NPASS Compound

Natural Product: NPC201986

Natural Product ID	NPC201986
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	BVQPBPDDNCHOSN-WDNGRKCRSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44715479
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000334] Flavonoids [CHEMONTID:0001111] Flavonoid glycosides [CHEMONTID:0001583] Flavonoid O-glycosides [CHEMONTID:0003531] Flavonoid-3-O-glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 99104 0 0 0 0 0 0 0 0999 V2000 8.0814 2.7878 0.5505 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6970 2.5861 -0.9093 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7818 1.7910 -1.5656 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6088 0.3172 -1.3906 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1618 -0.0559 -1.6027 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3795 0.7224 -0.5774 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4386 2.0535 -0.9474 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1468 0.2312 -0.2710 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9807 -0.1455 1.0407 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7046 -1.6128 1.2556 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9090 -1.8648 2.5041 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4162 -3.3050 2.5395 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9137 -1.0104 2.8112 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6293 -0.1596 1.7458 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9148 0.7140 1.6612 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5962 1.8360 0.9168 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5545 0.5966 1.9377 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4970 0.7810 1.1771 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5626 -0.2076 0.9034 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2783 -1.5859 0.5081 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0188 -1.7717 -0.9674 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0350 -0.9995 -1.7520 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1053 -0.5133 -0.8395 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5545 0.3331 0.0647 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1862 0.0984 -1.5571 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5084 -0.1065 -1.2658 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1073 -1.2553 -1.7500 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4556 -2.0520 -2.4252 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4375 -1.5481 -1.4994 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9892 -2.6942 -1.9942 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3053 -2.9906 -1.7478 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0555 -2.1163 -0.9965 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4735 -0.9621 -0.5061 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1475 -0.6462 -0.7444 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5779 0.4200 -0.3018 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2764 0.7336 -0.5339 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8132 1.9683 0.0311 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6641 2.5781 -0.3376 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2250 3.7702 0.2624 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9666 4.3568 1.2559 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1645 3.7526 1.6629 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5397 2.6012 1.0486 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8665 4.3840 2.6606 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0743 3.9811 3.2268 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5550 5.5244 1.8563 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4022 -2.4056 -0.7359 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0095 -3.5712 -1.2238 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2044 -3.5556 -2.7487 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4567 -1.7747 -2.8160 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2711 -1.5477 -1.3623 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6494 -2.2830 1.2570 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8754 -2.3654 1.3489 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0541 -1.4342 -1.4060 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9564 -0.0069 -0.0613 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6918 2.0428 -2.9612 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3376 3.8473 0.7842 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9105 2.1046 0.8154 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2265 2.4985 1.2158 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6815 3.6378 -1.3263 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8013 2.1346 -1.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2767 -0.2642 -2.0814 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8591 0.1916 -2.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9812 0.6683 0.3817 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9307 0.0619 1.5741 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1175 -1.9823 0.3980 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6381 -1.8273 3.3889 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0399 -3.6149 1.5406 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7166 -3.4723 3.3665 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2854 -3.9977 2.7505 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6340 -0.6814 0.7756 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1231 1.0228 2.6934 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3892 2.6227 1.4859 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0704 1.6856 1.6285 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9115 1.1972 0.1673 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1387 -0.2860 1.9077 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2500 -2.1804 0.7698 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2293 -2.8638 -1.1559 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5874 -0.0833 -2.2240 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6171 -1.3962 -0.3526 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7619 -3.9096 -2.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0632 -0.2735 0.0848 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0143 2.2281 -1.1200 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3021 4.2447 -0.0450 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4604 2.1339 1.3589 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6666 4.9249 3.4155 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9858 3.4914 4.2192 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6341 3.3442 2.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1416 6.3690 1.8757 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8432 -3.7577 -2.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6963 -4.4891 -0.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1055 -3.4340 -1.1128 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9416 -4.4839 -2.4335 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5136 -2.7538 -2.5841 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6051 -2.2816 -1.9194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4215 -2.1297 2.2274 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9612 -2.8189 2.2092 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3873 -1.7681 -2.0498 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6884 -0.9469 0.1428 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2054 2.8738 -3.1876 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 14 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 2 0 27 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 32 33 1 0 33 34 2 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 41 43 1 0 43 44 1 0 40 45 1 0 32 46 1 0 46 47 1 0 30 48 1 0 22 49 1 0 21 50 1 0 20 51 1 0 10 52 1 0 5 53 1 0 4 54 1 0 3 55 1 0 7 2 1 0 15 9 1 0 24 19 1 0 36 26 2 0 42 37 1 0 34 29 1 0 1 56 1 0 1 57 1 0 1 58 1 0 2 59 1 6 3 60 1 1 4 61 1 6 5 62 1 6 6 63 1 1 9 64 1 1 10 65 1 6 11 66 1 1 12 67 1 0 12 68 1 0 12 69 1 0 14 70 1 6 15 71 1 1 16 72 1 0 18 73 1 0 18 74 1 0 19 75 1 1 20 76 1 6 21 77 1 6 22 78 1 6 23 79 1 1 31 80 1 0 33 81 1 0 38 82 1 0 39 83 1 0 42 84 1 0 44 85 1 0 44 86 1 0 44 87 1 0 45 88 1 0 47 89 1 0 47 90 1 0 47 91 1 0 48 92 1 0 49 93 1 0 50 94 1 0 51 95 1 0 52 96 1 0 53 97 1 0 54 98 1 0 55 99 1 0 M END

