Natural Product: NPC260909| Natural Product ID | NPC260909 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Vincristine |
| IUPAC Name | n.a. |
| Synonyms | Vincristine |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL90555 |
| PubChem CID |
5978 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | OGWKCGZFUXNPDA-XQKSVPLYSA-N |
| Standard InCHI | InChI=1S/C46H56N4O10/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3/t28-,37+,38-,39-,42+,43-,44-,45+,46+/m1/s1 |
| SMILES | CC[C@@]1(C[C@@H]2C[C@](c3cc4c(cc3OC)N(C=O)[C@@H]3[C@@]54CCN4CC=C[C@](CC)([C@@H]54)[C@H]([C@@]3(C(=O)OC)O)OC(=O)C)(c3c(CCN(C2)C1)c1ccccc1[nH]3)C(=O)OC)O |
  Calculated Properties| Molecular Weight:   | 824.4 | Volume:   | 827.415 Van der Waals volume.
|
| Dense:   | 0.996 | LogP:   | 2.88 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.722 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -4.301 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 11.0 | Rigid Bonds:   | 49.0 |
| TPSA:   | 171.17 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 14.0 |
| H-Bond Donor:   | 3.0 | Rings:   | 9.0 |
| Heavy Atoms:   | 14.0 |
| QED Drug-Likeness Score:   | 0.131 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 7.261 | Fsp3:   | 0.565 |
| MCE-18:   | 270.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Accepted |
| Pfizer Rule:   | Rejected | GSK Rule:   | Accepted |
| Golden Triangle Rule:   | Accepted | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.364 | Fluc inhibitor:   | 0.005 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.699 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.868 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.001 | Promiscuous compounds:   | 0.994 |
| Caco-2 Permeability:   | -6.168 | MDCK Permeability:   | -5.21 |
| Pgp-inhibitor:   | 0.0 | Pgp-substrate:   | 1.0 |
| PAMPA:   |
0.237 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.0 |
| 20% Bioavailability (F20%):   | 0.184 | 30% Bioavailability (F30%):   | 0.939 |
| 50% Bioavailability (F50%):   | 0.998 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.697 | MRP1:   | 1.0 |
| Plasma Protein Binding (PPB):   | 64.325% | Volume Distribution (VD):   | 0.38 |
| Fu: |
33.31% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.465 |
| OATP1B3 inhibitor:   | 0.228 | BCRP inhibitor:   | 0.791 |
| BSEP inhibitor:   | 0.997 |
| CYP1A2-inhibitor:   | 0.999 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 1.0 | CYP2C19-substrate:   | 0.0 |
| CYP2C9-inhibitor:   | 0.0 | CYP2C9-substrate:   | 0.028 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 1.0 |
| CYP3A4-inhibitor:   | 1.0 | CYP3A4-substrate:   | 0.888 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.858 |
| HLM stability:   |
0.919 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 3.294 | Half-life (T1/2):   | 1.633 |
| hERG Blockers:   | 0.556 | hERG Blockers (10um):   | 0.153 |
| Human Hepatotoxicity (H-HT):   | 0.918 | Drug-induced Liver Injury (DILI):   | 0.722 |
| AMES Toxicity:   | 0.577 | Rat Oral Acute Toxicity:   | 0.864 |
| Maximum Recommended Daily Dose:   | 1.0 | Skin Sensitization:   | 1.0 |
| Carcinogencity:   | 0.225 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.0 | Respiratory Toxicity:   | 0.997 |
| Drug-induced Neurotoxicity:   | 0.904 | Ototoxicity:   | 0.901 |
| Hematotoxicity:   | 0.716 | Drug-induced Nephrotoxicity:   | 1.0 |
| Genotoxicity:   | 1.0 | RPMI-8226 Immunitoxicity:   | 0.623 |
| A549 Cytotoxicity:   | 0.99 | Hek293 Cytotoxicity:   | 0.945 |
| BCF:   |
0.581 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.861 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.641 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.889 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO64916 | Catharanthus roseus + Fusarium oxysporum symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 24066024] |
| NPO64872 | Catharanthus roseus + Talaromyces radicus symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 26697875] |
| NPO64694 | Catharanthus roseus + Eutypella spp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 27550200] |
| NPO64890 | Nerium indicum + Geomyces sp. symbiont | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[ 27664729] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[ 3619437] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1002/btpr.97] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1007/s11738-010-0631-6] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/j.plaphy.2018.10.015] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1080/17429145.2017.1293852] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1186/1750-2187-3-9] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12628396] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18778099] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[18778099] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | Hairy roots | n.a. | n.a. |
PMID[19271765] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[24773071] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | stem-bark | Pahang, Malaysia | 2003-JUN |
PMID[25919190] |
| NPO40245 | Nocardiopsis lucentensis DSM 44048 | Strain | Nocardiopsaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[26270803] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26285573] |
| NPO8665 | Kopsia pauciflora | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26717050] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26918761] |
| NPO10899 | Ophioparma ventosa | Species | Ophioparmaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26934105] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27077800] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29319316] |
| NPO40779 | Alstonia penangiana | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29746134] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30869890] |
| NPO40245 | Nocardiopsis lucentensis DSM 44048 | Strain | Nocardiopsaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[30958679] |
| NPO40779 | Alstonia penangiana | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31642315] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32356659] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[6619887] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[6631435] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7264679] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7264682] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7320741] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10899 | Ophioparma ventosa | Species | Ophioparmaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40779 | Alstonia penangiana | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8665 | Kopsia pauciflora | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40245 | Nocardiopsis lucentensis DSM 44048 | Strain | Nocardiopsaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO8665 | Kopsia pauciflora | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9376 | Tabernaemontana corymbosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO10899 | Ophioparma ventosa | Species | Ophioparmaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5881 | Catharanthus roseus | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 33.8 | nM | PubChem BioAssay data set |
| NPT2698 | Individual protein | Beta tubulin | Leishmania donovani | IC50 | < | 1000.0 | nM | PMID[15546733] |
| NPT2698 | Individual protein | Beta tubulin | Leishmania donovani | Inhibition | = | 83.0 | % | PMID[15546733] |
| NPT1197 | Individual protein | Huntingtin | Homo sapiens | Potency | = | 17.8 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 562.3 | nM | PubChem BioAssay data set |
| NPT304 | Individual protein | Canalicular multispecific organic anion transporter 1 | Rattus norvegicus | Activity | = | 42.0 | % | PMID[2172249] |
| NPT2850 | Individual protein | Multidrug resistance associated protein | Homo sapiens | Activity | = | 39.1 | % | PMID[11585759] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | IC50 | = | 70000.0 | nM | PMID[8621644] |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 298.6 | nM | PubChem BioAssay data set |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | = | 11157.6 | nM | PMID[37468498] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | = | 5726.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2761 | Individual protein | Phosphodiesterase 4A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT781 | Individual protein | Tubulin alpha chain | Sus scrofa | IC50 | = | 220.0 | nM | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT782 | Protein family | Tubulin | Bos taurus | IC50 | = | 1800.0 | nM | PMID[9554885] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 1.1 | nM | PubChem BioAssay data set |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Ki | = | 9800.0 | nM | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | IC50 | = | 11000.0 | nM | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 59.8 | % | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 65.1 | % | PMID[25618019] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Ki | = | 17600.0 | nM | PMID[25618019] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | IC50 | = | 36780.0 | nM | PMID[25618019] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3597 | Individual protein | Tubulin beta chain | Bos taurus | GTPase Activity | = | 0.09 | n.a. | PMID[11741473] |
