NPASS Compound

Natural Product: NPC184080

Natural Product ID	NPC184080
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PCSSAXAXMOBEOT-KUDGPSRDSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10079963
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0004603] Organic oxygen compounds [CHEMONTID:0000323] Organooxygen compounds [CHEMONTID:0000011] Carbohydrates and carbohydrate conjugates [CHEMONTID:0000198] Oligosaccharides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 2D 146152 0 0 0 0 0 0 0 0999 V2000 6.3567 -2.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2077 -1.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4681 0.0619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7981 -1.9284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 -0.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 -1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7500 1.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7500 1.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4895 2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9200 3.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2829 1.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6458 0.3784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5668 -0.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9323 -0.6113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9297 -2.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3715 -2.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7344 -3.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6554 -5.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0183 -6.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4602 -6.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5392 -5.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1763 -4.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9811 -6.2703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3440 -7.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8231 -8.3543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4054 3.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6659 4.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3415 5.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1924 6.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9567 7.6078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2625 4.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2278 6.3660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9018 3.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7405 4.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2522 6.0553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2369 4.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8945 3.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3908 3.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2296 4.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5720 5.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0757 5.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 0.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3886 2.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8886 2.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6386 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8886 5.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3886 5.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 6.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9095 7.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6386 3.7404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2981 5.5525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7877 2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6281 0.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1595 -1.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3086 -0.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0586 -2.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5586 -2.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3086 -0.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5586 0.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9681 0.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3777 1.4772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0586 0.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4577 -1.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2981 -3.6241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6491 -2.6600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4895 -2.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9200 -3.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0691 -2.3251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1805 -4.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0314 -5.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2919 -7.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7014 -7.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9619 -9.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8128 -10.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5967 -9.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8572 -8.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7458 -10.6135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1553 -10.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0733 -11.6395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3209 -1.2304 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2597 -3.4025 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5058 -3.3437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6132 0.1849 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1608 -2.3825 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6491 0.9642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2116 -1.6364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0363 -2.7715 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8482 -0.6575 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9935 2.1379 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0415 1.1296 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7717 2.0166 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6436 -3.5915 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6706 -1.7826 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2135 -4.6165 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2235 -7.7575 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1203 -3.2356 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7994 -7.3629 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9436 -8.2633 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7069 -9.1812 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2038 -8.9404 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6401 2.0165 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1650 4.9230 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1803 6.9230 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6245 5.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1566 7.7927 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6962 9.0850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6767 6.7543 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0557 1.9406 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0484 1.7313 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7259 4.2184 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4108 6.9148 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4181 7.1241 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8968 2.2847 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3502 2.1040 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7877 4.7046 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8101 6.5374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9270 5.3769 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1470 6.4382 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2788 7.1269 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7605 8.9581 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5586 7.0297 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1972 3.2893 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9763 0.3067 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4270 0.3657 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3191 -3.6241 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9681 -2.6600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5666 -0.0310 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4801 1.9491 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6492 -0.3723 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8114 2.4560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6382 2.9544 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8672 -1.2990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4472 -4.5883 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3886 -4.1372 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5900 -5.2795 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4604 -5.5740 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8505 -6.7567 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3714 -9.7112 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2667 -7.6590 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6683 -11.5100 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6423 -8.6909 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5648 -9.5874 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0758 -12.6037 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 13 12 1 6 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 16 18 1 0 18 19 2 0 19 20 1 0 20 21 2 0 21 22 1 0 22 23 2 0 23 24 1 0 24 25 2 0 24 26 1 0 26 27 1 0 23 28 1 0 13 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 29 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 39 40 2 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 9 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 49 54 1 0 48 55 1 0 47 56 1 0 8 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 61 66 1 0 60 67 1 0 59 68 1 0 7 69 1 0 69 70 1 0 70 71 2 0 70 72 1 0 72 73 2 0 73 74 1 0 74 75 2 0 75 76 1 0 76 77 2 0 77 78 1 0 78 79 2 0 78 80 1 0 80 81 1 0 77 82 1 0 11 6 1 0 34 13 1 0 44 39 1 0 53 46 1 0 65 58 1 0 79 74 1 0 25 20 1 0 1 83 1 0 1 84 1 0 1 85 1 0 5 86 1 0 5 87 1 0 6 88 1 1 7 89 1 6 8 90 1 1 9 91 1 6 10 92 1 6 14 93 1 0 14 94 1 0 18 95 1 0 19 96 1 0 21 97 1 0 22 98 1 0 25 99 1 0 27100 1 0 27101 1 0 27102 1 0 28103 1 0 29104 1 1 30105 1 6 31106 1 1 32107 1 0 32108 1 0 33109 1 0 35110 1 0 40111 1 0 41112 1 0 42113 1 0 43114 1 0 44115 1 0 46116 1 6 47117 1 1 48118 1 6 49119 1 1 50120 1 6 51121 1 0 51122 1 0 52123 1 0 54124 1 0 55125 1 0 56126 1 0 58127 1 6 59128 1 1 60129 1 6 61130 1 1 62131 1 6 63132 1 0 63133 1 0 64134 1 0 66135 1 0 67136 1 0 68137 1 0 72138 1 0 73139 1 0 75140 1 0 76141 1 0 79142 1 0 81143 1 0 81144 1 0 81145 1 0 82146 1 0 M END

