NPASS Compound

Natural Product: NPC37787

Natural Product ID	NPC37787
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	WXHUQVMHWUQNTG-GLHMJAHESA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3632952
PubChem CID	NA
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 90 93 0 0 0 0 0 0 0 0999 V2000 -2.4598 1.9499 3.2286 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9345 1.2840 1.9954 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5467 1.7379 0.8935 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7747 0.2006 1.9991 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1903 -0.3930 0.7113 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6730 -0.1380 0.6200 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8004 1.2809 0.7034 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3209 -0.5112 -0.6771 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4660 -0.7000 1.7428 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7511 -1.8012 0.6947 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6126 -2.5293 -0.5546 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6544 -2.1143 -1.6041 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2169 -2.0922 -1.1476 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2201 -1.3040 -1.4018 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1325 -0.0948 -2.2692 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0284 0.7855 -2.0366 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6604 1.0817 -3.2732 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1002 0.3275 -1.1229 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5699 -0.4979 0.0280 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9901 -1.7537 -0.6509 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5390 -2.7529 0.3544 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7377 -3.2142 -0.2500 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9354 -2.3592 -1.6339 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4099 0.1483 0.7371 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6378 -0.9963 0.9356 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9959 -0.3467 0.6360 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7283 1.1211 0.5643 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0222 1.4351 -0.7287 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9645 1.6605 -1.8874 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3172 2.7640 -0.5033 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1496 3.7334 0.3007 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5641 3.3528 0.4488 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4345 4.1510 0.2265 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9064 1.9828 0.8733 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0388 2.0398 2.4051 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2096 1.4664 0.3498 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0510 -1.0711 -2.5612 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3963 -2.5767 1.6996 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6077 1.3391 4.1392 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3503 2.1080 3.1326 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9666 2.9231 3.4026 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6865 0.2003 -0.0329 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7519 1.5059 0.5509 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5758 -0.4492 -1.4874 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7195 -1.5647 -0.6834 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1925 0.1657 -0.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0723 -0.4085 2.7519 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6345 -1.7938 1.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4871 -0.2419 1.6930 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6879 -1.7316 1.2115 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3377 -3.6199 -0.3078 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6344 -2.5671 -1.0527 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6216 -3.0611 -2.2940 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0557 -0.5029 -3.3202 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0406 0.5308 -2.2639 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7006 1.8108 -1.6841 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5844 0.2194 -3.7952 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7364 -0.4022 -1.7144 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2920 -3.5971 0.3709 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4770 -2.4095 1.3868 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4893 -4.1104 -0.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4831 -3.5751 0.4440 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9816 -2.3866 -1.3316 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7712 -1.9269 -2.6597 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6255 -3.4390 -1.7572 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1306 0.7931 0.0135 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3735 -0.5949 1.0654 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6785 0.7092 1.6296 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8215 -2.0816 0.8946 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4117 -0.7440 1.9878 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6776 -0.5818 1.4689 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4044 -0.6814 -0.3264 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9721 1.3502 1.3764 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4857 2.3688 -2.6258 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1761 0.6786 -2.3764 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9147 2.1126 -1.6434 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1572 3.2355 -1.5022 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3621 2.6513 0.0519 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0809 4.7703 -0.1408 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7279 3.8818 1.3406 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0525 1.9668 2.8822 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6079 1.1200 2.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6438 2.9012 2.7120 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0874 0.5355 -0.2806 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8957 1.1132 1.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8062 2.2434 -0.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0153 -1.4083 -3.0859 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2756 -0.0753 -2.2357 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3274 -1.1119 -3.4273 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8778 -3.4244 1.8313 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 6 9 1 0 5 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 20 23 1 6 19 24 1 1 19 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 28 30 1 0 30 31 1 0 31 32 1 0 32 33 2 0 32 34 1 0 34 35 1 0 34 36 1 0 12 37 1 0 10 38 1 0 22 13 1 0 34 27 1 0 20 14 1 0 28 18 1 0 1 39 1 0 1 40 1 0 1 41 1 0 5 42 1 6 7 43 1 0 8 44 1 0 8 45 1 0 8 46 1 0 9 47 1 0 9 48 1 0 9 49 1 0 10 50 1 1 11 51 1 0 11 52 1 0 12 53 1 6 15 54 1 0 15 55 1 0 16 56 1 1 17 57 1 0 18 58 1 6 21 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 23 64 1 0 23 65 1 0 24 66 1 0 24 67 1 0 24 68 1 0 25 69 1 0 25 70 1 0 26 71 1 0 26 72 1 0 27 73 1 1 29 74 1 0 29 75 1 0 29 76 1 0 30 77 1 0 30 78 1 0 31 79 1 0 31 80 1 0 35 81 1 0 35 82 1 0 35 83 1 0 36 84 1 0 36 85 1 0 36 86 1 0 37 87 1 0 37 88 1 0 37 89 1 0 38 90 1 0 M END

