NPASS Compound

Natural Product: NPC257342

Natural Product ID	NPC257342
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	KXZAVYDASQTYIN-CTEMQYTLSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 129137 0 0 0 0 0 0 0 0999 V2000 13.2037 -0.7392 1.3939 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8406 -0.0473 1.5048 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8639 1.1299 0.5810 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5088 1.5765 0.1169 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5121 0.4386 0.0531 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5248 0.6321 -1.1072 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1923 0.1112 -2.3505 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3997 -0.2576 -0.6434 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4722 -0.0196 0.8730 C 0 0 2 0 0 0 0 0 0 0 0 0 6.2568 0.8945 1.1224 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2923 0.2425 0.2156 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9858 0.8753 -0.0241 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2968 1.2343 1.2738 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9506 1.8561 0.8648 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1691 0.6948 0.3018 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3032 0.8952 0.2332 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9191 -0.5111 0.2452 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0739 -1.5330 -0.2382 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9544 -1.0344 -1.3618 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7602 0.1863 -0.9956 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6747 1.1652 -2.1228 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1770 -0.1890 -0.7773 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8666 -0.5376 -2.0553 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3177 -0.8487 -1.9411 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0503 0.1600 -1.0913 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0874 1.4490 -1.8443 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0604 -0.6086 -0.5065 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1863 -0.9341 0.2091 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2322 0.1262 -0.0329 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4927 -0.0818 0.7411 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9124 -1.5305 0.7431 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7569 -2.4457 0.7019 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1813 -3.8601 0.4001 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6527 -3.9430 -0.9110 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7696 -2.1332 -0.2399 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8646 -1.8634 -0.1877 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1043 -2.2117 0.3439 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2166 -1.2702 -0.0621 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1336 -1.9020 -1.0902 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.7660 -3.1535 -0.5543 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7760 -3.8025 0.3841 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4536 -3.5335 0.0800 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9000 -2.7911 0.1818 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5313 -2.0750 -2.3191 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9019 -0.8635 1.0532 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4405 0.7866 0.2482 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8239 1.7807 1.1652 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4240 3.1161 0.6709 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4955 4.0777 0.2859 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7913 3.7224 0.9294 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9935 2.2147 0.6881 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1209 1.6008 1.5697 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6462 3.8604 2.3170 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5854 4.1511 -1.1053 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5619 3.7442 1.6105 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6156 1.3436 0.2769 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6605 0.5853 1.1433 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1124 -0.8038 -0.0007 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7322 -1.0258 1.2205 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4787 -0.6961 0.3092 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9720 -0.1864 1.9749 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1585 -1.7706 1.7593 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7948 0.3128 2.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5237 0.9460 -0.3051 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3766 1.9635 1.1455 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1782 2.3693 0.8515 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5869 2.1266 -0.8529 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2914 1.6946 -1.1212 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1395 -0.4338 -2.1219 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5148 -0.6385 -2.8001 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4725 0.9123 -3.0682 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6202 -1.2982 -0.9000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3333 -0.9874 1.4130 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9654 0.8175 2.1832 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5733 1.9071 0.8159 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1400 -0.8035 0.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0458 1.8241 -0.6011 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0390 0.2875 1.8006 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9166 1.9104 1.8576 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3936 2.2240 1.7506 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1355 2.6399 0.1134 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3353 -0.1477 1.0391 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6240 1.4841 1.1144 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6416 1.4534 -0.6651 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1084 -0.7220 1.3345 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5170 -2.3809 -0.6784 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6448 -2.0006 0.5912 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2483 -0.7919 -2.2103 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5490 -1.8867 -1.7057 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5597 1.8304 -2.1954 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7771 1.8143 -2.0963 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5900 0.5947 -3.0924 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2158 -1.0965 -0.1244 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3786 -1.4648 -2.4795 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6995 0.2342 -2.8558 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5428 -1.8826 -1.6124 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7544 -0.7645 -2.9779 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1707 1.5874 -2.4583 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1634 2.3540 -1.2129 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9188 1.3743 -2.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9560 -1.0331 1.2817 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4663 0.1758 -1.1165 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3059 0.2501 1.8048 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4125 -1.6725 1.7478 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2931 -2.4944 1.7278 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3405 -4.5821 0.5636 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0226 -4.1089 1.0749 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3015 -4.7556 -1.3706 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9977 -2.1299 1.4434 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7595 -0.3992 -0.5564 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9668 -1.1566 -1.2435 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0981 -3.8427 -1.3590 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8866 -4.9227 0.3911 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0358 -3.4919 1.4224 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6997 -2.7058 -0.3988 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8480 -2.7954 -2.2044 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8124 -0.5740 0.7609 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2112 1.6044 2.1197 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7375 2.9411 -0.2212 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2224 5.1116 0.6298 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6702 4.2516 0.5494 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0298 1.9512 0.9122 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7344 1.9673 -0.3646 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4712 4.2628 2.6713 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3234 3.6298 -1.4846 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9445 3.0648 1.9809 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0710 1.6099 -0.5088 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9393 -0.8776 2.0106 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0490 -2.0887 1.3284 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 30 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 49 54 1 0 48 55 1 0 29 56 1 0 9 57 1 0 5 58 1 6 58 59 1 0 59 2 1 0 57 5 1 0 25 8 1 0 35 28 1 0 42 37 1 0 52 47 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 60 1 0 1 61 1 0 1 62 1 0 2 63 1 1 3 64 1 0 3 65 1 0 4 66 1 0 4 67 1 0 6 68 1 6 7 69 1 0 7 70 1 0 7 71 1 0 8 72 1 1 9 73 1 1 10 74 1 0 10 75 1 0 11 76 1 1 12 77 1 6 13 78 1 0 13 79 1 0 14 80 1 0 14 81 1 0 15 82 1 1 16 83 1 0 16 84 1 0 17 85 1 1 18 86 1 0 18 87 1 0 19 88 1 0 19 89 1 0 21 90 1 0 21 91 1 0 21 92 1 0 22 93 1 1 23 94 1 0 23 95 1 0 24 96 1 0 24 97 1 0 26 98 1 0 26 99 1 0 26100 1 0 28101 1 1 29102 1 6 30103 1 1 31104 1 1 32105 1 1 33106 1 0 33107 1 0 34108 1 0 37109 1 1 38110 1 6 39111 1 6 40112 1 6 41113 1 0 41114 1 0 43115 1 0 44116 1 0 45117 1 0 47118 1 1 48119 1 6 49120 1 1 50121 1 6 51122 1 0 51123 1 0 53124 1 0 54125 1 0 55126 1 0 56127 1 0 59128 1 0 59129 1 0 M END

