NPASS Compound

Natural Product: NPC149366

Natural Product ID	NPC149366
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	RDLNVCALMXCDOJ-QUVQPCEGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10793430
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 77 79 0 0 0 0 0 0 0 0999 V2000 -1.8346 -3.7768 0.2501 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3842 -2.4641 0.6188 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8551 -1.3284 0.2399 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6109 -1.3764 -0.6233 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5400 -0.7881 0.1321 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8298 -0.7544 -0.5486 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1219 -1.1642 -1.6798 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8872 -0.1726 0.1904 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1885 -0.0890 -0.3845 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1663 0.5561 0.5400 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4389 0.8123 -0.1920 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5283 1.3798 0.4456 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6861 1.5992 -0.2464 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8334 1.2784 -1.5789 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7265 0.7119 -2.1905 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5384 0.4784 -1.5095 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8188 0.3647 -3.5478 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0117 1.5034 -2.2778 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3340 -0.0664 1.7382 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9396 0.6199 2.8491 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1837 -0.1768 4.1262 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9600 -0.5607 -1.8426 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5660 0.5930 -1.5685 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8240 0.9440 -0.2613 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4449 -0.0245 0.6321 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7783 0.0495 0.3930 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5577 0.5169 1.4303 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2838 1.7855 1.1286 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5924 1.8029 1.8912 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4383 0.6004 1.6583 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6011 -0.6098 1.3867 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6847 -0.9865 -0.0695 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0034 -1.0611 -0.5104 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3350 -0.5212 1.8756 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2402 0.3931 2.7999 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3317 2.9583 1.6362 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5693 2.9141 1.5988 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6931 -0.9903 -3.1990 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1394 -2.0809 -3.4345 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0482 -0.1954 -4.2797 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8044 -0.5809 -5.6210 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8216 -3.9665 -0.8396 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4460 -4.5742 0.7077 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8239 -3.8577 0.6969 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2932 -2.4560 1.2500 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3823 -2.3833 -0.9824 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3134 0.2519 0.4979 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6946 -1.3583 1.0973 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5322 -1.0289 -0.8385 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0415 0.6330 -1.2451 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7345 1.5767 0.7690 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 1.6395 1.4999 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5390 2.0481 0.2718 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7344 0.0209 -2.0985 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0449 1.1427 -4.1667 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8961 1.1542 -1.8881 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5504 1.5387 2.9406 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8879 0.9771 2.8115 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3456 0.5595 4.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0585 -0.8444 4.0230 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2611 -0.7251 4.3828 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8551 1.2528 -2.3621 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1063 0.2825 1.6209 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8396 0.7423 2.2755 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4426 1.9627 0.0361 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3184 1.8310 2.9837 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1535 0.7681 0.8249 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0849 -1.4717 1.9381 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1775 -0.2081 -0.6712 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2157 -1.9470 -0.3037 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5406 -1.6412 0.0772 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8558 0.9117 3.5773 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8676 3.5795 1.0132 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8181 3.6929 1.0475 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0390 -0.0244 -6.0693 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7341 -0.5196 -6.2326 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5169 -1.6527 -5.6002 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 15 17 1 0 14 18 1 0 10 19 1 0 19 20 1 0 20 21 1 0 4 22 1 0 22 23 2 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 29 36 1 0 28 37 1 0 22 38 1 0 38 39 2 0 38 40 1 0 40 41 1 0 25 3 1 0 34 27 1 0 16 11 1 0 1 42 1 0 1 43 1 0 1 44 1 0 2 45 1 0 4 46 1 6 5 47 1 0 5 48 1 0 9 49 1 0 9 50 1 0 10 51 1 0 12 52 1 0 13 53 1 0 16 54 1 0 17 55 1 0 18 56 1 0 20 57 1 0 20 58 1 0 21 59 1 0 21 60 1 0 21 61 1 0 23 62 1 0 25 63 1 1 27 64 1 1 28 65 1 6 29 66 1 1 30 67 1 6 31 68 1 1 32 69 1 0 32 70 1 0 33 71 1 0 35 72 1 0 36 73 1 0 37 74 1 0 41 75 1 0 41 76 1 0 41 77 1 0 M END

