NPASS Compound

Natural Product: NPC231797

Natural Product ID	NPC231797
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Charantoside I
IUPAC Name	n.a.
Synonyms	charantoside I
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL411796
PubChem CID	23626009
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001686] Cucurbitacins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 103108 0 0 0 0 0 0 0 0999 V2000 9.0729 3.6580 -0.0342 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2462 2.6426 -0.1278 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6807 2.2198 -1.4430 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8310 1.8623 1.0473 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9985 0.8428 0.9786 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5700 0.0457 2.1412 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0644 0.0828 2.3818 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7615 1.5777 2.6267 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3006 -0.3920 1.1830 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6529 -1.8077 0.7979 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3773 -2.5053 0.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4916 -1.3168 0.0708 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0428 -0.6831 -1.1631 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0487 -1.6669 -0.0192 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8396 -2.3289 -1.3678 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3772 -2.3887 -1.8731 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4003 -1.4722 -1.3290 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6938 -0.1702 -1.0501 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6803 0.8952 -0.8050 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4848 1.0573 -2.0833 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4121 -0.1758 -2.0831 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5905 -1.4149 -2.2278 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1186 -1.5198 -3.6653 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4930 -2.5972 -2.0119 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1014 -0.0655 -0.8928 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4233 0.3403 -0.9927 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4257 -0.6152 -0.4405 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8095 -0.0374 -0.5098 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9006 1.3825 -0.0052 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8013 2.1487 -0.7302 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8402 3.6175 -0.3635 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7958 4.2794 -0.9839 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6118 1.5590 -0.3313 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1565 1.8789 -0.2427 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6912 -0.8124 0.2545 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4585 -1.8174 -1.1481 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0735 -0.5818 0.2213 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5765 0.5757 0.9929 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0465 0.7738 1.1188 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8191 -0.4638 1.3108 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4337 -1.1370 2.5697 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1297 -1.2454 0.9065 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7031 -2.2736 1.7809 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1461 -2.0787 3.0729 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7940 -1.9195 -0.0931 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4539 3.9246 0.9340 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3351 4.1849 -0.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9725 2.9788 -2.2157 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5936 2.0571 -1.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1458 1.2727 -1.8068 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2330 2.1511 1.9971 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6159 0.5910 0.0033 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9452 -1.0160 2.0776 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0186 0.4289 3.0901 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9118 -0.4286 3.3167 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4596 2.0725 1.6978 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6764 2.1198 2.9696 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0467 1.6775 3.4687 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6242 0.3372 0.3744 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0653 -2.4035 1.6266 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3306 -1.8179 -0.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5099 -3.0306 -0.6053 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9838 -3.2264 1.0724 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0018 -1.1869 -1.4888 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2856 0.3715 -1.1250 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3836 -0.8040 -2.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8995 -2.5369 0.6927 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6769 -2.7463 -1.9106 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5870 -3.0815 -2.6459 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0529 0.0775 -1.8807 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2869 1.9138 -0.6204 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4431 0.6670 -0.0186 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8562 0.9697 -2.9923 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1536 1.9292 -2.0760 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0866 0.0055 -2.9203 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8992 -1.0282 -4.2837 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0548 -2.5644 -4.0196 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1838 -0.9513 -3.8360 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8198 -2.5572 -0.9469 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8509 -3.5026 -2.1341 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3504 -2.6144 -2.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6564 0.5080 -2.0596 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2248 -0.8634 0.6134 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1899 -0.0173 -1.5616 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6695 1.3877 1.0841 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9225 1.9941 -1.8119 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6047 3.6432 0.7410 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8080 4.0804 -0.5439 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9136 3.9891 -0.6640 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5144 2.3124 0.5860 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2019 -1.0074 1.0981 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9305 -2.4823 -0.5554 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1912 1.5793 0.6436 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1540 0.5132 2.0289 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3903 1.4159 0.2710 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1615 1.4857 2.0090 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5777 -0.5486 3.0191 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2052 -1.3570 3.3002 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9342 -2.1411 2.3957 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7384 -0.5010 1.4572 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7687 -1.1205 3.4924 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2348 -2.1905 3.1870 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6689 -2.8664 3.6927 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 2 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 21 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 29 34 1 0 28 35 1 0 27 36 1 0 18 37 1 0 37 38 1 1 38 39 1 0 39 40 1 0 40 41 1 1 37 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 40 9 1 0 40 12 1 0 37 14 1 0 22 17 1 0 33 26 1 0 17 45 1 1 1 46 1 0 1 47 1 0 3 48 1 0 3 49 1 0 3 50 1 0 4 51 1 0 5 52 1 0 6 53 1 0 6 54 1 0 7 55 1 1 8 56 1 0 8 57 1 0 8 58 1 0 9 59 1 6 10 60 1 0 10 61 1 0 11 62 1 0 11 63 1 0 13 64 1 0 13 65 1 0 13 66 1 0 14 67 1 1 15 68 1 0 16 69 1 0 18 70 1 6 19 71 1 0 19 72 1 0 20 73 1 0 20 74 1 0 21 75 1 6 23 76 1 0 23 77 1 0 23 78 1 0 24 79 1 0 24 80 1 0 24 81 1 0 26 82 1 6 27 83 1 1 28 84 1 6 29 85 1 1 30 86 1 6 31 87 1 0 31 88 1 0 32 89 1 0 34 90 1 0 35 91 1 0 36 92 1 0 38 93 1 0 38 94 1 0 39 95 1 0 39 96 1 0 41 97 1 0 41 98 1 0 41 99 1 0 42100 1 1 44101 1 0 44102 1 0 44103 1 0 M END

