Natural Product: NPC264014
Natural Product ID:   | NPC264014 |
Common Name*:   | Clavulanic Acid |
IUPAC Name:   | (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
Synonyms:   | BRL-14151; Clavulanate; Clavulanic Acid |
Standard InCHIKey:   | HZZVJAQRINQKSD-PBFISZAISA-N |
Standard InCHI:   | InChI=1S/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1-/t6-,7-/m1/s1 |
SMILES:   | OC(=O)[C@@H]1N2[C@H](O/C/1=CCO)CC2=O
|
Synthetic Gene Cluster:   |
BGC0000841;BGC0000844;BGC0000845; |
ChEMBL Identifier:   |
CHEMBL777 |
PubChem CID:   |
5280980 |
Chemical Classification**:   |
-
CHEMONTID:0000000 [Organic compounds]
-
[CHEMONTID:0000264] Organic acids and derivatives
-
[CHEMONTID:0000265] Carboxylic acids and derivatives
[CHEMONTID:0000013] Amino acids, peptides, and analogues[CHEMONTID:0000347] Amino acids and derivatives[CHEMONTID:0000060] Alpha amino acids and derivatives
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO22109 |
Streptomyces clavuligerus |
Species |
Streptomycetaceae |
Bacteria |
n.a. |
n.a. |
n.a. |
PMID[18450406] |
NPO22109 |
Streptomyces clavuligerus |
Species |
Streptomycetaceae |
Bacteria |
n.a. |
n.a. |
n.a. |
PMID[19941870] |
NPO1454 |
Spondias mombin |
Species |
Anacardiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[8064298] |
NPO22109 |
Streptomyces clavuligerus |
Species |
Streptomycetaceae |
Bacteria |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO1454 |
Spondias mombin |
Species |
Anacardiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
Organism ID |
NP ID |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  Biological Activity
Activity Type |
# Activity |
IC50 |
121 |
Ki |
23 |
MIC |
58 |
Others |
131 |
Activity Type |
# Activity |
Individual Protein |
96 |
NON-MOLECULAR |
2 |
Organism |
91 |
Others |
134 |
SINGLE PROTEIN |
8 |
Tissue |
2 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
MPC |
= |
0.38 |
ug ml-1 |
PMID[496988] |
NPT653 |
Individual Protein |
Beta-lactamase |
Pseudomonas aeruginosa (strain ATCC 15692 / PAO1 / 1C / PRS 101 / LMG12228) |
MPC |
= |
3.0 |
ug ml-1 |
PMID[496988] |
NPT279 |
Individual Protein |
Leukocyte elastase |
Homo sapiens |
IC50 |
< |
40000.0 |
nM |
PMID[496989] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
MPC |
= |
0.4 |
ug ml-1 |
PMID[496990] |
NPT5565 |
Individual Protein |
Beta-lactamase type II |
Bacteroides fragilis |
MPC |
= |
6.3 |
ug ml-1 |
PMID[496990] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
> |
1000000.0 |
nM |
PMID[496991] |
NPT5566 |
Individual Protein |
Beta-lactamase |
Citrobacter freundii |
IC50 |
= |
3.2 |
ug.mL-1 |
PMID[496992] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
= |
6.3 |
ug.mL-1 |
PMID[496992] |
NPT655 |
Individual Protein |
Beta-lactamase |
Proteus mirabilis |
IC50 |
= |
0.013 |
ug.mL-1 |
PMID[496992] |
NPT5565 |
Individual Protein |
Beta-lactamase type II |
Bacteroides fragilis |
IC50 |
= |
0.05 |
ug.mL-1 |
PMID[496992] |
NPT5567 |
Individual Protein |
Beta-lactamase |
Klebsiella oxytoca |
IC50 |
= |
0.006 |
ug.mL-1 |
PMID[496992] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
0.008 |
ug.mL-1 |
PMID[496992] |
NPT5568 |
Individual Protein |
Beta-lactamase SHV-1 |
Escherichia coli |
IC50 |
= |
0.004 |
ug.mL-1 |
PMID[496992] |
NPT5569 |
Individual Protein |
Beta-lactamase BRO-1 |
Moraxella catarrhalis |
IC50 |
= |
0.006 |
ug.mL-1 |
PMID[496992] |
NPT651 |
Individual Protein |
Beta-lactamase OXA-1 |
Escherichia coli |
IC50 |
= |
0.08 |
ug.mL-1 |