| NPT3597 | Individual protein | Tubulin beta chain | Bos taurus | GTPase Activity | = | 5.3 | n.a. | PMID[11741473] |
| NPT317 | Nucleic acid | Nucleic Acid | n.a. | Activity | = | 100.0 | % | PMID[1812211] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Activity | = | 82.0 | % | PMID[18457386] |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 79432.8 | nM | PubChem BioAssay data set |
| NPT957 | Individual protein | Multidrug resistance-associated protein 7 | Homo sapiens | Activity | = | 18.4 | % | PMID[12527806] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Ki | = | 802000.0 | nM | PMID[12134946] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Ki | = | 42000.0 | nM | PMID[22541068] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | IC50 | = | 44000.0 | nM | PMID[22541068] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 3.9 | % | PMID[22541068] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 28.1 | % | PMID[25618019] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | IC50 | = | 500.0 | nM | PMID[2066973] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Inhibition | = | 87.0 | % | PMID[17482458] |
| NPT459 | Individual protein | Human immunodeficiency virus type 1 reverse transcriptase | Human immunodeficiency virus 1 | IC50 | > | 200.0 | ug.mL-1 | PMID[1710653] |
| NPT445 | Individual protein | Peripheral myelin protein 22 | Rattus norvegicus | Potency | n.a. | 281.6 | nM | PubChem BioAssay data set |
| NPT445 | Individual protein | Peripheral myelin protein 22 | Rattus norvegicus | Potency | n.a. | 90.7 | nM | PubChem BioAssay data set |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Inhibition | = | 13.0 | % | PMID[22541068] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Inhibition | = | 77.0 | % | PMID[24360827] |
| NPT3014 | Protein family | Tubulin | Sus scrofa | Ratio IC50 | = | 2.0 | n.a. | PMID[26580420] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 747.0 | a.u. | PMID[29407956] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 722.0 | a.u. | PMID[30055463] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 25.5 | % | PMID[32171161] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 28.8 | % | PMID[32171161] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 25.2 | % | PMID[32171161] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 30.4 | % | PMID[32171161] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 25.8 | % | PMID[32171161] |
| NPT518 | Protein complex | Tubulin | Homo sapiens | Activity | = | 29.1 | % | PMID[32171161] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30108 | Protein complex group | Tubulin | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35339837] |
| NPT74 | Individual protein | Proto-oncogene c-JUN | Homo sapiens | Potency | n.a. | 848.5 | nM | PubChem BioAssay data set |
| NPT1881 | Nucleic acid | Calf thymus DNA | Bos taurus | Activity | > | 70.0 | % | PMID[1812211] |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ratio_Papp | = | 6.31 | n.a. | PMID[11602674] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ratio_ATPase activity | = | 1.46 | n.a. | PMID[11602674] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | % maximum response | = | 8.4 | % | PMID[11602674] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ki1 | = | 0.47 | uM | PMID[9862789] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ki2 | = | 148.0 | uM | PMID[9862789] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ki | = | 213000.0 | nM | PMID[12134945] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | FC | = | 62.8 | n.a. | PMID[33725657] |
| NPT670 | Individual protein | Thrombin | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | IC50 | = | 2930.0 | ug.mL-1 | PMID[9207950] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 1.12 | nM | PMID[11728191] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 0.13 | nM | PMID[11728191] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 0.01 | nM | PMID[11728191] |
| NPT2829 | Cell line | MES-SA/DxS | Homo sapiens | IC50 | = | 0.02 | nM | PMID[11728191] |
| NPT168 | Cell line | P388 | Mus musculus | EC50 | = | 20.0 | nM | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 4.7 | nM | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 190.0 | nM | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT168 | Cell line | P388 | Mus musculus | ILS | ~ | 10.0 | % | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT168 | Cell line | P388 | Mus musculus | ILS | ~ | 147.0 | % | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT168 | Cell line | P388 | Mus musculus | ILS | ~ | 5.0 | % | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT168 | Cell line | P388 | Mus musculus | ILS | ~ | 130.0 | % | DOI[10.1016/S0960-894X(00)80225-5] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[12502374] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 17.0 | nM | PMID[12502374] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 3.4 | nM | PMID[1479582] |
| NPT168 | Cell line | P388 | Mus musculus | ILS | = | 85.0 | % | PMID[1433180] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.014 | ug.mL-1 | PMID[9873417] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1.05 | ug.mL-1 | PMID[9873417] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Log CR | = | 2.76 | n.a. | PMID[2362268] |
| NPT3859 | Cell line | PC-6 | Homo sapiens | GI50 | = | 1.14 | nM | PMID[9873473] |
| NPT681 | Cell line | PC-12 | Rattus norvegicus | GI50 | = | 104.0 | nM | PMID[9873473] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 350.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 50.0 | nM | PMID[14761187] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 35.0 | nM | PMID[10411476] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 5.0 | nM | PMID[10411476] |
| NPT137 | Cell line | L1210 | Mus musculus | MI0.5 | = | 11.0 | nM | PMID[2795608] |
| NPT168 | Cell line | P388 | Mus musculus | ILS | = | 122.0 | % | PMID[2795608] |
| NPT81 | Cell line | A549 | Homo sapiens | Combination_index | = | 0.301 | n.a. | PMID[15012986] |
| NPT81 | Cell line | A549 | Homo sapiens | Combination_index | = | 0.462 | n.a. | PMID[15012986] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.014 | ug.mL-1 | PMID[10612603] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.051 | ug.mL-1 | PMID[10612603] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 4.0 | nM | PMID[14761187] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[14761187] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 200.0 | nM | PMID[14761187] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 0.025 | ug.mL-1 | PMID[2769688] |
| NPT137 | Cell line | L1210 | Mus musculus | Mitotic index | = | 0.62 | uM | PMID[7131483] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 2.0 | nM | PMID[11140731] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[11140731] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.85 | nM | PMID[2066973] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 165.0 | % | PMID[2066973] |
| NPT168 | Cell line | P388 | Mus musculus | LTS | = | 0.0 | n.a. | PMID[2066973] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 2.06 | nM | PMID[9554885] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.84 | nM | PMID[9554885] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 0.73 | nM | PMID[9554885] |
| NPT1178 | Cell line | KB 3-1 | Homo sapiens | IC50 | = | 1230.48 | nM | PMID[15324905] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 1.0 | nM | PMID[15546733] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 20.0 | nM | PMID[15546733] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | = | 3.0 | nM | PMID[15546733] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 5.0 | nM | PMID[17915851] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[17915851] |
| NPT3158 | Cell line | NCI-H295R | Homo sapiens | IC50 | = | 90.0 | nM | PMID[16539377] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[17915851] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[17915851] |
| NPT5188 | Cell line | ARO | Homo sapiens | IC50 | = | 0.1 | nM | PMID[16539377] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[17915851] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[17915851] |
| NPT5189 | Cell line | PT-45 | Homo sapiens | IC50 | = | 4.0 | nM | PMID[17915851] |
| NPT3722 | Cell line | 4T1 | Mus musculus | IC50 | = | 20.0 | nM | PMID[16539377] |
| NPT5190 | Cell line | BNL | Mus musculus | IC50 | = | 80.0 | nM | PMID[16539377] |
