NPASS Compound

Natural Product: NPC275618

Natural Product ID	NPC275618
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NLHQJXWYMZLQJY-SWIZOJJJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	3086007
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 87 0 0 0 0 0 0 0 0999 V2000 7.6993 -1.7069 -0.4599 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4935 -1.2782 -1.1828 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4125 -0.8616 -0.5316 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1921 -0.4264 -1.2082 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7541 0.9684 -1.0977 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4466 1.5070 0.2568 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6915 1.4520 1.1060 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4294 0.6719 1.0012 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1960 1.2939 2.3345 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7679 0.9318 2.7049 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2198 0.1107 1.5848 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5841 -1.3357 1.8520 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0813 0.5632 0.4112 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5329 1.8488 -0.0855 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8248 1.5368 -0.7331 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5207 0.3999 -0.0746 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9818 0.4027 -0.4727 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7389 1.6049 -0.1315 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9906 0.2524 -2.0044 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3488 0.1066 -2.5745 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3749 -0.5259 -1.6961 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8624 -1.2995 -0.5495 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9409 -1.2768 0.5466 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8209 -2.7935 -0.9399 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5467 -0.9171 0.0008 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4072 -1.0783 1.4910 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9272 -1.0698 1.8205 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2483 0.2281 1.3689 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8122 1.2793 2.2746 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3907 0.4036 -1.3611 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0702 2.8502 0.2007 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4658 -1.3047 -2.6655 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4820 -2.2422 0.4850 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2718 -0.7781 -0.2020 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3691 -2.2858 -1.1404 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4901 -0.8909 0.5488 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3765 -1.1720 -0.9775 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3690 -0.6251 -2.3163 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6099 1.6145 -1.4902 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9153 1.1169 -1.8244 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6239 1.4299 0.5219 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7518 2.4581 1.6434 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6372 0.7314 1.9466 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9372 -0.3009 1.1558 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3238 2.4048 2.2068 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9192 0.9721 3.1104 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2580 1.8632 2.9163 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8266 0.3374 3.6570 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0045 -1.7733 2.6960 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6489 -1.4385 2.2144 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5232 -1.9236 0.9304 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0040 -0.1873 -0.4229 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4268 2.6104 0.7169 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1008 2.3472 -0.8866 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3664 2.4771 -0.7705 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6149 1.2541 -1.8080 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1178 -0.5453 -0.5617 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2386 2.0780 -1.0319 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1215 2.4642 0.2675 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5648 1.4854 0.6006 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5271 1.1650 -2.4823 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3893 -0.6471 -2.2122 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2312 -0.4207 -3.5691 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7408 1.1223 -2.8799 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9504 -1.2351 -2.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8192 -2.2064 1.1782 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8462 -0.4414 1.2310 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9484 -1.3925 0.0839 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5682 -3.4068 -0.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0974 -2.8518 -1.7810 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8191 -3.0515 -1.3845 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7786 -1.6521 -0.4068 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7375 -2.1358 1.7137 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0122 -0.4334 2.1026 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4964 -1.9557 1.3382 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8974 -1.1192 2.9501 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9311 1.2682 2.3362 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5196 0.9634 3.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5326 2.3030 2.0547 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5152 0.5352 -0.4164 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8283 3.4711 0.1841 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4627 -1.5712 -3.0937 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7017 -2.0138 -3.0061 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2191 -0.3127 -3.1123 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 1 21 30 1 0 6 31 1 0 2 32 1 0 13 8 1 0 28 16 1 0 28 11 1 0 25 17 1 0 1 33 1 0 1 34 1 0 1 35 1 0 3 36 1 0 4 37 1 0 4 38 1 0 5 39 1 0 5 40 1 0 7 41 1 0 7 42 1 0 7 43 1 0 8 44 1 1 9 45 1 0 9 46 1 0 10 47 1 0 10 48 1 0 12 49 1 0 12 50 1 0 12 51 1 0 13 52 1 0 14 53 1 0 14 54 1 0 15 55 1 0 15 56 1 0 16 57 1 6 18 58 1 0 18 59 1 0 18 60 1 0 19 61 1 0 19 62 1 0 20 63 1 0 20 64 1 0 21 65 1 6 23 66 1 0 23 67 1 0 23 68 1 0 24 69 1 0 24 70 1 0 24 71 1 0 25 72 1 6 26 73 1 0 26 74 1 0 27 75 1 0 27 76 1 0 29 77 1 0 29 78 1 0 29 79 1 0 30 80 1 0 31 81 1 0 32 82 1 0 32 83 1 0 32 84 1 0 M END

Standard InCHIKey	NLHQJXWYMZLQJY-SWIZOJJJSA-N
Standard InCHI	InChI=1S/C30H52O2/c1-20(2)10-9-16-30(8,32)22-13-18-28(6)21(22)11-12-24-27(5)17-15-25(31)26(3,4)23(27)14-19-29(24,28)7/h10,21-25,31-32H,9,11-19H2,1-8H3/t21?,22-,23-,24+,25-,27-,28+,29+,30?/m0/s1
SMILES	CC(=CCCC(C)([C@H]1CC[C@]2(C)C1CC[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3CC[C@@]21C)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	444.4	Volume:	508.154 ? Van der Waals volume.
Dense:	0.875	LogP:	5.494 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.458 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-6.207 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	21.0
TPSA:	40.46 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.44	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.675	Fsp³:	0.933
MCE-18:	85.345 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.784	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.708	Promiscuous compounds:	0.242