Standard InCHIKey	BVQPBPDDNCHOSN-WDNGRKCRSA-N
Standard InCHI	InChI=1S/C35H44O20/c1-11-21(38)25(42)27(44)34(51-11)54-31-22(39)12(2)50-33(29(31)46)49-10-19-23(40)26(43)28(45)35(53-19)55-32-24(41)20-16(37)8-14(47-3)9-18(20)52-30(32)13-5-6-15(36)17(7-13)48-4/h5-9,11-12,19,21-23,25-29,31,33-40,42-46H,10H2,1-4H3/t11-,12-,19+,21-,22-,23-,25+,26-,27+,28+,29+,31+,33+,34-,35-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@H](C)O[C@H]([C@@H]1O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)Oc1c(=O)c2c(cc(cc2oc1c1ccc(c(c1)OC)O)OC)O)O)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	784.24	Volume:	717.29 ? Van der Waals volume.
Dense:	1.093	LogP:	0.477 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.317 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.852 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	36.0
TPSA:	306.35 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	10.0	Rings:	6.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.104	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.368	Fsp³:	0.571
MCE-18:	152.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.623	Fluc inhibitor:	0.289 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.714 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.407 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.076	Promiscuous compounds:	0.419

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.412	MDCK Permeability:	-5.326
Pgp-inhibitor:	0.0	Pgp-substrate:	0.973
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.955
20% Bioavailability (F20%):	0.226	30% Bioavailability (F30%):	0.916
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.175
Plasma Protein Binding (PPB):	79.592%	Volume Distribution (VD):	-0.215
Fu:	19.431% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.451
BSEP inhibitor:	0.021

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.009
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.921
HLM stability:	0.353 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.815

Half-life (T1/2):