| NPT1527 | Cell line | WRL68 | Homo sapiens | IC50 | = | 1.42 | ug.mL-1 | PMID[16480866] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.15 | ug.mL-1 | PMID[16480866] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.05 | ug.mL-1 | PMID[16480866] |
| NPT1527 | Cell line | WRL68 | Homo sapiens | IC50 | = | 8.5 | ug.mL-1 | PMID[16480866] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.02 | ug.mL-1 | PMID[16480866] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.25 | ug.mL-1 | PMID[16480866] |
| NPT2400 | Cell line | PA-1 | Homo sapiens | IC50 | = | 0.01 | ug.mL-1 | PMID[16480866] |
| NPT3852 | Cell line | COLO 320DM | Homo sapiens | IC50 | = | 0.46 | ug.mL-1 | PMID[16480866] |
| NPT2400 | Cell line | PA-1 | Homo sapiens | IC50 | = | 1.0 | ug.mL-1 | PMID[16480866] |
| NPT3852 | Cell line | COLO 320DM | Homo sapiens | IC50 | = | 1.5 | ug.mL-1 | PMID[16480866] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[17154505] |
| NPT168 | Cell line | P388 | Mus musculus | Ratio IC50 | = | 66.0 | n.a. | PMID[17154505] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 0.63 | nM | PMID[17154505] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | Ratio IC50 | = | 41.0 | n.a. | PMID[17154505] |
| NPT552 | Cell line | P388/ADR | Mus musculus | IC50 | = | 4.5 | nM | PMID[17154505] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 0.29 | nM | PMID[17154505] |
| NPT552 | Cell line | P388/ADR | Mus musculus | IC50 | = | 299.0 | nM | PMID[17154505] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 2.2 | nM | PMID[17154505] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 2.6 | nM | PMID[19041247] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 2.2 | nM | PMID[19041247] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 4.5 | nM | PMID[17889547] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 0.6 | nM | PMID[21680190] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[17585747] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.0 | nM | PMID[17585747] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 8.5 | nM | PMID[17585747] |
| NPT133 | Cell line | ZR-75-1 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[17585747] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 360.0 | nM | PMID[17604394] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | < | 120.0 | nM | PMID[17604394] |
| NPT196 | Cell line | AGS | Homo sapiens | IC50 | < | 120.0 | nM | PMID[17604394] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[17604394] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[17889544] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 46.8 | % | PMID[17915851] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 0.5 | % | PMID[17915851] |
| NPT5188 | Cell line | ARO | Homo sapiens | IC50 | = | 0.3 | nM | PMID[17915851] |
| NPT2336 | Cell line | OE19 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[17915851] |
| NPT2337 | Cell line | OE33 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[17915851] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 7.9 | % | PMID[17915851] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 45.2 | % | PMID[17915851] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 0.9 | nM | PMID[17239597] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 3.1 | nM | PMID[17490878] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 16.7 | nM | PMID[17608533] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 2.8 | nM | PMID[17939738] |
| NPT396 | Cell line | T47D | Homo sapiens | EC50 | = | 43.0 | nM | PMID[18197614] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | EC50 | = | 58.0 | nM | PMID[18197614] |
| NPT4783 | Cell line | SNU-398 | Homo sapiens | EC50 | = | 12.0 | nM | PMID[18197614] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 7.9 | nM | PMID[18295490] |
| NPT111 | Cell line | K562 | Homo sapiens | Activity | = | 72.0 | % | PMID[18293907] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | IC50 | = | 1.51 | nM | PMID[17646169] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | IC50 | = | 9.42 | nM | PMID[17646169] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | Activity | = | 0.5 | % | PMID[17573162] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | Activity | = | 46.8 | % | PMID[17573162] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | Activity | = | 7.9 | % | PMID[17573162] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | Activity | = | 45.2 | % | PMID[17573162] |
| NPT15 | Cell line | Jurkat | Homo sapiens | IC50 | = | 0.0031 | ug.mL-1 | PMID[19026536] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 110.0 | % | PMID[14987066] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 92.0 | % | PMID[14987066] |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 242.0 | % | PMID[7161602] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 0.015 | ug ml-1 | PMID[18473435] |
| NPT81 | Cell line | A549 | Homo sapiens | ED50 | = | 0.004 | ug ml-1 | PMID[18473435] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ED50 | = | 0.01 | ug ml-1 | PMID[18473435] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | ED50 | = | 0.02 | ug ml-1 | PMID[18473435] |
| NPT306 | Cell line | PC-3 | Homo sapiens | ED50 | = | 0.01 | ug ml-1 | PMID[18473435] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[22119129] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[22119129] |
| NPT2433 | Cell line | SNU-423 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[19117761] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[19117761] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[19117761] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 0.066 | ug.mL-1 | PMID[15387638] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 20.74 | ug.mL-1 | PMID[14695795] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 7.0 | nM | PMID[2778449] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IZ | = | 30.0 | mm | PMID[2778449] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IZ | = | 15.0 | mm | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 1.2 | nM | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IZ | > | 40.0 | mm | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IZ | = | 32.5 | mm | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IZ | = | 12.5 | mm | PMID[2778449] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 1.3 | ug ml-1 | PMID[7130986] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 0.06 | ug.mL-1 | PMID[9392881] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[19111465] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 52210.0 | nM | PMID[19111465] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.4 | nM | PMID[25059503] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 90.1 | nM | PMID[19053773] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 17.6 | nM | PMID[19053773] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1.2 | nM | PMID[19053773] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 1.5 | nM | PMID[19147348] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 1.7 | nM | PMID[19147348] |
| NPT2452 | Cell line | NCI-H292 | n.a. | IC50 | = | 0.04 | ug.mL-1 | PMID[19027993] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | IC50 | = | 0.003 | ug.mL-1 | PMID[19027993] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 597.2 | nM | PMID[19743858] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 5300.0 | nM | PMID[19679470] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[19679470] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 3700.0 | nM | PMID[19679470] |
| NPT1179 | Cell line | MKN-28 | Homo sapiens | IC50 | = | 7100.0 | nM | PMID[19679470] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 0.87 | nM | PMID[19711971] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 10.0 | nM | PMID[20353152] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.07 | nM | PMID[20724170] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 1.1 | ug.mL-1 | PMID[20619938] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 0.05 | ug.mL-1 | PMID[20619938] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | Selectivity Index | = | 2.2 | n.a. | PMID[20619938] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ED50 | = | 12.1 | nM | PMID[21296579] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | ED50 | = | 24.2 | nM | PMID[21296579] |
| NPT81 | Cell line | A549 | Homo sapiens | ED50 | = | 4.8 | nM | PMID[21296579] |
| NPT306 | Cell line | PC-3 | Homo sapiens | ED50 | = | 12.1 | nM | PMID[21296579] |
| NPT65 | Cell line | HepG2 | Homo sapiens | ED50 | = | 2.9 | nM | PMID[21296579] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 2.4 | nM | PMID[21296579] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | GI50 | = | 36.0 | nM | PMID[21284385] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 18.0 | nM | PMID[21284385] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 7.0 | nM | PMID[21284385] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 18.0 | nM | PMID[21284385] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 18.0 | nM | PMID[21284385] |
| NPT91 | Cell line | KB | Homo sapiens | GI50 | = | 4.0 | nM | PMID[21284385] |