PMID[496992] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
IC50 |
= |
0.005 |
ug.mL-1 |
PMID[496992] |
NPT650 |
Individual Protein |
Beta-lactamase pse-1 |
Escherichia coli |
IC50 |
= |
15.0 |
ug.mL-1 |
PMID[496993] |
NPT651 |
Individual Protein |
Beta-lactamase OXA-1 |
Escherichia coli |
IC50 |
= |
350.0 |
ug.mL-1 |
PMID[496993] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
29.0 |
ug.mL-1 |
PMID[496993] |
NPT653 |
Individual Protein |
Beta-lactamase |
Pseudomonas aeruginosa (strain ATCC 15692 / PAO1 / 1C / PRS 101 / LMG12228) |
IC50 |
= |
740000.0 |
ug.mL-1 |
PMID[496993] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
= |
160000.0 |
ug.mL-1 |
PMID[496993] |
NPT655 |
Individual Protein |
Beta-lactamase |
Proteus mirabilis |
IC50 |
= |
19.0 |
ug.mL-1 |
PMID[496993] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
IC50 |
= |
30.0 |
ug.mL-1 |
PMID[496993] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
ID50 |
= |
0.315 |
uM |
PMID[496994] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
ID50 |
= |
310.0 |
uM |
PMID[496994] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
ID50 |
= |
0.38 |
uM |
PMID[496994] |
NPT5570 |
Individual Protein |
SHV-5 extended spectrum beta-lactamase |
Escherichia coli |
ID50 |
= |
0.013 |
uM |
PMID[496994] |
NPT651 |
Individual Protein |
Beta-lactamase OXA-1 |
Escherichia coli |
ID50 |
= |
3.4 |
uM |
PMID[496994] |
NPT5571 |
Individual Protein |
Beta-lactamase PSE-4 |
Pseudomonas aeruginosa |
ID50 |
= |
0.235 |
uM |
PMID[496994] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[496994] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[496994] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
= |
100000.0 |
nM |
PMID[496995] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
40.0 |
nM |
PMID[496995] |
NPT653 |
Individual Protein |
Beta-lactamase |
Pseudomonas aeruginosa (strain ATCC 15692 / PAO1 / 1C / PRS 101 / LMG12228) |
IC50 |
= |
800.0 |
nM |
PMID[496996] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
15.0 |
nM |
PMID[496996] |
NPT5572 |
Individual Protein |
Carbepenem-hydrolyzing beta-lactamase KPC |
Klebsiella pneumoniae |
MPC |
= |
0.1 |
ug ml-1 |
PMID[496997] |
NPT5565 |
Individual Protein |
Beta-lactamase type II |
Bacteroides fragilis |
MPC |
= |
63.0 |
ug ml-1 |
PMID[496997] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
MPC |
= |
0.4 |
ug ml-1 |
PMID[496997] |
NPT5573 |
Individual Protein |
Beta-lactamase 1 |
Bacillus cereus |
Inhibition |
= |
78.0 |
% |
PMID[496998] |
NPT5573 |
Individual Protein |
Beta-lactamase 1 |
Bacillus cereus |
Inhibition |
= |
33.0 |
% |
PMID[496998] |
NPT5573 |
Individual Protein |
Beta-lactamase 1 |
Bacillus cereus |
Inhibition |
= |
9.0 |
% |
PMID[496998] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
25000.0 |
nM |
PMID[496998] |
NPT5574 |
Individual Protein |
Beta-lactamase class C |
Enterobacter cloacae |
IC50 |
= |
100000.0 |
nM |
PMID[496998] |
NPT651 |
Individual Protein |
Beta-lactamase OXA-1 |
Escherichia coli |
IC50 |
= |
3200.0 |
nM |
PMID[496999] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
21000.0 |
nM |
PMID[496999] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
IC50 |
= |
80.0 |
nM |
PMID[496999] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
> |
20000.0 |
nM |
PMID[497000] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
60.0 |
nM |
PMID[497000] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
Ki |
= |
800.0 |
nM |
PMID[497001] |
NPT5575 |
Individual Protein |
Gil1 |