4.252

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.184
Human Hepatotoxicity (H-HT):	0.335	Drug-induced Liver Injury (DILI):	0.965
AMES Toxicity:	0.961	Rat Oral Acute Toxicity:	0.015
Maximum Recommended Daily Dose:	0.019	Skin Sensitization:	0.999
Carcinogencity:	0.018	Eye Corrosion:	0.0
Eye Irritation:	0.068	Respiratory Toxicity:	0.011
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.963
Hematotoxicity:	0.258	Drug-induced Nephrotoxicity:	0.539
Genotoxicity:	0.377	RPMI-8226 Immunitoxicity:	0.348
A549 Cytotoxicity:	0.793	Hek293 Cytotoxicity:	0.58
BCF:	0.41 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.119 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.752 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.872 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29658	Spinulum annotinum	Species	Lycopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29658	Spinulum annotinum	Species	Lycopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO376	Suillus tridentinus	Species	Suillaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29658	Spinulum annotinum	Species	Lycopodiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC201986 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23252
0.1-0.2	23233
0.2-0.3	2547
0.3-0.4	402
0.4-0.5	292
0.5-0.6	82
0.6-0.7	40
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7374	Intermediate Similarity	NPC476472
0.7374	Intermediate Similarity	NPC294815
0.7374	Intermediate Similarity	NPC16194
0.7216	Intermediate Similarity	NPC186816
0.6698	Remote Similarity	NPC189564
0.6636	Remote Similarity	NPC292019
0.6636	Remote Similarity	NPC202908
0.6569	Remote Similarity	NPC470443
0.6442	Remote Similarity	NPC142142
0.6421	Remote Similarity	NPC46420
0.6421	Remote Similarity	NPC271692
0.6346	Remote Similarity	NPC606657
0.6311	Remote Similarity	NPC126784
0.6311	Remote Similarity	NPC241423
0.6311	Remote Similarity	NPC153755
0.6296	Remote Similarity	NPC89052
0.6214	Remote Similarity	NPC473571
0.6214	Remote Similarity	NPC110941
0.619	Remote Similarity	NPC209296
0.619	Remote Similarity	NPC473327
0.6176	Remote Similarity	NPC173582
0.6176	Remote Similarity	NPC265885
0.6176	Remote Similarity	NPC181465
0.6176	Remote Similarity	NPC215710
0.6176	Remote Similarity	NPC67105
0.6176	Remote Similarity	NPC473438
0.6176	Remote Similarity	NPC253788
0.6168	Remote Similarity	NPC101636
0.6162	Remote Similarity	NPC223747
0.6126	Remote Similarity	NPC480441
0.6126	Remote Similarity	NPC25523
0.6122	Remote Similarity	NPC611303
0.6117	Remote Similarity	NPC203259
0.6117	Remote Similarity	NPC33054
0.6117	Remote Similarity	NPC210073
0.6117	Remote Similarity	NPC176740
0.6117	Remote Similarity	NPC471725
0.6117	Remote Similarity	NPC134532
0.6117	Remote Similarity	NPC602582
0.6042	Remote Similarity	NPC249281
0.6036	Remote Similarity	NPC173837
0.6019	Remote Similarity	NPC44931
0.6	Remote Similarity	NPC121703
0.6	Remote Similarity	NPC203145
0.5979	Remote Similarity	NPC158674
0.5962	Remote Similarity	NPC22062
0.5962	Remote Similarity	NPC473634
0.5962	Remote Similarity	NPC138811
0.5941	Remote Similarity	NPC276377
0.5926	Remote Similarity	NPC473073
0.581	Remote Similarity	NPC65563
0.581	Remote Similarity	NPC470949
0.5714	Remote Similarity	NPC209550
0.5714	Remote Similarity	NPC39834
0.5714	Remote Similarity	NPC227508
0.5701	Remote Similarity	NPC240306
0.5688	Remote Similarity	NPC486577
0.5686	Remote Similarity	NPC116458
0.5686	Remote Similarity	NPC246943
0.5686	Remote Similarity	NPC605784
0.566	Remote Similarity	NPC150164
0.5625	Remote Similarity	NPC14187
0.5596	Remote Similarity	NPC32641
0.5596	Remote Similarity	NPC256188
0.5565	Remote Similarity	NPC217520
0.5556	Remote Similarity	NPC488073
0.5556	Remote Similarity	NPC488074
0.5537	Remote Similarity	NPC192539
0.5537	Remote Similarity	NPC175429
0.5536	Remote Similarity	NPC470446
0.5524	Remote Similarity	NPC251417
0.5517	Remote Similarity	NPC277532
0.5495	Remote Similarity	NPC220173
0.5481	Remote Similarity	NPC203050
0.5481	Remote Similarity	NPC488072
0.5481	Remote Similarity	NPC225434
0.5472	Remote Similarity	NPC471079
0.547	Remote Similarity	NPC139571
0.5455	Remote Similarity	NPC483416
0.5455	Remote Similarity	NPC138990
0.5455	Remote Similarity	NPC72016
0.5455	Remote Similarity	NPC35119
0.5446	Remote Similarity	NPC470449
0.5421	Remote Similarity	NPC67326
0.5385	Remote Similarity	NPC78326
0.5378	Remote Similarity	NPC488086
0.537	Remote Similarity	NPC156869
0.5357	Remote Similarity	NPC195257
0.5351	Remote Similarity	NPC470455
0.5347	Remote Similarity	NPC297987
0.5347	Remote Similarity	NPC136042
0.5327	Remote Similarity	NPC609888
0.531	Remote Similarity	NPC470445
0.5294	Remote Similarity	NPC84362
0.5294	Remote Similarity	NPC27640
0.5288	Remote Similarity	NPC101026
0.5288	Remote Similarity	NPC488077
0.5268	Remote Similarity	NPC488089
0.5263	Remote Similarity	NPC135358
0.5259	Remote Similarity	NPC473072
0.5246	Remote Similarity	NPC488079
0.5243	Remote Similarity	NPC59534
0.5238	Remote Similarity	NPC311830
0.5229	Remote Similarity	NPC303913
0.5225	Remote Similarity	NPC12013
0.5225	Remote Similarity	NPC11432
0.5225	Remote Similarity	NPC477613
0.5221	Remote Similarity	NPC470447
0.5203	Remote Similarity	NPC241781
0.5189	Remote Similarity	NPC601586
0.5182	Remote Similarity	NPC204693
0.5179	Remote Similarity	NPC122467
0.5175	Remote Similarity	NPC298171
0.5146	Remote Similarity	NPC305811
0.514	Remote Similarity	NPC116864
0.514	Remote Similarity	NPC244776
0.5128	Remote Similarity	NPC470451
0.5098	Remote Similarity	NPC289667
0.5098	Remote Similarity	NPC238376
0.5094	Remote Similarity	NPC206123
0.5089	Remote Similarity	NPC65711
0.5089	Remote Similarity	NPC483415
0.5048	Remote Similarity	NPC219904
0.5044	Remote Similarity	NPC473623
0.5043	Remote Similarity	NPC11468
0.5038	Remote Similarity	NPC249560

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC201986 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5889
0.1-0.2	3213
0.2-0.3	40
0.3-0.4	2
0.4-0.5	1
0.5-0.6	1
0.6-0.7	4
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6863	Remote Similarity	NPD7251	Phase 2
0.6762	Remote Similarity	NPD7808	Phase 3
0.619	Remote Similarity	NPD7054	Phase 4
0.6117	Remote Similarity	NPD6797	Phase 2
0.5043	Remote Similarity	NPD7472	Pre-clinical

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data