NPASS Compound

Natural Product: NPC221511

Natural Product ID	NPC221511
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	MQRITWSHKHGVDI-IKIZNFIJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL464917
PubChem CID	24813123
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0002875] Tigliane and ingenane diterpenoids [CHEMONTID:0002906] Phorbol esters

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 93 96 0 0 0 0 0 0 0 0999 V2000 11.8496 -0.2050 1.5394 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4351 0.0700 1.0562 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5822 -1.1499 1.0730 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1919 -0.8332 0.6043 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1025 -0.2977 -0.7857 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6832 -0.0102 -1.2227 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0205 1.0034 -0.3477 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6098 1.2945 -0.7928 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7685 0.0624 -0.7616 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3828 0.3616 -1.1957 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6190 0.8768 -0.3356 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8685 0.1250 -2.4482 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5220 0.4602 -2.7307 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4321 -0.2564 -1.8657 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2221 0.4489 -1.1041 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3050 0.1007 -0.1060 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1521 1.2938 0.0908 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7255 1.6435 1.4411 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8353 3.1242 1.8373 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6130 0.7388 2.6108 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5857 1.1659 0.2823 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1815 -0.1816 0.3179 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2657 -1.3439 0.2766 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0623 -2.5270 -0.2928 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0131 -1.1369 -0.5490 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2586 -2.3782 -0.6036 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4691 -3.3827 0.4525 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4054 -4.1870 0.4971 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2446 -5.3412 1.4464 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4438 -3.7526 -0.5074 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4133 -4.4313 -1.0723 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7559 -2.3128 -0.6712 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3699 -1.7331 -1.9768 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1680 -1.6851 0.4206 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4955 -0.8278 -1.8488 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4211 2.1767 -0.2536 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7882 2.1829 -0.1391 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3576 1.2519 0.4719 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5525 3.2990 -0.7461 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1191 4.1184 0.3957 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9226 5.2920 -0.0611 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9024 -0.1943 2.6326 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2291 -1.1094 1.0577 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4468 0.6868 1.1949 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9941 0.8435 1.7039 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4843 0.4597 0.0169 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5154 -1.6009 2.0845 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0155 -1.9450 0.4044 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7384 -0.1393 1.3538 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5960 -1.7858 0.7238 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5097 -1.0581 -1.4870 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7077 0.6334 -0.8604 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1404 -0.9878 -1.2051 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7278 0.3056 -2.2733 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0084 0.6575 0.7114 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5925 1.9578 -0.4416 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6195 1.6950 -1.8232 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1684 2.0176 -0.0671 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1419 -0.7221 -1.4712 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7070 -0.3620 0.2575 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4028 1.5451 -2.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3300 0.2380 -3.8162 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0479 1.5336 -1.2284 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7396 -0.0438 0.8619 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8312 2.2315 -0.4638 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4359 3.7250 0.9738 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8806 3.3960 2.0854 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1310 3.2596 2.6788 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5596 0.1526 2.8050 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8044 0.0021 2.5887 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4640 1.2948 3.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9063 -0.2759 -0.5198 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8066 -0.2877 1.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9968 -1.6239 1.2971 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9066 -2.1201 -0.9252 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4731 -3.1530 -0.9555 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5864 -3.0812 0.5249 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5337 -2.9280 -1.5637 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3045 -3.5166 1.1175 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3394 -5.9111 1.1583 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1013 -6.0253 1.3446 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0724 -4.9871 2.4829 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1596 -2.0167 -2.7318 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5910 -2.0941 -2.3930 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8036 -1.7222 0.2757 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5309 -1.6357 -2.4148 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9108 3.9396 -1.3698 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3692 2.9086 -1.3986 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7507 3.4426 1.0022 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2572 4.4946 0.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9908 4.9970 -0.2088 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4818 5.7280 -0.9752 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8839 6.0647 0.7515 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 18 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 28 29 1 0 28 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 32 34 1 1 25 35 1 6 21 36 1 6 36 37 1 0 37 38 2 0 37 39 1 0 39 40 1 0 40 41 1 0 33 14 1 0 25 16 1 0 32 26 1 0 21 17 1 0 1 42 1 0 1 43 1 0 1 44 1 0 2 45 1 0 2 46 1 0 3 47 1 0 3 48 1 0 4 49 1 0 4 50 1 0 5 51 1 0 5 52 1 0 6 53 1 0 6 54 1 0 7 55 1 0 7 56 1 0 8 57 1 0 8 58 1 0 9 59 1 0 9 60 1 0 13 61 1 0 13 62 1 0 15 63 1 0 16 64 1 1 17 65 1 6 19 66 1 0 19 67 1 0 19 68 1 0 20 69 1 0 20 70 1 0 20 71 1 0 22 72 1 0 22 73 1 0 23 74 1 1 24 75 1 0 24 76 1 0 24 77 1 0 26 78 1 6 27 79 1 0 29 80 1 0 29 81 1 0 29 82 1 0 33 83 1 0 33 84 1 0 34 85 1 0 35 86 1 0 39 87 1 0 39 88 1 0 40 89 1 0 40 90 1 0 41 91 1 0 41 92 1 0 41 93 1 0 M END