Citrobacter gillenii |
IC50 |
= |
9.0 |
nM |
PMID[497004] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
30.0 |
nM |
PMID[497005] |
NPT5568 |
Individual Protein |
Beta-lactamase SHV-1 |
Escherichia coli |
IC50 |
= |
28.0 |
nM |
PMID[497005] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
= |
136200.0 |
nM |
PMID[497005] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
Activity |
= |
3.0 |
uM |
PMID[497007] |
NPT5576 |
Individual Protein |
Beta-lactamase SCO-1 |
Escherichia coli |
IC50 |
= |
70.0 |
nM |
PMID[497007] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
170.0 |
nM |
PMID[497007] |
NPT5577 |
Individual Protein |
Beta-lactamase |
Bacillus clausii |
IC50 |
= |
85.0 |
nM |
PMID[497009] |
NPT5578 |
Individual Protein |
Carbapenem-hydrolizing beta-lactamase SFC-1 |
Serratia fonticola |
IC50 |
= |
72800.0 |
nM |
PMID[497010] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
0.029 |
ug.mL-1 |
PMID[497012] |
NPT653 |
Individual Protein |
Beta-lactamase |
Pseudomonas aeruginosa (strain ATCC 15692 / PAO1 / 1C / PRS 101 / LMG12228) |
IC50 |
= |
740.0 |
ug.mL-1 |
PMID[497012] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
= |
155.0 |
ug.mL-1 |
PMID[497012] |
NPT655 |
Individual Protein |
Beta-lactamase |
Proteus mirabilis |
IC50 |
= |
0.019 |
ug.mL-1 |
PMID[497012] |
NPT656 |
Individual Protein |
Beta-lactamase |
Staphylococcus aureus |
IC50 |
= |
0.03 |
ug.mL-1 |
PMID[497012] |
NPT5580 |
Individual Protein |
Beta-lactamase CTX-M |
Escherichia coli |
IC50 |
= |
9.0 |
nM |
PMID[497013] |
NPT5581 |
Individual Protein |
Beta-lactamase ACC-4 |
Escherichia coli |
IC50 |
> |
500000.0 |
nM |
PMID[497016] |
NPT5582 |
Individual Protein |
Beta-lactamase TEM-125 |
Escherichia coli |
IC50 |
= |
8600.0 |
nM |
PMID[497017] |
NPT652 |
Individual Protein |
Beta-lactamase TEM |
Escherichia coli |
IC50 |
= |
80.0 |
nM |
PMID[497017] |
NPT5572 |
Individual Protein |
Carbepenem-hydrolyzing beta-lactamase KPC |
Klebsiella pneumoniae |
IC50 |
= |
10500.0 |
nM |
PMID[497024] |
NPT5583 |
Individual Protein |
Beta-lactamase GES-13 |
Pseudomonas aeruginosa |
IC50 |
= |
100.0 |
nM |
PMID[497026] |
NPT5584 |
Individual Protein |
Beta-lactamase SHV-1 |
Klebsiella pneumoniae |
IC50 |
= |
170.0 |
nM |
PMID[497027] |
NPT5585 |
Individual Protein |
Beta-lactamase SHV-72 |
Klebsiella pneumoniae |
IC50 |
= |
1720.0 |
nM |
PMID[497027] |
NPT5584 |
Individual Protein |
Beta-lactamase SHV-1 |
Klebsiella pneumoniae |
IC50 |
= |
170.0 |
nM |
PMID[497028] |
NPT5586 |
Individual Protein |
Beta-lactamase SHV-55 |
Klebsiella pneumoniae |
IC50 |
= |
20.0 |
nM |
PMID[497028] |
NPT5587 |
Individual Protein |
Class D beta-lactamase |
Brachyspira pilosicoli |
IC50 |
= |
2000.0 |
nM |
PMID[497030] |
NPT5475 |
Individual Protein |
Beta-lactamase VIM-2 |
Pseudomonas aeruginosa |
Km |
> |
5000000.0 |
nM |
PMID[497032] |
NPT5475 |
Individual Protein |
Beta-lactamase VIM-2 |
Pseudomonas aeruginosa |
Kcat |
= |
5.4 |
/s |
PMID[497032] |
NPT5475 |
Individual Protein |
Beta-lactamase VIM-2 |
Pseudomonas aeruginosa |
Kcat/Km |
= |
0.0011 |
/uM/s |
PMID[497032] |
NPT5572 |
Individual Protein |
Carbepenem-hydrolyzing beta-lactamase KPC |
Klebsiella pneumoniae |
Ki |
= |
11000.0 |
nM |
PMID[497036] |
NPT5589 |
Individual Protein |
ADC-14 protein |
Acinetobacter genomosp. 3 |
IC50 |
= |
235520.0 |
nM |
PMID[497037] |
NPT5590 |
Individual Protein |
ADC-16 protein |
Acinetobacter genomosp. 3 |
IC50 |
= |
1462480.0 |
nM |
PMID[497037] |
NPT5591 |
Individual Protein |
ADC-18 protein |
