NPASS Compound

Structure

NPC285431 OpenBabel06302215142D 103114 0 0 1 0 0 0 0 0999 V2000 3.5967 -6.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3467 -7.9227 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0298 -8.6058 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7797 -9.5390 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8466 -9.7891 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1634 -9.1059 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4135 -8.1727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2302 -9.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5471 -8.6728 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7972 -7.7396 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1140 -7.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8192 -7.3066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0692 -8.2397 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3861 -8.9229 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6361 -9.8561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0470 -10.5392 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1041 -11.4934 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7567 -11.9320 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3647 -12.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0185 -13.5847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4398 -11.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0012 -10.3881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4105 -12.8339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9649 -11.9320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9356 -8.7398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1856 -9.6730 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5025 -10.3562 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7525 -11.2893 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6857 -11.5394 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9358 -12.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3688 -10.8562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1188 -9.9231 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8019 -9.2399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7351 -9.4900 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9852 -10.4232 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9184 -10.6732 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6015 -9.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3514 -9.0569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4183 -8.8068 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1682 -7.8736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5345 -6.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0344 -4.6410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4677 -6.7574 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3043 -7.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1410 -6.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1410 -5.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6241 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1071 -5.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3043 -5.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4677 -5.7913 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6310 -5.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6310 -4.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7943 -3.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9577 -4.3422 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1210 -3.8591 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9577 -3.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1210 -2.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2843 -2.4100 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4477 -2.8930 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4477 -3.8591 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9646 -4.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4816 -3.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9985 -3.0224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2843 -4.3422 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2843 -5.3083 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1210 -5.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9577 -5.3083 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9577 -7.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7943 -5.7913 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9577 -6.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7943 -6.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6310 -7.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4477 -5.7913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6110 -2.4100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6110 -1.4439 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7743 -0.9608 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7743 0.0053 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6110 0.4883 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4477 0.0053 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2843 0.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2843 1.4544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4477 -0.9608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6110 1.4544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9377 0.4883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9377 -1.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1010 -0.9608 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7816 -1.3538 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.4280 -0.6358 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3106 -0.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4116 0.7180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9450 0.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2096 -1.2037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9825 -2.2987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2843 -1.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1684 -11.6064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3020 -11.1063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0694 -11.9725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5693 -10.1061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7303 -7.4896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5965 -10.7222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4629 -10.2222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9630 -8.3558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 0 0 0 2 3 1 0 0 0 0 2 7 1 0 0 0 0 3 4 1 0 0 0 0 3103 1 6 0 0 0 4 5 1 0 0 0 0 4102 1 1 0 0 0 5 6 1 0 0 0 0 5101 1 1 0 0 0 6 7 1 0 0 0 0 6 8 1 6 0 0 0 9 8 1 6 0 0 0 9 10 1 0 0 0 0 9 14 1 0 0 0 0 10 11 1 0 0 0 0 10100 1 1 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 13 25 1 6 0 0 0 14 15 1 1 0 0 0 16 15 1 6 0 0 0 16 17 1 0 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 24 1 1 0 0 0 18 19 1 0 0 0 0 18 21 1 0 0 0 0 18 23 1 1 0 0 0 19 20 1 0 0 0 0 21 22 1 0 0 0 0 26 25 1 6 0 0 0 26 27 1 0 0 0 0 26 32 1 0 0 0 0 27 28 1 0 0 0 0 27 99 1 6 0 0 0 28 29 1 0 0 0 0 28 98 1 1 0 0 0 29 30 1 6 0 0 0 29 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 1 0 0 0 34 33 1 6 0 0 0 34 35 1 0 0 0 0 34 39 1 0 0 0 0 35 36 1 0 0 0 0 35 97 1 1 0 0 0 36 37 1 0 0 0 0 36 96 1 1 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 39 40 1 1 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 43 41 1 6 0 0 0 43 72 1 0 0 0 0 43 44 1 0 0 0 0 43 50 1 0 0 0 0 44 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 46 48 1 0 0 0 0 46 49 1 0 0 0 0 50 49 1 1 0 0 0 50 51 1 0 0 0 0 51 69 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 54 53 1 6 0 0 0 54 55 1 0 0 0 0 54 67 1 0 0 0 0 55 64 1 0 0 0 0 55 56 1 6 0 0 0 55 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 95 1 6 0 0 0 59 60 1 0 0 0 0 59 74 1 6 0 0 0 60 61 1 6 0 0 0 60 62 1 0 0 0 0 60 64 1 0 0 0 0 62 63 1 0 0 0 0 64 65 1 0 0 0 0 65 66 1 0 0 0 0 65 73 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 67 69 1 0 0 0 0 69 70 1 0 0 0 0 69 71 1 0 0 0 0 71 72 1 0 0 0 0 75 74 1 6 0 0 0 75 76 1 0 0 0 0 75 82 1 0 0 0 0 76 77 1 0 0 0 0 76 85 1 0 0 0 0 77 78 1 0 0 0 0 77 84 1 6 0 0 0 78 79 1 0 0 0 0 78 83 1 0 0 0 0 79 80 1 6 0 0 0 79 82 1 0 0 0 0 80 81 1 0 0 0 0 86 85 1 6 0 0 0 86 87 1 0 0 0 0 86 92 1 0 0 0 0 87 88 1 0 0 0 0 87 94 1 1 0 0 0 88 89 1 0 0 0 0 88 91 1 0 0 0 0 88 93 1 1 0 0 0 89 90 1 0 0 0 0 91 92 1 0 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	1486.68
Volume:	1384.391
LogP:	0.103
LogD:	0.041
LogS:	-2.601
# Rotatable Bonds:	19
TPSA:	550.89
# H-Bond Aceptor:	35
# H-Bond Donor:	20
# Rings:	12
# Heavy Atoms:	35