Standard InCHIKey	MQRITWSHKHGVDI-IKIZNFIJSA-N
Standard InCHI	InChI=1S/C34H52O7/c1-7-9-10-11-12-13-14-16-27(35)40-21-24-18-25-29-31(5,6)33(29,41-28(36)15-8-2)19-23(4)34(25,39)26-17-22(3)30(37)32(26,38)20-24/h17-18,23,25-26,29,38-39H,7-16,19-21H2,1-6H3/t23-,25+,26-,29-,32-,33+,34-/m1/s1
SMILES	CCCCCCCCCC(=O)OCC1=C[C@H]2[C@@H]3C(C)(C)[C@@]3(C[C@@H](C)[C@@]2([C@@H]2C=C(C)C(=O)[C@]2(C1)O)O)OC(=O)CCC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	572.37	Volume:	610.743 ? Van der Waals volume.
Dense:	0.937	LogP:	5.315 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.231 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.221 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	21.0
TPSA:	110.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	7.0
H-Bond Donor:	2.0	Rings:	4.0
Heavy Atoms:	7.0

MedChem Properties

QED Drug-Likeness Score:	0.158	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.867	Fsp³:	0.794
MCE-18:	76.82 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.465	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.261	Promiscuous compounds:	0.578

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.118	MDCK Permeability:	-4.764
Pgp-inhibitor:	0.03	Pgp-substrate:	0.628
PAMPA:	0.624 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.064
20% Bioavailability (F20%):	0.98	30% Bioavailability (F30%):	0.981
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.016	MRP1:	0.991
Plasma Protein Binding (PPB):	96.76%	Volume Distribution (VD):	0.254
Fu:	4.129% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.994
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.016
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.004	CYP1A2-substrate:	1.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.129
CYP2C9-inhibitor:	0.146	CYP2C9-substrate:	0.007
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	1.0
CYP3A4-inhibitor:	0.43	CYP3A4-substrate:	0.895
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.991 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.997

Half-life (T1/2):

0.633

ADMET: Toxicity

hERG Blockers:	0.147	hERG Blockers (10um):	0.486
Human Hepatotoxicity (H-HT):	0.474	Drug-induced Liver Injury (DILI):	0.49
AMES Toxicity:	0.408	Rat Oral Acute Toxicity:	0.426
Maximum Recommended Daily Dose:	0.582	Skin Sensitization:	0.985
Carcinogencity:	0.848	Eye Corrosion:	0.01
Eye Irritation:	0.455	Respiratory Toxicity:	0.698
Drug-induced Neurotoxicity:	0.09	Ototoxicity:	0.45
Hematotoxicity:	0.411	Drug-induced Nephrotoxicity:	0.914
Genotoxicity:	0.038	RPMI-8226 Immunitoxicity:	0.174
A549 Cytotoxicity:	0.288	Hek293 Cytotoxicity:	0.263
BCF:	1.753 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.976 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.36 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.925 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO422	Euphorbia cornigera	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17512094]
NPO422	Euphorbia cornigera	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19376614]
NPO422	Euphorbia cornigera	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO422	Euphorbia cornigera	Species	Euphorbiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT91	Cell line	KB	Homo sapiens	IC50	=	7.8	ug.mL-1	PMID[24290061]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC221511 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	16340
0.1-0.2	31960
0.2-0.3	1426
0.3-0.4	56
0.4-0.5	28
0.5-0.6	21
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	3
0.9-0.95	1
0.95-1	4

Similarity Score	Similarity Level	Natural Product ID
0.9836	High Similarity	NPC17138
0.9836	High Similarity	NPC101825
0.9836	High Similarity	NPC215643
0.9836	High Similarity	NPC265499
0.9206	High Similarity	NPC170212
0.8657	High Similarity	NPC151216
0.8657	High Similarity	NPC89227
0.8529	High Similarity	NPC479000
0.7656	Intermediate Similarity	NPC96739
0.7612	Intermediate Similarity	NPC485736
0.7612	Intermediate Similarity	NPC277477
0.7612	Intermediate Similarity	NPC479003
0.7612	Intermediate Similarity	NPC485735
0.7612	Intermediate Similarity	NPC485733
0.7313	Intermediate Similarity	NPC174471
0.7101	Intermediate Similarity	NPC474871
0.7101	Intermediate Similarity	NPC260786
0.6849	Remote Similarity	NPC485731
0.6849	Remote Similarity	NPC485732
0.6282	Remote Similarity	NPC257017
0.6234	Remote Similarity	NPC183540
0.6216	Remote Similarity	NPC482454
0.6203	Remote Similarity	NPC602538
0.6087	Remote Similarity	NPC153036
0.6087	Remote Similarity	NPC91189
0.6049	Remote Similarity	NPC162009
0.5926	Remote Similarity	NPC159692
0.5915	Remote Similarity	NPC158523
0.5802	Remote Similarity	NPC222307
0.5769	Remote Similarity	NPC475391
0.5753	Remote Similarity	NPC71889
0.5753	Remote Similarity	NPC475937
0.5732	Remote Similarity	NPC153651
0.5625	Remote Similarity	NPC474937
0.557	Remote Similarity	NPC482317
0.557	Remote Similarity	NPC477091
0.5542	Remote Similarity	NPC472760
0.5455	Remote Similarity	NPC609113
0.5316	Remote Similarity	NPC275696
0.5316	Remote Similarity	NPC255081
0.5185	Remote Similarity	NPC603912
0.5062	Remote Similarity	NPC5991
0.5062	Remote Similarity	NPC196500
0.5062	Remote Similarity	NPC471108
0.5062	Remote Similarity	NPC5989
0.506	Remote Similarity	NPC22628
0.506	Remote Similarity	NPC600005

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC221511 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6379
0.1-0.2	2711
0.2-0.3	60
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data