Acinetobacter genomosp. 3 |
IC50 |
= |
1928020.0 |
nM |
PMID[497037] |
NPT5592 |
Individual Protein |
Extended-spectrum beta-lactamase CTX-M-53 |
Salmonella enterica subsp. enterica serovar Westhampton |
IC50 |
= |
10.0 |
nM |
PMID[497039] |
NPT5595 |
Individual Protein |
Beta-lactamase ADC-33 |
Acinetobacter baumannii |
IC50 |
= |
1600000.0 |
nM |
PMID[497042] |
NPT5596 |
Individual Protein |
ADC-11 |
Acinetobacter baumannii |
IC50 |
= |
2100000.0 |
nM |
PMID[497042] |
NPT654 |
Individual Protein |
Beta-lactamase |
Enterobacter cloacae |
IC50 |
> |
100000.0 |
nM |
PMID[497044] |
NPT653 |
Individual Protein |
Beta-lactamase |
Pseudomonas aeruginosa (strain ATCC 15692 / PAO1 / 1C / PRS 101 / LMG12228) |
IC50 |
> |
100000.0 |
nM |
PMID[497044] |
NPT5597 |
Individual Protein |
Beta-lactamase SHV-5 |
Klebsiella pneumoniae |
Ki |
= |
25360.0 |
nM |
PMID[497049] |
NPT5598 |
Individual Protein |
Beta-lactamase SHV-95 |
Citrobacter freundii |
Ki |
= |
107900.0 |
nM |
PMID[497049] |
NPT5584 |
Individual Protein |
Beta-lactamase SHV-1 |
Klebsiella pneumoniae |
Ki |
= |
229100.0 |
nM |
PMID[497049] |
NPT5599 |
Individual Protein |
Extended-spectrum beta-lactamase SHV-48 |
Acinetobacter baumannii |
Ki |
= |
227360.0 |
nM |
PMID[497049] |
NPT56 |
Individual Protein |
Beta-lactamase AmpC |
Escherichia coli K-12 |
IC50 |
= |
137664.7 |
nM |
PMID[497053] |
NPT5568 |
Individual Protein |
Beta-lactamase SHV-1 |
Escherichia coli |
IC50 |
= |
30.3 |
nM |
PMID[497053] |
NPT26298 |
SINGLE PROTEIN |
Beta lactamase TEM-1 |
Klebsiella pneumoniae |
MPC |
= |
0.1 |
ug ml-1 |
PMID[496990] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[496990] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[496990] |
NPT27 |
Others |
Unspecified |
|
T1/2 |
= |
2.0 |
hr |
PMID[496991] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
65.0 |
nM |
PMID[496991] |
NPT2 |
Others |
Unspecified |
|
ID50 |
= |
0.51 |
uM |
PMID[496994] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[496994] |
NPT2897 |
Organism |
Citrobacter freundii |
Citrobacter freundii |
MIC |
= |
8.0 |
ug.mL-1 |
PMID[496996] |
NPT18 |
Organism |
Pseudomonas aeruginosa |
Pseudomonas aeruginosa |
MIC |
> |
32.0 |
ug.mL-1 |
PMID[496996] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
0.25 |
ug.mL-1 |
PMID[496996] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[496997] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
= |
63.0 |
ug.mL-1 |
PMID[496997] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
63.0 |
ug.mL-1 |
PMID[496997] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
= |
2.0 |
ug.mL-1 |
PMID[496997] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
MIC |
= |
4.0 |
ug.mL-1 |
PMID[496997] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
4.0 |
ug.mL-1 |
PMID[496997] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
16.0 |
ug.mL-1 |
PMID[496997] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
160.0 |
nM |
PMID[496999] |
NPT1033 |
Organism |
Enterobacter cloacae |
Enterobacter cloacae |
IC50 |
= |
100000.0 |
nM |
PMID[497002] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
IC50 |
= |
40.0 |
nM |
PMID[497002] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
80.0 |
nM |
PMID[497003] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
20500.0 |
nM |
PMID[497003] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
25.0 |
nM |
PMID[497003] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
20.0 |
nM |
PMID[497003] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