Standard InCHIKey	PCSSAXAXMOBEOT-KUDGPSRDSA-N
Standard InCHI	InChI=1S/C53H64O29/c1-24(57)72-22-35-45(77-37(61)16-12-26-10-14-29(59)31(18-26)71-3)46(78-50-43(67)41(65)38(62)32(19-54)74-50)47(79-51-44(68)42(66)39(63)33(20-55)75-51)52(76-35)82-53(23-73-36(60)15-11-25-9-13-28(58)30(17-25)70-2)48(40(64)34(21-56)81-53)80-49(69)27-7-5-4-6-8-27/h4-18,32-35,38-48,50-52,54-56,58-59,62-68H,19-23H2,1-3H3/b15-11+,16-12+/t32-,33-,34-,35-,38-,39-,40-,41+,42+,43-,44-,45-,46+,47-,48+,50+,51+,52-,53+/m1/s1
SMILES	CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@]1(COC(=O)/C=C/c2ccc(c(c2)OC)O)[C@H]([C@@H]([C@@H](CO)O1)O)OC(=O)c1ccccc1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)OC(=O)/C=C/c1ccc(c(c1)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1164.35	Volume:	1080.718 ? Van der Waals volume.
Dense:	1.077	LogP:	0.265 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.787 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.024 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	26.0	Rigid Bonds:	47.0
TPSA:	431.03 ? Topological Polar Surface Area.	H-Bond Acceptor:	29.0
H-Bond Donor:	12.0	Rings:	7.0
Heavy Atoms:	29.0

MedChem Properties

QED Drug-Likeness Score:	0.027	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.413	Fsp³:	0.509
MCE-18:	184.175 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	0
Colloidal aggregators:	0.819	Fluc inhibitor:	0.667 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.068 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.623 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.302	Promiscuous compounds:	0.185

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.449	MDCK Permeability:	-5.399
Pgp-inhibitor:	0.001	Pgp-substrate:	0.091
PAMPA:	0.989 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.364
20% Bioavailability (F20%):	0.332	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.0
Plasma Protein Binding (PPB):	66.332%	Volume Distribution (VD):	-0.492
Fu:	30.491% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.037

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.999
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.169 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.383

Half-life (T1/2):

4.62

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.023
Human Hepatotoxicity (H-HT):	0.338	Drug-induced Liver Injury (DILI):	0.888
AMES Toxicity:	0.985	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.019	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.193	Drug-induced Nephrotoxicity:	0.932
Genotoxicity:	0.017	RPMI-8226 Immunitoxicity:	0.231
A549 Cytotoxicity:	0.724	Hek293 Cytotoxicity:	0.572
BCF:	0.49 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.337 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.283 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.351 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	leaf	n.a.	DOI[10.1016/S0031-9422(00)94055-X]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	flower	n.a.	DOI[10.3390/70200245]
NPO27808	Cremanthodium discoideum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10579856]
NPO27081	Clavularia inflata	Species	Clavulariidae	Eukaryota	n.a.	Formosan soft coral	n.a.	PMID[11520220]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24617303]
NPO28028	Aquilegia atrata	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28102	Baccharis tucumanensis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28491	Astrotrichilia voamatata	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO28491	Astrotrichilia voamatata	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27081	Clavularia inflata	Species	Clavulariidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28102	Baccharis tucumanensis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO27622	Ligularia cyathiceps	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28261	Pyrophorus pellucens	Species	Elateridae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28295	Foeniculum vulgare	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28154	Acrodontium salmoneum	Species	Mycosphaerellaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28312	Lentinus squarrosulus	Species	Lentinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28476	Doris tricolor	Species	Dorididae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28491	Astrotrichilia voamatata	Species	Meliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28081	Actinoplanes arizonaensis	Species	Micromonosporaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO27846	Aeodes ulvoidea	Species	Halymeniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20099	Petalostylis labicheoides	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO27934	Mezilaurus synandra	Species	Lauraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28521	Delphinium vestitum	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28210	Myrmecia gulosa	Species	Formicidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO27808	Cremanthodium discoideum	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO8672	Ophiura ophiura	Species	Ophiuridae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO17149	Heracleum candicans	Species	Apiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29361	Chondrus yendoi	Species	Gigartinaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO3513	Fuscoporia senex	Species	Hymenochaetaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28028	Aquilegia atrata	Species	Ranunculaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19588	Piper coruscans	Species	Piperaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC184080 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	13461
0.1-0.2	30352
0.2-0.3	5325
0.3-0.4	640
0.4-0.5	66
0.5-0.6	9
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9314	High Similarity	NPC246024
0.6239	Remote Similarity	NPC28651
0.6019	Remote Similarity	NPC3460
0.5766	Remote Similarity	NPC201148
0.5495	Remote Similarity	NPC125823
0.5495	Remote Similarity	NPC7145
0.5495	Remote Similarity	NPC143480
0.5463	Remote Similarity	NPC262182
0.5413	Remote Similarity	NPC83743
0.5398	Remote Similarity	NPC215095
0.531	Remote Similarity	NPC85192
0.5046	Remote Similarity	NPC471882

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC184080 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4386
0.1-0.2	4640
0.2-0.3	122
0.3-0.4	1
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data