| NPT857 | Cell line | LLC-PK1 | Sus scrofa | GI50 | = | 30.0 | nM | PMID[21344920] |
| NPT857 | Cell line | LLC-PK1 | Sus scrofa | RatioGI50 | = | 70.0 | n.a. | PMID[21344920] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 23.0 | % | PMID[21664138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 35.9 | % | PMID[21664138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 28.6 | % | PMID[21664138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 12.5 | % | PMID[21664138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 25.3 | % | PMID[21664138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 31.6 | % | PMID[21664138] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 4.0 | % | PMID[21664138] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | > | 25.0 | ug.mL-1 | PMID[21428274] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Ratio IC50 | = | 15.5 | n.a. | PMID[21680190] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Ratio IC50 | = | 167.0 | n.a. | PMID[21680190] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Ratio IC50 | > | 1000.0 | n.a. | PMID[21780800] |
| NPT111 | Cell line | K562 | Homo sapiens | Ratio IC50 | = | 1000.0 | n.a. | PMID[22582991] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Ratio IC50 | = | 1000.0 | n.a. | PMID[22582991] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[21761866] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1290.0 | nM | PMID[21761866] |
| NPT91 | Cell line | KB | Homo sapiens | Ratio IC50 | = | 55.97 | n.a. | PMID[21761866] |
| NPT401 | Cell line | 786-0 | Homo sapiens | IC50 | = | 37.0 | nM | PMID[21774499] |
| NPT401 | Cell line | 786-0 | Homo sapiens | IC50 | = | 1.2 | nM | PMID[21774499] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 3.0 | nM | PMID[22119124] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1610.0 | nM | PMID[22119124] |
| NPT91 | Cell line | KB | Homo sapiens | Ratio IC50 | = | 536.7 | n.a. | PMID[22119124] |
| NPT91 | Cell line | KB | Homo sapiens | GI50 | = | 2.0 | nM | PMID[22465634] |
| NPT91 | Cell line | KB | Homo sapiens | RatioGI50 | = | 1320.0 | n.a. | PMID[22465634] |
| NPT4783 | Cell line | SNU-398 | Homo sapiens | IC50 | = | 46.7 | nM | PMID[22320354] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 6.5 | nM | PMID[22320354] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 4.2 | nM | PMID[22320354] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 100.0 | nM | PMID[22320354] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[22320354] |
| NPT890 | Cell line | SNU-387 | Homo sapiens | IC50 | = | 40.9 | nM | PMID[22320354] |
| NPT4783 | Cell line | SNU-398 | Homo sapiens | IC50 | < | 0.13 | nM | PMID[22320354] |
| NPT2433 | Cell line | SNU-423 | Homo sapiens | IC50 | = | 18.4 | nM | PMID[22320354] |
| NPT2443 | Cell line | SNU-449 | Homo sapiens | IC50 | > | 100.0 | nM | PMID[22320354] |
| NPT4613 | Cell line | SNU-475 | Homo sapiens | IC50 | = | 29.3 | nM | PMID[22320354] |
| NPT4783 | Cell line | SNU-398 | Homo sapiens | Activity | = | 17.1 | % | PMID[22320354] |
| NPT4783 | Cell line | SNU-398 | Homo sapiens | Activity | = | 64.5 | % | PMID[22320354] |
| NPT4783 | Cell line | SNU-398 | Homo sapiens | Activity | = | 14.7 | % | PMID[22320354] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[22582991] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 0.1 | nM | PMID[22582991] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 0.17 | nM | PMID[22582991] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Ratio IC50 | = | 1.0 | n.a. | PMID[22582991] |
| NPT111 | Cell line | K562 | Homo sapiens | Ratio IC50 | > | 1000.0 | n.a. | PMID[22582991] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Ratio IC50 | = | 1.0 | n.a. | PMID[22582991] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Ratio IC50 | > | 1000.0 | n.a. | PMID[22582991] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 7.0 | nM | PMID[22247789] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 6.0 | nM | PMID[22247789] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 72.53 | % | PMID[23202849] |
| NPT2292 | Cell line | CAL-33 | Homo sapiens | Activity | = | 49.2 | % | PMID[23202849] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 4.65 | % | PMID[23202849] |
| NPT2292 | Cell line | CAL-33 | Homo sapiens | Activity | = | 17.13 | % | PMID[23202849] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 16.43 | % | PMID[23202849] |
| NPT2292 | Cell line | CAL-33 | Homo sapiens | Activity | = | 14.29 | % | PMID[23202849] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 5.97 | % | PMID[23202849] |
| NPT2292 | Cell line | CAL-33 | Homo sapiens | Activity | = | 20.5 | % | PMID[23202849] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 2.11 | nM | PMID[23360284] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 4.3 | nM | PMID[23855338] |
| NPT1357 | Cell line | H22 | Mus musculus | TGI | = | 61.0 | % | PMID[23981529] |
| NPT1357 | Cell line | H22 | Mus musculus | TGI | = | 31.0 | % | PMID[23981529] |
| NPT3881 | Cell line | MX1 | Homo sapiens | IC50 | = | 75.0 | nM | PMID[23981529] |
| NPT3881 | Cell line | MX1 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[23981529] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[23981529] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 139.0 | nM | PMID[23981529] |
| NPT1081 | Cell line | BXPC-3 | Homo sapiens | IC50 | > | 500.0 | nM | PMID[23981529] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[23981529] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[23981529] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 53.0 | nM | PMID[23981529] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[23981529] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.6 | nM | PMID[24106982] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | Activity | = | 47.0 | % | PMID[24215819] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 15.0 | nM | PMID[26927488] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1.6 | nM | PMID[24437936] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | GI | = | 74.5 | % | PMID[24681981] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | GI | = | 72.6 | % | PMID[24681981] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | GI | = | 70.9 | % | PMID[24681981] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | GI | = | 69.8 | % | PMID[24681981] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | Activity | = | 46.0 | % | PMID[24675179] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.9 | nM | PMID[26160020] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 2.32 | nM | PMID[24583355] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 2128.0 | nM | PMID[24583355] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Ratio IC50 | = | 0.46 | n.a. | PMID[24583355] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.007 | ug.mL-1 | PMID[25333996] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | IC50 | = | 1030.0 | nM | DOI[10.1039/C5MD00529A] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | Activity | = | 16.81 | % | PMID[25257911] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 930.0 | nM | PMID[25061803] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 56.0 | nM | PMID[25061803] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 4300.0 | nM | PMID[25061803] |
| NPT81 | Cell line | A549 | Homo sapiens | Ratio IC50 | = | 4.7 | n.a. | PMID[25061803] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Ratio IC50 | = | 1063.0 | n.a. | PMID[25061803] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[26270803] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[26270803] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[26270803] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 40.0 | nM | PMID[26270803] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[26270803] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 36.83 | nM | PMID[26318055] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 3.3 | nM | PMID[26717050] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | Inhibition | = | 16.8 | % | DOI[10.1039/C5MD00529A] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 61.0 | nM | PMID[27149641] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 98.0 | nM | PMID[27149641] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[27149641] |
| NPT179 | Cell line | A2780 | Homo sapiens | Ratio IC50 | = | 6.46 | n.a. | PMID[27149641] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | Ratio IC50 | = | 22.5 | n.a. | PMID[27149641] |
