NPASS Compound

Natural Product: NPC327805

Natural Product ID	NPC327805
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PEMTYRITAVXZON-SCWWMMHESA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5316839
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 88 0 0 0 0 0 0 0 0999 V2000 -5.8662 2.1565 -0.4875 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1283 0.9970 0.1876 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6720 -0.2941 -0.3544 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6867 -1.3903 -0.3750 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5372 -1.2365 0.6409 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5938 -2.3775 0.4852 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1407 -2.1417 0.4121 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7263 -0.8536 -0.2683 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4334 0.2086 0.4712 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9055 0.1182 0.6200 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6646 1.1743 -0.1624 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4045 1.2666 -1.5992 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3353 2.4603 0.3540 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8483 0.2731 1.8825 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6019 0.3654 2.0037 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2019 0.3764 0.6310 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7842 -0.7127 -0.2625 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2717 -0.2273 -1.6435 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7517 -0.0133 -1.6964 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3364 0.7911 -0.5892 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6643 0.7182 0.7160 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3011 -0.1247 1.7779 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7618 -0.3272 1.6695 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3485 -0.4512 0.3204 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8309 0.5903 -0.5917 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5656 1.8953 -0.3066 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3209 0.1942 -1.9958 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2424 -1.7588 -0.1308 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6719 2.1511 1.3146 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4665 -2.0445 -0.1138 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0873 -1.0526 -1.7149 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2850 -1.4858 1.9246 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5205 -1.7213 1.9341 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6796 -1.4759 3.1728 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2060 3.0712 -0.4359 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0071 1.8487 -1.5490 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8148 2.3247 0.0413 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2525 1.1154 1.2725 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0696 -0.1182 -1.4002 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5797 -0.5479 0.2301 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3211 -1.6758 -1.3782 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2393 -2.3344 -0.0536 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8704 -2.9224 -0.4692 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7535 -3.1807 1.2632 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6379 -2.9601 -0.1601 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6665 -2.1462 1.4116 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2621 1.2051 -0.0496 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1390 0.5304 1.6644 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7145 0.4610 -2.2525 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3276 1.5642 -1.7466 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9635 2.1811 -1.9616 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9092 2.6961 1.1099 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3492 1.1910 2.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2986 -0.5557 2.4650 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0008 -0.4292 2.6597 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8929 1.3297 2.4922 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7490 1.3134 0.1568 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8136 0.7813 -1.8213 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0612 -0.9587 -2.4444 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8951 0.4988 -2.7037 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2735 -0.9751 -1.8558 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2383 1.8639 -0.9683 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8148 -1.1151 1.9386 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1438 0.3415 2.8078 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0433 -1.2729 2.2294 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3211 0.4661 2.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4491 -0.2692 0.4204 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1390 2.7311 -0.8673 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6224 1.7186 -0.6686 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6649 2.1221 0.7487 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2767 -0.9002 -2.1540 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8956 0.8093 -2.7837 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4326 0.4183 -2.0264 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0261 -2.0579 -0.6430 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6804 2.6536 1.1562 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3778 2.8023 0.7525 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8417 2.1526 2.3887 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1545 -2.6367 -1.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1687 -2.6481 0.7341 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5370 -1.9209 -0.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5676 -2.0225 -2.0013 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1203 -1.2997 -1.9258 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8236 -0.2234 -2.3845 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2267 -1.0682 3.9376 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 9 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 24 28 1 0 21 29 1 0 17 30 1 0 8 31 1 0 5 32 1 0 32 33 2 0 32 34 1 0 11 2 1 0 10 5 1 0 17 8 1 0 21 16 1 0 25 20 1 0 1 35 1 0 1 36 1 0 1 37 1 0 2 38 1 0 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 6 43 1 0 6 44 1 0 7 45 1 0 7 46 1 0 9 47 1 0 10 48 1 0 12 49 1 0 12 50 1 0 12 51 1 0 13 52 1 0 14 53 1 0 14 54 1 0 15 55 1 0 15 56 1 0 16 57 1 0 18 58 1 0 18 59 1 0 19 60 1 0 19 61 1 0 20 62 1 0 22 63 1 0 22 64 1 0 23 65 1 0 23 66 1 0 24 67 1 0 26 68 1 0 26 69 1 0 26 70 1 0 27 71 1 0 27 72 1 0 27 73 1 0 28 74 1 0 29 75 1 0 29 76 1 0 29 77 1 0 30 78 1 0 30 79 1 0 30 80 1 0 31 81 1 0 31 82 1 0 31 83 1 0 34 84 1 0 M END

