NPASS Compound

Structure

NPC113551 OpenBabel06302216152D 52 59 0 0 1 0 0 0 0 0999 V2000 -8.5492 1.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5710 1.0906 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2620 0.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2839 -0.0684 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6148 0.6748 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2080 -0.2388 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7080 -1.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2135 -0.1343 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0056 0.8439 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0111 0.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6043 0.0349 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6533 -0.2741 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9101 0.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0409 0.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2488 -0.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1999 -1.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4078 -2.1793 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6647 -2.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2864 -2.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4943 -1.5613 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2374 -2.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4454 -1.2523 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1885 -1.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1396 -1.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 -0.6343 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7542 -1.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8716 1.3439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9238 1.6258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9019 1.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9749 -1.0194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 0 0 0 2 3 1 0 0 0 0 2 51 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 52 1 1 0 0 0 5 49 1 0 0 0 0 5 6 1 0 0 0 0 5 50 1 0 0 0 0 6 7 1 6 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 8 25 1 0 0 0 0 9 10 1 1 0 0 0 9 49 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 25 1 0 0 0 0 12 13 1 0 0 0 0 12 22 1 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 15 20 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 17 27 1 1 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 1 0 0 0 0 20 22 1 0 0 0 0 22 23 1 1 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 28 27 1 1 0 0 0 28 29 1 0 0 0 0 28 35 1 0 0 0 0 29 30 1 0 0 0 0 29 48 1 6 0 0 0 30 31 1 0 0 0 0 30 47 1 1 0 0 0 31 32 1 0 0 0 0 31 36 1 6 0 0 0 32 33 1 0 0 0 0 32 35 1 0 0 0 0 33 34 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 43 1 0 0 0 0 38 39 1 0 0 0 0 38 46 1 0 0 0 0 39 40 1 0 0 0 0 39 45 1 0 0 0 0 40 41 1 0 0 0 0 40 44 1 0 0 0 0 41 42 1 0 0 0 0 41 43 1 0 0 0 0 50 51 1 0 0 0 0 M END $$$$

Physi-Chem Properties

Molecular Weight:	239.15
Volume:	254.306
LogP:	1.542
LogD:	1.489
LogS:	-2.015
# Rotatable Bonds:	6
TPSA:	30.93
# H-Bond Aceptor:	4
# H-Bond Donor:	0
# Rings:	1
# Heavy Atoms:	4

MedChem Properties

QED Drug-Likeness Score:	0.757
Synthetic Accessibility Score:	1.816
Fsp3:	0.538
Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Accepted
GSK Rule:	Accepted
BMS Rule:	0
Golden Triangle Rule:	Accepted
Chelating Alert:	0
PAINS Alert:	0

ADMET Properties (ADMETlab2.0)

ADMET: Absorption

Caco-2 Permeability:	-4.404
MDCK Permeability:	1.1823908607766498e-05
Pgp-inhibitor:	0.015
Pgp-substrate:	0.847
Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.071
30% Bioavailability (F30%):	0.449

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.987
Plasma Protein Binding (PPB):	34.534767150878906%
Volume Distribution (VD):	2.032
Pgp-substrate:	47.30727767944336%

ADMET: Metabolism

CYP1A2-inhibitor:	0.166
CYP1A2-substrate:	0.956
CYP2C19-inhibitor:	0.019
CYP2C19-substrate:	0.969
CYP2C9-inhibitor:	0.001
CYP2C9-substrate:	0.672
CYP2D6-inhibitor:	0.132
CYP2D6-substrate:	0.936
CYP3A4-inhibitor:	0.011
CYP3A4-substrate:	0.777

ADMET: Excretion

Clearance (CL):	8.349
Half-life (T1/2):	0.838

ADMET: Toxicity

hERG Blockers:	0.147
Human Hepatotoxicity (H-HT):	0.319
Drug-inuced Liver Injury (DILI):	0.175
AMES Toxicity:	0.011
Rat Oral Acute Toxicity:	0.55
Maximum Recommended Daily Dose:	0.068
Skin Sensitization:	0.92
Carcinogencity:	0.22
Eye Corrosion:	0.679
Eye Irritation:	0.037
Respiratory Toxicity:	0.961

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs

Natural Product: NPC113551

Natural Product ID:	NPC113551
*Common Name:**	QNXPGBVADTYHLK-SUSMIJOYSA-N
IUPAC Name:	n.a.
Synonyms:
Standard InCHIKey:	QNXPGBVADTYHLK-SUSMIJOYSA-N
Standard InCHI:	InChI=1S/C39H62O13/c1-17-12-27(41)39(47-16-17)18(2)28-25(52-39)14-24-22-7-6-20-13-21(8-10-37(20,4)23(22)9-11-38(24,28)5)49-36-33(46)31(44)34(26(15-40)50-36)51-35-32(45)30(43)29(42)19(3)48-35/h6,17-19,21-36,40-46H,7-16H2,1-5H3/t17-,18+,19+,21+,22-,23+,24+,25+,26-,27+,28+,29+,30-,31-,32-,33-,34-,35+,36-,37+,38+,39+/m1/s1
SMILES:	C[C@@H]1C[C@@H]([C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O)O)O2)OC1)O
Synthetic Gene Cluster:	n.a.
ChEMBL Identifier:	n.a.
PubChem CID:	101847654
Chemical Classification:**	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13050	Solanum campaniforme	Species	Solanaceae	Eukaryota	n.a.	leaf	n.a.	PMID[21962208]
NPO16011	Galium rivale	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13382	Drosera intermedia	Species	Droseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO16011	Galium rivale	Species	Rubiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO16390	Vitis chunganensis	Species	Vitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13509	Flindersia schottiana	Species	Rutaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO15817	Alternaria scirpicola	Species	Pleosporaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7146	Achillea pyrenaica	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO9647	Polyporus leucomelas	Species	Polyporaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13050	Solanum campaniforme	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO2080	Cyathus bulleri	Species	Nidulariaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13382	Drosera intermedia	Species	Droseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO10940	Ligularia duciformis	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	NP ID	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.

Chemically structural similarity: I. Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC113551 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	292
0.1-0.2	2040
0.2-0.3	7323
0.3-0.4	14163
0.4-0.5	8123
0.5-0.6	5462
0.6-0.7	3076
0.7-0.8	1428
0.8-0.85	407
0.85-0.9	212
0.9-0.95	89
0.95-1	82

Similarity Score	Similarity Level	Natural Product ID

Chemically structural similarity: II. Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC113551 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	237
0.1-0.2	2209
0.2-0.3	4430
0.3-0.4	1507
0.4-0.5	394
0.5-0.6	261
0.6-0.7	83
0.7-0.8	18
0.8-0.85	10
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage

Bioactivity similarity: Similar Natural Products in NPASS

Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.

Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data