NPASS Compound

Natural Product: NPC279534

Natural Product ID	NPC279534
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XHGWZGKDSOFQOV-WITIDZFYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000334] Flavonoids [CHEMONTID:0001111] Flavonoid glycosides [CHEMONTID:0001583] Flavonoid O-glycosides [CHEMONTID:0003533] Flavonoid-7-O-glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 113119 0 0 0 0 0 0 0 0999 V2000 -10.8793 0.9920 -0.2914 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4582 2.0071 -1.2902 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9622 3.3997 -0.9995 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.2531 3.9850 0.1628 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0299 3.2807 0.6345 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3708 2.3745 -0.3435 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1004 2.1103 -1.4854 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1427 2.8864 -0.7749 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9435 2.2567 -0.8668 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8564 2.9832 -1.2975 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6106 2.4128 -1.4191 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4969 1.0554 -1.0849 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5517 0.2923 -0.6516 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7959 0.9324 -0.5480 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4441 -0.9699 -0.3452 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2840 -1.6341 -0.4301 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2813 -3.0618 -0.0585 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3667 -3.5415 0.6899 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4677 -4.8653 1.0314 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5192 -5.7909 0.6628 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4574 -5.3143 -0.0721 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3397 -3.9705 -0.4285 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4609 -6.2269 -0.4728 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6184 -7.1321 1.0081 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6932 -7.6458 1.7644 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2049 -0.9306 -0.8506 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2814 0.4304 -1.1894 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2919 1.0790 -1.5764 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9441 -1.4942 -0.9742 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0041 -1.4789 0.1237 C 0 0 1 0 0 0 0 0 0 0 0 0 0.9889 -2.5550 -0.0173 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7839 -2.2755 -1.2993 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4943 -0.9547 -1.1067 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9601 -0.2080 0.0691 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3935 1.2490 -0.0214 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7271 1.4736 -0.0371 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4828 1.0502 1.0166 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5788 0.1524 0.4879 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9521 0.6789 0.9507 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8514 0.7546 2.4557 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8073 1.7997 2.7691 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9398 1.3561 3.9390 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0483 2.1745 1.6599 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0335 1.1077 3.0778 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9629 -0.1176 0.4808 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8957 0.5374 -0.3218 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3029 0.4436 0.2123 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2488 0.7482 -0.9407 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6131 1.6748 -1.9473 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4055 1.0062 -2.5210 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8168 0.0932 -1.6471 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3224 2.9090 -1.3711 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5052 -0.4871 -1.5643 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5180 1.3884 1.1956 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3740 -1.1238 1.0062 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5820 -0.1988 0.0614 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3714 -0.1941 -2.2958 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8168 -2.1330 -2.3013 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8529 -2.7117 1.0864 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4799 3.0935 -1.8464 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3578 2.5892 1.8088 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1808 4.1060 1.2192 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7500 4.1532 -2.1666 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5023 0.2227 -0.7893 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5016 1.4005 0.5315 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9889 0.4482 0.0850 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8948 1.7367 -2.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0569 3.3339 -0.8341 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0177 5.0582 -0.1103 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2924 4.0524 0.9500 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1920 1.3911 0.1283 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9786 4.0439 -1.5519 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5958 0.2922 -0.2050 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1261 -2.8184 0.9911 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3036 -5.2384 1.6072 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5169 -3.6484 -1.0246 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2549 -6.9989 0.1273 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6601 -8.7498 1.6843 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6306 -7.3081 1.2752 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6476 -7.3247 2.8267 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5797 -1.5293 1.0616 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5827 -3.5803 -0.1716 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4718 -3.1120 -1.5333 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5754 -1.2087 -1.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3737 -0.5497 1.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8722 1.7666 0.8174 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9567 1.6504 -0.9610 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8977 0.5235 1.7663 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5222 0.1062 -0.5968 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0787 1.7175 0.5630 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5690 -0.2456 2.8436 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3358 2.7185 3.0937 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4317 1.6823 4.8956 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7700 0.2581 3.9205 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9964 1.9297 3.8763 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9352 0.8430 4.0478 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6113 1.6073 -0.3594 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5255 -0.5834 0.5860 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1782 1.1856 -0.5614 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3374 1.8581 -2.7599 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6270 1.7641 -2.7678 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6992 0.5086 -3.4775 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8323 3.0033 -0.5419 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1770 -0.3572 -2.3007 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2477 1.1371 1.8195 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8115 -1.7515 0.3562 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8997 -0.7046 -2.9952 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3672 -3.0099 -2.4234 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3894 -2.5747 1.9321 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5526 4.1099 -1.9162 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8869 3.1677 2.4102 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0648 4.2056 0.8029 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5785 3.5697 -2.9491 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 21 23 1 0 20 24 1 0 24 25 1 0 16 26 2 0 26 27 1 0 27 28 2 0 26 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 40 44 1 0 39 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 48 53 1 0 47 54 1 0 38 55 1 0 34 56 1 0 33 57 1 0 32 58 1 0 31 59 1 0 11 60 1 0 5 61 1 0 4 62 1 0 3 63 1 0 7 2 1 0 14 9 1 0 22 17 1 0 56 30 1 0 27 12 1 0 43 37 1 0 51 46 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 6 3 68 1 1 4 69 1 6 5 70 1 1 6 71 1 1 10 72 1 0 14 73 1 0 18 74 1 0 19 75 1 0 22 76 1 0 23 77 1 0 25 78 1 0 25 79 1 0 25 80 1 0 30 81 1 1 31 82 1 6 32 83 1 6 33 84 1 1 34 85 1 1 35 86 1 0 35 87 1 0 37 88 1 1 38 89 1 6 39 90 1 6 40 91 1 1 41 92 1 1 42 93 1 0 42 94 1 0 42 95 1 0 44 96 1 0 46 97 1 6 47 98 1 1 48 99 1 1 49100 1 6 50101 1 0 50102 1 0 52103 1 0 53104 1 0 54105 1 0 55106 1 0 57107 1 0 58108 1 0 59109 1 0 60110 1 0 61111 1 0 62112 1 0 63113 1 0 M END

