 82 1 1 22 83 1 6 23 84 1 0 23 85 1 0 27 86 1 0 28 87 1 0 30 88 1 0 33 89 1 0 33 90 1 0 33 91 1 0 36 92 1 0 38 93 1 0 38 94 1 0 38 95 1 0 39 96 1 0 40 97 1 1 41 98 1 6 42 99 1 1 43100 1 0 44101 1 0 45102 1 0 46103 1 0 46104 1 0 50105 1 0 51106 1 0 53107 1 0 56108 1 0 56109 1 0 56110 1 0 59111 1 0 61112 1 0 61113 1 0 61114 1 0 62115 1 0 63116 1 0 66117 1 0 68118 1 0 68119 1 0 68120 1 0 M END

Standard InCHIKey	UKOWEFSYOURPSF-SSZVGQTDSA-N
Standard InCHI	InChI=1S/C45H52O23/c1-57-25-13-22(14-26(58-2)36(25)50)7-10-33(47)63-19-31-39(53)41(55)42(56)44(65-31)68-45(21-46)43(66-35(49)12-9-24-17-29(61-5)38(52)30(18-24)62-6)40(54)32(67-45)20-64-34(48)11-8-23-15-27(59-3)37(51)28(16-23)60-4/h7-18,31-32,39-44,46,50-56H,19-21H2,1-6H3/b10-7+,11-8+,12-9+/t31-,32-,39-,40-,41+,42-,43+,44-,45+/m1/s1
SMILES	COc1cc(/C=C/C(=O)O[C@H]2[C@H](O)[C@H](O[C@@]2(CO)O[C@H]2O[C@H](COC(=O)/C=C/c3cc(OC)c(c(c3)OC)O)[C@H]([C@@H]([C@H]2O)O)O)COC(=O)/C=C/c2cc(OC)c(c(c2)OC)O)cc(c1O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	960.29	Volume:	906.722 ? Van der Waals volume.
Dense:	1.059	LogP:	1.818 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.989 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.502 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	23.0	Rigid Bonds:	35.0
TPSA:	323.81 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	8.0	Rings:	5.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.044	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.394	Fsp³:	0.4
MCE-18:	134.714 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.843	Fluc inhibitor:	0.996 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.23 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.654 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.113	Promiscuous compounds:	0.402

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.916	MDCK Permeability:	-5.442
Pgp-inhibitor:	0.966	Pgp-substrate:	0.113
PAMPA:	0.035 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.348
20% Bioavailability (F20%):	0.412	30% Bioavailability (F30%):	0.927
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.736
Plasma Protein Binding (PPB):	84.162%	Volume Distribution (VD):	-0.483
Fu:	17.35% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.974
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.553
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.885
CYP2C9-inhibitor:	0.026	CYP2C9-substrate:	0.852
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.924 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.267

Half-life (T1/2):

4.176

ADMET: Toxicity

hERG Blockers:	0.099	hERG Blockers (10um):	0.698
Human Hepatotoxicity (H-HT):	0.254	Drug-induced Liver Injury (DILI):	0.827
AMES Toxicity:	0.735	Rat Oral Acute Toxicity:	0.085
Maximum Recommended Daily Dose:	0.537	Skin Sensitization:	0.998
Carcinogencity:	0.057	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.028
Drug-induced Neurotoxicity:	0.143	Ototoxicity:	0.918
Hematotoxicity:	0.106	Drug-induced Nephrotoxicity:	0.872
Genotoxicity:	0.015	RPMI-8226 Immunitoxicity:	0.655
A549 Cytotoxicity:	0.699	Hek293 Cytotoxicity:	0.715
BCF:	0.456 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.514 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.997 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.392 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24176362]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	seeds	n.a.	n.a.	PMID[25466198]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	Root	n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT34	Cell line	BV-2	Mus musculus	IC50	=	21630.0	nM	PMID[25466198]
NPT81	Cell line	A549	Homo sapiens	IC50	=	20820.0	nM	PMID[22292922]
NPT146	Cell line	SK-OV-3	Homo sapiens	IC50	=	6710.0	nM	DOI[10.1007/s00044-010-9361-y]
NPT147	Cell line	SK-MEL-2	Homo sapiens	IC50	=	9500.0	nM	PMID[16562837]
NPT148	Cell line	HCT-15	Homo sapiens	IC50	=	12370.0	nM	PMID[16033252]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472612 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14048
0.1-0.2	31002
0.2-0.3	4119
0.3-0.4	556
0.4-0.5	96
0.5-0.6	12
0.6-0.7	13
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8904	High Similarity	NPC90896
0.8333	Intermediate Similarity	NPC283839
0.8101	Intermediate Similarity	NPC300262
0.7722	Intermediate Similarity	NPC262182
0.7722	Intermediate Similarity	NPC289967
0.7625	Intermediate Similarity	NPC83743
0.747	Intermediate Similarity	NPC173343
0.7333	Intermediate Similarity	NPC297342
0.7093	Intermediate Similarity	NPC472611
0.6905	Remote Similarity	NPC80732
0.6835	Remote Similarity	NPC225307
0.6667	Remote Similarity	NPC287615
0.6667	Remote Similarity	NPC125823
0.6667	Remote Similarity	NPC7145
0.6667	Remote Similarity	NPC199311
0.6667	Remote Similarity	NPC143480
0.6444	Remote Similarity	NPC201148
0.6374	Remote Similarity	NPC261122
0.631	Remote Similarity	NPC226005
0.6136	Remote Similarity	NPC216819
0.6047	Remote Similarity	NPC21516
0.6044	Remote Similarity	NPC3460
0.5977	Remote Similarity	NPC186073
0.5889	Remote Similarity	NPC192763
0.5638	Remote Similarity	NPC210611
0.5595	Remote Similarity	NPC219677
0.5586	Remote Similarity	NPC601579
0.5517	Remote Similarity	NPC28637
0.5312	Remote Similarity	NPC481006
0.5217	Remote Similarity	NPC476865
0.5208	Remote Similarity	NPC85192
0.5155	Remote Similarity	NPC215095
0.507	Remote Similarity	NPC48315
0.5059	Remote Similarity	NPC195196

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472612 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4692
0.1-0.2	4378
0.2-0.3	76
0.3-0.4	3
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data