Drug Information| Drug ID: | NPD9746 |
| Drug Name: | Potassium Bicarbonate |
| Molecular Formula: | CH2O3.K |
| Canonical SMILES: | [O-]C(=O)O.[K+] |
| Standard InCHI: | InChI=1S/CH2O3.K/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| Standard InCHIKey: | TYJJADVDDVDEDZ-UHFFFAOYSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9746Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC327795 |
| Remote Similarity | 0.6154 | NPC159900 |
| Remote Similarity | 0.5714 | NPC300325 |