Standard InCHIKey	XHGWZGKDSOFQOV-WITIDZFYSA-N
Standard InCHI	InChI=1S/C39H50O24/c1-11-22(43)27(48)30(51)38(58-11)59-14-7-16(41)21-19(8-14)60-33(13-4-5-18(54-3)15(40)6-13)35(26(21)47)63-39-31(52)28(49)25(46)20(61-39)10-56-37-32(53)34(23(44)12(2)57-37)62-36-29(50)24(45)17(42)9-55-36/h4-8,11-12,17,20,22-25,27-32,34,36-46,48-53H,9-10H2,1-3H3/t11-,12-,17+,20+,22-,23-,24-,25-,27+,28-,29+,30+,31+,32+,34+,36-,37+,38-,39-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)Oc1cc(c2c(c1)oc(c1ccc(c(c1)O)OC)c(c2=O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O)O1)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	902.27	Volume:	813.078 ? Van der Waals volume.
Dense:	1.11	LogP:	-0.51 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.512 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.6 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	42.0
TPSA:	376.27 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	13.0	Rings:	7.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.086	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.9	Fsp³:	0.615
MCE-18:	181.746 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.645	Fluc inhibitor:	0.326 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.66 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.462 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.163	Promiscuous compounds:	0.509

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.647	MDCK Permeability:	-5.047
Pgp-inhibitor:	0.0	Pgp-substrate:	0.999
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.94
20% Bioavailability (F20%):	0.151	30% Bioavailability (F30%):	0.983
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.032
Plasma Protein Binding (PPB):	70.629%	Volume Distribution (VD):	-0.254
Fu:	25.652% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.015
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.964
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.515
HLM stability:	0.868 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.357

Half-life (T1/2):