| NPT81 | Cell line | A549 | Homo sapiens | Ratio IC50 | = | 9.2 | n.a. | PMID[27149641] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Ratio IC50 | = | 12.9 | n.a. | PMID[27149641] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | GI | = | 74.6 | % | PMID[27480030] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 23.45 | % | PMID[27187865] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 17.7 | % | PMID[27187865] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 2.75 | % | PMID[27187865] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 56.1 | % | PMID[27187865] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Ratio IC50 | = | 3.0 | n.a. | PMID[27187865] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 2.13 | nM | PMID[28064078] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.72 | nM | PMID[29294282] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.2 | nM | PMID[28333459] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 178.0 | nM | PMID[29678463] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | Activity | = | 74.5 | % | PMID[29133050] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | Activity | = | 72.6 | % | PMID[29133050] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | Activity | = | 70.9 | % | PMID[29133050] |
| NPT1668 | Cell line | NCI-H157 | Homo sapiens | Activity | = | 69.8 | % | PMID[29133050] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | Activity | = | 74.5 | % | PMID[29133050] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | Activity | = | 72.6 | % | PMID[29133050] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | Activity | = | 70.9 | % | PMID[29133050] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | Activity | = | 69.8 | % | PMID[29133050] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 0.042 | ug.mL-1 | PMID[29133050] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[29133061] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 25000.0 | nM | PMID[29133061] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.65 | nM | PMID[29795767] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[29886320] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | GI | = | 12.34 | % | PMID[29886320] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | GI | = | 17.74 | % | PMID[29886320] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | GI | = | 23.94 | % | PMID[29886320] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | GI | = | 45.74 | % | PMID[29886320] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | GI | = | 68.51 | % | PMID[29886320] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 0.00063 | ug.mL-1 | PMID[29274817] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 283.0 | % | PMID[30156410] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 265.0 | % | PMID[30156410] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 21.2 | % | PMID[30156410] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 9.7 | % | PMID[30156410] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | = | 64.1 | % | PMID[30156410] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 5310.0 | nM | PMID[30109000] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 5360.0 | nM | PMID[30109000] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 9860.0 | nM | PMID[30109000] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 5970.0 | nM | PMID[30109000] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.46 | ug.mL-1 | PMID[28760313] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 74.5 | % | PMID[31112894] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.21 | nM | PMID[30455148] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 10.3 | nM | PMID[30852384] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 3.0 | nM | PMID[31419740] |
| NPT2846 | Cell line | BHK-21 | Cricetulus griseus | IC50 | = | 1080.0 | nM | PMID[31404864] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 21.0 | nM | PMID[30530194] |
| NPT319 | Cell line | B16 | Mus musculus | IC50 | = | 500.0 | nM | PMID[26934105] |
| NPT941 | Cell line | HaCaT | Homo sapiens | IC50 | = | 650.0 | nM | PMID[26934105] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 0.008 | ug.mL-1 | PMID[32527555] |
| NPT179 | Cell line | A2780 | Homo sapiens | EC50 | = | 3.4 | nM | PMID[31047749] |
| NPT179 | Cell line | A2780 | Homo sapiens | EC50 | = | 3.9 | nM | PMID[31047749] |
| NPT885 | Cell line | PBL | n.a. | GI50 | = | 1200.0 | nM | PMID[32986419] |
| NPT885 | Cell line | PBL | n.a. | GI50 | = | 7500.0 | nM | PMID[32986419] |
| NPT91 | Cell line | KB | Homo sapiens | GI50 | = | 1.86 | nM | PMID[32171161] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 890.0 | nM | PMID[33477020] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1740.0 | nM | PMID[33477020] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 920.0 | nM | PMID[33477020] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 270.0 | nM | PMID[33636536] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 0.8 | nM | PMID[33872002] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 800.0 | nM | PMID[33872002] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 6.0 | nM | PMID[37849542] |
| NPT858 | Cell line | LNCaP | Homo sapiens | IC50 | = | 2600.0 | nM | PMID[32531682] |
| NPT2299 | Cell line | CAL-51 | Homo sapiens | GI50 | = | 89.0 | nM | PMID[37849542] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 178.0 | nM | PMID[32992133] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 173.0 | nM | PMID[37856840] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 350.0 | nM | PMID[35282680] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 7860.0 | nM | PMID[35282680] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[35282680] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 560.0 | nM | PMID[35282680] |
| NPT81 | Cell line | A549 | Homo sapiens | Ratio IC50 | = | 9.33 | n.a. | PMID[35282680] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 217.0 | nM | PMID[34649064] |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | IC50 | = | 10050.0 | nM | PMID[33725657] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[35282680] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 170.0 | nM | PMID[35282680] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 93670.0 | nM | PMID[37084600] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | IC50 | = | 94950.0 | nM | PMID[37084600] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[34794817] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.7 | nM | PMID[34794817] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | < | 0.001 | uM | PMID[7131483] |
| NPT165 | Cell line | HeLa | Homo sapiens | CC50 | = | 0.05 | ug.mL-1 | PMID[19217699] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | CC50 | = | 0.05 | ug.mL-1 | PMID[11858754] |
| NPT1161 | Cell line | CHO | Cricetulus griseus | CC50 | = | 1.15 | ug.mL-1 | PMID[11858754] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 1.1 | ug.mL-1 | PMID[19217699] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 1.0 | nM | PMID[20547797] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 9528.3 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 84.9 | nM | PubChem BioAssay data set |
| NPT22764 | Cell line | KB/VJ300 | Homo sapiens | IC50 | = | 5900.0 | nM | PMID[27759387] |
| NPT23408 | Cell line | K562/VCR | Homo sapiens | IC50 | = | 4737.0 | nM | PMID[29678463] |
| NPT22764 | Cell line | KB/VJ300 | Homo sapiens | IC50 | = | 3900.0 | nM | PMID[29746134] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Hit score | = | 0.4904 | n.a. | DOI[10.1101/2020.04.21.054387] |
| NPT23408 | Cell line | K562/VCR | Homo sapiens | IC50 | = | 5060.0 | nM | PMID[30530194] |
| NPT22764 | Cell line | KB/VJ300 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[31642315] |
| NPT22764 | Cell line | KB/VJ300 | Homo sapiens | IC50 | = | 6600.0 | nM | PMID[26918761] |
| NPT22764 | Cell line | KB/VJ300 | Homo sapiens | IC50 | = | 2600.0 | nM | PMID[30869890] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 2916.0 | nM | PMID[37856840] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 435.85 | nM | PMID[33360797] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | < | 40000.0 | nM | PMID[35751979] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 1.63 | nM | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 1.5 | nM | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 40.79 | n.a. | PMID[36167009] |
| NPT23408 | Cell line | K562/VCR | Homo sapiens | IC50 | = | 4730.0 | nM | PMID[32992133] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 1.18 | nM | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 473.91 | n.a. | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 22.46 | n.a. | PMID[35282680] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 5.67 | n.a. | PMID[35282680] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 13.71 | nM | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 559.21 | nM | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 10200.0 | nM | PMID[34649064] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 47.0 | n.a. | PMID[34649064] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 16.9 | n.a. | PMID[37856840] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 50300.0 | nM | PMID[32992133] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 50300.0 | nM | PMID[32531682] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | n.a. | n.a. | n.a. | PMID[34794817] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 372.81 | n.a. | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 301.0 | n.a. | PMID[34794817] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 343.07 | n.a. | PMID[36167009] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 2013.0 | nM | PMID[34794817] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 1282.2 | n.a. | PMID[34794817] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.025 | ug.mL-1 | PMID[2918516] |