Standard InCHIKey	PEMTYRITAVXZON-SCWWMMHESA-N
Standard InCHI	InChI=1S/C30H50O4/c1-18-10-15-30(24(32)33)17-16-27(5)19(23(30)29(18,7)34)8-9-21-26(4)13-12-22(31)25(2,3)20(26)11-14-28(21,27)6/h18-23,31,34H,8-17H2,1-7H3,(H,32,33)/t18?,19?,20?,21?,22-,23?,26-,27?,28+,29+,30-/m0/s1
SMILES	CC1CCC2(CCC3(C(C2C1(C)O)CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	474.37	Volume:	517.178 ? Van der Waals volume.
Dense:	0.917	LogP:	3.035 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.132 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.441 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	27.0
TPSA:	77.76 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.418	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.929	Fsp³:	0.967
MCE-18:	109.831 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.066	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.03 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.305	Promiscuous compounds:	0.019

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.239	MDCK Permeability:	-4.799
Pgp-inhibitor:	0.0	Pgp-substrate:	0.016
PAMPA:	0.974 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.003
50% Bioavailability (F50%):	0.834

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.136	MRP1:	1.0
Plasma Protein Binding (PPB):	83.17%	Volume Distribution (VD):	-0.291
Fu:	14.323% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.003
OATP1B3 inhibitor:	0.746	BCRP inhibitor:	0.0
BSEP inhibitor:	0.454

ADMET: Metabolism

CYP1A2-inhibitor:	0.551	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.983	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.032	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.154	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.999	CYP2C8-inhibitor:	0.001
HLM stability:	0.012 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.778

Half-life (T1/2):

1.743

ADMET: Toxicity

hERG Blockers:	0.067	hERG Blockers (10um):	0.23
Human Hepatotoxicity (H-HT):	0.53	Drug-induced Liver Injury (DILI):	0.058
AMES Toxicity:	0.042	Rat Oral Acute Toxicity:	0.061
Maximum Recommended Daily Dose:	0.535	Skin Sensitization:	0.289
Carcinogencity:	0.305	Eye Corrosion:	0.019
Eye Irritation:	0.416	Respiratory Toxicity:	0.763
Drug-induced Neurotoxicity:	0.053	Ototoxicity:	0.945
Hematotoxicity:	0.154	Drug-induced Nephrotoxicity:	0.223
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.026
A549 Cytotoxicity:	0.062	Hek293 Cytotoxicity:	0.163
BCF:	1.733 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.684 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.955 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.274 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	aerial parts	n.a.	n.a.	PMID[10869197]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[1812212]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[33780581]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[36270431]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38257257]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38893531]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39104562]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	leaves	n.a.	n.a.	PMID[9834145]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO1859	Lantana camara	Species	Verbenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC327805 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24748
0.1-0.2	21515
0.2-0.3	2856
0.3-0.4	532
0.4-0.5	175
0.5-0.6	22
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.6935	Remote Similarity	NPC30583
0.6935	Remote Similarity	NPC264317
0.6935	Remote Similarity	NPC294438
0.6885	Remote Similarity	NPC472608
0.6825	Remote Similarity	NPC476071
0.6615	Remote Similarity	NPC16377
0.6364	Remote Similarity	NPC18064
0.5882	Remote Similarity	NPC151191
0.5857	Remote Similarity	NPC202728
0.5857	Remote Similarity	NPC158059
0.5821	Remote Similarity	NPC488164
0.5821	Remote Similarity	NPC264005
0.5775	Remote Similarity	NPC60692
0.5507	Remote Similarity	NPC474512
0.5493	Remote Similarity	NPC488165
0.5455	Remote Similarity	NPC298168
0.5455	Remote Similarity	NPC143133
0.5429	Remote Similarity	NPC2783
0.5362	Remote Similarity	NPC474686
0.5362	Remote Similarity	NPC181225
0.5352	Remote Similarity	NPC290481
0.527	Remote Similarity	NPC481311
0.5238	Remote Similarity	NPC212733
0.5167	Remote Similarity	NPC232112
0.5143	Remote Similarity	NPC488506
0.5143	Remote Similarity	NPC220498
0.5079	Remote Similarity	NPC480925
0.5079	Remote Similarity	NPC48079
0.5077	Remote Similarity	NPC91573

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC327805 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6127
0.1-0.2	2938
0.2-0.3	76
0.3-0.4	6
0.4-0.5	2
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6935	Remote Similarity	NPD7520	Phase 1

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data