170.0 |
nM |
PMID[497003] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
1000.0 |
nM |
PMID[497003] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
F |
= |
75.0 |
% |
PMID[497006] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
100.0 |
nM |
PMID[497007] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
300.0 |
nM |
PMID[497008] |
NPT5579 |
Organism |
Aeromonas punctata |
Aeromonas caviae |
MIC |
= |
16.0 |
ug.mL-1 |
PMID[497011] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
4.0 |
ug.mL-1 |
PMID[497011] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
8.0 |
ug.mL-1 |
PMID[497011] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
0.5 |
ug.mL-1 |
PMID[497011] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
0.015 |
ug.mL-1 |
PMID[497012] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
0.35 |
ug.mL-1 |
PMID[497012] |
NPT27 |
Others |
Unspecified |
|
PPB |
= |
25.0 |
% |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Cmax |
= |
2.1 |
ug.mL-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
fCmax |
= |
1.5 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Tmax |
= |
1.5 |
hr |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
T1/2 |
= |
1.0 |
hr |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
ft1/2 |
= |
1.0 |
hr |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
AUC |
= |
4700.0 |
ng.hr.mL-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
fAUC |
= |
2900.0 |
ng.hr.mL-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
1.5 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
0.9 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
< |
0.03 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
0.1 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
0.4 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
1.0 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
1.4 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
0.7 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
2.1 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
1.3 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
1.2 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
0.5 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
Drug uptake |
= |
0.2 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
AUC |
= |
4500.0 |
ng.hr.mL-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
fCmax |
= |
1.4 |
ug ml-1 |
PMID[497014] |
NPT27 |
Others |
Unspecified |
|
fAUC |
= |
2800.0 |
ng.hr.mL-1 |
PMID[497014] |
NPT16 |
Organism |
Staphylococcus aureus |
Staphylococcus aureus |
IZ |
> |
16.0 |
mm |
PMID[497015] |
NPT17 |
Organism |
Staphylococcus epidermidis |
Staphylococcus epidermidis |
IZ |
> |
16.0 |
mm |
PMID[497015] |
NPT18 |
Organism |
Pseudomonas aeruginosa |
Pseudomonas aeruginosa |
IZ |
> |
16.0 |
mm |
PMID[497015] |
NPT1033 |
Organism |
Enterobacter cloacae |
Enterobacter cloacae |
IZ |
> |
16.0 |
mm |
PMID[497015] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
IZ |
> |
16.0 |
mm |
PMID[497015] |
NPT173 |
Organism |
Klebsiella pneumoniae |
Klebsiella pneumoniae |
IZ |
= |
11.0 |
mm |
PMID[497015] |
NPT2 |
Others |
Unspecified |
|
Ratio IC50 |
= |
2.0 |
n.a. |
PMID[497017] |
NPT2 |
Others |
Unspecified |
|
Ratio IC50 |
= |
3.0 |
n.a. |
PMID[497017] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
1000.0 |
nM |
PMID[497017] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
13600.0 |
nM |
PMID[497017] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