| NPT610 | Others | Molecular identity unknown | n.a. | EC50 | = | 2.4 | nM | PMID[17973361] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 58.0 | nM | PMID[19041247] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2035.0 | nM | PMID[19041247] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 27.7 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 24.0 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 28.3 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 26.0 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 13.1 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 7.2 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 4.8 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 5.9 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 11.1 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 11.7 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 17.2 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 65.8 | % | PMID[17973361] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 86.7 | % | PMID[17973361] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 92.6 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 95.1 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 93.8 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 61.2 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 64.5 | % | PMID[17181164] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 53.7 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 6.5 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 0.5 | % | PMID[19220018] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 1.0 | % | PMID[17973361] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 0.2 | % | PMID[17973361] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 100.0 | nM | PMID[17567121] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 9.3 | nM | PMID[21680190] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5300.0 | nM | PMID[17585747] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 100.0 | nM | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 90.0 | nM | PMID[17915851] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 895.0 | nM | PMID[17239597] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 311.0 | nM | PMID[17490878] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1335.0 | nM | PMID[17608533] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1200.0 | nM | PMID[17939738] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.0007 | ug.mL-1 | PMID[18044843] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5720.0 | nM | PMID[18295490] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5.4 | nM | PMID[25333996] |
| NPT141 | Organism | Agrobacterium tumefaciens | Agrobacterium tumefaciens | Inhibition | = | -44.0 | % | PMID[7161602] |
| NPT141 | Organism | Agrobacterium tumefaciens | Agrobacterium tumefaciens | Inhibition | = | -36.0 | % | PMID[7161602] |
| NPT141 | Organism | Agrobacterium tumefaciens | Agrobacterium tumefaciens | Inhibition | = | -17.0 | % | PMID[7161602] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | = | 7.0 | ug ml-1 | PMID[18473435] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 20.0 | nM | PMID[19117761] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 100.0 | % | PMID[8277312] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 0.0 | % | PMID[8277312] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1.37 | ug.mL-1 | PMID[14695795] |
| NPT141 | Organism | Agrobacterium tumefaciens | Agrobacterium tumefaciens | IC50 | = | 0.003 | ppm | PMID[18650096] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 366.6 | nM | PMID[19743858] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 60.88 | nM | PMID[19743858] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 840.0 | nM | PMID[20353152] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1483.48 | nM | PMID[20724170] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1489.58 | nM | PMID[20724170] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 6860.0 | nM | PMID[20735140] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 2.9 | nM | PMID[20735140] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | > | 1.0 | nM | PMID[17417631] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ED50 | > | 100.0 | nM | PMID[21296579] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 9091.0 | nM | PMID[21284385] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 2650.0 | nM | PMID[21344920] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 106590.0 | nM | PMID[21344920] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 430.0 | nM | PMID[21344920] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 340.0 | nM | PMID[21344920] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 21000.0 | nM | PMID[21344920] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 100000.0 | nM | PMID[21680190] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 90.1 | nM | PMID[25059503] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1.2 | nM | PMID[22060033] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 17.6 | nM | PMID[22060033] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 12.7 | nM | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 21.2 | nM | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 7.2 | nM | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 28.2 | nM | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 22.1 | nM | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 35.9 | nM | PMID[22320354] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 12.2 | % | PMID[22320354] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 68.4 | % | PMID[22320354] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 11.8 | % | PMID[22320354] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 303.2 | nM | PMID[23360284] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 7900.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 300.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 6300.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 100.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 19900.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 200.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 4000.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 15800.0 | nM | PMID[23685944] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 80.0 | nM | PMID[23855338] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (acute) | = | 0.0 | % | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI | = | 74.5 | % | PMID[24681981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI | = | 72.6 | % | PMID[24681981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI | = | 70.9 | % | PMID[24681981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI | = | 69.8 | % | PMID[24681981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 96.4 | nM | PMID[26160020] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2.1 | nM | PMID[26160020] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1.5 | nM | PMID[24657567] |
| NPT141 | Organism | Agrobacterium tumefaciens | Agrobacterium tumefaciens | Activity | = | 100.0 | % | PMID[25036793] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5.4 | ug.mL-1 | PMID[25333996] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 570.0 | nM | PMID[25597010] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1900.0 | nM | PMID[25061803] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.87 | nM | PMID[26318055] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 387.43 | nM | PMID[26318055] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 7500.0 | nM | PMID[26717050] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 350.0 | nM | PMID[27149641] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 168.0 | nM | PMID[27149641] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 7860.0 | nM | PMID[27149641] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 561.0 | nM | PMID[27149641] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1261.0 | nM | PMID[27149641] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 54.6 | % | PMID[27187865] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 7.8 | % | PMID[27187865] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 17.9 | % | PMID[27187865] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 5.1 | % | PMID[27187865] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 900.0 | nM | PMID[27187865] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 300.0 | nM | PMID[27187865] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1300.0 | nM | PMID[27240278] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 4.0 | % | PMID[27318123] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 13.83 | % | PMID[27318123] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 82.17 | % | PMID[27318123] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 800.0 | nM | DOI[10.1039/C6MD00178E] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 4100.0 | nM | DOI[10.1039/C6MD00178E] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 4.0 | nM | PMID[27423028] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 926.0 | nM | PMID[27423028] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 36.0 | nM | PMID[27423028] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 871.0 | nM | PMID[27423028] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 29.0 | nM | PMID[27423028] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 10.0 | nM | PMID[28105271] |