MedChem Properties

QED Drug-Likeness Score:	0.034
Synthetic Accessibility Score:	6.843
Fsp3:	0.956
Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted
GSK Rule:	Rejected
BMS Rule:	1
Golden Triangle Rule:	Rejected
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-6.604
MDCK Permeability:	0.0003022880991920829
Pgp-inhibitor:	0.0
Pgp-substrate:	1.0
Human Intestinal Absorption (HIA):	1.0
20% Bioavailability (F20%):	0.862
30% Bioavailability (F30%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.348
Plasma Protein Binding (PPB):	45.217185974121094%
Volume Distribution (VD):	-0.43
Pgp-substrate:	26.028478622436523%

ADMET: Metabolism

CYP1A2-inhibitor:	0.0
CYP1A2-substrate:	0.137
CYP2C19-inhibitor:	0.0
CYP2C19-substrate:	0.054
CYP2C9-inhibitor:	0.0
CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0
CYP2D6-substrate:	0.01
CYP3A4-inhibitor:	0.069
CYP3A4-substrate:	0.001

ADMET: Excretion

Clearance (CL):	-0.645
Half-life (T1/2):	0.832

ADMET: Toxicity

hERG Blockers:	0.323
Human Hepatotoxicity (H-HT):	0.155
Drug-inuced Liver Injury (DILI):	0.062
AMES Toxicity:	0.045
Rat Oral Acute Toxicity:	0.027
Maximum Recommended Daily Dose:	0.0
Skin Sensitization:	0.044
Carcinogencity:	0.01
Eye Corrosion:	0.003
Eye Irritation:	0.004
Respiratory Toxicity:	0.104

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC285431

Natural Product ID:	NPC285431
*Common Name:**	OIYPMBDCELBJBO-VFRSPWOLSA-N
IUPAC Name:	n.a.
Synonyms:
Standard InCHIKey:	OIYPMBDCELBJBO-VFRSPWOLSA-N
Standard InCHI:	InChI=1S/C68H110O35/c1-26-36(77)40(81)43(84)53(94-26)97-44-33(76)20-91-55(48(44)101-59-51(86)68(89,23-72)25-93-59)98-46-41(82)37(78)27(2)95-56(46)99-45-38(79)32(75)19-90-54(45)103-60(87)66-13-11-61(3,4)15-29(66)28-9-10-35-62(5)16-31(74)52(63(6,21-70)49(62)30(73)17-65(35,8)64(28,7)12-14-66)102-57-47(42(83)39(80)34(18-69)96-57)100-58-50(85)67(88,22-71)24-92-58/h9,26-27,29-59,69-86,88-89H,10-25H2,1-8H3/t26-,27-,29-,30+,31-,32-,33+,34+,35+,36-,37-,38-,39+,40+,41+,42-,43+,44-,45+,46+,47+,48+,49+,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,62+,63-,64+,65+,66-,67+,68+/m0/s1
SMILES:	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]1[C@@H](CO[C@H]([C@@H]1O[C@H]1[C@@H]([C@@](CO)(CO1)O)O)O[C@@H]1[C@@H]([C@H]([C@H](C)O[C@H]1O[C@@H]1[C@H]([C@H](CO[C@H]1OC(=O)[C@@]12CCC(C)(C)C[C@H]2C2=CC[C@@H]3[C@@]4(C)C[C@@H]([C@@H]([C@@](C)(CO)[C@@H]4[C@@H](C[C@@]3(C)[C@]2(C)CC1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@](CO)(CO1)O)O)O)O)O)O)O)O)O)O)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	n.a.
PubChem CID:	21578040
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO24126	Streptomyces albus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[18648803]
NPO24126	Streptomyces albus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	PMID[19246195]
NPO24126	Streptomyces albus	Species	Streptomycetaceae	Bacteria	n.a.	mycelium	n.a.	PMID[21718029]
NPO22667	Plectranthus amboinicus	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24491635]
NPO4739	Prunus yedoensis	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13117	Asparagus setaceus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13117	Asparagus setaceus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4739	Prunus yedoensis	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4739	Prunus yedoensis	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO13117	Asparagus setaceus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO24126	Streptomyces albus	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO4739	Prunus yedoensis	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22667	Plectranthus amboinicus	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14944	Ophioceras venezuelense	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC285431 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	266
0.1-0.2	1681
0.2-0.3	5516
0.3-0.4	12744
0.4-0.5	9049
0.5-0.6	6137
0.6-0.7	4056
0.7-0.8	1906
0.8-0.85	725
0.85-0.9	424
0.9-0.95	187
0.95-1	6

Similarity Score	Similarity Level	Natural Product ID

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC285431 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	233
0.1-0.2	1972
0.2-0.3	4137
0.3-0.4	1849
0.4-0.5	491
0.5-0.6	291
0.6-0.7	131
0.7-0.8	31
0.8-0.85	14
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data