Standard InCHIKey	KXZAVYDASQTYIN-CTEMQYTLSA-N
Standard InCHI	InChI=1S/C43H70O16/c1-19-7-12-43(54-16-19)20(2)30-28(59-43)14-25-23-6-5-21-13-22(8-10-41(21,3)24(23)9-11-42(25,30)4)55-40-35(51)37(58-39-34(50)32(48)27(46)18-53-39)36(29(15-44)56-40)57-38-33(49)31(47)26(45)17-52-38/h19-40,44-51H,5-18H2,1-4H3/t19-,20-,21-,22-,23+,24-,25-,26+,27+,28-,29+,30-,31-,32-,33+,34+,35+,36-,37+,38-,39-,40+,41-,42-,43+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC[C@H]6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	842.47	Volume:	815.919 ? Van der Waals volume.
Dense:	1.033	LogP:	2.616 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.08 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.118 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	235.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.164	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.613	Fsp³:	1.0
MCE-18:	225.256 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.724	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.024 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.237	Promiscuous compounds:	0.044

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.94	MDCK Permeability:	-5.053
Pgp-inhibitor:	0.0	Pgp-substrate:	0.906
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.139	30% Bioavailability (F30%):	0.907
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.042
Plasma Protein Binding (PPB):	53.204%	Volume Distribution (VD):	-0.428
Fu:	35.876% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.341
BSEP inhibitor:	0.302

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.222
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.003
HLM stability:	0.065 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.442

Half-life (T1/2):