Standard InCHIKey	WXHUQVMHWUQNTG-GLHMJAHESA-N
Standard InCHI	InChI=1S/C32H52O6/c1-18(16-23(35)27(29(5,6)37)38-19(2)33)20-10-14-31(8)21(20)17-22(34)26-30(7)13-12-25(36)28(3,4)24(30)11-15-32(26,31)9/h18,22-24,26-27,34-35,37H,10-17H2,1-9H3/t18-,22+,23+,24+,26+,27+,30+,31+,32+/m1/s1
SMILES	CC(=O)O[C@H](C(O)(C)C)[C@H](C[C@H](C1=C2C[C@H](O)[C@@H]3[C@]([C@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	532.38	Volume:	572.634 ? Van der Waals volume.
Dense:	0.93	LogP:	2.343 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.641 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.116 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	22.0
TPSA:	104.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	6.0
H-Bond Donor:	3.0	Rings:	4.0
Heavy Atoms:	6.0

MedChem Properties

QED Drug-Likeness Score:	0.314	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.193	Fsp³:	0.875
MCE-18:	91.267 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.875	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.018 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.267	Promiscuous compounds:	0.379

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.019	MDCK Permeability:	-4.802
Pgp-inhibitor:	0.999	Pgp-substrate:	0.047
PAMPA:	0.812 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.112	30% Bioavailability (F30%):	0.385
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.959
Plasma Protein Binding (PPB):	91.747%	Volume Distribution (VD):	-0.096
Fu:	10.859% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.52
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.006	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.873	CYP2C19-substrate:	0.016
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.002
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.393
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.907
HLM stability:	0.944 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

8.716

Half-life (T1/2):

0.629

ADMET: Toxicity

hERG Blockers:	0.009	hERG Blockers (10um):	0.076
Human Hepatotoxicity (H-HT):	0.576	Drug-induced Liver Injury (DILI):	0.16
AMES Toxicity:	0.459	Rat Oral Acute Toxicity:	0.189
Maximum Recommended Daily Dose:	0.246	Skin Sensitization:	0.985
Carcinogencity:	0.799	Eye Corrosion:	0.002
Eye Irritation:	0.07	Respiratory Toxicity:	0.083
Drug-induced Neurotoxicity:	0.046	Ototoxicity:	0.733
Hematotoxicity:	0.501	Drug-induced Nephrotoxicity:	0.972
Genotoxicity:	0.505	RPMI-8226 Immunitoxicity:	0.08
A549 Cytotoxicity:	0.13	Hek293 Cytotoxicity:	0.253
BCF:	0.969 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.607 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.372 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.444 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30648	Alisma orientale	Species	Alismataceae	Eukaryota	rhizome	n.a.	n.a.	PMID[10560729]
NPO30648	Alisma orientale	Species	Alismataceae	Eukaryota	n.a.	rhizome	n.a.	PMID[17541191]
NPO30648	Alisma orientale	Species	Alismataceae	Eukaryota	Rhizome	n.a.	n.a.	PMID[26425784]
NPO30648	Alisma orientale	Species	Alismataceae	Eukaryota	n.a.	tuber	n.a.	PMID[26666273]
NPO30648	Alisma orientale	Species	Alismataceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO30648	Alisma orientale	Species	Alismataceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3061	Alisma orientalis	Species	Alismataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO3061	Alisma orientalis	Species	Alismataceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
EC50	1

Activity Type	# Activity
Individual protein	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT203	Individual protein	Carboxylesterase 2	Homo sapiens	IC50	=	10790.0	nM	PMID[26425784]
NPT540	Individual protein	Bile acid receptor FXR	Homo sapiens	EC50	=	15310.0	nM	PMID[31494470]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC37787 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19011
0.1-0.2	25364
0.2-0.3	5208
0.3-0.4	228
0.4-0.5	19
0.5-0.6	13
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC473415
1.0	High Similarity	NPC30677
0.7812	Intermediate Similarity	NPC198074
0.7812	Intermediate Similarity	NPC274046
0.7742	Intermediate Similarity	NPC469314
0.7742	Intermediate Similarity	NPC469317
0.7742	Intermediate Similarity	NPC241875
0.7463	Intermediate Similarity	NPC180557
0.7463	Intermediate Similarity	NPC469329
0.7231	Intermediate Similarity	NPC469319
0.7231	Intermediate Similarity	NPC229871
0.7101	Intermediate Similarity	NPC471777
0.7101	Intermediate Similarity	NPC602467
0.6957	Remote Similarity	NPC473166
0.6	Remote Similarity	NPC469322
0.5921	Remote Similarity	NPC473173
0.5921	Remote Similarity	NPC324001
0.5921	Remote Similarity	NPC469318
0.5882	Remote Similarity	NPC86370
0.5541	Remote Similarity	NPC471784
0.5541	Remote Similarity	NPC303777
0.5493	Remote Similarity	NPC473157
0.5455	Remote Similarity	NPC469327
0.5342	Remote Similarity	NPC473170
0.5333	Remote Similarity	NPC473176
0.5333	Remote Similarity	NPC473165
0.5325	Remote Similarity	NPC469316
0.5135	Remote Similarity	NPC473167

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC37787 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6623
0.1-0.2	2375
0.2-0.3	152
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data