Standard InCHIKey	RDLNVCALMXCDOJ-QUVQPCEGSA-N
Standard InCHI	InChI=1S/C27H36O14/c1-4-14-15(9-21(31)38-12-20(37-5-2)13-6-7-17(29)18(30)8-13)16(25(35)36-3)11-39-26(14)41-27-24(34)23(33)22(32)19(10-28)40-27/h4,6-8,11,15,19-20,22-24,26-30,32-34H,5,9-10,12H2,1-3H3/b14-4+/t15-,19+,20?,22+,23-,24+,26-,27-/m0/s1
SMILES	C/C=C/1[C@H](CC(=O)OCC(c2ccc(c(c2)O)O)OCC)C(=CO[C@H]1O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C(=O)OC

Calculated Properties

Physi-Chem Properties

Molecular Weight:	584.21	Volume:	554.487 ? Van der Waals volume.
Dense:	1.054	LogP:	0.761 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.203 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.057 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	21.0
TPSA:	210.9 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	6.0	Rings:	3.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.114	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.948	Fsp³:	0.556
MCE-18:	80.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.509	Fluc inhibitor:	0.005 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.089 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.479 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.093	Promiscuous compounds:	0.079

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.934	MDCK Permeability:	-5.213
Pgp-inhibitor:	0.0	Pgp-substrate:	0.111
PAMPA:	0.967 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.154
20% Bioavailability (F20%):	0.714	30% Bioavailability (F30%):	0.996
50% Bioavailability (F50%):	0.995

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.896
Plasma Protein Binding (PPB):	71.95%	Volume Distribution (VD):	-0.389
Fu:	25.945% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.996
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.067
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.743
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.018
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.706
HLM stability:	0.42 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.732

Half-life (T1/2):

2.161

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.207
Human Hepatotoxicity (H-HT):	0.751	Drug-induced Liver Injury (DILI):	0.982
AMES Toxicity:	0.932	Rat Oral Acute Toxicity:	0.277
Maximum Recommended Daily Dose:	0.25	Skin Sensitization:	1.0
Carcinogencity:	0.383	Eye Corrosion:	0.0
Eye Irritation:	0.002	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.103	Ototoxicity:	0.983
Hematotoxicity:	0.301	Drug-induced Nephrotoxicity:	0.736
Genotoxicity:	0.995	RPMI-8226 Immunitoxicity:	0.072
A549 Cytotoxicity:	0.842	Hek293 Cytotoxicity:	0.431
BCF:	0.53 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.239 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.118 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.215 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	fruit	n.a.	PMID[11411539]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO18340	Ligustrum lucidum	Species	Oleaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC149366 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8958
0.1-0.2	35614
0.2-0.3	4794
0.3-0.4	419
0.4-0.5	51
0.5-0.6	8
0.6-0.7	13
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7349	Intermediate Similarity	NPC296643
0.7349	Intermediate Similarity	NPC299576
0.6824	Remote Similarity	NPC169398
0.6778	Remote Similarity	NPC23677
0.663	Remote Similarity	NPC198577
0.6533	Remote Similarity	NPC303451
0.6533	Remote Similarity	NPC72358
0.6237	Remote Similarity	NPC469364
0.6237	Remote Similarity	NPC609284
0.617	Remote Similarity	NPC65262
0.617	Remote Similarity	NPC84429
0.617	Remote Similarity	NPC101686
0.6111	Remote Similarity	NPC600692
0.6024	Remote Similarity	NPC469543
0.6022	Remote Similarity	NPC488388
0.5914	Remote Similarity	NPC488384
0.5882	Remote Similarity	NPC488389
0.5851	Remote Similarity	NPC488383
0.5577	Remote Similarity	NPC488387
0.5524	Remote Similarity	NPC488386
0.549	Remote Similarity	NPC488385
0.5446	Remote Similarity	NPC246893
0.52	Remote Similarity	NPC469367

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC149366 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4324
0.1-0.2	4723
0.2-0.3	102
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data