NPASS Compound

Natural Product: NPC472611

Natural Product ID	NPC472611
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZFUNZIPOLRYQON-CTDLUVRVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3581230
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000476] Cinnamic acids and derivatives [CHEMONTID:0001391] Hydroxycinnamic acids and derivatives [CHEMONTID:0000059] Coumaric acids and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 116120 0 0 0 0 0 0 0 0999 V2000 5.2186 -2.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4686 -0.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9686 -0.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2186 -2.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7186 -2.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0314 -0.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7186 0.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2186 0.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9686 1.7502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0314 1.7502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7186 3.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0314 -3.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5314 -3.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2814 -4.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7814 -4.7450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5314 -6.0440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2814 -7.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0314 -8.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6219 -9.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3614 -10.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5105 -11.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9200 -11.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1805 -9.6063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4200 -11.0835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1700 -12.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1737 -13.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4237 -14.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9565 -14.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7997 -12.9927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7997 -15.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6429 -17.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7940 -15.4064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9508 -16.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7373 -17.7799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3211 -17.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4779 -19.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8482 -19.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0618 -18.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.4321 -19.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5889 -20.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3754 -21.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0050 -21.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5322 -23.2039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3186 -24.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.9592 -21.4405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.6456 -18.4569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -16.0159 -19.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1774 -12.3825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6446 -12.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1081 -14.1210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6483 -11.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1155 -11.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.1192 -10.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.6557 -9.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.6594 -8.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.1266 -8.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -15.5902 -9.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.5865 -11.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -16.1303 -7.4327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.1959 -6.8090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.1996 -5.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3835 -11.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5971 -10.6192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2605 -12.8956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6114 -11.9314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1219 -9.1551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9686 -3.4460 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5176 -1.3969 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9195 -2.8969 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9686 -3.4460 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5314 -0.8479 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4686 1.7502 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4686 4.3483 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5805 3.7992 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0176 2.2992 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7186 -4.7450 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2814 -2.1469 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5805 -6.5931 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5476 -7.6545 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1805 -7.6779 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3888 -8.3928 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1002 -10.2950 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3614 -12.5607 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8153 -12.5798 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3872 -14.3789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1375 -16.2688 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4565 -14.4844 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3079 -15.8194 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2612 -16.3137 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2726 -18.0781 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5347 -16.6266 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2644 -19.8818 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9050 -17.2367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7915 -21.9836 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1051 -24.9672 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2003 -25.2991 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4369 -22.8720 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1160 -22.9323 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.3863 -19.6771 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.6260 -17.6967 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.4058 -20.4374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1848 -10.1531 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5791 -13.3181 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1885 -9.0384 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.0574 -10.2859 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0500 -12.5153 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -17.5975 -7.7446 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2033 -4.5795 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0849 -4.6905 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.3143 -6.6979 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5327 -12.4650 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5019 -10.2873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0743 -10.8796 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5105 -14.1946 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8886 -11.9314 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7809 -10.3531 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 7 10 1 0 10 11 1 0 5 12 1 0 12 13 2 3 13 14 1 0 14 15 2 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 27 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 2 3 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 41 43 1 0 43 44 1 0 40 45 1 0 39 46 1 0 46 47 1 0 26 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 51 52 2 3 52 53 1 0 53 54 2 0 54 55 1 0 55 56 2 0 56 57 1 0 57 58 2 0 56 59 1 0 55 60 1 0 60 61 1 0 25 62 1 0 62 63 1 0 21 64 1 0 20 65 1 0 19 66 1 0 8 3 1 0 23 18 1 0 29 25 1 0 42 37 1 0 58 53 1 0 1 67 1 0 1 68 1 0 1 69 1 0 4 70 1 0 6 71 1 0 9 72 1 0 11 73 1 0 11 74 1 0 11 75 1 0 12 76 1 0 13 77 1 0 17 78 1 0 17 79 1 0 18 80 1 0 19 81 1 0 20 82 1 0 21 83 1 0 22 84 1 0 26 85 1 0 27 86 1 0 28 87 1 0 30 88 1 0 30 89 1 0 31 90 1 0 35 91 1 0 36 92 1 0 38 93 1 0 42 94 1 0 44 95 1 0 44 96 1 0 44 97 1 0 45 98 1 0 47 99 1 0 47100 1 0 47101 1 0 51102 1 0 52103 1 0 54104 1 0 57105 1 0 58106 1 0 59107 1 0 61108 1 0 61109 1 0 61110 1 0 62111 1 0 62112 1 0 63113 1 0 64114 1 0 65115 1 0 66116 1 0 M END

