Drug Information| Drug ID: | NPD9771 |
| Drug Name: | Technetium Tc 99m Oxidronate |
| Molecular Formula: | CH6O7P2.Tc |
| Canonical SMILES: | OC(P(=O)(O)O)P(=O)(O)O.[100Tc] |
| Standard InCHI: | InChI=1S/CH6O7P2.Tc/c2-1(9(3,4)5)10(6,7)8;/h1-2H,(H2,3,4,5)(H2,6,7,8);/i;1+2 |
| Standard InCHIKey: | SIJNDWFHVBDXDY-NLQOEHMXSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | DrugBank |
Structural Similarity Between NPASS Natural Products and NPD9771Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6957 | NPC314978 |
| Remote Similarity | 0.6842 | NPC317825 |
| Remote Similarity | 0.6 | NPC117466 |
| Remote Similarity | 0.6 | NPC317545 |