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-4.959	MDCK Permeability:	-4.903
Pgp-inhibitor:	0.505	Pgp-substrate:	0.143
PAMPA:	0.618 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.298	30% Bioavailability (F30%):	0.038
50% Bioavailability (F50%):	0.967

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.951	MRP1:	0.961
Plasma Protein Binding (PPB):	95.304%	Volume Distribution (VD):	-0.198
Fu:	4.996% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.996	BCRP inhibitor:	0.24
BSEP inhibitor:	0.92

ADMET: Metabolism

CYP1A2-inhibitor:	0.139	CYP1A2-substrate:	0.021
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.192
CYP2C9-inhibitor:	0.246	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.009	CYP2D6-substrate:	0.049
CYP3A4-inhibitor:	0.662	CYP3A4-substrate:	0.433
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.831
HLM stability:	0.278 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

13.497

Half-life (T1/2):

0.468

ADMET: Toxicity

hERG Blockers:	0.193	hERG Blockers (10um):	0.426
Human Hepatotoxicity (H-HT):	0.673	Drug-induced Liver Injury (DILI):	0.062
AMES Toxicity:	0.278	Rat Oral Acute Toxicity:	0.359
Maximum Recommended Daily Dose:	0.469	Skin Sensitization:	0.957
Carcinogencity:	0.803	Eye Corrosion:	0.034
Eye Irritation:	0.554	Respiratory Toxicity:	0.842
Drug-induced Neurotoxicity:	0.121	Ototoxicity:	0.644
Hematotoxicity:	0.247	Drug-induced Nephrotoxicity:	0.568
Genotoxicity:	0.16	RPMI-8226 Immunitoxicity:	0.051
A549 Cytotoxicity:	0.384	Hek293 Cytotoxicity:	0.374
BCF:	2.323 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.713 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.788 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.492 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 12877918]
NPO64800	Aralia elata + Camarosporium sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 23203194]
NPO64833	Aralia elata + Dictyochaeta sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 23203194]
NPO64720	Aralia elata + Penicillium sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 23203194]
NPO64814	Panax ginseng + Fusarium sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 23543782]
NPO64854	Panax ginseng + Aspergillus sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 23543782]
NPO64838	Panax ginseng + Verticillium sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 23543782]
NPO64953	Panax notoginseng + Fusarium sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 28278662]
NPO64777	Panax notoginseng + Aspergillus sp. symbiont	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[ 28278662]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	leaves and stems	n.a.	n.a.	PMID[25442304]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29812	Panax quinquefolium	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14105.2	Panax pseudo-ginseng var. notoginseng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29812	Panax quinquefolium	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO14148.1	Panax pseudo - ginseng var. notoginseng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO14105.2	Panax pseudo-ginseng var. notoginseng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29812	Panax quinquefolium	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC275618 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24230
0.1-0.2	20989
0.2-0.3	3983
0.3-0.4	490
0.4-0.5	112
0.5-0.6	37
0.6-0.7	7
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC285761
1.0	High Similarity	NPC34930
0.8077	Intermediate Similarity	NPC13554
0.75	Intermediate Similarity	NPC245869
0.7222	Intermediate Similarity	NPC80530
0.7222	Intermediate Similarity	NPC273410
0.6727	Remote Similarity	NPC488511
0.6491	Remote Similarity	NPC215843
0.6429	Remote Similarity	NPC237460
0.6333	Remote Similarity	NPC488508
0.6182	Remote Similarity	NPC606606
0.6	Remote Similarity	NPC480925
0.6	Remote Similarity	NPC48079
0.5968	Remote Similarity	NPC131665
0.5968	Remote Similarity	NPC255387
0.5965	Remote Similarity	NPC600477
0.5965	Remote Similarity	NPC606605
0.5593	Remote Similarity	NPC42853
0.5574	Remote Similarity	NPC126993
0.5556	Remote Similarity	NPC232112
0.55	Remote Similarity	NPC296701
0.55	Remote Similarity	NPC218616
0.5484	Remote Similarity	NPC322313
0.5484	Remote Similarity	NPC102253
0.5484	Remote Similarity	NPC236237
0.5439	Remote Similarity	NPC129829
0.5424	Remote Similarity	NPC91573
0.5345	Remote Similarity	NPC192638
0.5345	Remote Similarity	NPC25511
0.5345	Remote Similarity	NPC600137
0.5333	Remote Similarity	NPC301707
0.5263	Remote Similarity	NPC142712
0.5254	Remote Similarity	NPC66407
0.5254	Remote Similarity	NPC185536
0.5246	Remote Similarity	NPC201725
0.5246	Remote Similarity	NPC3403
0.5211	Remote Similarity	NPC119036
0.5167	Remote Similarity	NPC144075
0.5167	Remote Similarity	NPC301226
0.5161	Remote Similarity	NPC207013
0.5161	Remote Similarity	NPC91387
0.5161	Remote Similarity	NPC231680
0.5161	Remote Similarity	NPC270306
0.5082	Remote Similarity	NPC58631
0.5082	Remote Similarity	NPC248830
0.5082	Remote Similarity	NPC231256
0.5082	Remote Similarity	NPC212241
0.5082	Remote Similarity	NPC178383
0.5079	Remote Similarity	NPC145143
0.5077	Remote Similarity	NPC201406

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC275618 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7780
0.1-0.2	1267
0.2-0.3	99
0.3-0.4	2
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5484	Remote Similarity	NPD7525	Registered

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data