Standard InCHIKey	ZFUNZIPOLRYQON-CTDLUVRVSA-N
Standard InCHI	InChI=1S/C44H50O22/c1-56-26-14-22(6-10-25(26)47)7-12-35(50)64-42-41(63-34(49)13-9-24-17-29(59-4)37(52)30(18-24)60-5)31(19-45)65-44(42,21-46)66-43-40(55)39(54)38(53)32(62-43)20-61-33(48)11-8-23-15-27(57-2)36(51)28(16-23)58-3/h6-18,31-32,38-43,45-47,51-55H,19-21H2,1-5H3/b11-8+,12-7+,13-9+/t31-,32-,38-,39+,40-,41-,42+,43-,44+/m1/s1
SMILES	COC1=CC(=CC(=C1O)OC)C=CC(=O)OCC2C(C(C(C(O2)OC3(C(C(C(O3)CO)OC(=O)C=CC4=CC(=C(C(=C4)OC)O)OC)OC(=O)C=CC5=CC(=C(C=C5)O)OC)CO)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	930.28	Volume:	880.636 ? Van der Waals volume.
Dense:	1.056	LogP:	1.509 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.859 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.232 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	22.0	Rigid Bonds:	35.0
TPSA:	314.58 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	8.0	Rings:	5.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.046	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.401	Fsp³:	0.386
MCE-18:	131.803 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.722	Fluc inhibitor:	0.667 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.347 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.626 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.222	Promiscuous compounds:	0.305

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.115	MDCK Permeability:	-5.432
Pgp-inhibitor:	0.001	Pgp-substrate:	0.312
PAMPA:	0.969 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.994	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.987
Plasma Protein Binding (PPB):	80.125%	Volume Distribution (VD):	-0.428
Fu:	19.358% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.775
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.612
BSEP inhibitor:	0.826

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.196	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.979	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.459
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.327 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.557

Half-life (T1/2):

3.375

ADMET: Toxicity

hERG Blockers:	0.085	hERG Blockers (10um):	0.59
Human Hepatotoxicity (H-HT):	0.311	Drug-induced Liver Injury (DILI):	0.358
AMES Toxicity:	0.823	Rat Oral Acute Toxicity:	0.224
Maximum Recommended Daily Dose:	0.581	Skin Sensitization:	0.999
Carcinogencity:	0.072	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.012
Drug-induced Neurotoxicity:	0.69	Ototoxicity:	0.977
Hematotoxicity:	0.012	Drug-induced Nephrotoxicity:	0.728
Genotoxicity:	0.007	RPMI-8226 Immunitoxicity:	0.55
A549 Cytotoxicity:	0.548	Hek293 Cytotoxicity:	0.973
BCF:	0.439 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.344 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.882 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.221 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24176362]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	seeds	n.a.	n.a.	PMID[25466198]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	Root	n.a.	n.a.	Database[FooDB]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO7539	Raphanus sativus	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT34	Cell line	BV-2	Mus musculus	IC50	=	34800.0	nM	PMID[25466198]
NPT81	Cell line	A549	Homo sapiens	IC50	=	26940.0	nM	PMID[22749279]
NPT146	Cell line	SK-OV-3	Homo sapiens	IC50	=	23790.0	nM	PMID[15187442]
NPT147	Cell line	SK-MEL-2	Homo sapiens	IC50	=	16700.0	nM	PMID[17315960]
NPT148	Cell line	HCT-15	Homo sapiens	IC50	=	18850.0	nM	PMID[16033252]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC472611 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16415
0.1-0.2	28904
0.2-0.3	3777
0.3-0.4	603
0.4-0.5	117
0.5-0.6	24
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9114	High Similarity	NPC289967
0.7471	Intermediate Similarity	NPC83743
0.7126	Intermediate Similarity	NPC90896
0.7111	Intermediate Similarity	NPC300262
0.7093	Intermediate Similarity	NPC472612
0.7011	Intermediate Similarity	NPC226005
0.6966	Remote Similarity	NPC262182
0.6739	Remote Similarity	NPC283839
0.6452	Remote Similarity	NPC80732
0.6421	Remote Similarity	NPC125823
0.6421	Remote Similarity	NPC7145
0.6421	Remote Similarity	NPC143480
0.6224	Remote Similarity	NPC201148
0.6082	Remote Similarity	NPC173343
0.602	Remote Similarity	NPC3460
0.5941	Remote Similarity	NPC28651
0.5918	Remote Similarity	NPC287615
0.5918	Remote Similarity	NPC199311
0.5851	Remote Similarity	NPC471881
0.5843	Remote Similarity	NPC297342
0.5729	Remote Similarity	NPC476865
0.5686	Remote Similarity	NPC261122
0.5612	Remote Similarity	NPC216819
0.5579	Remote Similarity	NPC476869
0.5556	Remote Similarity	NPC192763
0.5521	Remote Similarity	NPC476868
0.5484	Remote Similarity	NPC225307
0.5435	Remote Similarity	NPC219677
0.5412	Remote Similarity	NPC157554
0.5368	Remote Similarity	NPC471405
0.534	Remote Similarity	NPC210611
0.5248	Remote Similarity	NPC11411
0.5204	Remote Similarity	NPC21516
0.5152	Remote Similarity	NPC186073
0.5104	Remote Similarity	NPC291296
0.5096	Remote Similarity	NPC85192
0.5053	Remote Similarity	NPC252833
0.505	Remote Similarity	NPC479767
0.5048	Remote Similarity	NPC215095

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC472611 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5189
0.1-0.2	3881
0.2-0.3	77
0.3-0.4	2
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data