NPASS Compound

Natural Product: NPC19125

Natural Product ID	NPC19125
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LUJTWDWEYNWTBP-USPQCQLHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	12016586
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 82 86 0 0 0 0 0 0 0 0999 V2000 6.0371 -0.5217 -1.2415 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2518 -1.0478 -0.0807 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8099 -2.3989 0.3138 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4533 -0.1225 1.1122 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9587 1.2187 0.6961 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4655 1.1625 0.3770 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2073 2.4901 -0.3634 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6420 1.1717 1.6230 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6625 0.0841 1.7845 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8385 -0.3275 0.6074 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6224 -0.0064 -0.6349 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0019 0.1751 -1.7490 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4572 0.0999 -1.9558 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1982 -0.1488 -0.7023 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6737 0.2339 -0.8086 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9532 1.6210 -1.1799 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2540 -0.6522 -1.9340 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7171 -0.4883 -2.0958 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5112 -0.1559 -0.8895 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8327 -0.3002 0.4220 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4177 0.7824 1.3490 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3118 -1.6036 1.0964 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3546 -0.3092 0.4069 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8014 0.2050 1.7082 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3549 -0.2894 1.7158 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5519 0.2514 0.5713 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3999 1.7259 0.7885 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9672 1.5217 1.9623 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1346 1.1152 -1.0009 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1055 0.0843 -0.5845 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7808 -1.2368 -0.3706 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7193 -1.8083 0.5920 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9075 -2.5161 -0.4568 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3980 -2.5422 1.7195 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3989 -0.1233 -2.0421 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8107 0.2339 -0.9162 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6564 -1.3346 -1.7226 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7288 -2.2299 0.9082 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9790 -2.9900 -0.6000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0723 -2.8629 1.0020 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8842 -0.5482 1.9411 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5190 -0.1178 1.3344 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5387 1.6239 -0.1366 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0538 1.9000 1.5803 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1263 2.8070 -0.8614 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9319 3.2670 0.3819 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3900 2.3306 -1.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2096 2.1786 1.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3726 1.0715 2.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0114 0.3804 2.6671 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1831 -0.8133 2.1829 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6371 0.4123 -2.6420 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7363 1.0365 -2.4852 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5777 -0.7836 -2.6556 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2794 -1.2858 -0.6132 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6779 1.7148 -2.0503 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0805 2.1885 -1.5626 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4182 2.2588 -0.4023 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9751 -1.6939 -1.6950 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7781 -0.3960 -2.9047 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9197 0.3186 -2.8633 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0868 -1.4214 -2.6211 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4093 -0.8498 -0.8962 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0886 0.6486 2.3866 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3381 1.7833 0.9406 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5236 0.5437 1.3620 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4052 -1.4927 2.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2158 -1.9967 0.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5105 -2.3810 0.9261 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0367 -1.4050 0.3968 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3034 -0.4149 2.5107 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9736 -0.1176 2.7115 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4808 -1.4061 1.5630 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2790 2.3429 0.6535 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4195 2.1714 0.2190 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1511 1.8496 1.8865 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9835 1.7166 2.9170 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0027 1.1299 -0.5352 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4938 0.4377 -1.5873 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3835 -1.8636 0.4207 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7146 -1.8055 -1.3279 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7456 -3.4795 1.8950 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 6 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 20 22 1 0 20 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 24 28 1 0 19 29 1 0 11 30 1 0 30 31 1 0 10 32 1 1 32 33 2 0 32 34 1 0 31 2 1 0 30 6 1 0 26 10 1 0 26 14 1 0 23 15 1 0 1 35 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 5 43 1 0 5 44 1 0 7 45 1 0 7 46 1 0 7 47 1 0 8 48 1 0 8 49 1 0 9 50 1 0 9 51 1 0 12 52 1 0 13 53 1 0 13 54 1 0 14 55 1 1 16 56 1 0 16 57 1 0 16 58 1 0 17 59 1 0 17 60 1 0 18 61 1 0 18 62 1 0 19 63 1 1 21 64 1 0 21 65 1 0 21 66 1 0 22 67 1 0 22 68 1 0 22 69 1 0 23 70 1 1 24 71 1 1 25 72 1 0 25 73 1 0 27 74 1 0 27 75 1 0 27 76 1 0 28 77 1 0 29 78 1 0 30 79 1 6 31 80 1 0 31 81 1 0 34 82 1 0 M END

Standard InCHIKey	LUJTWDWEYNWTBP-USPQCQLHSA-N
Standard InCHI	InChI=1S/C30H48O4/c1-25(2)12-13-27(5)14-15-30(24(33)34)18(19(27)16-25)8-9-21-28(6)11-10-22(32)26(3,4)23(28)20(31)17-29(21,30)7/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20+,21+,22-,23-,27+,28+,29+,30+/m0/s1
SMILES	CC1(C)CC[C@]2(C)CC[C@@]3(C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5[C@@H](C[C@@]34C)O)O)[C@@H]2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	472.36	Volume:	514.542 ? Van der Waals volume.
Dense:	0.918	LogP:	2.848 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.634 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.064 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	27.0
TPSA:	77.76 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.397	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.956	Fsp³:	0.9
MCE-18:	108.07 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.787	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.339	Promiscuous compounds:	0.164