20.0 |
nM |
PMID[497017] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
27000.0 |
nM |
PMID[497017] |
NPT1207 |
Organism |
Acinetobacter |
Acinetobacter |
MIC |
> |
2.0 |
ug.mL-1 |
PMID[497018] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
4700.0 |
nM |
PMID[497019] |
NPT2 |
Others |
Unspecified |
|
Ratio IC50 |
= |
60.0 |
n.a. |
PMID[497019] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
CL |
= |
3.1 |
mL.min-1.kg-1 |
PMID[497020] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
CL_renal |
= |
1.33 |
mL.min-1.kg-1 |
PMID[497020] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
CL_renal |
= |
1.3 |
mL.min-1.kg-1 |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
CL |
= |
1.8 |
mL.min-1.kg-1 |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
CL |
= |
3.1 |
mL.min-1.kg-1 |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
Vdss |
= |
0.22 |
L.kg-1 |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
F_fraction |
= |
0.75 |
n.a. |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
Fa |
= |
0.9 |
n.a. |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
Fg |
= |
0.9 |
n.a. |
PMID[497021] |
NPT614 |
Tissue |
Plasma |
Rattus norvegicus |
Fu |
= |
0.91 |
n.a. |
PMID[497021] |
NPT605 |
Organism |
Homo sapiens |
Homo sapiens |
Fh |
= |
0.92 |
n.a. |
PMID[497021] |
NPT26318 |
SINGLE PROTEIN |
Beta-lactamase |
Pseudomonas luteola |
IC50 |
= |
36.0 |
nM |
PMID[497022] |
NPT26319 |
SINGLE PROTEIN |
Beta-lactamase |
Pseudomonas aeruginosa |
IC50 |
= |
100.0 |
nM |
PMID[497023] |
NPT26320 |
SINGLE PROTEIN |
Beta-lactamase bla(BEL1) |
Pseudomonas aeruginosa |
IC50 |
= |
100.0 |
nM |
PMID[497023] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
30000.0 |
nM |
PMID[497024] |
NPT2 |
Others |
Unspecified |
|
Kcat/Km |
= |
0.0036 |
microM/s |
PMID[497025] |
NPT2 |
Others |
Unspecified |
|
Ratio |
= |
2500.0 |
n.a. |
PMID[497025] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
5.0 |
% |
PMID[497025] |
NPT2 |
Others |
Unspecified |
|
Km |
= |
8400.0 |
nM |
PMID[497025] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
195000.0 |
nM |
PMID[497029] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
104000.0 |
nM |
PMID[497029] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
19000.0 |
nM |
PMID[497029] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
45000.0 |
nM |
PMID[497029] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
51000.0 |
nM |
PMID[497029] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
IZ |
>= |
5.0 |
mm |
PMID[497031] |
NPT173 |
Organism |
Klebsiella pneumoniae |
Klebsiella pneumoniae |
IZ |
>= |
5.0 |
mm |
PMID[497031] |
NPT26326 |
SINGLE PROTEIN |
Metallo-b-lactamase |
Pseudomonas aeruginosa |
Kcat |
= |
2.3 |
/s |
PMID[497032] |
NPT26326 |
SINGLE PROTEIN |
Metallo-b-lactamase |
Pseudomonas aeruginosa |
Km |
= |
940000.0 |
nM |
PMID[497032] |
NPT26326 |
SINGLE PROTEIN |
Metallo-b-lactamase |
Pseudomonas aeruginosa |
Kcat/Km |
= |
0.0025 |
/uM/s |
PMID[497032] |
NPT27 |
Others |
Unspecified |
|
Vdss |
= |
0.22 |
L.kg-1 |
PMID[497033] |
NPT27 |
Others |
Unspecified |
|
T1/2 |
= |
0.9 |
hr |
PMID[497033] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
Fu |
= |
0.91 |
n.a. |
PMID[497033] |
NPT27 |
Others |
Unspecified |
|
MRT |
= |
1.0 |
hr |
PMID[497033] |
NPT27 |
Others |
Unspecified |
|
CL |
= |
3.1 |
mL.min-1.kg-1 |
PMID[497033] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
10.0 |
nM |
PMID[497034] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