| NPT20987 | Cell line | HeLa S3 | Homo sapiens | IC50 | < | 40000.0 | nM | PMID[35751979] |
| NPT29612 | Protein family | Tubulin beta | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[34648295] |
| NPT29612 | Protein family | Tubulin beta | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[38107178] |
| NPT29612 | Protein family | Tubulin beta | Homo sapiens | Activity | = | 1.12 | n.a. | PMID[35339837] |
| NPT29612 | Protein family | Tubulin beta | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[37856840] |
| NPT29612 | Protein family | Tubulin beta | Homo sapiens | Activity | = | 0.98 | n.a. | PMID[35339837] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 3.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 7.3 | % | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (granulomatous hepatitis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (benign tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT25005 | Cell line | DLKP cell line | Homo sapiens | Combination_index | = | 0.241 | n.a. | PMID[15012986] |
| NPT25005 | Cell line | DLKP cell line | Homo sapiens | Combination_index | = | 0.593 | n.a. | PMID[15012986] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[29886320] |
| NPT21742 | Cell line | L02 | Homo sapiens | GI | = | 1.6 | % | PMID[29886320] |
| NPT21742 | Cell line | L02 | Homo sapiens | GI | = | 1.39 | % | PMID[29886320] |
| NPT21742 | Cell line | L02 | Homo sapiens | GI | = | 7.26 | % | PMID[29886320] |
| NPT21742 | Cell line | L02 | Homo sapiens | GI | = | 11.5 | % | PMID[29886320] |
| NPT21742 | Cell line | L02 | Homo sapiens | GI | = | 16.46 | % | PMID[29886320] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[30852384] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[33636536] |
| NPT25039 | Cell line | KB-V1 | Homo sapiens | IC50 | = | 8571.0 | nM | PMID[34794817] |
| NPT28808 | Protein family | Tubulin | Sus scrofa | Inhibition | n.a. | n.a. | % | PMID[27010345] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 95.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3757.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 8.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 105.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 94.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 53.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 84.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 47.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 169.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 5.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 213.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 7.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 749.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 23.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 13333.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 10.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 749.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 23914.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 237.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 167.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 106.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 6.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1059.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 3.7 | n.a. | PMID[15012986] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 72.28 | n.a. | PMID[15012986] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 26.0 | n.a. | PMID[19041247] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 925.0 | n.a. | PMID[19041247] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 6200.0 | nM | PMID[8988604] |
| NPT2 | Others | Unspecified | n.a. | Ratio ED50 | = | 0.002 | n.a. | PMID[18473435] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 2500.0 | nM | PMID[21126027] |
| NPT24179 | Cell line | MDCK-II | Canis lupus familiaris | RatioGI50 | = | 40.3 | n.a. | PMID[21344920] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Composite Activity - Active | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | Composite Activity - Marginal | = | 0.0 | n.a. | PMID[16472241] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_bilirubinemia | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_cholecystitis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_cholelithiasis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_cirrhosis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatic failure | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatic necrosis | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatomegaly | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_jaundice | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_liver fatty | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_liver function tests abnormal | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_Combined Scores | = | 0.0 | n.a. | PMID[22194678] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 143.7 | n.a. | PMID[23360284] |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | IC50 | = | 30.0 | nM | PMID[23927763] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 80.0 | % | PMID[24437936] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 20.0 | % | PMID[24437936] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 50.0 | % | PMID[24502232] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 5011.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2818.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 120.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 4.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 3981.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 5.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 5.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 153.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 216.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 281.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT23299 | Cell line | K562/Adr | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[34794817] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_liver disease | = | 0.0 | n.a. | PMID[22194678] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 4.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 16.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 20.8 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 46.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survivors | = | 0.0 | n.a. | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 1.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 10.7 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 12.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 30.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 28.8 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 14.7 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 24.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 20.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 36.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 26.6 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 37.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 47.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 53.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 64.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 146.0 | % | PMID[4020828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 85.0 | % | PMID[1479582] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 100.0 | % | PMID[7131483] |
| NPT32 | Organism | Mus musculus | Mus musculus | ILS | = | 145.0 | % | PMID[7131483] |
| NPT32 | Organism | Mus musculus | Mus musculus | Median T/C | = | 12.6 | day | PMID[9873389] |
| NPT32 | Organism | Mus musculus | Mus musculus | Range | = | 10.0 | day | PMID[9873389] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 110.0 | % | PMID[9873389] |