Standard InCHIKey	XTMJHIYXJLZGJC-CGLOHJMOSA-N
Standard InCHI	InChI=1S/C37H58O8/c1-21(2)10-9-11-22(3)23-14-16-35(7)25-15-17-37-26(36(25,32(42-8)45-37)19-18-34(23,35)6)12-13-27(33(37,4)5)44-31-30(41)29(40)28(39)24(20-38)43-31/h9-10,15,17,22-32,38-41H,1,11-14,16,18-20H2,2-8H3/b10-9+/t22-,23-,24-,25+,26+,27+,28-,29+,30-,31+,32-,34-,35+,36+,37-/m1/s1
SMILES	C=C(C)/C=C/C[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3C=C[C@@]45[C@@H](CC[C@@H](C4(C)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)[C@@]3(CC[C@]12C)[C@H](OC)O5

Calculated Properties

Physi-Chem Properties

Molecular Weight:	630.41	Volume:	659.582 ? Van der Waals volume.
Dense:	0.956	LogP:	3.138 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.379 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.679 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	31.0
TPSA:	117.84 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	4.0	Rings:	6.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.221	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.031	Fsp³:	0.838
MCE-18:	162.794 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.917	Fluc inhibitor:	0.006 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.308	Promiscuous compounds:	0.23

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.705	MDCK Permeability:	-5.182
Pgp-inhibitor:	0.402	Pgp-substrate:	0.039
PAMPA:	0.22 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.045	30% Bioavailability (F30%):	0.948
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.362
Plasma Protein Binding (PPB):	85.334%	Volume Distribution (VD):	-0.463
Fu:	10.756% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.011
BSEP inhibitor:	0.785

ADMET: Metabolism

CYP1A2-inhibitor:	0.307	CYP1A2-substrate:	0.003
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.069	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.398
CYP3A4-inhibitor:	0.032	CYP3A4-substrate:	0.961
CYP2B6-substrate:	0.004	CYP2C8-inhibitor:	0.275
HLM stability:	0.856 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.987

Half-life (T1/2):

1.581

ADMET: Toxicity

hERG Blockers:	0.071	hERG Blockers (10um):	0.124
Human Hepatotoxicity (H-HT):	0.577	Drug-induced Liver Injury (DILI):	0.46
AMES Toxicity:	0.8	Rat Oral Acute Toxicity:	0.117
Maximum Recommended Daily Dose:	0.107	Skin Sensitization:	0.999
Carcinogencity:	0.183	Eye Corrosion:	0.0
Eye Irritation:	0.111	Respiratory Toxicity:	0.232
Drug-induced Neurotoxicity:	0.016	Ototoxicity:	0.942
Hematotoxicity:	0.262	Drug-induced Nephrotoxicity:	0.627
Genotoxicity:	0.192	RPMI-8226 Immunitoxicity:	0.176
A549 Cytotoxicity:	0.412	Hek293 Cytotoxicity:	0.331
BCF:	2.428 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.157 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.293 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.873 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17685651]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	Stems	n.a.	n.a.	PMID[18637688]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	Roots	n.a.	n.a.	PMID[24836069]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28621938]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	Vines	n.a.	n.a.	PMID[32357011]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[38440938]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8182	Momordica charantia	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	4
Activity	1

Activity Type	# Activity
Cell line	1
Others	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT80	Cell line	Raji	Homo sapiens	Activity	=	70.0	%	PMID[23398362]
NPT2	Others	Unspecified	n.a.	Inhibition	=	12.6	%	PMID[25442304]
NPT2	Others	Unspecified	n.a.	Inhibition	=	35.4	%	DrugMatrix in vitro pharmacology data
NPT2	Others	Unspecified	n.a.	Inhibition	=	81.1	%	PMID[22445674]
NPT2	Others	Unspecified	n.a.	Inhibition	=	100.0	%	PMID[18077425]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC231797 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21098
0.1-0.2	24368
0.2-0.3	3913
0.3-0.4	442
0.4-0.5	15
0.5-0.6	8
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8514	High Similarity	NPC473318
0.8514	High Similarity	NPC473328
0.7949	Intermediate Similarity	NPC191439
0.725	Intermediate Similarity	NPC208189
0.725	Intermediate Similarity	NPC65034
0.725	Intermediate Similarity	NPC41129
0.6533	Remote Similarity	NPC471450
0.6235	Remote Similarity	NPC28844
0.6235	Remote Similarity	NPC610098
0.619	Remote Similarity	NPC65155
0.619	Remote Similarity	NPC610237
0.5843	Remote Similarity	NPC170974
0.5843	Remote Similarity	NPC103627
0.557	Remote Similarity	NPC300399
0.557	Remote Similarity	NPC471482
0.5568	Remote Similarity	NPC479583
0.5568	Remote Similarity	NPC479582
0.5375	Remote Similarity	NPC37207
0.5281	Remote Similarity	NPC484069

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC231797 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7352
0.1-0.2	1724
0.2-0.3	70
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data