MIC |
= |
16.0 |
ug.mL-1 |
PMID[497035] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
2.0 |
ug.mL-1 |
PMID[497035] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
16.0 |
ug.mL-1 |
PMID[497035] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
13000.0 |
nM |
PMID[497036] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
55000.0 |
nM |
PMID[497036] |
NPT2 |
Others |
Unspecified |
|
FC |
= |
1.7 |
n.a. |
PMID[497036] |
NPT2 |
Others |
Unspecified |
|
FC |
= |
5.0 |
n.a. |
PMID[497036] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
100.0 |
nM |
PMID[497038] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
70.0 |
nM |
PMID[497038] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
1.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
0.25 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
0.5 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
4.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
8.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
16.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
32.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC |
= |
2.0 |
ug.mL-1 |
PMID[497040] |
NPT4806 |
Organism |
Campylobacter coli |
Campylobacter coli |
MIC |
= |
8.0 |
ug.mL-1 |
PMID[497040] |
NPT4806 |
Organism |
Campylobacter coli |
Campylobacter coli |
MIC |
= |
4.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC50 |
= |
4.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC90 |
= |
8.0 |
ug.mL-1 |
PMID[497040] |
NPT2910 |
Organism |
Campylobacter jejuni |
Campylobacter jejuni |
MIC95 |
= |
0.25 |
ug ml-1 |
PMID[497040] |
NPT4806 |
Organism |
Campylobacter coli |
Campylobacter coli |
MIC50 |
= |
16.0 |
ug.mL-1 |
PMID[497040] |
NPT4806 |
Organism |
Campylobacter coli |
Campylobacter coli |
MIC90 |
= |
32.0 |
ug.mL-1 |
PMID[497040] |
NPT4806 |
Organism |
Campylobacter coli |
Campylobacter coli |
MIC95 |
= |
2.0 |
ug ml-1 |
PMID[497040] |
NPT4806 |
Organism |
Campylobacter coli |
Campylobacter coli |
MIC |
= |
2.0 |
ug.mL-1 |
PMID[497040] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
28.0 |
nM |
PMID[497043] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
30.0 |
nM |
PMID[497043] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
136200.0 |
nM |
PMID[497043] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
58.0 |
nM |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
12.0 |
nM |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
IC50 |
> |
100000.0 |
nM |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
4.0 |
nM |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
0.03 |
/s |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
Ratio |
= |
60000.0 |
/M/s |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
800.0 |
nM |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
Km |
= |
500.0 |
nM |
PMID[497044] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
80.0 |
nM |
PMID[497045] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
90.0 |
nM |
PMID[497045] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
100.0 |
nM |
PMID[497045] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
500.0 |
nM |
PMID[497045] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
800.0 |
nM |
PMID[497045] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
1700.0 |
nM |
PMID[497045] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
337130.0 |
nM |
PMID[497049] |
NPT2 |
Others |
Unspecified |
|
Tm |
= |
46.1 |
degrees C |
PMID[497050] |
NPT2 |
