NPASS Compound

Structure

NPC215019 OpenBabel06302215562D 45 50 0 0 1 0 0 0 0 0999 V2000 -1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1691 0.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0827 0.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9487 0.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9487 -0.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8147 -1.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6808 -0.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6808 0.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8147 0.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5468 -1.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4128 -0.9704 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2788 -1.4704 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1449 -0.9704 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.1449 0.0296 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2788 0.5296 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2788 1.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1449 2.0296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4128 0.0296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0109 0.5296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0109 -1.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.2788 -2.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9781 1.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7213 2.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6723 1.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4155 2.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2076 3.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2565 3.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5134 3.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0486 4.8187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3666 2.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 39 1 0 0 0 0 2 3 1 0 0 0 0 3 8 2 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 5 6 1 0 0 0 0 5 38 1 0 0 0 0 6 29 1 0 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 10 29 2 0 0 0 0 11 16 2 0 0 0 0 11 12 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 14 17 1 0 0 0 0 15 16 1 0 0 0 0 18 17 1 1 0 0 0 18 19 1 0 0 0 0 18 25 1 0 0 0 0 19 20 1 0 0 0 0 19 28 1 6 0 0 0 20 21 1 0 0 0 0 20 27 1 1 0 0 0 21 22 1 0 0 0 0 21 26 1 6 0 0 0 22 23 1 1 0 0 0 22 25 1 0 0 0 0 23 24 1 0 0 0 0 29 30 1 0 0 0 0 30 35 2 0 0 0 0 30 31 1 0 0 0 0 31 32 2 0 0 0 0 32 33 1 0 0 0 0 32 37 1 0 0 0 0 33 34 2 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 39 44 2 0 0 0 0 39 40 1 0 0 0 0 40 41 2 0 0 0 0 41 42 1 0 0 0 0 42 43 2 0 0 0 0 42 45 1 0 0 0 0 43 44 1 0 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	614.18
Volume:	605.063
LogP:	4.213
LogD:	2.893
LogS:	-4.457
# Rotatable Bonds:	7
TPSA:	193.44
# H-Bond Aceptor:	11
# H-Bond Donor:	8
# Rings:	6
# Heavy Atoms:	11

MedChem Properties

QED Drug-Likeness Score:	0.124
Synthetic Accessibility Score:	4.254
Fsp3:	0.176
Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted
GSK Rule:	Rejected
BMS Rule:	0
Golden Triangle Rule:	Rejected
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-6.255
MDCK Permeability:	7.499609182559652e-06
Pgp-inhibitor:	0.116
Pgp-substrate:	0.429
Human Intestinal Absorption (HIA):	0.384
20% Bioavailability (F20%):	0.768
30% Bioavailability (F30%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003
Plasma Protein Binding (PPB):	100.10466766357422%
Volume Distribution (VD):	0.494
Pgp-substrate:	0.882844090461731%

ADMET: Metabolism

CYP1A2-inhibitor:	0.75
CYP1A2-substrate:	0.035
CYP2C19-inhibitor:	0.095
CYP2C19-substrate:	0.045
CYP2C9-inhibitor:	0.427
CYP2C9-substrate:	0.785
CYP2D6-inhibitor:	0.366
CYP2D6-substrate:	0.798
CYP3A4-inhibitor:	0.368
CYP3A4-substrate:	0.064

ADMET: Excretion

Clearance (CL):	8.011
Half-life (T1/2):	0.626

ADMET: Toxicity

hERG Blockers:	0.323
Human Hepatotoxicity (H-HT):	0.41
Drug-inuced Liver Injury (DILI):	0.979
AMES Toxicity:	0.663
Rat Oral Acute Toxicity:	0.028
Maximum Recommended Daily Dose:	0.051
Skin Sensitization:	0.915
Carcinogencity:	0.123
Eye Corrosion:	0.003
Eye Irritation:	0.044
Respiratory Toxicity:	0.051

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC215019

Natural Product ID:	NPC215019
*Common Name:**	BTVDGMUSPORWED-MMNRRLNTSA-N
IUPAC Name:	n.a.
Synonyms:
Standard InCHIKey:	BTVDGMUSPORWED-MMNRRLNTSA-N
Standard InCHI:	InChI=1S/C34H30O11/c35-16-27-30(40)31(41)32(42)34(45-27)43-24-9-5-19(6-10-24)33-28(20-13-22(37)15-23(38)14-20)29-25(39)11-18(12-26(29)44-33)2-1-17-3-7-21(36)8-4-17/h1-15,27,30-32,34-42H,16H2/b2-1+/t27-,30-,31+,32-,34-/m1/s1
SMILES:	C(=Cc1cc(c2c(c1)oc(c1ccc(cc1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)c2c1cc(cc(c1)O)O)O)/c1ccc(cc1)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	n.a.
PubChem CID:	21575645
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0003405] 2-arylbenzofuran flavonoids

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22441	Senna spectabilis	Species	Fabaceae	Eukaryota	flowers	n.a.	n.a.	PMID[30413343]
NPO23044	Aesculus hippocastanum	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[3783160]
NPO10654	Lindera obtusiloba	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO23044	Aesculus hippocastanum	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO23044	Aesculus hippocastanum	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO16782	Andrographis viscosula	Species	Acanthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO10654	Lindera obtusiloba	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO23044	Aesculus hippocastanum	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO10654	Lindera obtusiloba	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO10654	Lindera obtusiloba	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO10064	Diospyros canaliculata	Species	Ebenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19091	Bacterium from	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[UNPD]
NPO23044	Aesculus hippocastanum	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16782	Andrographis viscosula	Species	Acanthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16548	Chenopodium formosanum	Species	Chenopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10654	Lindera obtusiloba	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO5869	Anthocercis albicans	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22441	Senna spectabilis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10984	Euclea crispa	Species	Ebenaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO11360	Tiliacora racemosa	Species	Menispermaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18427	Axinella agnata	Species	Axinellidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO17900	Iotrochota birotulata	Species	Iotrochotidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3096	Verbascum laxum	Species	Scrophulariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC215019 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	447
0.1-0.2	1688
0.2-0.3	3505
0.3-0.4	8728
0.4-0.5	9576
0.5-0.6	4615
0.6-0.7	5570
0.7-0.8	5851
0.8-0.85	1778
0.85-0.9	859
0.9-0.95	80
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC215019 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	390
0.1-0.2	895
0.2-0.3	1776
0.3-0.4	2683
0.4-0.5	1958
0.5-0.6	979
0.6-0.7	291
0.7-0.8	144
0.8-0.85	20
0.85-0.9	12
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data