| NPT32 | Organism | Mus musculus | Mus musculus | Median T/C | = | 10.6 | day | PMID[9873389] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 92.0 | % | PMID[9873389] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 25.5 | g | PMID[23981529] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 24.6 | g | PMID[23981529] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Fabs | < | 10.0 | % | PMID[21051535] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Pc | = | 0.00000064 | cm s-1 | PMID[7392035] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_elevated liver function tests | = | 0.0 | n.a. | PMID[22194678] |
| NPT20596 | Phenotype | Hepatotoxicity | n.a. | HepSE_hepatitis | = | 0.0 | n.a. | PMID[22194678] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 51.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 39700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 351.17 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 82.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 151.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 34500000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 100.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 803.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 316.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1491.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 105.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 108.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.47 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.2 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 58300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 8.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 7637.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 67.83 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 661.17 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5380000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 128800.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 8370.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 91.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.95 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 382300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.6 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.83 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 8.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.17 | /100WBC | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 865000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 52.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 364.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 82.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 170.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 32330000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 758.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 419.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.1 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1550.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 111.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 11.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 103.2 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.8 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 59800.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 6.2 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 6333.5 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 38.83 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 661.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5440000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 34.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 132200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 7030.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 90.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.38 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 387000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.95 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.5 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 9.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.0 | /100WBC | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 924330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 99.6 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.37 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.64 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 52.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 40300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 301.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 100.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 136.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 35670000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 98.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 806.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 355.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1383.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 108.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 104.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.91 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 142.8 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 5.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 50.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 6489.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 75.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 285.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5180000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 30.77 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 120700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 6900.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.3 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 392000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 59.47 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 4.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.33 | /100WBC | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1561000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 42.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 38000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 313.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 132.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 186.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 29670000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 99.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 650.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 254.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.8 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1873.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 136.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 108.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.21 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.2 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 54000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 7.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 15.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 5856.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 77.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 217.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 4270000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 27.3 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 107000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 6170.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 25.1 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 391700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.03 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 4.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1370670.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | n.a. | Fu | = | 0.4 | n.a. | PMID[18426954] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Rattus norvegicus | LD50 | = | 1.0 | mg.kg-1 | PMID[4020828] |
| - | Mus musculus | LD50 | = | 1.0 | mg.kg-1 | PMID[4020828] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC260909 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.9677 | High Similarity | NPC489610 |
| 0.7101 | Intermediate Similarity | NPC195788 |
| 0.7101 | Intermediate Similarity | NPC237901 |
| 0.6901 | Remote Similarity | NPC485509 |
| 0.5946 | Remote Similarity | NPC608514 |
| 0.5878 | Remote Similarity | NPC277353 |
| 0.5878 | Remote Similarity | NPC600057 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC260909 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD8460 | Phase 4 |
| 0.9677 | High Similarity | NPD8459 | Approved |
| 0.7101 | Intermediate Similarity | NPD8466 | Phase 4 |
| 0.7101 | Intermediate Similarity | NPD8467 | Approved |
| 0.6901 | Remote Similarity | NPD8465 | Approved |
| 0.6276 | Remote Similarity | NPD8364 | Approved |
| 0.6276 | Remote Similarity | NPD8489 | Phase 1 |
| 0.6149 | Remote Similarity | NPD8363 | Approved |
| 0.6149 | Remote Similarity | NPD8365 | Clinical (unspecified phase) |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