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.537	MDCK Permeability:	-5.107
Pgp-inhibitor:	0.008	Pgp-substrate:	0.389
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.008
20% Bioavailability (F20%):	0.935	30% Bioavailability (F30%):	0.306
50% Bioavailability (F50%):	0.991

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.631	MRP1:	0.993
Plasma Protein Binding (PPB):	96.415%	Volume Distribution (VD):	-0.465
Fu:	4.277% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.925	BCRP inhibitor:	0.009
BSEP inhibitor:	0.557

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.001
CYP2C19-inhibitor:	0.878	CYP2C19-substrate:	0.149
CYP2C9-inhibitor:	0.005	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.03	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.42	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.912 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.898

Half-life (T1/2):

1.083

ADMET: Toxicity

hERG Blockers:	0.023	hERG Blockers (10um):	0.053
Human Hepatotoxicity (H-HT):	0.65	Drug-induced Liver Injury (DILI):	0.475
AMES Toxicity:	0.374	Rat Oral Acute Toxicity:	0.576
Maximum Recommended Daily Dose:	0.325	Skin Sensitization:	0.985
Carcinogencity:	0.865	Eye Corrosion:	0.016
Eye Irritation:	0.485	Respiratory Toxicity:	0.862
Drug-induced Neurotoxicity:	0.06	Ototoxicity:	0.684
Hematotoxicity:	0.628	Drug-induced Nephrotoxicity:	0.832
Genotoxicity:	0.854	RPMI-8226 Immunitoxicity:	0.041
A549 Cytotoxicity:	0.318	Hek293 Cytotoxicity:	0.211
BCF:	0.932 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.489 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.168 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.458 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11339628]
NPO18851	Psychotria klugii	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12880315]
NPO18851	Psychotria klugii	Species	Rubiaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[12880315]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	bark	n.a.	PMID[17260795]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	Daejeon, Korea	2007-Jan	PMID[19670875]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	seed	n.a.	PMID[20822014]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[22547314]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	root bark	Bozhou, Anhui Province, China	2010-AUG	PMID[24377852]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	flower	n.a.	PMID[24504864]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	Flowers	LuoYang, HeNan, China	n.a.	PMID[24621197]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	bark	n.a.	PMID[26767291]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26767291]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18851	Psychotria klugii	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20825	Illicium anisatum	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20694	Hibiscus furcatus	Species	Malvaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21521	Xylia dolabriformis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO20825	Illicium anisatum	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO22745	Hedera pastuchovii	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20694	Hibiscus furcatus	Species	Malvaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20076	Hypoestes verticillaris	Species	Acanthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18851	Psychotria klugii	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22550	Paeonia suffruticosa	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20760	Polystichum tripteron	Species	Dryopteridaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21521	Xylia dolabriformis	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22226	Monanthotaxis fornicata	Species	Annonaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16850	Eucommia ulmoides	Species	Eucommiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO22745	Hedera pastuchovii	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20825	Illicium anisatum	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21022	Centaurea cineraria	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18718	Capparis decidua	Species	Capparaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16485	Calycanthus praecox	Species	Calycanthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC19125 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24471
0.1-0.2	22081
0.2-0.3	2889
0.3-0.4	359
0.4-0.5	34
0.5-0.6	12
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC473240
0.8525	High Similarity	NPC476318
0.7581	Intermediate Similarity	NPC17733
0.7581	Intermediate Similarity	NPC470629
0.7344	Intermediate Similarity	NPC189880
0.7164	Intermediate Similarity	NPC260149
0.697	Remote Similarity	NPC126369
0.697	Remote Similarity	NPC470589
0.697	Remote Similarity	NPC111110
0.6866	Remote Similarity	NPC209868
0.6615	Remote Similarity	NPC71507
0.6286	Remote Similarity	NPC476327
0.5775	Remote Similarity	NPC1753
0.5714	Remote Similarity	NPC473242
0.5714	Remote Similarity	NPC290690
0.5652	Remote Similarity	NPC251779
0.5652	Remote Similarity	NPC199595
0.5556	Remote Similarity	NPC470590
0.5556	Remote Similarity	NPC285184
0.5417	Remote Similarity	NPC64872
0.5417	Remote Similarity	NPC25906
0.5263	Remote Similarity	NPC58942
0.52	Remote Similarity	NPC195715
0.5065	Remote Similarity	NPC158347

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC19125 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6784
0.1-0.2	2310
0.2-0.3	53
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data