5.643

ADMET: Toxicity

hERG Blockers:	0.004	hERG Blockers (10um):	0.053
Human Hepatotoxicity (H-HT):	0.518	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.982	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.004	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.19	Drug-induced Nephrotoxicity:	0.93
Genotoxicity:	0.25	RPMI-8226 Immunitoxicity:	0.509
A549 Cytotoxicity:	0.682	Hek293 Cytotoxicity:	0.329
BCF:	0.25 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	2.861 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.651 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.605 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16116	Aniba canelilla	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38005295]
NPO6418	Passalora rosicola	Species	Mycosphaerellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19510	Origanum floribundum	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO23040	Methylomonas methanica	Species	Methylococcaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14708	Macowania corymbosa	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13937	Leptodontidium elatius	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19165	Comptonia peregrina	Species	Myricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16769	Baccharis hutchisonii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16116	Aniba canelilla	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16769	Baccharis hutchisonii	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16116	Aniba canelilla	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14708	Macowania corymbosa	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19510	Origanum floribundum	Species	Lamiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19165	Comptonia peregrina	Species	Myricaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO23040	Methylomonas methanica	Species	Methylococcaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO6418	Passalora rosicola	Species	Mycosphaerellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13937	Leptodontidium elatius	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC279534 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22261
0.1-0.2	24226
0.2-0.3	2590
0.3-0.4	407
0.4-0.5	267
0.5-0.6	84
0.6-0.7	15
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7327	Intermediate Similarity	NPC606657
0.7158	Intermediate Similarity	NPC611303
0.703	Intermediate Similarity	NPC186816
0.699	Remote Similarity	NPC209296
0.699	Remote Similarity	NPC473327
0.6311	Remote Similarity	NPC251417
0.6286	Remote Similarity	NPC22062
0.6286	Remote Similarity	NPC473634
0.6286	Remote Similarity	NPC138811
0.6275	Remote Similarity	NPC276377
0.6262	Remote Similarity	NPC470443
0.61	Remote Similarity	NPC271692
0.6053	Remote Similarity	NPC292019
0.6053	Remote Similarity	NPC202908
0.6019	Remote Similarity	NPC126784
0.6019	Remote Similarity	NPC241423
0.6	Remote Similarity	NPC142142
0.6	Remote Similarity	NPC480441
0.5965	Remote Similarity	NPC189564
0.5946	Remote Similarity	NPC476472
0.5946	Remote Similarity	NPC294815
0.5946	Remote Similarity	NPC16194
0.5941	Remote Similarity	NPC46420
0.5893	Remote Similarity	NPC101636
0.5888	Remote Similarity	NPC67105
0.5872	Remote Similarity	NPC488074
0.5862	Remote Similarity	NPC25523
0.5842	Remote Similarity	NPC158674
0.5833	Remote Similarity	NPC203259
0.5833	Remote Similarity	NPC33054
0.5833	Remote Similarity	NPC210073
0.5833	Remote Similarity	NPC176740
0.5833	Remote Similarity	NPC471725
0.5833	Remote Similarity	NPC134532
0.5833	Remote Similarity	NPC602582
0.5825	Remote Similarity	NPC219904
0.578	Remote Similarity	NPC473571
0.578	Remote Similarity	NPC110941
0.5743	Remote Similarity	NPC249281
0.5741	Remote Similarity	NPC173582
0.5741	Remote Similarity	NPC44931
0.5741	Remote Similarity	NPC265885
0.5741	Remote Similarity	NPC181465
0.5741	Remote Similarity	NPC67326
0.5741	Remote Similarity	NPC215710
0.5741	Remote Similarity	NPC473438
0.5741	Remote Similarity	NPC227508
0.5741	Remote Similarity	NPC253788
0.5664	Remote Similarity	NPC473073
0.5652	Remote Similarity	NPC14187
0.5648	Remote Similarity	NPC471079
0.5596	Remote Similarity	NPC39834
0.5575	Remote Similarity	NPC488089
0.5566	Remote Similarity	NPC605784
0.5545	Remote Similarity	NPC150164
0.5492	Remote Similarity	NPC198199
0.5487	Remote Similarity	NPC72016
0.547	Remote Similarity	NPC203145
0.5439	Remote Similarity	NPC486577
0.5431	Remote Similarity	NPC470446
0.5421	Remote Similarity	NPC116458
0.5421	Remote Similarity	NPC246943
0.541	Remote Similarity	NPC488086
0.5405	Remote Similarity	NPC65563
0.5405	Remote Similarity	NPC470949
0.536	Remote Similarity	NPC120952
0.5357	Remote Similarity	NPC204693
0.5351	Remote Similarity	NPC483416
0.5351	Remote Similarity	NPC32641
0.5351	Remote Similarity	NPC256188
0.5351	Remote Similarity	NPC473623
0.5345	Remote Similarity	NPC221342
0.5345	Remote Similarity	NPC476470
0.5339	Remote Similarity	NPC121703
0.5317	Remote Similarity	NPC192539
0.531	Remote Similarity	NPC488073
0.5289	Remote Similarity	NPC277532
0.5288	Remote Similarity	NPC289667
0.5268	Remote Similarity	NPC303913
0.5217	Remote Similarity	NPC51326
0.5217	Remote Similarity	NPC35119
0.5214	Remote Similarity	NPC470449
0.5214	Remote Similarity	NPC470445
0.521	Remote Similarity	NPC11468
0.5175	Remote Similarity	NPC240306
0.5169	Remote Similarity	NPC135358
0.514	Remote Similarity	NPC59534
0.5133	Remote Similarity	NPC156869
0.5124	Remote Similarity	NPC173837
0.5118	Remote Similarity	NPC209550
0.5118	Remote Similarity	NPC241781
0.5094	Remote Similarity	NPC136042
0.5089	Remote Similarity	NPC187379
0.5083	Remote Similarity	NPC89052
0.5047	Remote Similarity	NPC84362
0.5047	Remote Similarity	NPC27640
0.5046	Remote Similarity	NPC22832
0.5046	Remote Similarity	NPC120099
0.5044	Remote Similarity	NPC275454
0.5043	Remote Similarity	NPC475366
0.5043	Remote Similarity	NPC153755
0.5041	Remote Similarity	NPC470451

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC279534 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5627
0.1-0.2	3477
0.2-0.3	36
0.3-0.4	4
0.4-0.5	1
0.5-0.6	2
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.699	Remote Similarity	NPD7054	Phase 4
0.6759	Remote Similarity	NPD7808	Phase 3
0.6698	Remote Similarity	NPD7251	Phase 2
0.5833	Remote Similarity	NPD6797	Phase 2
0.5739	Remote Similarity	NPD7472	Pre-clinical

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data