2.282

ADMET: Toxicity

hERG Blockers:	0.024	hERG Blockers (10um):	0.039
Human Hepatotoxicity (H-HT):	0.579	Drug-induced Liver Injury (DILI):	0.929
AMES Toxicity:	0.875	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.07	Skin Sensitization:	1.0
Carcinogencity:	0.098	Eye Corrosion:	0.0
Eye Irritation:	0.009	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.445	Drug-induced Nephrotoxicity:	0.858
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.195
A549 Cytotoxicity:	0.832	Hek293 Cytotoxicity:	0.893
BCF:	1.94 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.609 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.786 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.21 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1894	Amyris texana	Species	Rutaceae	Eukaryota	Leaves	n.a.	n.a.	PMID[20695429]
NPO4702	Trichosanthes rosthornii	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO5637	Globularia davisiana	Species	Plantaginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3788	Bunias orientalis	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4702	Trichosanthes rosthornii	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO4702	Trichosanthes rosthornii	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO5637	Globularia davisiana	Species	Plantaginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO4702	Trichosanthes rosthornii	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO4702	Trichosanthes rosthornii	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO1894	Amyris texana	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3788	Bunias orientalis	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5637	Globularia davisiana	Species	Plantaginaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO4702	Trichosanthes rosthornii	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC257342 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24940
0.1-0.2	22009
0.2-0.3	2359
0.3-0.4	323
0.4-0.5	113
0.5-0.6	68
0.6-0.7	32
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8353	Intermediate Similarity	NPC250393
0.7386	Intermediate Similarity	NPC177834
0.7228	Intermediate Similarity	NPC232037
0.7191	Intermediate Similarity	NPC325828
0.7172	Intermediate Similarity	NPC97700
0.7172	Intermediate Similarity	NPC30856
0.7129	Intermediate Similarity	NPC475625
0.7097	Intermediate Similarity	NPC264101
0.7083	Intermediate Similarity	NPC475351
0.7019	Intermediate Similarity	NPC132080
0.6809	Remote Similarity	NPC107188
0.68	Remote Similarity	NPC471464
0.6739	Remote Similarity	NPC234352
0.6733	Remote Similarity	NPC128572
0.6667	Remote Similarity	NPC107962
0.6476	Remote Similarity	NPC116756
0.6458	Remote Similarity	NPC211354
0.6458	Remote Similarity	NPC19400
0.6452	Remote Similarity	NPC297348
0.6452	Remote Similarity	NPC249204
0.6452	Remote Similarity	NPC48339
0.6452	Remote Similarity	NPC141769
0.6452	Remote Similarity	NPC477547
0.6364	Remote Similarity	NPC470866
0.6354	Remote Similarity	NPC206003
0.6354	Remote Similarity	NPC473610
0.6346	Remote Similarity	NPC184617
0.6316	Remote Similarity	NPC477451
0.6311	Remote Similarity	NPC51172
0.6311	Remote Similarity	NPC49032
0.63	Remote Similarity	NPC160426
0.6296	Remote Similarity	NPC476112
0.6296	Remote Similarity	NPC307534
0.6263	Remote Similarity	NPC6295
0.6176	Remote Similarity	NPC202898
0.6162	Remote Similarity	NPC215408
0.6161	Remote Similarity	NPC94086
0.6161	Remote Similarity	NPC473817
0.6091	Remote Similarity	NPC233433
0.6087	Remote Similarity	NPC481418
0.6019	Remote Similarity	NPC473601
0.6	Remote Similarity	NPC220836
0.5981	Remote Similarity	NPC115165
0.5981	Remote Similarity	NPC475319
0.5909	Remote Similarity	NPC470864
0.5872	Remote Similarity	NPC475333
0.5872	Remote Similarity	NPC224098
0.5872	Remote Similarity	NPC208383
0.5806	Remote Similarity	NPC329807
0.5784	Remote Similarity	NPC470432
0.5784	Remote Similarity	NPC230507
0.5761	Remote Similarity	NPC88962
0.5729	Remote Similarity	NPC485594
0.569	Remote Similarity	NPC480556
0.5669	Remote Similarity	NPC481189
0.566	Remote Similarity	NPC475643
0.5631	Remote Similarity	NPC125324
0.5631	Remote Similarity	NPC485595
0.5625	Remote Similarity	NPC329727
0.5607	Remote Similarity	NPC92890
0.551	Remote Similarity	NPC181845
0.5446	Remote Similarity	NPC312678
0.5446	Remote Similarity	NPC473518
0.5446	Remote Similarity	NPC253268
0.5412	Remote Similarity	NPC48463
0.54	Remote Similarity	NPC294686
0.54	Remote Similarity	NPC485591
0.5398	Remote Similarity	NPC232611
0.5378	Remote Similarity	NPC473505
0.5377	Remote Similarity	NPC14704
0.5364	Remote Similarity	NPC151134
0.5354	Remote Similarity	NPC481423
0.5351	Remote Similarity	NPC108072
0.5345	Remote Similarity	NPC31896
0.5321	Remote Similarity	NPC477809
0.5317	Remote Similarity	NPC330026
0.5315	Remote Similarity	NPC294129
0.5304	Remote Similarity	NPC83137
0.5294	Remote Similarity	NPC222731
0.5289	Remote Similarity	NPC210569
0.5288	Remote Similarity	NPC485590
0.5283	Remote Similarity	NPC195297
0.5273	Remote Similarity	NPC274200
0.5273	Remote Similarity	NPC6806
0.5233	Remote Similarity	NPC248944
0.5233	Remote Similarity	NPC7479
0.5233	Remote Similarity	NPC257296
0.5231	Remote Similarity	NPC329820
0.5229	Remote Similarity	NPC470433
0.5229	Remote Similarity	NPC46190
0.5229	Remote Similarity	NPC171073
0.5204	Remote Similarity	NPC24960
0.5179	Remote Similarity	NPC98018
0.5179	Remote Similarity	NPC284104
0.5179	Remote Similarity	NPC103616
0.5169	Remote Similarity	NPC232054
0.5128	Remote Similarity	NPC84111
0.5128	Remote Similarity	NPC287483
0.5128	Remote Similarity	NPC470865
0.5102	Remote Similarity	NPC473774
0.5102	Remote Similarity	NPC481419
0.5102	Remote Similarity	NPC481417
0.5093	Remote Similarity	NPC113044
0.5093	Remote Similarity	NPC283829
0.5093	Remote Similarity	NPC161676
0.5091	Remote Similarity	NPC602423
0.5089	Remote Similarity	NPC480555
0.5089	Remote Similarity	NPC150372
0.5086	Remote Similarity	NPC480554
0.5041	Remote Similarity	NPC15918

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC257342 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7649
0.1-0.2	1435
0.2-0.3	49
0.3-0.4	12
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7191	Intermediate Similarity	NPD8171	Phase 2
0.6263	Remote Similarity	NPD8170	Phase 2
0.5233	Remote Similarity	NPD6928	Phase 2
0.5155	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data