Others |
Unspecified |
|
Tm |
= |
55.0 |
degrees C |
PMID[497050] |
NPT2 |
Others |
Unspecified |
|
Ratio |
= |
50.0 |
n.a. |
PMID[497050] |
NPT2 |
Others |
Unspecified |
|
Ratio |
= |
25.0 |
n.a. |
PMID[497050] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
< |
0.06 |
ug.mL-1 |
PMID[497050] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
7700.0 |
nM |
PMID[497050] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
1300.0 |
nM |
PMID[497050] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
4.0 |
ug.mL-1 |
PMID[497050] |
NPT19 |
Organism |
Escherichia coli |
Escherichia coli |
MIC |
= |
16.0 |
ug.mL-1 |
PMID[497050] |
NPT621 |
Tissue |
Plasma |
Homo sapiens |
fCmax |
= |
8.616 |
uM |
PMID[497051] |
NPT712 |
Individual Protein |
Bile salt export pump |
Rattus norvegicus |
IC50 |
> |
1000000.0 |
nM |
PMID[497051] |
NPT713 |
Individual Protein |
Bile salt export pump |
Homo sapiens |
IC50 |
> |
1000000.0 |
nM |
PMID[497051] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
845000.0 |
nM |
PMID[497052] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
1106000.0 |
nM |
PMID[497052] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
20.0 |
nM |
PMID[497052] |
NPT2 |
Others |
Unspecified |
|
Ki |
<= |
39.0 |
nM |
PMID[497052] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
27.0 |
nM |
PMID[497052] |
NPT2 |
Others |
Unspecified |
|
Ki |
= |
41200.0 |
nM |
PMID[497052] |
NPT26338 |
SINGLE PROTEIN |
Bacterial beta-lactamase TEM |
Bacteria |
IC50 |
= |
29.5 |
nM |
PMID[497053] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
12.0 |
nM |
PMID[497054] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
40.0 |
nM |
PMID[497054] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
1800.0 |
nM |
PMID[497054] |
NPT2 |
Others |
Unspecified |
|
IC50 |
> |
100000.0 |
nM |
PMID[497054] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
120.0 |
nM |
PMID[497054] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
30000.0 |
nM |
PMID[497054] |
NPT88 |
Organism |
Mycobacterium tuberculosis |
Mycobacterium tuberculosis |
FC |
= |
4.0 |
n.a. |
PMID[497055] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
IC50 |
> |
20000.0 |
nM |
PMID[497056] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
IC50 |
> |
19952.62 |
nM |
PMID[497056] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
  Chemically structural similarity: I. Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient ![](images/questionmark.png)
●  The left chart: Distribution of similarity level between NPC264014 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 106 |
0.1-0.2 | 3324 |
0.2-0.3 | 28689 |
0.3-0.4 | 9256 |
0.4-0.5 | 1211 |
0.5-0.6 | 109 |
0.6-0.7 | 1 |
0.7-0.8 | 0 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 1 |
  Chemically structural similarity: II. Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC264014 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 79 |
0.1-0.2 | 1634 |
0.2-0.3 | 5525 |
0.3-0.4 | 1592 |
0.4-0.5 | 293 |
0.5-0.6 | 24 |
0.6-0.7 | 1 |
0.7-0.8 | 0 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 2 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
1.0 |
High Similarity |
NPD9512 |
Approved |
0.9873 |
High Similarity |
NPD9511 |
Approved |
0.6147 |
Remote Similarity |
NPD777 |
Phase 3 |
0.5847 |
Remote Similarity |
NPD1773 |
Discontinued |
0.5798 |
Remote Similarity |
NPD2495 |
Phase 3 |
0.5641 |
Remote Similarity |
NPD1376 |
Discontinued |
0.5619
|
Remote Similarity |
NPD161 |
Discontinued |